WO2023235212A1 - Glass compositions and colored glass articles formed therefrom - Google Patents
Glass compositions and colored glass articles formed therefrom Download PDFInfo
- Publication number
- WO2023235212A1 WO2023235212A1 PCT/US2023/023493 US2023023493W WO2023235212A1 WO 2023235212 A1 WO2023235212 A1 WO 2023235212A1 US 2023023493 W US2023023493 W US 2023023493W WO 2023235212 A1 WO2023235212 A1 WO 2023235212A1
- Authority
- WO
- WIPO (PCT)
- Prior art keywords
- equal
- mol
- less
- glass
- glass composition
- Prior art date
Links
- 239000011521 glass Substances 0.000 title claims abstract description 367
- 239000000203 mixture Substances 0.000 title claims abstract description 196
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 38
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims abstract description 19
- 229910052681 coesite Inorganic materials 0.000 claims abstract description 19
- 229910052906 cristobalite Inorganic materials 0.000 claims abstract description 19
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 19
- 229910052682 stishovite Inorganic materials 0.000 claims abstract description 19
- 229910052905 tridymite Inorganic materials 0.000 claims abstract description 19
- VQCBHWLJZDBHOS-UHFFFAOYSA-N erbium(III) oxide Inorganic materials O=[Er]O[Er]=O VQCBHWLJZDBHOS-UHFFFAOYSA-N 0.000 claims abstract description 18
- PLDDOISOJJCEMH-UHFFFAOYSA-N neodymium oxide Inorganic materials [O-2].[O-2].[O-2].[Nd+3].[Nd+3] PLDDOISOJJCEMH-UHFFFAOYSA-N 0.000 claims abstract description 18
- FUJCRWPEOMXPAD-UHFFFAOYSA-N Li2O Inorganic materials [Li+].[Li+].[O-2] FUJCRWPEOMXPAD-UHFFFAOYSA-N 0.000 claims abstract description 17
- XUCJHNOBJLKZNU-UHFFFAOYSA-M dilithium;hydroxide Chemical compound [Li+].[Li+].[OH-] XUCJHNOBJLKZNU-UHFFFAOYSA-M 0.000 claims abstract description 17
- 229910011255 B2O3 Inorganic materials 0.000 claims abstract description 14
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 claims description 20
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 16
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 14
- UBEWDCMIDFGDOO-UHFFFAOYSA-N cobalt(II,III) oxide Inorganic materials [O-2].[O-2].[O-2].[O-2].[Co+2].[Co+3].[Co+3] UBEWDCMIDFGDOO-UHFFFAOYSA-N 0.000 claims description 9
- CETPSERCERDGAM-UHFFFAOYSA-N ceric oxide Chemical compound O=[Ce]=O CETPSERCERDGAM-UHFFFAOYSA-N 0.000 claims description 8
- 229910000422 cerium(IV) oxide Inorganic materials 0.000 claims description 8
- 238000002834 transmittance Methods 0.000 claims description 8
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 claims description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052593 corundum Inorganic materials 0.000 abstract 1
- 235000012239 silicon dioxide Nutrition 0.000 abstract 1
- 229910001845 yogo sapphire Inorganic materials 0.000 abstract 1
- 239000003086 colorant Substances 0.000 description 28
- 238000005342 ion exchange Methods 0.000 description 23
- 238000000034 method Methods 0.000 description 11
- 230000006835 compression Effects 0.000 description 10
- 238000007906 compression Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 230000007423 decrease Effects 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 238000005286 illumination Methods 0.000 description 7
- 239000000470 constituent Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229910021645 metal ion Inorganic materials 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 238000005728 strengthening Methods 0.000 description 6
- 229910052723 transition metal Inorganic materials 0.000 description 5
- 150000003624 transition metals Chemical class 0.000 description 5
- 239000005354 aluminosilicate glass Substances 0.000 description 4
- 238000000265 homogenisation Methods 0.000 description 4
- 230000014759 maintenance of location Effects 0.000 description 4
- 229910001415 sodium ion Inorganic materials 0.000 description 4
- QPLDLSVMHZLSFG-UHFFFAOYSA-N CuO Inorganic materials [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 230000002411 adverse Effects 0.000 description 3
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- GNRSAWUEBMWBQH-UHFFFAOYSA-N nickel(II) oxide Inorganic materials [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 3
- 229910001414 potassium ion Inorganic materials 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000003467 diminishing effect Effects 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 238000007654 immersion Methods 0.000 description 2
- 229910001404 rare earth metal oxide Inorganic materials 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229910000314 transition metal oxide Inorganic materials 0.000 description 2
- -1 A12O3 Chemical compound 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 239000005391 art glass Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 229910001423 beryllium ion Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000007657 chevron notch test Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000006025 fining agent Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NOTVAPJNGZMVSD-UHFFFAOYSA-N potassium monoxide Inorganic materials [K]O[K] NOTVAPJNGZMVSD-UHFFFAOYSA-N 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000007658 short bar method Methods 0.000 description 1
- 238000007655 standard test method Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C3/00—Glass compositions
- C03C3/04—Glass compositions containing silica
- C03C3/076—Glass compositions containing silica with 40% to 90% silica, by weight
- C03C3/11—Glass compositions containing silica with 40% to 90% silica, by weight containing halogen or nitrogen
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C3/00—Glass compositions
- C03C3/04—Glass compositions containing silica
- C03C3/076—Glass compositions containing silica with 40% to 90% silica, by weight
- C03C3/095—Glass compositions containing silica with 40% to 90% silica, by weight containing rare earths
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C1/00—Ingredients generally applicable to manufacture of glasses, glazes, or vitreous enamels
- C03C1/04—Opacifiers, e.g. fluorides or phosphates; Pigments
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C10/00—Devitrified glass ceramics, i.e. glass ceramics having a crystalline phase dispersed in a glassy phase and constituting at least 50% by weight of the total composition
- C03C10/0018—Devitrified glass ceramics, i.e. glass ceramics having a crystalline phase dispersed in a glassy phase and constituting at least 50% by weight of the total composition containing SiO2, Al2O3 and monovalent metal oxide as main constituents
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C10/00—Devitrified glass ceramics, i.e. glass ceramics having a crystalline phase dispersed in a glassy phase and constituting at least 50% by weight of the total composition
- C03C10/0018—Devitrified glass ceramics, i.e. glass ceramics having a crystalline phase dispersed in a glassy phase and constituting at least 50% by weight of the total composition containing SiO2, Al2O3 and monovalent metal oxide as main constituents
- C03C10/0027—Devitrified glass ceramics, i.e. glass ceramics having a crystalline phase dispersed in a glassy phase and constituting at least 50% by weight of the total composition containing SiO2, Al2O3 and monovalent metal oxide as main constituents containing SiO2, Al2O3, Li2O as main constituents
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C21/00—Treatment of glass, not in the form of fibres or filaments, by diffusing ions or metals in the surface
- C03C21/001—Treatment of glass, not in the form of fibres or filaments, by diffusing ions or metals in the surface in liquid phase, e.g. molten salts, solutions
- C03C21/002—Treatment of glass, not in the form of fibres or filaments, by diffusing ions or metals in the surface in liquid phase, e.g. molten salts, solutions to perform ion-exchange between alkali ions
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C3/00—Glass compositions
- C03C3/04—Glass compositions containing silica
- C03C3/076—Glass compositions containing silica with 40% to 90% silica, by weight
- C03C3/089—Glass compositions containing silica with 40% to 90% silica, by weight containing boron
- C03C3/091—Glass compositions containing silica with 40% to 90% silica, by weight containing boron containing aluminium
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C3/00—Glass compositions
- C03C3/04—Glass compositions containing silica
- C03C3/076—Glass compositions containing silica with 40% to 90% silica, by weight
- C03C3/089—Glass compositions containing silica with 40% to 90% silica, by weight containing boron
- C03C3/091—Glass compositions containing silica with 40% to 90% silica, by weight containing boron containing aluminium
- C03C3/093—Glass compositions containing silica with 40% to 90% silica, by weight containing boron containing aluminium containing zinc or zirconium
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C3/00—Glass compositions
- C03C3/04—Glass compositions containing silica
- C03C3/076—Glass compositions containing silica with 40% to 90% silica, by weight
- C03C3/097—Glass compositions containing silica with 40% to 90% silica, by weight containing phosphorus, niobium or tantalum
-
- C—CHEMISTRY; METALLURGY
- C03—GLASS; MINERAL OR SLAG WOOL
- C03C—CHEMICAL COMPOSITION OF GLASSES, GLAZES OR VITREOUS ENAMELS; SURFACE TREATMENT OF GLASS; SURFACE TREATMENT OF FIBRES OR FILAMENTS MADE FROM GLASS, MINERALS OR SLAGS; JOINING GLASS TO GLASS OR OTHER MATERIALS
- C03C4/00—Compositions for glass with special properties
- C03C4/02—Compositions for glass with special properties for coloured glass
Definitions
- the glass composition and the colored glass article may comprise greater than or equal to 10 mol% and less than or equal to 20 mol% A1 2 O 3 , such as greater than or equal to 13 mol% and less than or equal to 17 mol% A1 2 O 3 .
- the concentration of A1 2 O 3 in the glass composition and the colored glass article may be greater than or equal to 10 mol%, greater than or equal to 12 mol%, greater than or equal to 13 mol%, greater than or equal to 14 mol%, or more.
- the glass compositions and the colored glass articles described herein may further comprise ZnO.
- ZnO lowers the viscosity of the glass compositions, which enhances the formability, the strain point, and the Young’s modulus, and may improve ionexchangeability.
- the diffusivity of sodium and potassium ions in the glass composition decreases which, in turn, adversely impacts the ion-exchange performance (i.e., the ability to ion-exchange) of the colored glass article.
- a colored glass article may have a transmittance color coordinate in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle, of L* greater than or equal to 60 and less than or equal to 98, such as greater than or equal to 70 and less than or equal to 96, greater than or equal to 80 and less than or equal to 94, greater than or equal to 85 and less than or equal to 93, greater than or equal to 90 and less than or equal to 92, or any and all sub-ranges formed from any of these endpoints.
- L* greater than or equal to 60 and less than or equal to 98, such as greater than or equal to 70 and less than or equal to 96, greater than or equal to 80 and less than or equal to 94, greater than or equal to 85 and less than or equal to 93, greater than or equal to 90 and less than or equal to 92, or any and all sub-ranges formed from any of these endpoints.
- a colored glass article may have a transmittance color coordinate in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle, of b* greater than or equal to -22 and less than or equal to 91, such as greater than or equal to -20 and less than or equal to 90, greater than or equal to -15 and less than or equal to 85, greater than or equal to -10 and less than or equal to 80, greater than or equal to -5 and less than or equal to 75, greater than or equal to 0 and less than or equal to 70, greaterthan or equal to 5 and less than or equal to 65, greater than or equal to 10 and less than or equal to 60, greater than or equal to 15 and less than or equal to 55, greater than or equal to 20 and less than or equal to 50, greater than or equal to 25 and less than or equal to 45, greater than or equal to 30 and less than or equal to 40, greater than or equal to 0 and less than or equal to 35, or any and all sub-ranges formed from any of these
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Geochemistry & Mineralogy (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Ceramic Engineering (AREA)
- Crystallography & Structural Chemistry (AREA)
- Dispersion Chemistry (AREA)
- Glass Compositions (AREA)
Abstract
A glass composition includes greater than or equal to 50 mol% and less than or equal to 70 mol% SiO2; greater than or equal to 10 mol% and less than or equal to 20 mol% Al2O3; greater than or equal to 1 mol% and less than or equal to 10 mol% B2O3; greater than or equal to 7 mol% and less than or equal to 14 mol% Li2O; greater than 0 mol% and less than or equal to 8 mol% Na2O; greater than or equal to 0 mol% and less than or equal to 1 mol% K2O; greater than or equal to 0 mol% and less than or equal to 7 mol% CaO; greater than or equal to 0 mol% and less than or equal to 8 mol% MgO; and at least one of: greater than 0 mol% to less than or equal to 4 mol% Er2O3, and greater than 0 mol% to less than or equal to 4 mol% Nd2O3.
Description
GLASS COMPOSITIONS AND COLORED GLASS ARTICLES FORMED THEREFROM
Cross-Reference to Related Applications
[0001] This application claims the benefit of priority under 35 U.S.C. § 119 of U. S. Provisional Application No. 63/347,201 filed May31, 2022, the content of which is incorporated herein by reference in its entirety.
Field
[0002] The present specification generally relates to glass compositions and glass articles and, in particular, to glass compositions and ion-exchangeable, colored glass articles formed therefrom.
Technical Background
[0003] Aluminosilicate glass articles may exhibit superior ion-exchangeability and drop performance. Various industries, including the consumer electronics industry, desire colored materials with the same or similar strength and fracture toughness properties. However, simply including colorants in conventional aluminosilicate glass compositions may not produce the desired color and/or result in colored glass articles suitable for use in electronic devices transmitting and/or receiving high frequencies (e.g., frequencies of fifth generation (5G) wireless).
[0004] Accordingly, a need exists for alternative colored glass articles that provide the high strength and fracture toughness necessary for use in electronic devices.
SUMMARY
[0005] According to a first aspect, a glass composition is provided. The glass composition comprises: greater than or equal to 50 mol% and less than or equal to 70 mol% SiO2; greater than or equal to 10 mol% and less than or equal to 20 mol% AI2O3; greater than or equal to 1 mol% and less than or equal to 10 mol% B2O3; greater than or equal to 7 mol% and less than or equal to 14 mol%Li2O; greater than 0 mol% and less than or equal to 8 mol%Na2O; greater than or equal to 0 mol% and less than or equal to 1 mol% K2O; greater than or equal to 0 mol% and less than or equal to 7 mol% CaO; greater than or equal to 0 mol% and less than or
equal to 8 mol% MgO; and at least one of : greater than 0 mol% to less than or equal to 4 mol% Er2O3, and greater than 0 mol% to less than or equal to 4 mol% Nd2O3.
[0006] According to another aspect, a glass article is provided. The glass article comprises: the glass composition of any of the preceding aspect, wherein the glass-based article is characterized by a transmittance color coordinate: a* from greater than or equal to -6 to less than or equal to 16, andb* from greater than or equal to -22 to less than or equal to 91, measured with an F-02 illuminant at 10°.
[0007] Additional features and advantages of the colored glass articles described herein will be set forth in the detailed description which follows, and in part will be readily apparent to those skilled in the art from that description or recognized by practicing the embodiments described herein, including the detailed description which follows, the claims, as well as the appended drawings.
[0008] It is to be understood that both the foregoing general description and the following detailed description describe various embodiments and are intended to provide an overview or framework for understanding the nature and character of the claimed subject matter. The accompanying drawings are included to provide a further understanding of the various embodiments, and are incorporated into and constitute a part of this specification. The drawings illustrate the various embodiments described herein, and together with the description serve to explain the principles and operations of the claimed subject matter.
BRIEF DESCRIPTION OF THE DRAWINGS
[0009] FIG. 1 is a plan view of an electronic device incorporating any of the colored glass articles accordingto one or more embodiments described herein; and
[0010] FIG. 2 is a perspective view of the electronic device of FIG. 1 .
DETAILED DESCRIPTION
[0011] Reference will now be made in detail to various embodiments of glass compositions and colored glass articles formed therefrom having a desired color. According to embodiments, a glass composition includes greater than or equal to 50 mol% and less than or equal to 70 mol% SiO2; greater than or equal to 10 mol% and less than or equal to 20 mol% AbCh; greater than or equal to 1 mol% and less than or equal to 10 mol% B2C>3; greater than
or equal to 7 mol% and less than or equal to 14 mol% Li2O; greater than 0 mol% and less than or equal to 8 mol% Na2O; greater than or equal to 0 mol% and less than or equal to 1 mol% K2O; greater than or equal to 0 mol% and less than or equal to 7 mol% CaO; greater than or equal to 0 mol% and less than or equal to 8 mol% MgO; and at least one of: greater than 0 mol% to less than or equal to 4 mol% Er2O3, and greater than 0 mol% to less than or equal to 4 mol% Nd2O3. Various embodiments of colored glass articles and methods of making the same will be described herein with specific reference to the appended drawings.
[0012] Ranges may be expressed herein as from “about” one particular value, and/or to “about” another particular value. When such a range is expressed, another embodiment includes from the one particular value and/or to the other particular value. Similarly, when values are expressed as approximations, by use ofthe antecedent “about,” itwill be understood that the particular value forms another embodiment. It will be further understood that the endpoints of each of the ranges are significant both in relation to the other endpoint, and independently of the other endpoint.
[0013] Directional terms as used herein - for example up, down, right, left, front, back, top, bottom - are made only with reference to the figures as drawn and are not intended to imply absolute orientation.
[0014] Unless otherwise expressly stated, it is in no way intended that any method set forth herein be construed as requiring that its steps be performed in a specific order, nor that with any apparatus specific orientations be required. Accordingly, where a method claim does not actually recite an orderto be followed by its steps, orthatany apparatus claim doesnot actually recite an order or orientation to individual components, or it is not otherwise specifically stated in the claims or description that the steps are to be limited to a specific order, or that a specific order or orientation to components of an apparatus is not recited, it is in no way intended that an order or orientation be inferred, in any respect. This holds for any possible non-express basis for interpretation, including: matters of logic with respect to arrangement of steps, operational flow, order of components, or orientation of components; plain meaning derived from grammatical organization or punctuation, and; the number or type of embodiments described in the specification.
[0015] As used herein, the singular forms “a,” “an” and “the” include plural referents unless the context clearly dictates otherwise. Thus, for example, reference to “a” component includes aspects havingtwo or more such components, unlessthe context clearly indicates otherwise.
[0016] In the embodiments of the glass compositions and the resultant colored glass articles described herein, the concentrations of constituent components in oxide form (e.g., SiO2, A12O3, and the like) are specified in mole percent (mol%) on an oxide basis, unless otherwise specified.
[0017] The term “substantially free,” when used to describe the concentration and/or absence of a particular constituent component in a glass composition and the resultant colored glass article, means that the constituent component is not intentionally added to the glass composition and the resultant colored glass article. However, the glass composition and the colored glass article may contain traces of the constituent component as a contaminant or tramp, such as in amounts of less than 0.01 mol%, unless specified otherwise herein.
[0018] The terms “0 mol%” and “free,” when used to describe the concentration and/or absence of a particular constituent component in a glass composition, means that the constituent component is not present in the glass composition.
[0019] Surface compressive stress is measured with a surface stress meter (FSM) such as commercially available instruments such as the FSM-6000, manufactured by Orihara Industrial Co., Ltd. (Japan). Surface stress measurements rely upon the measurement of the stress optical coefficient (SOC), which is related to the birefringence of the glass article. SOC, in turn, is measured according to Procedure C (Glass Disc Method) described in ASTM standard C770-16, entitled “Standard Test Method for Measurement of Glass Stress-Optical Coefficient,” the contents of which are incorporated herein by reference in their entirety. Depth of compression (DOC) is also measured with the FSM. The maximum central tension (CT) values are measured using a scattered light polariscope (SCALP) technique known in the art.
[0020] The term “depth of compression” (DOC), as used herein, refers to the position in the article where compressive stress transitions to tensile stress.
[0021] The term “CIELAB color space,” as used herein, refers to a color space defined by the International Commission on Illumination (CIE) in 1976. It expresses color as three values:
L* for the lightness from black (0) to white (100), a* from green (-) to red (+), and B* from blue (-) to yellow (+).
[0022] The term “color gamut,” as used herein, refers to the pallet of colors that may be achieved by the colored glass articles within the CIELAB color space.
[0023] Colorants have been added to conventional aluminosilicate glass compositions to achieve a colored glass article having a desired color and improved mechanical properties. For example, transition metal oxides and/or rare earth oxides may be added. However, simply including colorants in aluminosilicate glass compositions may not produce the desired color and color stability, and/or result in in colored glass articles suitable for use in electronic devices.
[0024] Disclosed herein are glass compositions and colored glass articles formed therefrom that mitigate the aforementioned problems such that colored articles having the desired color while retaining the superior ion-exchangeability and drop performance of the colored glass articles. Specifically, the glass compositions disclosed herein include Er2O3 and/or Nd2O3 to achieve a desired color. Moreover, the glass compositions disclosed herein include provide a damage resistance and ion exchange capability that allow use in mobile electronic devices.
[0025] The glass compositions and colored glass articles described herein may be described as boroaluminosilicate glass compositions and colored glass articles and comprise SiO2, A12O3, B2O3, Li2O, Na2O, and at least one of E Ch and Nd2O3. The inclusion of alkali oxides in the glass compositions and colored glass articles described herein enables the ionexchangeability of the colored glass articles.
[0026] The glass compositions described herein are capable of forming colored glass articles with colors not previously achievable for materials with the fracture toughness and ion exchangeability that allows use in electronic devices. The glass compositions described herein can form colored glass articles without requiring a post-forming heat treatment to develop the desired color and also provide a high fracture toughness, avoiding the increased cost associated with post-forming heat treatments. The glass articles formed from the glass compositions may be ion exchanged to have a deep depth of compression and excellent fracture resistance. The glass compositions are capable of achieving a positive a* color space (orange, pink, red, purple) without the need for a post-forming heat treatment of the type necessary when utilizing Au, Ag, or Cu containing glasses to achieve these colors. The
positive a* color space (orange, pink, red, purple) is not achievable in other glass compositions in combination with the mechanical performance necessary for electronic device applications. Additional transition metal colorants, such as CeO2, TiO2, NiO, Co3O4, Cr2O3, and CuO, may be included in the glass to tune the color of the resulting glass articles, such as by altering the b* value.
[0027] The glass compositions described herein may be utilized to form colored glass articles for electronic devices, colored glass articles for electronic appliances, and art glass, among other applications.
[0028] SiO2 is the primary glass former in the glass compositions described herein and may function to stabilize the network structure of the colored glass articles. The concentration of SiO2 in the glass compositions and resultant colored glass articles should be sufficiently high (e.g., greater than or equal to 50 mol%) to enhance the chemical durability of the glass composition and, in particular, the resistance of the glass composition to degradation upon exposure to acidic solutions, basic solutions, and in water. The amount of SiO2 may be limited (e.g., to less than or equal to 70 mol%) to control the melting point of the glass composition, as the melting point of pure SiO2 or high SiO2 glasses is undesirably high. Thus, limitingthe concentration of SiO2 may aid in improving the meltability of the glass composition and the formability of the colored glass article.
[0029] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 50 mol% and less than or equal to 70 mol% SiO2, such as greater than or equal to 57 mol% and less than or equal to 63 mol% SiO2. In embodiments, the concentration of SiO2 in the glass composition and the colored glass article may be greater than or equal to 53 mol%, greater than or equal to 55 mol%, greater than or equal to 57 mol%, greater than or equal to 60 mol%, greater than or equal to 63 mol%, or more. In embodiments, the concentration of SiO2 in the glass composition and the colored glass article may be less than or equal to 65 mol%, less than or equal to 64 mol%, less than or equal to 63 mol%, or less. In embodiments, the concentration of SiO2 in the glass composition and the colored glass article may be greater than or equal to 50 mol% and less than or equal to 70 mol%, greater than or equal to 51 mol% and less than or equal to 69 mol%, greater than or equal to 52 mol% and less than or equal to 68 mol%, greater than or equal to 53 mol% and less than or equal to 67 mol%, greater than or equal to 54 mol% and less than or equal to 66 mol%, greater than or equal to 55 mol% and less than or equal to 65 mol%, greater than or equal to 56 mol% and
less than or equal to 64 mol%, greater than or equal to 57 mol% and less than or equal to 63 mol%, greater than or equal to 58 mol% and less than or equal to 62 mol%, greater than or equal to 59 mol% and less than or equal to 61 mol%, greater than or equal to 55 mol% and less than or equal to 60 mol%, or any and all sub-ranges formed from any of these endpoints.
[0030] Like SiO2, A12O3 may also stabilize the glass network and additionally provides improved mechanical properties and chemical durability to the glass composition and the colored glass article. The amount of A12O3 may also be tailored to control the viscosity of the glass composition. A12O3 may be included such that the resultant glass composition has the desired fracture toughness. However, if the amount of A12O3 is too high (e.g., greater than 20 mol%), the viscosity of the melt may increase, thereby diminishing the formability of the colored glass article.
[0031] Accordingly, in embodiments, the glass composition and the colored glass article may comprise greater than or equal to 10 mol% and less than or equal to 20 mol% A12O3, such as greater than or equal to 13 mol% and less than or equal to 17 mol% A12O3. In embodiments, the concentration of A12O3 in the glass composition and the colored glass article may be greater than or equal to 10 mol%, greater than or equal to 12 mol%, greater than or equal to 13 mol%, greater than or equal to 14 mol%, or more. In embodiments, the concentration of A12O3 in the glass composition and the colored glass article may be less than or equal to 17 mol%, less than or equal to 16 mol%, less than or equal to 15 mol%, less than or equal to 14 mol%, or less. In embodiments, the concentration of A12O3 in the glass composition and the resultant colored glass article may be greater than or equal to 10 mol% and less than or equal to 20 mol%, greater than or equal to 11 mol% and less than or equal to 19 mol% greater than or equal to 12 mol% and less than or equal to 18 mol%, greater than or equal to 13 mol% and less than or equal to 17 mol%, greater than or equal to 14 mol% and less than or equal to 16 mol%, greater than or equal to 13 mol% and less than or equal to 15 mol%, or any and all sub-ranges formed from any of these endpoints.
[0032] B2O3 decreases the melting point of the glass composition, which may improve the retention of certain colorants in the glass. B2O3 may also improve the damage resistance of the colored glass article. In addition, B2O3 is added to reduce the formation of non-bridging oxygen, the presence of which may reduce fracture toughness. The inclusion ofB2O3 reduces the melting point of the glass composition, improves the formability, and increases the fracture toughness of the colored glass article. However, if B2O3 is too high (e.g., greater than
10 mol%), the annealingpointand strain point may decrease, which increases stress relaxation and reduces the overall strength of the colored glass article.
[0033] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 1 mol% and less than or equal to 10 mol% B2O3, such as greater than or equal to 5 mol% and less than or equal to 7 mol% B2O3. In embodiments, the concentration of B2O3 in the glass composition and the colored glass article may be greater than or equal to 1 mol%, greater than or equal to 2 mol%, greater than or equal to 3 mol%, greater than or equal to 4 mol%, greater than or equal to 5 mol%, or more. In embodiments, the concentration of B2O3 in the glass composition and the colored glass article may be less than or equal to 10 mol%, less than or equal to 9 mol%, less than or equal to 8 mol%, less than or equal to 7 mol%, or less. In embodiments, the concentration of B2O3 in the glass composition and the resultant colored glass article may be greater than or equal to 1 mol% and less than or equal to 10 mol%, greater than or equal to 2 mol% and less than or equal to 9 mol%, greater than or equal to 3 mol% and less than or equal to 8 mol%, greater than or equal to 4 mol% and less than or equal to 7 mol%, greater than or equal to 5 mol% and less than or equal to 6 mol%, or any and all sub-ranges formed from any of these endpoints.
[0034] As described hereinabove, the glass compositions and the colored glass articles may contain alkali oxides, such as Li2O, Na2O, and K2O, to enable the ion-exchangeability of the colored glass articles.
[0035] Li2O aids in the ion-exchangeability of the colored glass article and also reduces the softening point of the glass composition, thereby increasing the formability of the colored glass articles. Li2O is also the most beneficial of the alkali metal oxides for the purposes of promoting color stability in the colored glass article. In addition, Li2O decreases the melting point of the glass composition, which may help improve retention of colorants in the glass. The concentration of Li2O in the glass compositions and resultant colored glass articles should be sufficiently high to reduce the melting point of the glass composition and achieve the desired maximum central tension. However, if the amount of Li2O is too high (e.g., greater than 16 mol%), the liquidus temperature may increase, thereby diminishing the manufacturability of the colored glass article.
[0036] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 7 mol% and less than or equal to 14 mol% Li2O, such as greater than
or equal to 8 mol% and less than or equal to 13 mol%Li2O. In embodiments, the concentration of Li2O in the glass composition and the colored glass article may be greater than or equal to 7 mol%, greater than or equal to 8 mol%, greater than or equal to 9 mol%, or more. In embodiments, the concentration ofLi2O in the glass composition and the colored glass article may be less than or equal to 14 mol%, less than or equal to 12 mol%, less than or equal to 10 mol%, or less. In embodiments, the concentration of Li2O in the glass composition and the resultant colored glass article may be greater than or equal to 1 mol% and less than or equal to 14 mol%, greater than or equal to 2 mol% and less than or equal to 13 mol%, greater than or equal to 3 mol% and less than or equal to 12 mol%, greater than or equal to 4 mol% and less than or equal to 11 mol%, greater than or equal to 5 mol% and less than or equal to 10 mol%, greater than or equal to 6 mol% and less than or equal to 9 mol%, greater than or equal to 7 mol% and less than or equal to 8 mol%, or any and all sub-ranges formed from any of these endpoints.
[0037] Na2O improves diffusivity of alkali ions in the glass and thereby reduces ion-exchange time and helps achieve the desired surface compressive stress (e.g., greater than or equal to 300 MPa). Na2O also improves formability of the colored glass article. In addition, Na2O decreases the melting point of the glass composition, which may help improve colorant retention. However, if too much Na2O is added to the glass composition, the melting point may be too low. As such, in embodiments, the concentration of Li2O present in the glass composition and the colored glass article may be greater than the concentration of Na2O present in the glass composition and the colored glass article.
[0038] In embodiments, the glass composition and the colored glass article may comprise greater than 0 mol% and less than or equal to 8 mol% Na2O, such as greater than or equal to 0.1 mol% and less than or equal to 8 mol% Na2O, or greater than or equal to 1 mol% and less than or equal to 7 mol% Na2O. In embodiments, the concentration of Na2O in the glass composition and the colored glass article may be greater than 0 mol%, greater than or equal to 0.1 mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, or more. In embodiments, the concentration of Na2O in the glass composition and the colored glass article may be less than or equal to 8 mol%, less than or equal to 7 mol%, less than or equal to 6 mol%, less than or equal to 5 mol%, less than or equal to 4 mol%, less than or equal to 3 mol%, or less. In embodiments, the concentration of Na2O in the glass composition and the resultant colored glass article may be greater than 0 mol% and less than or equal to 8 mol%,
greater than or equal to 0. 1 mol% and less than or equal to 7 mol%, greater than or equal to 0.5 mol% and less than or equal to 6 mol%, greater than or equal to 1 mol% and less than or equal to 5 mol%, greater than or equal to 2 mol% and less than or equal to 4 mol%, greater than or equal to 3 mol% and less than or equal to 7 mol%, or any and all sub-ranges formed from any of these endpoints.
[0039] K2O promotes ion-exchange and may increase the depth of compression and decrease the melting point to improve the formability of the colored glass article. However, adding too much K2O may cause the surface compressive stress and melting point to be too low. Accordingly, in embodiments, the amount of K2O added to the glass composition may be limited.
[0040] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 0 mol% and less than or equal to 1 mol% K2O, such as greater than 0 mol% and less than or equal to 1 mol% K2O, or greater than or equal to 0.1 mol% and less than or equal to 1 mol% K2O. In embodiments, the concentration of K2O in the glass composition and the colored glass article may be greater than 0 mol%, greater than or equal to 0.1 mol%, greater than or equal to 0.2 mol%, or more. In embodiments, the concentration of K2O in the glass composition and the colored glass article may be less than or equal to 1 mol%, less than or equal to 0.7 mol%, less than or equal to 0.5 mol%, or less. In embodiments, the concentration of K2O in the glass composition and the resultant colored glass article may be greater than or equal to 0 mol% and less than or equal to 1 mol%, greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greaterthan or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or any and all sub-ranges formed from any of these endpoints.
[0041] In embodiments, the glass compositions and the colored glass articles described herein may further comprise CaO. CaO lowers the viscosity of a glass composition, which enhances the formability, the strain point and the Young’s modulus, and may improve the ionexchangeability. However, when too much CaO is added to the glass composition, the diffusivity of sodium and potassium ions in the glass composition decreases which, in turn, adversely impacts the ion-exchange performance (i.e., the ability to ion-exchange) of the resultant glass.
[0042] In embodiments, the concentration of CaO in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 7 mol%, such as greater than or equal to 0 mol% and less than or equal to 5 mol%. In embodiments, the concentration of CaO in the glass composition and the colored glass article may be greater than or equal to 0 mol%, greater than 0 mol%, greater than or equal to 0.1 mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, or more. In embodiments, the concentration of CaO in the glass composition and the colored glass article may be less than or equal to 6 mol%, less than or equal to 5 mol%, less than or equal to 4 mol%, less than or equal to 3 mol%, less than or equal to 2 mol%, or less. In embodiments, the concentration of CaO in the glass composition and the resultant colored glass article may be greater than or equal to 0 mol% and less than or equal to 7 mol%, greater than 0 mol% and less than or equal to 6 mol%, greater than or equal to 0. 1 mol% and less than or equal to 5 mol%, greater than or equal to 0.5 mol% and less than or equal to 4 mol%, greater than or equal to 1 mol% and less than or equal to 3 mol%, greater than or equal to 1 mol% and less than or equal to 2 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition and the colored glass article may be substantially free or free of CaO.
[0043] In embodiments, the glass compositions and the colored glass articles described herein may further comprise MgO. MgO lowers the viscosity of the glass compositions, which enhances the formability, the strain point, and the Young’s modulus, and may improve ionexchangeability. However, when too much MgO is added to the glass composition, the diffusivity of sodium and potassium ions in the glass composition decreases which, in turn, adversely impacts the ion-exchange performance (i.e., the ability to ion-exchange) of the colored glass article.
[0044] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 0 mol% and less than or equal to 8 mol% MgO, such as greater than or equal to 0 mol% and less than or equal to 2 mol% MgO. In embodiments, the concentration of MgO in the glass composition may be greater than or equal to 0 mol%, greater than or equal to O. l mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, greater than or equal to 2 mol%, or more. In embodiments, the concentration of MgO in the glass composition may be less than or equal to 8 mol%, less than or equal to 7 mol%, less than or equal to 6 mol%, less than or equal to 5 mol%, less than or equal to 4 mol%, less than or equal to 3 mol%, or less. In embodiments, the concentration of MgO in the glass composition may
be greater than or equal to 0 mol% and less than or equal to 8 mol%, greater than 0 mol% and less than or equal to 7 mol%, greater than or equal to 0. 1 mol% and less than or equal to 6 mol%, greater than or equal to 0.5 mol% and less than or equal to 5 mol%, greater than or equal to 1 mol% and less than or equal to 4 mol%, greater than or equal to 2 mol% and less than or equal to 3 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition and the colored glass article may be substantially free or free of MgO.
[0045] In embodiments, the glass compositions and the colored glass articles described herein may further comprise ZnO. ZnO lowers the viscosity of the glass compositions, which enhances the formability, the strain point, and the Young’s modulus, and may improve ionexchangeability. However, when too much ZnO is added to the glass composition, the diffusivity of sodium and potassium ions in the glass composition decreases which, in turn, adversely impacts the ion-exchange performance (i.e., the ability to ion-exchange) of the colored glass article.
[0046] In embodiments, the glass composition and the colored glass article may comprise greater than or equal to 0 mol% and less than or equal to 8 mol% ZnO, such as greater than or equal to 0 mol% and less than or equal to 1 mol% ZnO. In embodiments, the concentration of ZnO in the glass composition may be greater than or equal to 0 mol%, greater than 0 mol%, greater than or equal to 0. 1 mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, or more. In embodiments, the concentration of ZnO in the glass composition may be less than or equal to 8 mol%, less than or equal to 3 mol%, less than or equal to 2 mol%, less than or equal to 1 mol%, or less. In embodiments, the concentration of ZnO in the glass composition may be greater than or equal to 0 mol% and less than or equal to 8 mol%, greater than 0 mol% and less than or equal to 7 mol%, greater than or equal to 0. 1 mol% and less than or equal to 6 mol%, greater than or equal to 0.5 mol% and less than or equal to 5 mol%, greater than or equal to 1 mol% and less than or equal to 4 mol%, greater than or equal to 2 mol% and less than or equal to 3 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition and the colored glass article may be substantially free or free of ZnO.
[0047] The glass compositions include at least one of Er2O3 and Nd2O3 as colorants for the purposes of providing the desired color. The inclusion of Er2O3 and Nd2O3 in the glass compositions allows colors to be achieved that are not possible with other transition metal
colorants and do notrequire apost-formingheattreatmentto achievethe desired colors, unlike some glasses that utilize Au, Ag, or Cu as colorants. The Er2O3 and Nd2O3 may also be combined with other colorants to tune the color of the colored glass article.
[0048] In embodiments, the glass compositions include Er2O3 in an amount greater than or equal to 0 mol% to less than or equal to 4 mol%, such as greater than 0 mol% to less than or equal to 4 mol%, or greater than or equal to 0.1 mol% to less than or equal to 2 mol%. In embodiments, the glass compositions include E Ch in an amount greater than or equal to 0 mol%, greater than 0 mol%, greater than or equal to 0.1 mol%, greater than or equal to 0.2 mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, or more. In embodiments, the glass compositionsincludeEr2O3 in an amount less than or equal to 4 mol%, less than or equal to 3 mol%, less than or equal to 2 mol%, less than or equal to 1 mol%, less than or equal to 0.5 mol%, or less. In embodiments, the glass compositions include Er2O3 in an amount greater than or equal to 0 mol% to less than or equal to 4 mol%, greater than 0 mol% to less than or equal to 3.5 mol%, greater than or equal to 0. 1 mol% to less than or equal to 3 mol%, greater than or equal to 0.2 mol% to less than or equal to 2.5 mol%, greater than or equal to 0.3 mol% to less than or equal to 2 mol%, greater than or equal to 0.4 mol% to less than or equal to 1.9 mol%, greater than or equal to 0.5 mol% to less than or equal to 1.8 mol%, greater than or equal to 0.6 mol%to less than or equal to 1.7 mol%, greater than or equal to 0.7 mol% to less than or equal to 1 .6 mol%, greater than or equal to 0.8 mol% to less than or equal to 1.5 mol%, greater than or equal to 0.9 mol% to less than or equal to 1.4 mol%, greater than or equal to 1.0 mol% to less than or equal to 1 .3 mol%, greater than or equal to 1.1 mol% to less than or equal to 1.2 mol%, or any and all sub-ranges formed from the foregoing endpoints. In embodiments, the glass compositions may be substantially free or free of Er2O3.
[0049] In embodiments, the glass compositions include Nd2O3 in an amount greater than or equal to 0 mol% to less than or equal to 4 mol%, such as greater than 0 mol% to less than or equal to 4 mol%, or greater than or equal to 0.1 mol% to less than or equal to 3 mol%. In embodiments, the glass compositions include Nd2O3 in an amount greater than or equal to 0 mol%, greater than 0 mol%, greater than or equal to 0.1 mol%, greater than or equal to 0.2 mol%, greater than or equal to 0.5 mol%, greater than or equal to 1 mol%, or more. In embodiments, the glass compositions include Nd2C>3 in an amount less than or equal to 4 mol%, less than or equal to 3 mol%, less than or equal to 2 mol%, less than or equal to
1 mol%, less than or equal to 0.5 mol%, or less. In embodiments, the glass compositions include Nd2O3 in an amount greater than or equal to 0 mol% to less than or equal to 4 mol%, greater than 0 mol% to less than or equal to 3.5 mol%, greater than or equal to 0.1 mol% to less than or equal to 3 mol%, greater than or equal to 0.2 mol% to less than or equal to 2.5 mol%, greater than or equal to 0.3 mol%to less than or equal to 2 mol%, greater than or equal to 0.4 mol% to less than or equal to 1.9 mol%, greater than or equal to 0.5 mol% to less than or equal to 1.8 mol%, greater than or equal to 0.6 mol% to less than or equal to 1 .7 mol%, greater than or equal to 0.7 mol% to less than or equal to 1.6 mol%, greater than or equal to 0.8 mol% to less than or equal to 1 .5 mol%, greater than or equal to 0.9 mol% to less than or equal to 1.4 mol%, greaterthan or equal to 1.0 mol%to less than or equal to 1.3 mol%, greater than or equal to 1 .1 mol% to less than or equal to 1 .2 mol%, or any and all sub-ranges formed from the foregoing endpoints. In embodiments, the glass compositions may be substantially free or free of Nd2O3.
[0050] The glass compositions may include additional transition metals as part of the colorant package, in addition to the Er2O3 and/or Nd2O3 described above. A color package including TiO2 and CeO2 in addition to Er2O3 (TiO2+CeO2+Er2O3) may be employed to achieve a color in the orange, orange-pink, and pink range. A color package including NiO, Co3O4, Cr2O3, and CuO in addition to Er2O3 (NiO+Co3O4+Cr2O3+CuO +Er2O3) or NiO, Co3O4, Cr2O3, and CuO in addition to Nd2O3 (NiO+Co3O4+Cr2O3+CuO+Nd2O3) may be employed to achieve a color in the orange, orange-pink, pink, red, and purple range.
[0051] The glass composition and the colored glass article may include TiO2. The TiO2 may act as an additional colorant. In embodiments, the concentration of TiO2 in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 5 mol%, such as greater than or equal to 0.5 mol% and less than or equal to 4.5 mol%, greater than or equal to 1 mol% and less than or equal to 4 mol%, greater than or equal to 1.5 mol% and less than or equal to 3.5 mol%, greater than or equal to 2 mol% and less than or equal to 3 mol%, greater than or equal to 1 mol% and less than or equal to 2.5 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition maybe substantially free or free of TiO2.
[0052] The glass composition and the colored glass article may include CeO2. The CeO2 may act as an additional colorant. In embodiments, the concentration of CeO2 in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than
or equal to 1 mol%, such as greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greater than or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition may be substantially free or free of CeO2.
[0053] The glass composition and the colored glass article may include NiO. The NiO may act as an additional colorant. In embodiments, the concentration of NiO in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 1 mol%, such as greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greater than or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition may be substantially free or free of NiO.
[0054] The glass composition and the colored glass article may include CuO. The CuO may act as an additional colorant. In embodiments, the concentration of CuO in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 1 mol%, such as greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greater than or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition may be substantially free or free of NiO.
[0055] The glass composition and the colored glass article may include Co3O4. The Co3O4 may act as an additional colorant. In embodiments, the concentration of Co3O4 in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 1 mol%, such as greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greater than or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or
any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition may be substantially free or free of CO3O4.
[0056] The glass composition and the colored glass article may include Cr2O3. The Cr2O3 may act as an additional colorant. In embodiments, the concentration of Cr2O3 in the glass composition and the colored glass article may be greater than or equal to 0 mol% and less than or equal to 1 mol%, such as greater than 0 mol% and less than or equal to 0.9 mol%, greater than or equal to 0.1 mol% and less than or equal to 0.8 mol%, greater than or equal to 0.2 mol% and less than or equal to 0.7 mol%, greater than or equal to 0.3 mol% and less than or equal to 0.6 mol%, greater than or equal to 0.4 mol% and less than or equal to 0.5 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition may be substantially free or free of Cr2O3.
[0057] The glass compositions and the colored glass articles described herein may further comprise Fe2O3, which may help improve colorant retention. In embodiments, the concentration of Fe2O3 in the glass composition may be less than or equal to 0.1 mol%, such as greater than or equal to 0 mol% and less than or equal to 0. 1 mol%, greater than 0 mol% and less than or equal to 0.05 mol%, greater than or equal to 0.001 mol% and less than or equal to 0.1 mol%, greater than or equal to 0.01 mol% and less than or equal to 0.1 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition and the colored glass article may be substantially free or free ofFe2O3.
[0058] The glass compositions and the colored glass articles described herein may further comprise SnO2. The SnO2 in the glass compositions may be added as a fining agent. In embodiments, the concentration of SnO2 in the glass composition and the colored glass article may be greater than or equal to 0 mol%, greater than or equal to 0.01 mol%, or more. In embodiments, the concentration of SnO2 in the glass composition and the colored glass article may be less than or equal to 0.5 mol%, less than or equal to 0.2 mol%, less than or equal to 0.1 mol%, or less. In embodiments, the concentration of SnO2 in the glass composition and the resultant colored glass article may be greater than or equal to 0 mol% and less than or equal to 0.5 mol%, greater than 0 mol% and less than or equal to 0.5 mol%, greater than or equal to 0.001 mol% and less than or equal to 0.5 mol%, greaterthan or equal to 0.01 mol% and less than or equal to 0.2 mol%, greaterthan or equal to 0 mol% and less than or equal to 0.05 mol%, or any and all sub-ranges formed from any of these endpoints. In embodiments, the glass composition and the colored glass article may be substantially free or free of SnO2.
[0059] The glass compositions described herein may be formed into a colored glass article by any appropriate forming process. In embodiments, the glass compositions are formed into a colored glass article by a roll forming process. The roll forming process may include rolling the glass composition to form a rolled glass article, and then cooling the rolled glass article to form a colored glass article. In particular, roll forming processes with quenching times in the range of 30 seconds to 200 seconds may be employed.
[0060] In embodiments, the process for making a glass article may include heat treating a glass composition described herein at one or more preselected temperatures for one or more preselected times to induce glass homogenization. In embodiments, the heat treatment for making a glass article may include (i) heating a glass composition at a rate of 1-100 °C/min to glass homogenization temperature; (ii) maintaining the glass composition at the glass homogenization temperature for a time greater than or equal to 0.25 hour and less than or equal to 4 hours to produce a glass article; and (iii) cooling the formed glass article to room temperature. In embodiments, the glass homogenization temperature may be greater than or equal to 300 °C and less than or equal to 700 °C. In embodiments, the formed glass article may be a colored glass article such that additional heat treatment is not necessary.
[0061] The colored glass articles formed from the glass compositions described herein may be any suitable thickness, which may vary depending on the particular application of the colored glass article. In embodiments, the colored glass articles may have a thickness greater than or equal to 250 pm and less than or equal to 6 mm, greater than or equal to 250 pm and less than or equal to 4 mm, greater than or equal to 250 pm and less than or equal to 2 mm, greater than or equal to 250 pm and less than or equal to 1 mm, greater than or equal to 250 pm and less than or equal to 750 pm, greater than or equal to 250 pm and less than or equal to 500 pm, greater than or equal to 500 pm and less than or equal to 6 mm, greater than or equal to 500 pm and less than or equal to 4 mm, greater than or equal to 500 pm and less than or equal to 2 mm, greater than or equal to 500 pm and less than or equal to 1 mm, greater than or equal to 500 pm and less than or equal to 750 pm, greater than or equal to 750 pm and less than or equal to 6 mm, greater than or equal to 750 pm andless than or equal to 4 mm, greater than or equal to 750 pm and less than or equal to 2 mm, greater than or equal to 750 pm and less than or equal to 1 mm, greater than or equal to 1 mm and less than or equal to 6 mm, greater than or equal to 1 mm and less than or equal to 4 mm, greater than or equal to 1 mm and less than or equal to 2 mm, greater than or equal to 2 mm and less than or equal to 6 mm,
greater than or equal to 2 mm and less than or equal to 4 mm, or even greater than or equal to 4 mm and less than or equal to 6 mm, or any and all sub-ranges formed from any of these endpoints.
[0062] As discussed hereinabove, colored glass articles formed from the glass compositions described herein may have an increased fracture toughness such that the colored glass articles are more resistant to damage. In embodiments, the colored glass article may have a KJC fracture toughness as measured by a chevron notch short bar method greater than or equal to 0.7 MPa m1/2, greater than or equal to 0.8 MPa m1/2, greater than or equal to 0.9 MPa m172, or even greater than or equal to 1.0 MPa m1/2.
[0063] In embodiments, the glass compositions described herein are ion-exchangeable to facilitate strengthening the colored glass article made from the glass compositions. In typical ion-exchange processes, smaller metal ions in the glass compositions are replaced or “exchanged” with larger metal ions of the same valence within a lay er that is close to the outer surface of the colored glass article made from the glass composition. The replacement of smaller ions with larger ions creates a compressive stress within the layer of the colored glass article made from the glass composition. In embodiments, the metal ions are mon oval ent metal ions (e.g., Li+, Na+, K+, and the like), and ion-exchange is accomplished by immersing the glass article made from the glass composition in a bath comprising at least one molten salt of the larger metal ion that is to replace the smaller metal ion in the colored glass article. Alternatively, other monovalent ions such as Ag+, Tl+, Cu+, and the like may be exchanged for monovalent ions. The ion-exchange process or processes that are used to strengthen the colored glass article made from the glass composition may include contacting the colored glass article with an ion-exchange medium. In embodiments, the ion-exchange medium may be a molten salt bath. For example, the ion-exchange process may include, but is not limited to, immersion in a single bath or multiple baths of like or different compositions with optional washing and/or annealing steps between immersions.
[0064] Upon exposure to the colored glass article, the ion-exchange solution (e.g., KN03 and/or NaNO3 molten salt bath) may, according to embodiments, be at a temperature greater than or equal to 350 °C and less than or equal to 500 °C, greater than or equal to 360 °C and less than or equal to 450 °C, greater than or equal to 370 °C and less than or equal to 440 °C, greater than or equal to 360 °C and less than or equal to 420 °C, greater than or equal to 370 °C and less than or equal to 400 °C, greater than or equal to 375 °C and less than or equal to
475 °C, greater than or equal to 400 °C and less than or equal to 500 °C, greater than or equal to 410 °C and less than or equal to 490 °C, greater than or equal to 420 °C and less than or equal to 480 °C, greater than or equal to 430 °C and less than or equal to 470 °C, or even greater than or equal to 440 °C and less than or equal to 460 °C, or any and all sub-ranges between the foregoing values. In embodiments, the colored glass article may be exposed to the ion-exchange solution for a duration greater than or equal to 2 hours and less than or equal to 24 hours, greater than or equal to 2 hours and less than or equal to 12 hours, greater than or equal to 2 hours and less than or equal to 6 hours, greater than or equal to 8 hours and less than or equal to 24 hours, greater than or equal to 6 hours and less than or equal to 24 hours, greater than or equal to 6 hours and less than or equal to 12 hours, greater than or equal to 8 hours and less than or equal to 24 hours, or even greater than or equal to 8 hours and less than or equal to 12 hours, or any and all sub-ranges formed from any of these endpoints.
[0065] In embodiments, a colored glass article made from a glass composition may be ion- exchanged to achieve a depth of compression of greater than or equal to 30 pm, greater than or equal to 40 pm, greater than or equal to 50 pm, greater than or equal to 60 pm, greater than or equal to 70 pm, greater than or equal to 80 pm, greater than or equal to 90 pm, greater than or equal to 100 pm, or more. In embodiments, the colored glass article made from the glass composition may have a thickness “t” and may be ion-exchanged to achieve a depth of compression greater than or equal to O. lt, greater than or equal to 0.15t, greater than or equal to 0.2t, or more. In embodiments, the colored glass article made from the glass composition described herein may have a thickness “t” and may be ion-exchanged to achieve a depth of compression greater than or equal to O. lt and less than or equal to 0.3t, greater than or equal to 0.15t and less than or equal to 0.25t, or any and all sub-ranges formed from any of these endpoints.
[0066] The development of this surface compression layer is beneficial for achieving a better crack resistance and higher flexural strength compared to non-ion-exchanged materials. The surface compression layer has a higher concentration of the ions exchanged into the colored glass article in comparison to the concentration of the ions exchanged into the colored glass article forthe body (i.e., the area not including the surface compression) of the colored glass article. In embodiments, the colored glass article made from the glass composition may have a surface compressive stress after ion-exchange strengthening greater than or equal to 300 MPa, greater than or equalto400 MPa, greater than or equal to 500MPa, greater than or equal
to 600 MPa, or more. In embodiments, the colored glass article made from the glass composition may have a surface compressive stress after ion-exchange strengthening greater than or equal to 300 MPa and less than or equal to 1.5 GPa, greater than or equal to 300 MPa and less than or equal to 1 GPa, greater than or equal to 400 MPa and less than or equal to 900 MPa, greater than or equal to 500 MPa and less than or equal to 800 MPa, greater than or equal to 600 MPa and less than or equal to 700 MPa, or any and all sub-ranges formed from any of these endpoints.
[0067] In embodiments, the colored glass articles made from the glass composition may have a central tension after ion-exchange strengthening greater than or equal to 40 MPa, greater than or equal to 60 MPa, greater than or equal to 80 MPa, greater than or equal to 100 MPa, or more. In embodiments, the colored glass article made from the glass composition may have a central tension after ion-exchange strengthening less than or equal to 250 MPa, less than or equal to 200 MPa, less than or equal to 150 MPa, or less. In embodiments, the colored glass article made from the glass composition may have a central tension after ion-exchange strengthening greater than or equal to 40 MPa and less than or equal to 250 MPa, greater than or equal to 40 MPa and less than or equal to 200 MPa, greater than or equal to 40 MPa and less than or equal to 150 MPa, greater than or equal to 60 MPa and less than or equal to 250 MPa, greater than or equal to 60 MPa and less than or equal to 200 MPa, greater than or equal to 60 MPa and less than or equal to 150 MPa, greater than or equal to 80 MPa and less than or equal to 250 MPa, greater than or equal to 80 MPa and less than or equal to 200 MPa, greater than or equal to 80 MPa and less than or equal to 150 MPa, greater than or equal to 100 MPa and less than or equal to 250 MPa, greater than or equal to 100 MPa and less than or equal to 200 MPa, or even greater than or equal to 100 MPa and less than or equal to 150 MPa, or any and all sub-ranges formedfrom any ofthese endpoints. As utilized herein, central tension refers to a maximum central tension value unless otherwise indicated.
[0068] As described herein, the glass compositions described herein include a colorant that comprises or consists of transition metal oxides, rare earth oxides, or combinations thereof, to achieve a desired color. In embodiments, a colored glass article may have a transmittance color coordinate in the CIELAB color space, under F2 illumination and a 10° standard observer angle, of L* greater than or equal to 60 and less than or equal to 98, a* greater than or equal to -6.0 and less than or equal to 16, and b* greater than or equal to -22.0 and less than or equal to 91. In embodiments, a colored glass article may have a transmittance color
coordinate in the CIELAB color space, under F2 illumination and a 10° standard observer angle, of a* greater than or equal to -6 and less than or equal to 16, and b* greater than or equal to -22 and less than or equal to 91. The glass compositions described herein are capable of achieving low magnitude negative a* values in combination with high magnitude negative b* values that are not achievable with transition metal colorants alone.
[0069] In embodiments, a colored glass article may have a transmittance color coordinate in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle, of L* greater than or equal to 60 and less than or equal to 98, such as greater than or equal to 70 and less than or equal to 96, greater than or equal to 80 and less than or equal to 94, greater than or equal to 85 and less than or equal to 93, greater than or equal to 90 and less than or equal to 92, or any and all sub-ranges formed from any of these endpoints.
[0070] In embodiments, a colored glass article may have a transmittance color coordinate in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle, of a* greater than or equal to -6 and less than or equal to 16, such as greater than or equal to -5 and less than or equal to 15, greater than or equal to -4 and less than or equal to 14, greater than or equal to -3 and less than or equal to 13 , greater than or equal to -2 and less than or equal to 12, greater than or equal to -1 and less than or equal to 11, greater than or equal to 0 and less than or equal to 10, greater than or equal to 1 and less than or equal to 9, greater than or equal to 2 and less than or equal to 8, greater than or equal to 3 and less than or equal to 7, greater than or equal to 4 and less than or equal to 6, greater than or equal to 1 and less than or equal to 5, or any and all sub-ranges formed from any of these endpoints. The glass compositions described herein are capable of achieving high magnitude positive a* colors that are not achievable with transition metal colorants alone.
[0071] In embodiments, a colored glass article may have a transmittance color coordinate in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle, of b* greater than or equal to -22 and less than or equal to 91, such as greater than or equal to -20 and less than or equal to 90, greater than or equal to -15 and less than or equal to 85, greater than or equal to -10 and less than or equal to 80, greater than or equal to -5 and less than or equal to 75, greater than or equal to 0 and less than or equal to 70, greaterthan or equal to 5 and less than or equal to 65, greater than or equal to 10 and less than or equal to 60, greater than or equal to 15 and less than or equal to 55, greater than or equal to 20 and less than or equal to 50, greater than or equal to 25 and less than or equal to 45, greater than or
equal to 30 and less than or equal to 40, greater than or equal to 0 and less than or equal to 35, or any and all sub-ranges formed from any of these endpoints.
[0072] The colored glass articles described herein may be used for a variety of applications including, for example, backcover applications in consumer or commercial electronic devices such as smartphones, tablet computers, personal computers, ultrabooks, televisions, and cameras. An exemplary article incorporating any of the colored glass articles disclosed herein is shown in FIGS. 1 and 2. Specifically, FIGS. 1 and 2 show a consumer electronic device 100 including a housing 102 having front 104, back 106, and side surfaces 108; electrical components (not shown) that are at least partially inside or entirely within the housing and including at least a controller, a memory, and a display 110 at or adjacent to the front surface of the housing; and a cover substrate 112 at or over the front surface of the housing such that it is over the display. In embodiments, at least a portion of housing 102, such as the back 106, may include any of the colored glass articles disclosed herein.
Examples
[0073] In order that various embodiments be more readily understood, reference is made to the following examples, which illustrate various embodiments of the colored glass articles described herein.
[0074] Table 1 shows the analyzed compositions of exemplary colored glass articles (in terms of mol%). The density, thickness, and transmittance color coordinates in the CIELAB color space, as measured under F2 illumination and a 10° standard observer angle are also reported in Table I.
Table I
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
Table I (cont.)
[0075] It will be apparent to those skilled in the art that various modifications and variations may be made to the embodiments described herein without departing from the spirit and scope of the claimed subject matter. Thus, itis intended thatthe specification cover the modifications and variations of the various embodiments described herein provided such modification and variations come within the scope of the appended claims and their equivalents.
Claims
1 . A glass composition comprising: greater than or equal to 50 mol% and less than or equal to 70 mol% SiO2; greater than or equal to 10 mol% and less than or equal to 20 mol% A12O3; greater than or equal to 1 mol% and less than or equal to 10 mol% B2O3; greater than or equal to 7 mol% and less than or equal to 14 mol% Li2O; greater than 0 mol% and less than or equal to 8 mol% Na2O; greater than or equal to 0 mol% and less than or equal to 1 mol% K2O; greater than or equal to 0 mol% and less than or equal to 7 mol% CaO; greater than or equal to 0 mol% and less than or equal to 8 mol% MgO; and at least one of: greater than 0 mol% to less than or equal to 4 mol% Er2O3, and greater than 0 mol% to less than or equal to 4 mol% Nd2O3.
2. The glass composition of claim 1, comprising greater than 0 mol% to less than or equal to 4 mol% Er2O3.
3. The glass composition of any of the preceding claims, comprising greater than or equal to 0.1 mol% to less than or equal to 2 mol% Er2O3.
4. The glass composition of any ofthe preceding claims, comprising greater than 0 mol% to less than or equal to 4 mol% Nd2O3.
5. The glass composition of any of the preceding claims, comprising greater than or equal to 0.1 mol% to less than or equal to 3 mol% Nd2O3.
6. The glass composition of any ofthe preceding claims, comprising greater than 0 mol% and less than or equal to 1 mol% K2O.
7. The glass composition of any ofthe preceding claims, comprising greater than or equal to 0.1 mol% and less than or equal to 1 mol% K2O.
8. The glass composition of any of the preceding claims, comprising greater than or equal to 8 mol% and less than or equal to 13 mol% Li2O.
9. The glass composition of any of the preceding claims, comprising greater than or equal to 0.1 mol% and less than or equal to 8 mol% Na2O.
10. The glass composition of any ofthe preceding claims, comprising greater than or equal to 1 mol% and less than or equal to 7 mol% Na2O.
11. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 8 mol% ZnO.
12. The glass composition of any ofthe preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 1 mol% ZnO.
13. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 2 mol% MgO.
14. The glass composition of any ofthe preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 5 mol% CaO.
15. The glass composition of any of the preceding claims, comprising greater than or equal to 57 mol% and less than or equal to 63 mol% SiO2.
16. The glass composition of any ofthe preceding claims, comprising greater than or equal to 13 mol% and less than or equal to 17 mol% A12O3.
17. The glass composition of any ofthe preceding claims, comprising greater than or equal to 5 mol% and less than or equal to 7 mol% B2O3.
18. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 5 mol% TiO2.
19. The glass composition of any ofthe preceding claims, comprising greater than or equal to 0 mol% and less than or equal to 1 mol% CeO2.
20. The glass composition of any of the preceding claims, comprising less than or equal to 0.1 mol% Fe2O3.
21. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% to less than or equal to 1 mol% NiO.
22. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% to less than or equal to 1 mol% CuO.
23. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% to less than or equal to 1 mol% Co3O4.
24. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% to less than or equal to 1 mol% Cr2O3.
25. The glass composition of any of the preceding claims, comprising greater than or equal to 0 mol% to less than or equal to 0.5 mol% SnO2.
26. A glass-based article, comprising: the glass composition of any of the preceding claims, wherein the glass-based article is characterized by a transmittance color coordinate: a* from greater than or equal to -6 to less than or equal to 16, and b * from greater than or equal to -22 to less than or equal to 91 , measured with an F-02 illuminant at 10°.
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US202263347201P | 2022-05-31 | 2022-05-31 | |
| US63/347,201 | 2022-05-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| WO2023235212A1 true WO2023235212A1 (en) | 2023-12-07 |
Family
ID=87994926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PCT/US2023/023493 WO2023235212A1 (en) | 2022-05-31 | 2023-05-25 | Glass compositions and colored glass articles formed therefrom |
Country Status (2)
| Country | Link |
|---|---|
| CN (2) | CN116783151A (en) |
| WO (1) | WO2023235212A1 (en) |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6374641B1 (en) * | 1997-06-23 | 2002-04-23 | Corning Incorporated | Method of making an optical fiber by melting particulate glass in a glass cladding tube |
| WO2023107409A1 (en) * | 2021-12-06 | 2023-06-15 | Corning Incorporated | Glass compositions for forming colored glass articles and glass articles formed therefrom |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20130136909A1 (en) * | 2011-11-30 | 2013-05-30 | John Christopher Mauro | Colored alkali aluminosilicate glass articles |
| WO2013130668A1 (en) * | 2012-02-29 | 2013-09-06 | Corning Incorporated | High cte opal glass compositions and glass articles comprising the same |
| KR102618609B1 (en) * | 2014-12-11 | 2023-12-27 | 코닝 인코포레이티드 | X-Ray Induced Coloration In Glass Or Glass-Ceramic Articles |
| EP3452421A1 (en) * | 2016-05-04 | 2019-03-13 | Corning Incorporated | Tinted aluminosilicate glass compositions and glass articles including same |
| US11053159B2 (en) * | 2017-12-13 | 2021-07-06 | Corning Incorporated | Polychromatic articles and methods of making the same |
| WO2020243123A1 (en) * | 2019-05-29 | 2020-12-03 | Corning Incorporated | Colored glass-ceramics having petalite and lithium silicate structures |
-
2022
- 2022-06-17 CN CN202280011103.0A patent/CN116783151A/en active Pending
- 2022-06-17 CN CN202311033281.6A patent/CN117069373A/en active Pending
-
2023
- 2023-05-25 WO PCT/US2023/023493 patent/WO2023235212A1/en unknown
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6374641B1 (en) * | 1997-06-23 | 2002-04-23 | Corning Incorporated | Method of making an optical fiber by melting particulate glass in a glass cladding tube |
| WO2023107409A1 (en) * | 2021-12-06 | 2023-06-15 | Corning Incorporated | Glass compositions for forming colored glass articles and glass articles formed therefrom |
Also Published As
| Publication number | Publication date |
|---|---|
| CN117069373A (en) | 2023-11-17 |
| CN116783151A (en) | 2023-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20220002187A1 (en) | Ion exchangeable li-containing glass compositions for 3-d forming | |
| JP7179865B2 (en) | Microcrystalline glass, microcrystalline glass product, and method for producing same | |
| US11840475B2 (en) | Colored glass-ceramics having petalite and lithium silicate structures | |
| CN115385571B (en) | Chemically strengthened glass and chemically strengthened glass | |
| US20210009462A1 (en) | Glass for chemical strengthening | |
| JP2022050889A (en) | Crystallized glass and reinforced crystallized glass | |
| WO2022049823A1 (en) | Crystallized glass and chemically strengthened glass | |
| JP2022044041A (en) | Crystallized glass and chemically strengthened glass | |
| WO2023235212A1 (en) | Glass compositions and colored glass articles formed therefrom | |
| US20220402804A1 (en) | Gold containing silicate glass | |
| US20220048809A1 (en) | Glass, chemically tempered glass, and method for producing same | |
| US20230382783A1 (en) | Ion exchangeable yellow glass articles | |
| US11897808B2 (en) | Tunable glass compositions having improved mechanical durability | |
| WO2023244792A1 (en) | Au and ag containing glass composition and colored glass-based articles formed therefrom | |
| US20220396519A1 (en) | Glass compositions having improved mechanical durability and low characteristic temperatures | |
| WO2022266273A1 (en) | Colored glass articles having improved mechanical durability | |
| WO2023244715A1 (en) | Fusion formable glass composition and colored glass-based articles formed therefrom | |
| US20240025796A1 (en) | Gold containing silicate glass | |
| WO2023235288A1 (en) | Method for ion exchange of copper containing glass articles | |
| JP2019182718A (en) | Reinforced crystallized glass | |
| EP3490950A1 (en) | Glasses having resistance to photo-darkening |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 121 | Ep: the epo has been informed by wipo that ep was designated in this application |
Ref document number: 23816587 Country of ref document: EP Kind code of ref document: A1 |