ZA704878B - Ergoline derivatives - Google Patents
Ergoline derivativesInfo
- Publication number
- ZA704878B ZA704878B ZA704878A ZA704878A ZA704878B ZA 704878 B ZA704878 B ZA 704878B ZA 704878 A ZA704878 A ZA 704878A ZA 704878 A ZA704878 A ZA 704878A ZA 704878 B ZA704878 B ZA 704878B
- Authority
- ZA
- South Africa
- Prior art keywords
- ergoline derivatives
- ergoline
- derivatives
- Prior art date
Links
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1979169 | 1969-07-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA704878B true ZA704878B (en) | 1971-03-31 |
Family
ID=11161239
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA704878A ZA704878B (en) | 1969-07-18 | 1970-07-15 | Ergoline derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3717640A (OSRAM) |
| AT (1) | AT297943B (OSRAM) |
| AU (1) | AU1759570A (OSRAM) |
| BE (1) | BE753602A (OSRAM) |
| BR (1) | BR6915443D0 (OSRAM) |
| CA (1) | CA926862A (OSRAM) |
| CH (1) | CH545792A (OSRAM) |
| DE (1) | DE2035008A1 (OSRAM) |
| ES (1) | ES381956A1 (OSRAM) |
| FR (1) | FR2059526B1 (OSRAM) |
| GB (1) | GB1258546A (OSRAM) |
| IE (1) | IE34382B1 (OSRAM) |
| IL (1) | IL34924A0 (OSRAM) |
| NL (1) | NL7009951A (OSRAM) |
| ZA (1) | ZA704878B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
| DE3151912A1 (de) * | 1981-12-23 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue ergolin-aminoderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| DE3528576A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Verfahren zur herstellung von ergolin-thioharnstoffen |
| DE3528584A1 (de) * | 1985-08-06 | 1987-02-19 | Schering Ag | Neue 1-alkyl-ergolin-thioharnstoffderivate |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3251846A (en) * | 1966-05-17 | G-dimethyosoergolenyl-b | ||
| US3238211A (en) * | 1966-03-01 | Derhvatives of g-methyl and i,g-dimethyl ergolhne | ||
| US3245997A (en) * | 1963-07-17 | 1966-04-12 | Searle & Co | 3-substituted 1-(1, 2, 3, 4-tetrahydro-2-isoquinolyl) alkyl-2-thioureas |
| DE1695752C3 (de) * | 1966-07-29 | 1974-06-06 | Societa Farmaceutici Italia, Mailand (Italien) | 1 ,ö-Dimethyl-ebeta-N-carbobenzoxyaminomethyl-2,3-dihydro-1 Oalpha-ergolin und ein Verfahren zu seiner Herstellung |
-
1969
- 1969-12-19 BR BR215443/69A patent/BR6915443D0/pt unknown
-
1970
- 1970-07-06 NL NL7009951A patent/NL7009951A/xx unknown
- 1970-07-13 IE IE905/70A patent/IE34382B1/xx unknown
- 1970-07-14 GB GB1258546D patent/GB1258546A/en not_active Expired
- 1970-07-14 IL IL34924A patent/IL34924A0/xx unknown
- 1970-07-14 CA CA088097A patent/CA926862A/en not_active Expired
- 1970-07-15 AU AU17595/70A patent/AU1759570A/en not_active Expired
- 1970-07-15 FR FR7025972A patent/FR2059526B1/fr not_active Expired
- 1970-07-15 ZA ZA704878A patent/ZA704878B/xx unknown
- 1970-07-15 DE DE19702035008 patent/DE2035008A1/de active Pending
- 1970-07-15 AT AT642570A patent/AT297943B/de not_active IP Right Cessation
- 1970-07-17 BE BE753602D patent/BE753602A/xx unknown
- 1970-07-17 CH CH1096370A patent/CH545792A/xx not_active IP Right Cessation
- 1970-07-17 US US00055985A patent/US3717640A/en not_active Expired - Lifetime
- 1970-07-17 ES ES381956A patent/ES381956A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2059526A1 (OSRAM) | 1971-06-04 |
| BE753602A (fr) | 1971-01-18 |
| IE34382B1 (en) | 1975-04-30 |
| NL7009951A (OSRAM) | 1971-01-20 |
| BR6915443D0 (pt) | 1973-03-13 |
| US3717640A (en) | 1973-02-20 |
| CH545792A (OSRAM) | 1974-02-15 |
| FR2059526B1 (OSRAM) | 1974-02-01 |
| DE2035008A1 (de) | 1971-12-23 |
| IE34382L (en) | 1971-01-18 |
| GB1258546A (OSRAM) | 1971-12-30 |
| IL34924A0 (en) | 1970-09-17 |
| AU1759570A (en) | 1972-01-20 |
| AT297943B (de) | 1972-04-10 |
| CA926862A (en) | 1973-05-22 |
| ES381956A1 (es) | 1972-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HK61677A (en) | Triazolobenzodiazepine derivatives | |
| ZA705600B (en) | Thiophene derivatives | |
| KE2582A (en) | Alkanolaminie derivatives | |
| IL35135A0 (en) | Inosine derivatives | |
| IL34685A0 (en) | Dibenzodioxocine derivatives | |
| CY806A (en) | Phenylaminoethanol derivatives | |
| ZA707593B (en) | Benzodiazepine derivatives | |
| PH9290A (en) | Tetrahydrocyclopropadibenzazepine derivatives | |
| ZA704940B (en) | Propargyl derivatives | |
| ZA704878B (en) | Ergoline derivatives | |
| ZA703011B (en) | Morphinone derivatives | |
| MY7500010A (en) | Benzodiazepine derivatives | |
| MY7500239A (en) | Indenopyridine derivatives | |
| ZA707765B (en) | New hydrazinecarbodithioate derivatives | |
| ZA704094B (en) | 2-hydroxy-5-benzamide derivatives | |
| IL34994A0 (en) | Hydroxyisoquinuclidine derivatives | |
| ZA704013B (en) | Benzoisothiazol derivatives | |
| IL34240A0 (en) | Imidazole derivatives | |
| ZA703512B (en) | Derivatives of alpha-aminopenicillins | |
| ZA703858B (en) | Pyrazine derivatives | |
| IL35307A (en) | Pyrazolophthalazine derivatives | |
| ZA705161B (en) | Pyrimidinylpyrazole derivatives | |
| AU7332074A (en) | Indenopyridine derivatives | |
| IL33107A0 (en) | Ergoline derivatives | |
| ZA702689B (en) | Triazine derivatives |