ZA738208B - Fluoranthene derivatives - Google Patents
Fluoranthene derivativesInfo
- Publication number
- ZA738208B ZA738208B ZA738208*A ZA738208A ZA738208B ZA 738208 B ZA738208 B ZA 738208B ZA 738208 A ZA738208 A ZA 738208A ZA 738208 B ZA738208 B ZA 738208B
- Authority
- ZA
- South Africa
- Prior art keywords
- fluoranthene derivatives
- fluoranthene
- derivatives
- Prior art date
Links
- 125000003914 fluoranthenyl group Chemical class C1(=CC=C2C=CC=C3C4=CC=CC=C4C1=C23)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/70—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with ring systems containing two or more relevant rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US317150A US3882113A (en) | 1972-12-21 | 1972-12-21 | Fluoranthene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA738208B true ZA738208B (en) | 1974-09-25 |
Family
ID=23232330
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA738208*A ZA738208B (en) | 1972-12-21 | 1973-08-23 | Fluoranthene derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3882113A (cs) |
| JP (1) | JPS4988857A (cs) |
| AU (1) | AU474522B2 (cs) |
| CA (1) | CA1041094A (cs) |
| DE (1) | DE2362749A1 (cs) |
| FR (1) | FR2211241B1 (cs) |
| GB (1) | GB1416929A (cs) |
| IL (1) | IL43673A (cs) |
| ZA (1) | ZA738208B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8313571D0 (en) * | 1983-05-17 | 1983-06-22 | Wellcome Found | Chemical compounds |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3707471A (en) * | 1970-04-27 | 1972-12-26 | Richardson Merrell Inc | Fluoranthene bis-basic ethers and thioethers |
| ZA712220B (en) * | 1970-04-27 | 1971-12-29 | Richardson Merrell Inc | Bis-basic ketones of fluoranthene |
-
1972
- 1972-12-21 US US317150A patent/US3882113A/en not_active Expired - Lifetime
-
1973
- 1973-08-23 ZA ZA738208*A patent/ZA738208B/xx unknown
- 1973-10-26 AU AU61862/73A patent/AU474522B2/en not_active Expired
- 1973-10-29 CA CA184,540A patent/CA1041094A/en not_active Expired
- 1973-11-21 IL IL43673A patent/IL43673A/xx unknown
- 1973-12-17 DE DE2362749A patent/DE2362749A1/de not_active Withdrawn
- 1973-12-17 GB GB5826573A patent/GB1416929A/en not_active Expired
- 1973-12-19 FR FR7345517A patent/FR2211241B1/fr not_active Expired
- 1973-12-20 JP JP48141914A patent/JPS4988857A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2211241B1 (cs) | 1976-12-31 |
| DE2362749A1 (de) | 1974-06-27 |
| IL43673A (en) | 1978-10-31 |
| FR2211241A1 (cs) | 1974-07-19 |
| GB1416929A (en) | 1975-12-10 |
| US3882113A (en) | 1975-05-06 |
| AU474522B2 (en) | 1976-07-22 |
| IL43673A0 (en) | 1974-03-14 |
| CA1041094A (en) | 1978-10-24 |
| AU6186273A (en) | 1975-05-01 |
| JPS4988857A (cs) | 1974-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL43795A (en) | 3-aminoalkylamino-1-phenoxy-2-propanol derivatives | |
| ZA728544B (en) | Alpha-aryl-4-substituted piperidinoalkanol derivatives | |
| CY992A (en) | Benzocycloheptathiophene derivatives | |
| ZA736059B (en) | New quinoxaline-di-n-oxide derivatives | |
| GB1402219A (en) | Berbine derivatives | |
| GB1405444A (en) | 2-aminoindane derivatives | |
| IL42943A (en) | 16-methyl-prednisolone derivatives | |
| ZA728917B (en) | Oxaziniondole-and thiaziniondole derivatives | |
| IL43280A0 (en) | Amidinourea derivatives | |
| ZA731557B (en) | Diphenylalkyllactamimide derivatives | |
| PH10465A (en) | Debenzazecine derivatives | |
| KE2917A (en) | New phenylformamidine derivatives | |
| GB1405227A (en) | Pheynlthioethyl-imidazole derivatives | |
| ZA728875B (en) | Pyrano-and thiopyranoindole derivatives | |
| ZA734945B (en) | New beta-aminoketone derivatives | |
| ZA733261B (en) | Diphenylmethane derivatives | |
| YU33072B (en) | Lamelna sklopka z zunanjimi lamelami | |
| ZA738208B (en) | Fluoranthene derivatives | |
| MY8000220A (en) | Benzoisoindoline derivatives | |
| PH10653A (en) | Indolylimidoylquinoline derivatives | |
| PH10601A (en) | Diaza-oxa-bicyclodecane derivatives | |
| AU5872373A (en) | Isoxolidine derivatives | |
| AU5916873A (en) | Cyclohexanepentol derivative | |
| AU5667373A (en) | Benzodaizepine derivatives benzodaizepine derivatives | |
| AU5423773A (en) | Alpha-pyrone derivatives |