ZA738205B - Anthraquinone derivatives - Google Patents
Anthraquinone derivativesInfo
- Publication number
- ZA738205B ZA738205B ZA738205A ZA738205A ZA738205B ZA 738205 B ZA738205 B ZA 738205B ZA 738205 A ZA738205 A ZA 738205A ZA 738205 A ZA738205 A ZA 738205A ZA 738205 B ZA738205 B ZA 738205B
- Authority
- ZA
- South Africa
- Prior art keywords
- anthraquinone derivatives
- anthraquinone
- derivatives
- Prior art date
Links
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 title 1
- 150000004056 anthraquinones Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
- C07C225/26—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00317239A US3847953A (en) | 1972-12-21 | 1972-12-21 | Anthraquinone derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA738205B true ZA738205B (en) | 1974-09-25 |
Family
ID=23232751
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA738205A ZA738205B (en) | 1972-12-21 | 1973-10-23 | Anthraquinone derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3847953A (enExample) |
| JP (1) | JPS4988854A (enExample) |
| AU (1) | AU472387B2 (enExample) |
| CA (1) | CA1065316A (enExample) |
| DE (1) | DE2362600A1 (enExample) |
| FR (1) | FR2211244B1 (enExample) |
| GB (1) | GB1416248A (enExample) |
| IL (1) | IL43676A (enExample) |
| ZA (1) | ZA738205B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6977177B1 (en) * | 2004-05-26 | 2005-12-20 | Rohm And Haas Company | Method for marking hydrocarbons with substituted anthraquinones |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA956940A (en) * | 1970-05-14 | 1974-10-29 | Arthur D. Sill | Bis-basic ethers of 2,6-and 2,7-dihydroxyanthraquinones |
-
1972
- 1972-12-21 US US00317239A patent/US3847953A/en not_active Expired - Lifetime
-
1973
- 1973-10-23 ZA ZA738205A patent/ZA738205B/xx unknown
- 1973-10-26 AU AU61886/73A patent/AU472387B2/en not_active Expired
- 1973-10-29 CA CA184,542A patent/CA1065316A/en not_active Expired
- 1973-11-21 IL IL43676A patent/IL43676A/en unknown
- 1973-12-17 GB GB5826773A patent/GB1416248A/en not_active Expired
- 1973-12-17 DE DE2362600A patent/DE2362600A1/de not_active Withdrawn
- 1973-12-19 FR FR7345520A patent/FR2211244B1/fr not_active Expired
- 1973-12-20 JP JP48141926A patent/JPS4988854A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1416248A (en) | 1975-12-03 |
| FR2211244B1 (enExample) | 1976-12-31 |
| IL43676A0 (en) | 1974-03-14 |
| AU472387B2 (en) | 1976-05-20 |
| AU6188673A (en) | 1975-05-01 |
| US3847953A (en) | 1974-11-12 |
| CA1065316A (en) | 1979-10-30 |
| FR2211244A1 (enExample) | 1974-07-19 |
| IL43676A (en) | 1977-06-30 |
| JPS4988854A (enExample) | 1974-08-24 |
| DE2362600A1 (de) | 1974-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL43795A (en) | 3-aminoalkylamino-1-phenoxy-2-propanol derivatives | |
| IL41060A0 (en) | Alpha-aryl-4-substituted piperidinoalkanol derivatives | |
| ZA736059B (en) | New quinoxaline-di-n-oxide derivatives | |
| CY992A (en) | Benzocycloheptathiophene derivatives | |
| GB1402219A (en) | Berbine derivatives | |
| IL43280A0 (en) | Amidinourea derivatives | |
| IL42943A (en) | 16-methyl-prednisolone derivatives | |
| ZA728917B (en) | Oxaziniondole-and thiaziniondole derivatives | |
| KE2917A (en) | New phenylformamidine derivatives | |
| ZA731557B (en) | Diphenylalkyllactamimide derivatives | |
| PH10465A (en) | Debenzazecine derivatives | |
| GB1405227A (en) | Pheynlthioethyl-imidazole derivatives | |
| IL43875A0 (en) | Nitrobenzene derivatives | |
| ZA734945B (en) | New beta-aminoketone derivatives | |
| ZA728875B (en) | Pyrano-and thiopyranoindole derivatives | |
| IL43676A0 (en) | Anthraquinone derivatives | |
| MY8000220A (en) | Benzoisoindoline derivatives | |
| PH10601A (en) | Diaza-oxa-bicyclodecane derivatives | |
| AU5872373A (en) | Isoxolidine derivatives | |
| PH10653A (en) | Indolylimidoylquinoline derivatives | |
| ZA739415B (en) | Nitrobenzene derivatives | |
| ZA733030B (en) | New nitrofurl-amidine derivatives | |
| AU5423773A (en) | Alpha-pyrone derivatives | |
| AU5667373A (en) | Benzodaizepine derivatives benzodaizepine derivatives | |
| GB1404382A (en) | Homopyrimidazole derivatives |