ZA728288B - Alkenyl and alkynyl substituted xanthone carboxylic acid compounds - Google Patents
Alkenyl and alkynyl substituted xanthone carboxylic acid compoundsInfo
- Publication number
- ZA728288B ZA728288B ZA738288A ZA728288A ZA728288B ZA 728288 B ZA728288 B ZA 728288B ZA 738288 A ZA738288 A ZA 738288A ZA 728288 A ZA728288 A ZA 728288A ZA 728288 B ZA728288 B ZA 728288B
- Authority
- ZA
- South Africa
- Prior art keywords
- alkenyl
- carboxylic acid
- acid compounds
- alkynyl substituted
- substituted xanthone
- Prior art date
Links
- WNKRYYFWYMHTGV-UHFFFAOYSA-N 9-oxoxanthene-1-carboxylic acid Chemical class O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O WNKRYYFWYMHTGV-UHFFFAOYSA-N 0.000 title 1
- 125000003342 alkenyl group Chemical group 0.000 title 1
- 125000000304 alkynyl group Chemical group 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00291618A US3818040A (en) | 1972-09-25 | 1972-09-25 | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA728288B true ZA728288B (en) | 1974-07-31 |
Family
ID=23121062
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA738288A ZA728288B (en) | 1972-09-25 | 1972-11-22 | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3818040A (en:Method) |
| JP (1) | JPS4969672A (en:Method) |
| AR (1) | AR195514A1 (en:Method) |
| AT (1) | AT325040B (en:Method) |
| AU (1) | AU464832B2 (en:Method) |
| BE (1) | BE793865A (en:Method) |
| DE (1) | DE2300367A1 (en:Method) |
| ES (1) | ES410419A1 (en:Method) |
| FR (1) | FR2199977B1 (en:Method) |
| GB (1) | GB1399168A (en:Method) |
| IL (1) | IL40899A (en:Method) |
| NL (1) | NL7300531A (en:Method) |
| SE (1) | SE387120B (en:Method) |
| ZA (1) | ZA728288B (en:Method) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4304720A (en) * | 1980-04-30 | 1981-12-08 | Merck & Co., Inc. | Fluorescein esters and ethers and the preparation thereof |
| CA1305480C (en) * | 1987-03-20 | 1992-07-21 | Roshantha A.S. Chandraratna | Disubstituted acetylenes bearing heteroaromatic and heterobicyclic groups having retinoid like activity |
| US20030191180A1 (en) | 2000-03-09 | 2003-10-09 | Calvin Ross | Pharmaceutical compositions |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE759292A (fr) * | 1969-11-27 | 1971-05-24 | Allen & Hanburys Ltd | Derives de xanthone, leur preparation et leur emploi |
-
0
- BE BE793865D patent/BE793865A/xx unknown
-
1972
- 1972-09-25 US US00291618A patent/US3818040A/en not_active Expired - Lifetime
- 1972-11-22 IL IL40899A patent/IL40899A/xx unknown
- 1972-11-22 ZA ZA738288A patent/ZA728288B/xx unknown
- 1972-12-15 AU AU50123/72A patent/AU464832B2/en not_active Expired
- 1972-12-28 GB GB5990872A patent/GB1399168A/en not_active Expired
-
1973
- 1973-01-05 DE DE2300367A patent/DE2300367A1/de active Pending
- 1973-01-08 ES ES410419A patent/ES410419A1/es not_active Expired
- 1973-01-10 AT AT19573A patent/AT325040B/de not_active IP Right Cessation
- 1973-01-10 FR FR7300772A patent/FR2199977B1/fr not_active Expired
- 1973-01-11 JP JP48006264A patent/JPS4969672A/ja active Pending
- 1973-01-12 AR AR246104A patent/AR195514A1/es active
- 1973-01-12 NL NL7300531A patent/NL7300531A/xx unknown
- 1973-01-12 SE SE7300432A patent/SE387120B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2300367A1 (de) | 1974-04-25 |
| NL7300531A (en:Method) | 1974-03-27 |
| FR2199977A1 (en:Method) | 1974-04-19 |
| AU464832B2 (en) | 1975-09-11 |
| BE793865A (fr) | 1973-07-10 |
| AU5012372A (en) | 1974-06-20 |
| AR195514A1 (es) | 1973-10-15 |
| GB1399168A (en) | 1975-06-25 |
| FR2199977B1 (en:Method) | 1976-03-05 |
| US3818040A (en) | 1974-06-18 |
| ES410419A1 (es) | 1976-05-01 |
| JPS4969672A (en:Method) | 1974-07-05 |
| SE387120B (sv) | 1976-08-30 |
| IL40899A (en) | 1975-06-25 |
| IL40899A0 (en) | 1973-01-30 |
| AT325040B (de) | 1975-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZA734053B (en) | Phenylalkonoic acids | |
| IL37019A (en) | Dihydro-furo-quinoline carboxylic acid derivatives | |
| ZA734687B (en) | Succinic acid derivatives | |
| IL50968A0 (en) | New substituted 2-benzoyl-benzoic acids | |
| PH9438A (en) | New sulfamyl-benzoic acid derivatives | |
| ZA724756B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| IL41771A0 (en) | Novel octanoic acid derivatives and their production | |
| ZA734135B (en) | Tri-alkoxy-cinnamoyl-amino-carbon acids | |
| IL43318A0 (en) | Novel 13-bromo-lysergic acid compounds and their preparation | |
| ZA728288B (en) | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds | |
| AU6366973A (en) | Sulfamylbenzoic acids | |
| ZA724757B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| PH10714A (en) | 3-(o-sulfobenzoic acid imido-pyrrolidone-or-piperidone-2 and derivatives thereof | |
| ZA724759B (en) | Heterocyclic substituted xanthone carboxylic acid compounds | |
| CA1014167A (en) | Disubstituted xanthone carboxylic acid compounds | |
| ZA737591B (en) | 13-bromo-lysergic acid compounds | |
| AU5920273A (en) | Alpha-phenyl-fatty acid compounds | |
| ZA733641B (en) | Phenoxy alicyclic carboxylic acid derivatives | |
| PH12770A (en) | 6(a-(amidino-and imidoylamino-alkanoylamino)-aracylamino)-penicillanic acids | |
| ZA721129B (en) | 5-n-pyrrylsalicylic acid | |
| IE37984L (en) | Quinoline-thionophosphoric acid esters; pesticides | |
| AU6201973A (en) | Terahydroindazole-5-carboxylic acid compounds | |
| AU6199173A (en) | Substituted phenoxy-alkane-carboxylic acids | |
| AU476552B2 (en) | Tetrahydro isoquinolyl carboxylic acid amides | |
| AU5158673A (en) | O-vinylphosphoric acid ester amides |