ZA725520B - Aminobenzimidazolcarboxylic acid derivatives,process for their preparation,and their systemic-fungicidal and bactericidal use - Google Patents
Aminobenzimidazolcarboxylic acid derivatives,process for their preparation,and their systemic-fungicidal and bactericidal useInfo
- Publication number
- ZA725520B ZA725520B ZA725520A ZA725520A ZA725520B ZA 725520 B ZA725520 B ZA 725520B ZA 725520 A ZA725520 A ZA 725520A ZA 725520 A ZA725520 A ZA 725520A ZA 725520 B ZA725520 B ZA 725520B
- Authority
- ZA
- South Africa
- Prior art keywords
- aminobenzimidazolcarboxylic
- fungicidal
- systemic
- preparation
- acid derivatives
- Prior art date
Links
- ZMGZOIDMVIXQQY-UHFFFAOYSA-N 4-amino-1h-benzimidazole-2-carboxylic acid Chemical class NC1=CC=CC2=C1NC(C(O)=O)=N2 ZMGZOIDMVIXQQY-UHFFFAOYSA-N 0.000 title 1
- 230000000844 anti-bacterial effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/24—Benzimidazoles; Hydrogenated benzimidazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D235/30—Nitrogen atoms not forming part of a nitro radical
- C07D235/32—Benzimidazole-2-carbamic acids, unsubstituted or substituted; Esters thereof; Thio-analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2140863A DE2140863A1 (de) | 1971-08-14 | 1971-08-14 | Aminobenzimidazolcarbonsaeure-derivate, verfahren zu ihrer herstellung und ihre systemisch-fungizide und bakterizide verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA725520B true ZA725520B (en) | 1973-04-25 |
Family
ID=5816791
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA725520A ZA725520B (en) | 1971-08-14 | 1972-08-11 | Aminobenzimidazolcarboxylic acid derivatives,process for their preparation,and their systemic-fungicidal and bactericidal use |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3856811A (enExample) |
| JP (2) | JPS4828469A (enExample) |
| AT (1) | AT316211B (enExample) |
| AU (1) | AU4553272A (enExample) |
| BE (1) | BE787412A (enExample) |
| BR (1) | BR7205474D0 (enExample) |
| DD (1) | DD104700A5 (enExample) |
| DE (1) | DE2140863A1 (enExample) |
| FR (1) | FR2150064A5 (enExample) |
| GB (1) | GB1344967A (enExample) |
| HU (1) | HU164368B (enExample) |
| IL (1) | IL40111A0 (enExample) |
| IT (1) | IT963996B (enExample) |
| NL (1) | NL7211086A (enExample) |
| TR (1) | TR17008A (enExample) |
| ZA (1) | ZA725520B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2263212C2 (de) * | 1972-12-23 | 1979-08-30 | Johann 8473 Pfreimd Wilden | Verfahren zum Herstellen lederharter Formlinge |
| JPS5067810A (enExample) * | 1973-10-19 | 1975-06-06 | ||
| JPS5549927Y2 (enExample) * | 1975-02-14 | 1980-11-20 | ||
| DE2425704A1 (de) * | 1974-05-28 | 1975-12-18 | Hoechst Ag | Substituierte phenylmercapto-benzimidazole |
| JPS518306A (ja) * | 1974-07-10 | 1976-01-23 | Hitachi Metals Ltd | Shitsushikiseikeisochi |
| JPS5138306A (ja) * | 1974-09-30 | 1976-03-31 | Hitachi Metals Ltd | Shitsushikifueraitoseikeiho |
| JPS5147903A (ja) * | 1974-10-23 | 1976-04-24 | Ina Seito Kk | Tokisotainokaatsuikomiseikeihoho narabini sonohohoniryosuruseikeigata |
| JPS51124107A (en) * | 1975-04-23 | 1976-10-29 | Hitachi Metals Ltd | Method and apparatus for manufacturing products from ceramic materials |
| JPH0133287Y2 (enExample) * | 1980-11-27 | 1989-10-09 | ||
| JPS56133411U (enExample) * | 1981-02-19 | 1981-10-09 | ||
| US4435418A (en) | 1982-12-13 | 1984-03-06 | Smithkline Beckman Corporation | 5-Phenylethenylbenzimidazoles |
| JPS6046210A (ja) * | 1983-08-25 | 1985-03-13 | 梅屋 薫 | 射出濾過圧密成形法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3399212A (en) * | 1966-05-16 | 1968-08-27 | Smith Kline French Lab | Benzimidazole ureas |
| US3455948A (en) * | 1966-11-09 | 1969-07-15 | Smithkline Corp | 2-aminobenzimidazole and a process for preparing 2-aminobenzimidazoles |
| US3647817A (en) * | 1969-01-14 | 1972-03-07 | Du Pont | Rearrangement process for preparation of alkyl 2 - benzimidazolecarbamates from alkyl 2 -aminobenzimidazole-1-carboxylates |
| US3641048A (en) * | 1969-07-29 | 1972-02-08 | Du Pont | Alkyl 1 - (substituted alkylideneaminooxycarbonyl) - 2 -benzimidazolecarbamates |
-
0
- BE BE787412D patent/BE787412A/xx unknown
-
1971
- 1971-08-14 DE DE2140863A patent/DE2140863A1/de active Pending
-
1972
- 1972-08-03 US US00277829A patent/US3856811A/en not_active Expired - Lifetime
- 1972-08-10 DD DD164970A patent/DD104700A5/xx unknown
- 1972-08-11 BR BR5474/72A patent/BR7205474D0/pt unknown
- 1972-08-11 ZA ZA725520A patent/ZA725520B/xx unknown
- 1972-08-11 IL IL40111A patent/IL40111A0/xx unknown
- 1972-08-11 AU AU45532/72A patent/AU4553272A/en not_active Expired
- 1972-08-11 FR FR7229016A patent/FR2150064A5/fr not_active Expired
- 1972-08-12 IT IT28198/72A patent/IT963996B/it active
- 1972-08-14 HU HUBA2786A patent/HU164368B/hu unknown
- 1972-08-14 AT AT699572A patent/AT316211B/de not_active IP Right Cessation
- 1972-08-14 TR TR17008A patent/TR17008A/xx unknown
- 1972-08-14 JP JP47080837A patent/JPS4828469A/ja active Pending
- 1972-08-14 NL NL7211086A patent/NL7211086A/xx unknown
- 1972-08-14 GB GB3782972A patent/GB1344967A/en not_active Expired
- 1972-08-14 JP JP47080838A patent/JPS4826926A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1344967A (en) | 1974-01-23 |
| DD104700A5 (enExample) | 1974-03-20 |
| NL7211086A (enExample) | 1973-02-16 |
| AT316211B (de) | 1974-06-25 |
| AU4553272A (en) | 1974-02-14 |
| BE787412A (fr) | 1973-02-12 |
| DE2140863A1 (de) | 1973-02-15 |
| JPS4828469A (enExample) | 1973-04-14 |
| BR7205474D0 (pt) | 1973-07-05 |
| IT963996B (it) | 1974-01-21 |
| FR2150064A5 (enExample) | 1973-03-30 |
| TR17008A (tr) | 1974-04-11 |
| JPS4826926A (enExample) | 1973-04-09 |
| HU164368B (enExample) | 1974-02-28 |
| IL40111A0 (en) | 1972-10-29 |
| US3856811A (en) | 1974-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KE2755A (en) | New phenoxy-alkyl-carboxylic acid derivatives and the preparation thereof | |
| IL45299A (en) | 16-phenoxy-11a,15a-dihydroxy-17,18,19,20-tetranor-5-cis-13-transprostadienoic acid and prostadienol derivatives and prostadienol derivatives and processes for their preparation | |
| IL45133A0 (en) | Imidazolyl-o,n-acetals and their salts,processes for their preparation and their use as fungicides | |
| ZA725520B (en) | Aminobenzimidazolcarboxylic acid derivatives,process for their preparation,and their systemic-fungicidal and bactericidal use | |
| CA979437A (en) | 15-oxoprostanoic acid derivatives and process for the preparation thereof | |
| ZA73891B (en) | 1-aminosulphonyl-2-aminobenzimidazoles,process for their preparation and their fungicidal use | |
| ZA726638B (en) | New phenoxy-alkyl-carboxylic acid derivatives and the preparation thereof | |
| IL39735A0 (en) | 3,20-dioxo-pregn-4-ene 21-carboxylic acid derivatives | |
| ZA725202B (en) | Process for producing 4-hydroxymethyl-1-keto-1,2-dihydrophthalazine and acid salts thereof,and pharmaceutical composition containing the same | |
| IL39387A0 (en) | Butene-carboxylic acid derivatives,their manufacture and their use as pesticides | |
| ZA712802B (en) | Ureidophenylisothioureas,process for their preparation and their use as fungicides | |
| AU473287B2 (en) | Substituted phenllimida zolidinones, the acid addition salts thereof and processes for their preparation | |
| ZA728821B (en) | 8,12-diisoprostanoic acid derivatives and process for their preparation | |
| IL39058A (en) | N-picolylalkanoyl-piperazine derivatives,their salts and process for the preparation thereof | |
| ZA723936B (en) | Thiazylureas,process for their preparation,and their fungicidal use | |
| IL39356A0 (en) | Novel 3-aryl-thiopropionic acid derivatives,their preparation and their use as herbicides | |
| ZA726015B (en) | N,n-dimethyl-o-pyrazolylcarbamic acid esters,process for their preparation and their use as insecticides | |
| IL40859A0 (en) | Amidophenylguanidines,process for their preparation and their fungicidal use | |
| MY7700158A (en) | 1,4-methano-and ethano-tetrahydronaphthyl-oxypropanols and process for their preparation | |
| IL39097A0 (en) | Pyrazolydinyl-phenylphosphoric acid derivatives,their salts and their preparation | |
| ZA745657B (en) | 7-monochloroacetamido-3-desacetoxycephalosporanic acid derivatives, their preparation and use | |
| AU456953B2 (en) | Novel phenylhydrazonoimidazolenines, processes for their preparation and their fungicidal and bacteericidal use | |
| ZA733967B (en) | 9-desoxy-prosta-5,9(10),13-trienoic acid derivatives and process for their preparation | |
| IL40507A (en) | Pyridazonylphosphoric acid derivatives,their manufacture and their use as herbicides | |
| IL39945A0 (en) | 14,15beta-epoxycardenolide-and 14,15beta-epoxybufadienolideglycosides and process for their preparation |