ZA734470B - Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides,a process for their preparation and their use as insecticides,acaricides and fungicides - Google Patents
Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides,a process for their preparation and their use as insecticides,acaricides and fungicidesInfo
- Publication number
- ZA734470B ZA734470B ZA734470A ZA734470A ZA734470B ZA 734470 B ZA734470 B ZA 734470B ZA 734470 A ZA734470 A ZA 734470A ZA 734470 A ZA734470 A ZA 734470A ZA 734470 B ZA734470 B ZA 734470B
- Authority
- ZA
- South Africa
- Prior art keywords
- thioanilides
- acaricides
- insecticides
- fungicides
- dione
- Prior art date
Links
- UDJIPUWKNJRKBB-UHFFFAOYSA-N 2,6-dioxo-N-phenylcyclohexane-1-carboxamide Chemical class O=C(Nc1ccccc1)C1C(=O)CCCC1=O UDJIPUWKNJRKBB-UHFFFAOYSA-N 0.000 title 1
- 230000000895 acaricidal effect Effects 0.000 title 1
- 239000000642 acaricide Substances 0.000 title 1
- 239000000417 fungicide Substances 0.000 title 1
- 239000002917 insecticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2232730A DE2232730A1 (de) | 1972-07-04 | 1972-07-04 | Substituierte cyclohexan-2,6-dion-1carbonsaeureanilide und -thioanilide, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und fungizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA734470B true ZA734470B (en) | 1974-05-29 |
Family
ID=5849630
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA734470A ZA734470B (en) | 1972-07-04 | 1973-07-03 | Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides,a process for their preparation and their use as insecticides,acaricides and fungicides |
Country Status (14)
| Country | Link |
|---|---|
| JP (2) | JPS49100225A (cs) |
| AU (1) | AU5760873A (cs) |
| BE (1) | BE801842A (cs) |
| BR (1) | BR7304833D0 (cs) |
| CH (1) | CH568963A5 (cs) |
| DE (1) | DE2232730A1 (cs) |
| FR (1) | FR2190806B1 (cs) |
| GB (1) | GB1377319A (cs) |
| IE (1) | IE37868B1 (cs) |
| IL (1) | IL42638A0 (cs) |
| IT (1) | IT990867B (cs) |
| LU (1) | LU67692A1 (cs) |
| NL (1) | NL7309198A (cs) |
| ZA (1) | ZA734470B (cs) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2601780B2 (de) * | 1976-01-20 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | N-Phenyl-N'-benzoylharnstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide |
| ATE40106T1 (de) * | 1983-05-18 | 1989-02-15 | Ciba Geigy Ag | Cyclohexandion-carbonsaeurederivate mit herbizider und das pflanzenwachstum regulierender wirkung. |
| SU1400503A3 (ru) * | 1983-05-18 | 1988-05-30 | Циба-Гейги Аг (Фирма) | Способ получени производных циклогександионкарбоновой кислоты |
| EP0177450B1 (de) * | 1984-10-02 | 1989-03-29 | Ciba-Geigy Ag | Verfahren zur Herstellung von Cyclohexandion-carbonsäurederivaten mit herbizider und das Pflanzenwachstum regulierender Wirkung |
| AU2022428605A1 (en) * | 2021-12-28 | 2024-07-18 | Adeka Corporation | Arylcyclohexanedione derivative or salt thereof, pest control agent containing said compound, and method for using same |
| US20250072421A1 (en) * | 2021-12-28 | 2025-03-06 | Adeka Corporation | Aryl dihydropyran derivative or salt thereof, pest control agent containing same, and method for use thereof |
| JPWO2023127807A1 (cs) * | 2021-12-28 | 2023-07-06 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1327154A (en) * | 1971-01-15 | 1973-08-15 | American Cyanamid Co | Dioxocyclohexenecarboxanilide insecticides and acaricides |
-
1972
- 1972-07-04 DE DE2232730A patent/DE2232730A1/de active Pending
-
1973
- 1973-05-29 LU LU67692A patent/LU67692A1/xx unknown
- 1973-06-29 BR BR4833/73A patent/BR7304833D0/pt unknown
- 1973-07-02 IT IT26104/73A patent/IT990867B/it active
- 1973-07-02 AU AU57608/73A patent/AU5760873A/en not_active Expired
- 1973-07-02 NL NL7309198A patent/NL7309198A/xx unknown
- 1973-07-02 CH CH963873A patent/CH568963A5/xx not_active IP Right Cessation
- 1973-07-02 IL IL42638A patent/IL42638A0/xx unknown
- 1973-07-03 BE BE133061A patent/BE801842A/xx unknown
- 1973-07-03 ZA ZA734470A patent/ZA734470B/xx unknown
- 1973-07-03 IE IE1104/73A patent/IE37868B1/xx unknown
- 1973-07-03 GB GB3157773A patent/GB1377319A/en not_active Expired
- 1973-07-04 JP JP48074948A patent/JPS49100225A/ja active Pending
- 1973-07-04 JP JP48074947A patent/JPS49100054A/ja active Pending
- 1973-07-04 FR FR737324599A patent/FR2190806B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT990867B (it) | 1975-07-10 |
| DE2232730A1 (de) | 1974-01-24 |
| IL42638A0 (en) | 1973-10-25 |
| IE37868B1 (en) | 1977-10-26 |
| AU5760873A (en) | 1975-01-09 |
| JPS49100054A (cs) | 1974-09-20 |
| BR7304833D0 (pt) | 1974-08-15 |
| LU67692A1 (cs) | 1973-08-02 |
| FR2190806B1 (cs) | 1977-02-18 |
| NL7309198A (cs) | 1974-01-08 |
| BE801842A (fr) | 1974-01-03 |
| CH568963A5 (cs) | 1975-11-14 |
| JPS49100225A (cs) | 1974-09-21 |
| FR2190806A1 (cs) | 1974-02-01 |
| IE37868L (en) | 1974-01-04 |
| GB1377319A (en) | 1974-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HK2280A (en) | Imidazolyl-o,n-acetals and their salts, processes for their preparation and their use as fungicides | |
| ZA72178B (en) | Novel benzthiazolones,a process for their preparation and their use insecticides,acaricides and fungicides | |
| EG11035A (en) | N-sulphenylated n-methylcarbamidoxines,process for their preparation and their use as insecticides,acaricides or fungicides | |
| IL43411A0 (en) | Novel carbamic o-triazolylcarbamic acid esters,their preparation and their use as insecticides and acaricides | |
| ZA734470B (en) | Novel cyclohexane-2,6-dione-1-carboxylic acid anilides and thioanilides,a process for their preparation and their use as insecticides,acaricides and fungicides | |
| EG10795A (en) | Novel n-sulphenylated carbamidoximes,a process for their preparation and their fungicidal and bactericidal use | |
| IL42062A (en) | O-pyrazolo-phosphoric,-thiono-phosphoric,-phosphonic and-thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| ZA74346B (en) | O-ethyl-s-n-propyl-o-vinyl-thionothiolphosphoric acid esters,a process for their preparation and their use as insecticides or acaricides | |
| IL41838A (en) | Halogenophenyl-pyridazino-thionophosphoric and thionophosphonic acid esters,their production and their use as insecticides and acaricides | |
| AU3106071A (en) | Novel thionothiolphosphoric acid ester amides, a process for their preparation and their use as nematocil insecticides and acaricides | |
| ZA745526B (en) | Novel thionothiolphosphoric acid esters, process for their preparation and their use insecticides and acaricides | |
| ZA716176B (en) | N-sulphenylated dihydrobenzofuranyl-carbamates,a process for their preparation,and their use as insecticides and acaricides | |
| MY7300472A (en) | Amidophenylisothioureas, a process for their preparation and their use as fungicides | |
| EG10667A (en) | N-(aminomethylidene)-thiol-phosphoric acid ester imides,process for their manufacture and their use as insecticides and acaricides | |
| ZA741517B (en) | Novel aminobenzhydroxamic acids and their salts, a process for their preparation and their fungicidal and microbicidal use | |
| EG10722A (en) | Dichlorovinylthionophosphoric acid di-ester amides,process for their preparation,and their use as insecticides or acaricides | |
| ZA735434B (en) | Novel quinoline-thionophosphonic acid esters,a process for their preparation and their use as insecticides and acaricides | |
| IL41500A0 (en) | O-alkyl-s-carbamoyloxymethyl-thiophosphoric,thionothiolphosphoric,thiolphosphonic and thionothiolphosphonic acid esters,their production and their use as insecticides and acaricides | |
| ZA74383B (en) | O-haloalkylphosphoric acid ester-amides,a process for their preparation and their use as insecticides or acaricides | |
| EG10091A (en) | Novel thionothiolphosphoric acid ester amides,a process for their preparation and their use as nematocides,insecticides and acaricides | |
| IL38050A0 (en) | Novel thiopyrophosphoric acid ester amides,a process for their preparation and their use as insecticides and acaricides | |
| KE2741A (en) | O-pyrazolopyrimidine-thiono-phosphoric acid ester-amides,a process for their preparation and their use as insecticides and acaricides | |
| IL43241A0 (en) | Vinylphosphoric acid diester-amides,their production and their use as insecticides,acaricides and fungicides | |
| ZA735582B (en) | Novel thiophosphoric acid ester amides,a process for their preparation and their use as insecticides and acaricides | |
| ZA714558B (en) | Novel flouroacetic acid amides,a process for their preparation and their use as pesticides |