ZA738210B - Xanthene and thioxanthene derivatives - Google Patents
Xanthene and thioxanthene derivativesInfo
- Publication number
- ZA738210B ZA738210B ZA738210A ZA738210A ZA738210B ZA 738210 B ZA738210 B ZA 738210B ZA 738210 A ZA738210 A ZA 738210A ZA 738210 A ZA738210 A ZA 738210A ZA 738210 B ZA738210 B ZA 738210B
- Authority
- ZA
- South Africa
- Prior art keywords
- xanthene
- thioxanthene derivatives
- thioxanthene
- derivatives
- Prior art date
Links
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 title 1
- 229940054058 antipsychotic thioxanthene derivative Drugs 0.000 title 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 title 1
- 150000005075 thioxanthenes Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/317,148 US4008240A (en) | 1972-12-21 | 1972-12-21 | Xanthene and thioxanthene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA738210B true ZA738210B (en) | 1974-10-30 |
Family
ID=23232320
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA738210A ZA738210B (en) | 1972-12-21 | 1973-10-23 | Xanthene and thioxanthene derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4008240A (enExample) |
| JP (1) | JPS4988875A (enExample) |
| AU (1) | AU472984B2 (enExample) |
| CA (1) | CA1042440A (enExample) |
| DE (1) | DE2362541A1 (enExample) |
| FR (1) | FR2211239B1 (enExample) |
| GB (1) | GB1416750A (enExample) |
| IL (1) | IL43671A (enExample) |
| ZA (1) | ZA738210B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2434636A1 (en) * | 2001-01-16 | 2002-07-25 | Guilford Pharmaceuticals, Inc. | Symmetrically disubstituted aromatic compounds and pharmaceutical compositions for inhibiting poly (adp-ribose) glycohydrolase, and methods for their use |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3576865A (en) * | 1968-10-11 | 1971-04-27 | Richardson Merrell Inc | Fluorenone-,fluorenol-,and fluorenebis-basic carboxamides |
| US3531489A (en) * | 1968-10-18 | 1970-09-29 | Richardson Merrell Inc | Bis-basic esters and thioesters of fluoranthene |
| IL33573A (en) * | 1968-12-30 | 1973-10-25 | Richardson Merrell Inc | Bis-basic ethers and thioethers of fluorenone,fluorenol and fluorene |
| US3647860A (en) * | 1969-01-09 | 1972-03-07 | Richardson Merrell Inc | Fluorene bis-basic esters |
| US3673191A (en) * | 1970-02-18 | 1972-06-27 | Richardson Merrell Inc | Bis-basic ethers and thioethers of dibenzothiophene |
| US3859286A (en) | 1970-12-11 | 1975-01-07 | Richardson Merrell Inc | Bis-basic ketones of xanthene and xanthen-9-one |
| US3856789A (en) * | 1971-04-23 | 1974-12-24 | Richardson Merrell Inc | Bis-basic ketones of thioxanthene |
| US3701786A (en) * | 1971-05-19 | 1972-10-31 | Aldrich Chem Co Inc | Dibenzofuranyl-aminoalcohols |
-
1972
- 1972-12-21 US US05/317,148 patent/US4008240A/en not_active Expired - Lifetime
-
1973
- 1973-10-23 ZA ZA738210A patent/ZA738210B/xx unknown
- 1973-10-26 AU AU61887/73A patent/AU472984B2/en not_active Expired
- 1973-10-29 CA CA184,538A patent/CA1042440A/en not_active Expired
- 1973-11-21 IL IL43671A patent/IL43671A/en unknown
- 1973-12-17 GB GB5826373A patent/GB1416750A/en not_active Expired
- 1973-12-17 DE DE2362541A patent/DE2362541A1/de not_active Withdrawn
- 1973-12-19 FR FR7345515A patent/FR2211239B1/fr not_active Expired
- 1973-12-20 JP JP48141924A patent/JPS4988875A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1416750A (en) | 1975-12-03 |
| AU472984B2 (en) | 1976-06-10 |
| FR2211239B1 (enExample) | 1976-09-03 |
| IL43671A0 (en) | 1974-03-14 |
| JPS4988875A (enExample) | 1974-08-24 |
| DE2362541A1 (de) | 1974-06-27 |
| US4008240A (en) | 1977-02-15 |
| CA1042440A (en) | 1978-11-14 |
| AU6188773A (en) | 1975-05-01 |
| IL43671A (en) | 1977-10-31 |
| FR2211239A1 (enExample) | 1974-07-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL43795A (en) | 3-aminoalkylamino-1-phenoxy-2-propanol derivatives | |
| IL41515A0 (en) | 11-deoxyprostaglandin derivatives and their preparation | |
| ZA739471B (en) | Chromane derivatives | |
| ZA732526B (en) | Chromone derivatives | |
| IL41060A0 (en) | Alpha-aryl-4-substituted piperidinoalkanol derivatives | |
| HK11279A (en) | Benzocycloheptathiophene derivatives | |
| GB1402219A (en) | Berbine derivatives | |
| IL42943A (en) | 16-methyl-prednisolone derivatives | |
| IL43280A0 (en) | Amidinourea derivatives | |
| IL41789A0 (en) | Diphenylalkyllactamimide derivatives | |
| HK45378A (en) | Coumarin and coumarinimide derivatives | |
| GB1405227A (en) | Pheynlthioethyl-imidazole derivatives | |
| PH10711A (en) | 1-cyclopropyl-1-phenyl-w-amino-1-alkanols and 1-lower-alkylacyl derivatives | |
| IL43665A0 (en) | Xanthene and thioxanthene derivatives | |
| IL43671A0 (en) | Xanthene and thioxanthene derivatives | |
| ZA73494B (en) | Benzocycloheptathiophene derivatives and their preparation | |
| AU6087773A (en) | Octahydro-aryl-isoquinolines and derivatives thereof | |
| IL43670A0 (en) | Xanthene derivatives | |
| AU5872373A (en) | Isoxolidine derivatives | |
| HK380A (en) | Benzoisoindoline derivatives | |
| CA879112A (en) | Xanthene and thioxanthene derivatives | |
| IL42454A0 (en) | New benzopyran derivatives | |
| ZA735180B (en) | Thiophene derivatives | |
| AU5423773A (en) | Alpha-pyrone derivatives | |
| GB1404382A (en) | Homopyrimidazole derivatives |