ZA714211B - 2-nitro-benzofurans - Google Patents
2-nitro-benzofuransInfo
- Publication number
- ZA714211B ZA714211B ZA714211A ZA714211A ZA714211B ZA 714211 B ZA714211 B ZA 714211B ZA 714211 A ZA714211 A ZA 714211A ZA 714211 A ZA714211 A ZA 714211A ZA 714211 B ZA714211 B ZA 714211B
- Authority
- ZA
- South Africa
- Prior art keywords
- benzofurans
- nitro
- Prior art date
Links
- RSZMTXPFGDUHSE-UHFFFAOYSA-N 2-nitro-1-benzofuran Chemical class C1=CC=C2OC([N+](=O)[O-])=CC2=C1 RSZMTXPFGDUHSE-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7023984A FR2092891A1 (en) | 1970-06-29 | 1970-06-29 | 2-nitro-benzofuran derivs - antimicrobial, antiparasitic - cpd prepd from salicylaldehyde and halo-nitro methane |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA714211B true ZA714211B (en) | 1972-03-29 |
Family
ID=9057957
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA714211A ZA714211B (en) | 1970-06-29 | 1971-06-28 | 2-nitro-benzofurans |
Country Status (3)
| Country | Link |
|---|---|
| ES (1) | ES392410A1 (show.php) |
| FR (1) | FR2092891A1 (show.php) |
| ZA (1) | ZA714211B (show.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2424266A1 (fr) * | 1978-04-24 | 1979-11-23 | Anvar | Derives nitres de naphtofurannes, leur preparation et leur application comme medicaments |
-
1970
- 1970-06-29 FR FR7023984A patent/FR2092891A1/fr active Granted
-
1971
- 1971-06-18 ES ES392410A patent/ES392410A1/es not_active Expired
- 1971-06-28 ZA ZA714211A patent/ZA714211B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2092891A1 (en) | 1972-01-28 |
| ES392410A1 (es) | 1974-06-16 |
| FR2092891B1 (show.php) | 1974-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU120771A (en) | Toplotni izmenjalnik | |
| HK42177A (en) | Azapurinones | |
| IL36363A (en) | 5-azapyrimidine-nucleosides | |
| JPS5636468A (en) | 44hydroxyy66arylpyrimidines | |
| JPS5182632A (en) | Seidensenzono ekitaigenzosochi | |
| HK13477A (en) | Arylalkylsulphoxides | |
| IL38178A (en) | 1-phenyl-3-acyl-thioureas | |
| IL36191A0 (en) | Disc-brakes | |
| JPS5123747A (en) | Seidensenzono ekitaigenzosochi | |
| JPS56156207A (en) | Tickicide | |
| IL37883A0 (en) | Alpha-6-deoxytetracyclines | |
| IE35693L (en) | 1 - phenoxy - 2 - hydroxy - 3 - hydroxyalkyl-aminopropanes | |
| IL36747A0 (en) | 3-sulfonamido-4-hydroxyphenyl-2-piperidylcarbinols | |
| IL36155A (en) | 3-amino-1-phenoxy-propan-2-olderivatives | |
| HK86379A (en) | 3-fluoroalanines | |
| MY7400161A (en) | Copocymers | |
| JPS5136411A (en) | Jukikagobutsuno seizohoho | |
| IL43774A0 (en) | 4-benzyloxy-ureidoacetophenones | |
| GB1364569A (en) | Cinecamera | |
| IL36630A (en) | 2-naphthyl-quinazolinones | |
| IE34900B1 (en) | Hexahydroazepines | |
| ZA714211B (en) | 2-nitro-benzofurans | |
| IL37003A0 (en) | 6-deoxy-5-oxytetracycline-esters | |
| AU4883172A (en) | Stick-classifying | |
| IE34997B1 (en) | 4-piperidylidene-benzocycloheptathiopenes |