ZA732413B - 1-(4',6'-dichloro-s-triazin-2-ylcarbamoyl)-2-methoxycarbonylamino-benzimidazole as pesticide - Google Patents
1-(4',6'-dichloro-s-triazin-2-ylcarbamoyl)-2-methoxycarbonylamino-benzimidazole as pesticideInfo
- Publication number
- ZA732413B ZA732413B ZA732413A ZA732413A ZA732413B ZA 732413 B ZA732413 B ZA 732413B ZA 732413 A ZA732413 A ZA 732413A ZA 732413 A ZA732413 A ZA 732413A ZA 732413 B ZA732413 B ZA 732413B
- Authority
- ZA
- South Africa
- Prior art keywords
- ylcarbamoyl
- methoxycarbonylamino
- triazin
- benzimidazole
- pesticide
- Prior art date
Links
- IAAFGKXNZDACHY-UHFFFAOYSA-N methyl N-[1-[(4,6-dichloro-1,3,5-triazin-2-yl)carbamoyl]benzimidazol-2-yl]carbamate Chemical compound ClC1=NC(=NC(=N1)Cl)NC(=O)N1C(=NC2=C1C=CC=C2)NC(=O)OC IAAFGKXNZDACHY-UHFFFAOYSA-N 0.000 title 1
- 239000000575 pesticide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH520972 | 1972-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA732413B true ZA732413B (en) | 1974-01-30 |
Family
ID=4289759
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA732413A ZA732413B (en) | 1972-04-10 | 1973-04-09 | 1-(4',6'-dichloro-s-triazin-2-ylcarbamoyl)-2-methoxycarbonylamino-benzimidazole as pesticide |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3840538A (enExample) |
| JP (1) | JPS4913334A (enExample) |
| AT (1) | AT322910B (enExample) |
| AU (1) | AU5416773A (enExample) |
| BE (1) | BE797924A (enExample) |
| DD (1) | DD104904A5 (enExample) |
| DE (1) | DE2317391A1 (enExample) |
| FR (1) | FR2179859B1 (enExample) |
| HU (1) | HU166554B (enExample) |
| IL (1) | IL41931A (enExample) |
| NL (1) | NL7305008A (enExample) |
| TR (1) | TR17744A (enExample) |
| ZA (1) | ZA732413B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4272537A (en) * | 1980-07-02 | 1981-06-09 | Merck & Co., Inc. | 3-Amino-5-substituted-6-halo-N-(4,4-disubstituted-6-substituted-1,3,5-triazin-2-yl)-2-pyrazinecarboxamides |
-
1973
- 1973-04-02 IL IL41931A patent/IL41931A/xx unknown
- 1973-04-04 US US00347739A patent/US3840538A/en not_active Expired - Lifetime
- 1973-04-05 AU AU54167/73A patent/AU5416773A/en not_active Expired
- 1973-04-06 DE DE2317391A patent/DE2317391A1/de active Pending
- 1973-04-09 FR FR7312650A patent/FR2179859B1/fr not_active Expired
- 1973-04-09 BE BE129774A patent/BE797924A/xx unknown
- 1973-04-09 ZA ZA732413A patent/ZA732413B/xx unknown
- 1973-04-09 DD DD170049A patent/DD104904A5/xx unknown
- 1973-04-09 JP JP48040299A patent/JPS4913334A/ja active Pending
- 1973-04-09 HU HUCI1364A patent/HU166554B/hu unknown
- 1973-04-09 AT AT310973A patent/AT322910B/de not_active IP Right Cessation
- 1973-04-09 TR TR17744A patent/TR17744A/xx unknown
- 1973-04-10 NL NL7305008A patent/NL7305008A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2179859A1 (enExample) | 1973-11-23 |
| TR17744A (tr) | 1976-07-01 |
| BE797924A (fr) | 1973-10-09 |
| DE2317391A1 (de) | 1973-10-25 |
| US3840538A (en) | 1974-10-08 |
| FR2179859B1 (enExample) | 1975-08-22 |
| DD104904A5 (enExample) | 1974-04-05 |
| JPS4913334A (enExample) | 1974-02-05 |
| AU5416773A (en) | 1974-10-10 |
| HU166554B (enExample) | 1975-04-28 |
| AT322910B (de) | 1975-06-10 |
| IL41931A0 (en) | 1973-06-29 |
| IL41931A (en) | 1975-05-22 |
| NL7305008A (enExample) | 1973-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7900243A (en) | Substituted 16,17,18,19,20-pentanor-prostaglandins | |
| CA993452A (en) | 2,6-dihalo-4-cyanophenoxy-acetonitriles | |
| JPS5745162A (en) | Substituted 1,2,4,5-tetrahydro-3h,3-benzoazepines | |
| GB1402046A (en) | 11,12-epoxyerythromycins | |
| CA1009666A (en) | 2,5,5-trimethyl-hepta-2,6-dienal | |
| ZA732413B (en) | 1-(4',6'-dichloro-s-triazin-2-ylcarbamoyl)-2-methoxycarbonylamino-benzimidazole as pesticide | |
| CA1020953A (en) | 2,2,3-endo-trimethyl-7-anti-amino-norbornanes | |
| AU472337B2 (en) | 11, 12-secoprostaglandins | |
| AU467306B2 (en) | 15, 16-methylene-4-oestren-17 -ols | |
| CA999595A (en) | 3,5-dialkyl-4-hydroxybenzyl-oxiranes and -thiiranes | |
| AU474523B2 (en) | Substituted 9,10-dihydroanthracenes | |
| GB1404277A (en) | 16,17-seco-d-homosteroids | |
| CA986936A (en) | 2,3,5-substituted-6-trifluoromethyl-1,3-diazin-4-ones | |
| CA987669A (en) | 10,11-anhydroerythromycins | |
| CA990280A (en) | 5,6-trans-25-hydroxycholecalciferol | |
| AU5701673A (en) | 3, 4-dialkanyloxyphenyl)-l-alanines | |
| CA893727A (en) | 1-(3',4'-dihydroxyphenyl)-2-t-butylamino-butanol-(1) | |
| CA907616A (en) | 2,2-diaryl-4-(4'-aryl-4'-hydroxypiperidino)-butyramides | |
| CA896567A (en) | 1,1'-peroxydicyclohexylamine | |
| CA1000272A (en) | 2',3',5'-tri-o-nicotinoyl-4-thiouridine | |
| AU445761B2 (en) | 1, 2, 3-trithiane insecticides | |
| CA905931A (en) | 3,4-diazapregnanes | |
| CA902063A (en) | 1,2,8,9-tetraazaphenalene-3-hydrazones | |
| AU477691B2 (en) | 2, 4, 5-trisubstituted-imidazoles | |
| AU485879B2 (en) | 3-diazine-substituted 1, 2, 4-benzothiadiazines |