ZA737591B - 13-bromo-lysergic acid compounds - Google Patents
13-bromo-lysergic acid compoundsInfo
- Publication number
- ZA737591B ZA737591B ZA00737591*A ZA737591A ZA737591B ZA 737591 B ZA737591 B ZA 737591B ZA 737591 A ZA737591 A ZA 737591A ZA 737591 B ZA737591 B ZA 737591B
- Authority
- ZA
- South Africa
- Prior art keywords
- bromo
- acid compounds
- lysergic acid
- lysergic
- compounds
- Prior art date
Links
- BINZJVHNWBJJNU-YMTOWFKASA-N (6ar,9r)-2-bromo-7-methyl-6,6a,8,9-tetrahydro-4h-indolo[4,3-fg]quinoline-9-carboxylic acid Chemical class BrC1=CC(C2=C[C@H](CN([C@@H]2C2)C)C(O)=O)=C3C2=CNC3=C1 BINZJVHNWBJJNU-YMTOWFKASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1403272A CH581136A5 (enExample) | 1972-09-26 | 1972-09-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA737591B true ZA737591B (en) | 1975-05-28 |
Family
ID=4397351
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00737591*A ZA737591B (en) | 1972-09-26 | 1973-09-26 | 13-bromo-lysergic acid compounds |
Country Status (6)
| Country | Link |
|---|---|
| AT (1) | ATA818373A (enExample) |
| BE (1) | BE805237A (enExample) |
| CH (1) | CH581136A5 (enExample) |
| GB (1) | GB1451904A (enExample) |
| HU (1) | HU168101B (enExample) |
| ZA (1) | ZA737591B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH619468A5 (enExample) * | 1976-01-12 | 1980-09-30 | Sandoz Ag | |
| EP0026899A1 (de) * | 1979-10-09 | 1981-04-15 | Sandoz Ag | Peptidergotalkaloide, Verfahren zu deren Herstellung, diese enthaltende pharmakologische Zusammensetzungen und ihre Anwendung bei der therapeutischen Behandlung |
-
1972
- 1972-09-26 CH CH1403272A patent/CH581136A5/xx not_active IP Right Cessation
-
1973
- 1973-09-20 GB GB1877676A patent/GB1451904A/en not_active Expired
- 1973-09-24 HU HUSA2537A patent/HU168101B/hu unknown
- 1973-09-24 BE BE135978A patent/BE805237A/xx unknown
- 1973-09-24 AT AT818373A patent/ATA818373A/de not_active Application Discontinuation
- 1973-09-26 ZA ZA00737591*A patent/ZA737591B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1451904A (en) | 1976-10-06 |
| ATA818373A (de) | 1977-08-15 |
| HU168101B (enExample) | 1976-02-28 |
| CH581136A5 (enExample) | 1976-10-29 |
| BE805237A (fr) | 1974-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH13272A (en) | Substituted w-pentanorprostaglandins | |
| AU6939974A (en) | Sulphamoylbenzoic acid | |
| AU5659473A (en) | Anti-caries compound anti-caries compound | |
| PH12257A (en) | New pyrazilodiazepine compounds | |
| IL40801A0 (en) | Novel substituted ceph-3-ems | |
| PH9438A (en) | New sulfamyl-benzoic acid derivatives | |
| AU5152573A (en) | Chemical compounds | |
| GB1405757A (en) | 7-amino-cephem compounds | |
| AU5709073A (en) | Trialkoxycinnamoylaminocarbon acid | |
| AU6151473A (en) | Penicillin compounds | |
| CA990287A (en) | 13-bromo-lysergic acid compounds | |
| PH12447A (en) | 6-aminopenicillanic acid preparation | |
| ZA7392B (en) | Substituted 3-cyanobenzenesulfonamides | |
| IL41276A0 (en) | Dithiethane compounds | |
| GB1483379A (en) | 7-halo-methyl-17-hydroxy-3-oxo-17alpha-pregn-4-ene-21-carboxylic acid ypsilon-lactones | |
| AU5920273A (en) | Alpha-phenyl-fatty acid compounds | |
| ZA737591B (en) | 13-bromo-lysergic acid compounds | |
| AU6201973A (en) | Terahydroindazole-5-carboxylic acid compounds | |
| MW6873A1 (en) | Compounds | |
| ZA721129B (en) | 5-n-pyrrylsalicylic acid | |
| AU6034273A (en) | Prostaglandin compounds | |
| IL38805A0 (en) | 5-n-pyrrylsalicyclic acid | |
| CA1002945A (en) | 13-bromo-lysergic acid compounds | |
| ZA737414B (en) | Fusidic acid conjutates | |
| AU6199173A (en) | Substituted phenoxy-alkane-carboxylic acids |