ZA707307B - 1-carbamoyl-4-phenylpiperidines and tetrahydropyridines - Google Patents
1-carbamoyl-4-phenylpiperidines and tetrahydropyridinesInfo
- Publication number
- ZA707307B ZA707307B ZA707307A ZA707307A ZA707307B ZA 707307 B ZA707307 B ZA 707307B ZA 707307 A ZA707307 A ZA 707307A ZA 707307 A ZA707307 A ZA 707307A ZA 707307 B ZA707307 B ZA 707307B
- Authority
- ZA
- South Africa
- Prior art keywords
- tetrahydropyridines
- phenylpiperidines
- carbamoyl
- Prior art date
Links
- FZOKXDNYTHYNPE-UHFFFAOYSA-N 4-phenylpiperidine-1-carboxamide Chemical class C1CN(C(=O)N)CCC1C1=CC=CC=C1 FZOKXDNYTHYNPE-UHFFFAOYSA-N 0.000 title 1
- 125000004853 tetrahydropyridinyl group Chemical class N1(CCCC=C1)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/02—Preparation by ring-closure or hydrogenation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86988169A | 1969-10-27 | 1969-10-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA707307B true ZA707307B (en) | 1971-07-28 |
Family
ID=25354406
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA707307A ZA707307B (en) | 1969-10-27 | 1970-10-27 | 1-carbamoyl-4-phenylpiperidines and tetrahydropyridines |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS4939266B1 (cg-RX-API-DMAC10.html) |
| AT (1) | AT302354B (cg-RX-API-DMAC10.html) |
| BE (1) | BE757436A (cg-RX-API-DMAC10.html) |
| CA (1) | CA918161A (cg-RX-API-DMAC10.html) |
| CH (1) | CH525886A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2048589A1 (cg-RX-API-DMAC10.html) |
| ES (1) | ES384311A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2070167B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1307277A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7015396A (cg-RX-API-DMAC10.html) |
| NO (1) | NO131172C (cg-RX-API-DMAC10.html) |
| PH (1) | PH9289A (cg-RX-API-DMAC10.html) |
| SE (2) | SE382454B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA707307B (cg-RX-API-DMAC10.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4374991A (en) | 1976-12-17 | 1983-02-22 | Rohm And Haas Company | 2,6-Dimethylpiperidinyl-N-carbobutoxymethyl urea |
| US4357471A (en) | 1976-12-17 | 1982-11-02 | Rohm And Haas Company | Azaspiro compounds |
| US4400512A (en) * | 1976-12-17 | 1983-08-23 | Rohm And Haas Company | Azaspiro compounds |
| US4405630A (en) * | 1980-12-29 | 1983-09-20 | Rohm And Haas Company | Arthropod repellent compositions and methods |
| FR2501506A1 (fr) * | 1981-03-11 | 1982-09-17 | Sanofi Sa | Compositions pharmaceutiques a action anorexigene contenant des derives de la tetrahydropyridine |
| CN1856484B (zh) * | 2003-07-24 | 2010-09-22 | 欧洲凯尔蒂克公司 | 用于治疗或预防疼痛的杂芳基-四氢吡啶基化合物 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1087174A (en) * | 1965-04-05 | 1967-10-11 | Allen & Hanburys Ltd | Piperidine derivatives |
| FR1589754A (cg-RX-API-DMAC10.html) * | 1968-10-17 | 1970-04-06 |
-
0
- BE BE757436D patent/BE757436A/xx unknown
-
1970
- 1970-10-02 DE DE19702048589 patent/DE2048589A1/de active Pending
- 1970-10-07 ES ES384311A patent/ES384311A1/es not_active Expired
- 1970-10-15 SE SE7312890A patent/SE382454B/xx unknown
- 1970-10-15 SE SE7013959A patent/SE372942B/xx unknown
- 1970-10-20 CH CH1546970A patent/CH525886A/fr not_active IP Right Cessation
- 1970-10-21 NL NL7015396A patent/NL7015396A/xx unknown
- 1970-10-22 PH PH11886*UA patent/PH9289A/en unknown
- 1970-10-23 GB GB5050970A patent/GB1307277A/en not_active Expired
- 1970-10-26 CA CA096580A patent/CA918161A/en not_active Expired
- 1970-10-26 FR FR7038570A patent/FR2070167B1/fr not_active Expired
- 1970-10-26 NO NO4046/70A patent/NO131172C/no unknown
- 1970-10-27 AT AT966570A patent/AT302354B/de not_active IP Right Cessation
- 1970-10-27 JP JP45094014A patent/JPS4939266B1/ja active Pending
- 1970-10-27 ZA ZA707307A patent/ZA707307B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE757436A (fr) | 1971-03-16 |
| GB1307277A (en) | 1973-02-14 |
| FR2070167A1 (cg-RX-API-DMAC10.html) | 1971-09-10 |
| JPS4939266B1 (cg-RX-API-DMAC10.html) | 1974-10-24 |
| AT302354B (de) | 1972-10-10 |
| SE382454B (sv) | 1976-02-02 |
| NL7015396A (cg-RX-API-DMAC10.html) | 1971-04-29 |
| NO131172B (cg-RX-API-DMAC10.html) | 1975-01-06 |
| CA918161A (en) | 1973-01-02 |
| DE2048589A1 (de) | 1971-05-06 |
| PH9289A (en) | 1975-08-13 |
| FR2070167B1 (cg-RX-API-DMAC10.html) | 1975-03-14 |
| ES384311A1 (es) | 1973-09-01 |
| SE372942B (cg-RX-API-DMAC10.html) | 1975-01-20 |
| CH525886A (fr) | 1972-07-31 |
| NO131172C (cg-RX-API-DMAC10.html) | 1975-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL34383A0 (en) | 2-acylimidazoles and their preparation | |
| ZA696487B (en) | Power units and parts thereof | |
| YU33338B (en) | Jonizacioni pozarni alarmni uredaj sa kontrolom izolacije | |
| YU33218B (en) | Sklop u uredaju sa gasnim gorionikom | |
| ZA707307B (en) | 1-carbamoyl-4-phenylpiperidines and tetrahydropyridines | |
| YU30270A (en) | Dvoredno kotrljajuce leziste sa buricima | |
| ZA705567B (en) | 7beta-alkyl-19-nortestosterones and derivatives | |
| ZA705898B (en) | Improvements in mincers | |
| GB1322742A (en) | Silanolate-complexes and use thereof | |
| IL34009A (en) | Lincomycin-3-acylates and process | |
| YU31893B (en) | Sediste sa elasticnim vesanjem | |
| IL33812A0 (en) | 9alpha-fluoro-16-fluoromethylene-prednisolone-21-ester and preparation thereof | |
| ZA705964B (en) | Triglyceride-lowering compositions and methods | |
| YU31689B (en) | Sediste vozila sa podesljivim lednim naslonom | |
| IE34142L (en) | Perhydroindanes and perhydronaphthalenes | |
| YU33256B (en) | Plovni objekat sa mlaznom propulzijom | |
| YU31411B (en) | Kocnica sa diskom | |
| ZA706797B (en) | 2-propargylamino-5-phenyl-2-oxazolin-4-one and derivatives | |
| AU451503B2 (en) | Dibenzodiasepines and pyridobenzo-diozepines | |
| CA808659A (en) | Pyrazinoylguanidines and pyrazinamidoguanidines | |
| CA822680A (en) | Azaspirodecanediones and azaspiroundecanediones | |
| CA995239A (en) | Phenylthioaralkylamides and 2-phenylthio-benzylamides | |
| YU264569A (en) | Zvezdna vrtilna karta nebo in zemlja | |
| YU33389B (en) | Postopek izdelave tiocianatov alkalijskih in zemljoalkalijskih kovin | |
| IL42364A0 (en) | Perhydroindanes and their manufacture |