ZA694354B - Penicillanic acid derivatives - Google Patents
Penicillanic acid derivativesInfo
- Publication number
- ZA694354B ZA694354B ZA694354A ZA694354A ZA694354B ZA 694354 B ZA694354 B ZA 694354B ZA 694354 A ZA694354 A ZA 694354A ZA 694354 A ZA694354 A ZA 694354A ZA 694354 B ZA694354 B ZA 694354B
- Authority
- ZA
- South Africa
- Prior art keywords
- acid derivatives
- penicillanic acid
- penicillanic
- derivatives
- acid
- Prior art date
Links
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL686808622A NL155260B (nl) | 1968-06-19 | 1968-06-19 | Werkwijze voor de bereiding van derivaten van 6-aminopenicillaanzuur. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA694354B true ZA694354B (en) | 1971-01-27 |
Family
ID=19803934
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA694354A ZA694354B (en) | 1968-06-19 | 1969-06-18 | Penicillanic acid derivatives |
Country Status (15)
| Country | Link |
|---|---|
| AT (2) | AT290726B (enExample) |
| BE (1) | BE734708A (enExample) |
| BR (1) | BR6909873D0 (enExample) |
| CA (1) | CA922705A (enExample) |
| CH (2) | CH547308A (enExample) |
| DE (1) | DE1931097C3 (enExample) |
| ES (1) | ES368569A1 (enExample) |
| FR (1) | FR2011238B1 (enExample) |
| GB (1) | GB1268536A (enExample) |
| IE (1) | IE32890B1 (enExample) |
| IL (1) | IL32329A (enExample) |
| LU (1) | LU58901A1 (enExample) |
| NL (1) | NL155260B (enExample) |
| SE (1) | SE377126B (enExample) |
| ZA (1) | ZA694354B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS165353B2 (enExample) * | 1969-12-18 | 1975-12-22 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE603703A (fr) * | 1960-07-05 | 1961-09-01 | Novo Terapeutisk Labor As | Dérivés de l'acide 6-amino-pénicillanique et leur procédé de préparation |
-
1968
- 1968-06-19 NL NL686808622A patent/NL155260B/xx unknown
-
1969
- 1969-06-02 IL IL32329A patent/IL32329A/xx unknown
- 1969-06-13 SE SE6908458A patent/SE377126B/xx unknown
- 1969-06-17 BE BE734708D patent/BE734708A/xx unknown
- 1969-06-17 CH CH1324271A patent/CH547308A/xx not_active IP Right Cessation
- 1969-06-17 CH CH923669A patent/CH528539A/de not_active IP Right Cessation
- 1969-06-18 LU LU58901D patent/LU58901A1/xx unknown
- 1969-06-18 AT AT575569A patent/AT290726B/de not_active IP Right Cessation
- 1969-06-18 AT AT658470A patent/AT300194B/de not_active IP Right Cessation
- 1969-06-18 ZA ZA694354A patent/ZA694354B/xx unknown
- 1969-06-18 IE IE834/69A patent/IE32890B1/xx unknown
- 1969-06-18 BR BR209873/69A patent/BR6909873D0/pt unknown
- 1969-06-18 GB GB30958/69A patent/GB1268536A/en not_active Expired
- 1969-06-19 DE DE1931097A patent/DE1931097C3/de not_active Expired
- 1969-06-19 FR FR696920550A patent/FR2011238B1/fr not_active Expired
- 1969-06-19 ES ES368569A patent/ES368569A1/es not_active Expired
- 1969-06-19 CA CA054776A patent/CA922705A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IE32890L (en) | 1969-12-19 |
| LU58901A1 (enExample) | 1969-11-12 |
| AT300194B (de) | 1972-07-10 |
| DE1931097C3 (de) | 1975-05-07 |
| DE1966702B2 (de) | 1976-01-15 |
| ES368569A1 (es) | 1971-05-01 |
| BE734708A (enExample) | 1969-12-17 |
| NL6808622A (enExample) | 1969-12-23 |
| GB1268536A (en) | 1972-03-29 |
| DE1966702A1 (de) | 1973-09-06 |
| FR2011238A1 (enExample) | 1970-02-27 |
| NL155260B (nl) | 1977-12-15 |
| CA922705A (en) | 1973-03-13 |
| CH547308A (de) | 1974-03-29 |
| CH528539A (de) | 1972-09-30 |
| AT290726B (de) | 1971-06-11 |
| IL32329A0 (en) | 1969-08-27 |
| DE1931097B2 (de) | 1974-08-08 |
| BR6909873D0 (pt) | 1973-02-08 |
| IL32329A (en) | 1974-01-14 |
| FR2011238B1 (enExample) | 1973-01-12 |
| DE1931097A1 (de) | 1970-01-02 |
| IE32890B1 (en) | 1974-01-09 |
| SE377126B (enExample) | 1975-06-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1012136B (en) | Penicillins | |
| IE33906B1 (en) | Pyrrolobenzodiazepinone derivatives | |
| MY7500209A (en) | Pyridobenzo-diazepine derivatives | |
| CY697A (en) | New sulphamyl-benzoic acid derivatives | |
| IL32786A0 (en) | Novel n-phenylsuccinimide derivatives | |
| IL32640A (en) | 3-carbamoylphenoxy-1-amino-2-propanol derivatives | |
| MY7500061A (en) | Penicillin preparation | |
| ZA716894B (en) | Penicillanic acid derivatives | |
| IE33478L (en) | 6-aminopenicillanic acid derivatives | |
| MY7400238A (en) | Oxalic acid derivatives | |
| IL35931A (en) | Alpha-aminooxycarbohydroxamic acid derivatives | |
| IE33874B1 (en) | New sulphamyl-benzoic acid derivatives | |
| ZA707347B (en) | New penicillanic acid derivatives | |
| CY770A (en) | Ergolene derivatives | |
| ZA694354B (en) | Penicillanic acid derivatives | |
| IE32843L (en) | Penicillin derivatives | |
| ZA705462B (en) | Penicillanic acids | |
| MY7400140A (en) | Oxazinobenzodiazepine derivatives | |
| ZA697692B (en) | Penicillin derivatives | |
| ZA695730B (en) | Aminocyclopentanecarboxylic acid derivatives | |
| MY7400239A (en) | New sulphamyl-benzoic acid derivatives | |
| AU437621B2 (en) | Pencillanic acid derivatives | |
| AU424265B2 (en) | Phosphanilic acid derivatives | |
| AU436705B2 (en) | Aminocyclopenanecarboxylic acid derivatives | |
| CA779912A (en) | 2-alkylideneacetic acid derivatives |