USRE45686E1 - Disperse dyes, their preparation and their use - Google Patents
Disperse dyes, their preparation and their use Download PDFInfo
- Publication number
- USRE45686E1 USRE45686E1 US13/667,106 US200713667106A USRE45686E US RE45686 E1 USRE45686 E1 US RE45686E1 US 200713667106 A US200713667106 A US 200713667106A US RE45686 E USRE45686 E US RE45686E
- Authority
- US
- United States
- Prior art keywords
- hydrogen
- methyl
- formula
- alkyl
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active, expires
Links
- 0 [1*]C1=C(N=N[2H])C=C([2*])C(N([3*])C([4*])CC([6*])C(=O)OC([7*])C([5*])=O)=C1 Chemical compound [1*]C1=C(N=N[2H])C=C([2*])C(N([3*])C([4*])CC([6*])C(=O)OC([7*])C([5*])=O)=C1 0.000 description 25
- NMAFJDQZWCZMRJ-UHFFFAOYSA-N CC1=C2C=C([N+](=O)[O-])C=CC2=NS1 Chemical compound CC1=C2C=C([N+](=O)[O-])C=CC2=NS1 NMAFJDQZWCZMRJ-UHFFFAOYSA-N 0.000 description 4
- YAQKYKGFPQPPQE-UHFFFAOYSA-N CC1=NC2=C(C=C([N+](=O)[O-])C=C2)S1 Chemical compound CC1=NC2=C(C=C([N+](=O)[O-])C=C2)S1 YAQKYKGFPQPPQE-UHFFFAOYSA-N 0.000 description 4
- OMYZLMYILFOYNB-UHFFFAOYSA-N CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(=O)CC)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC(C)=C(N=NC2=CC(Cl)=C(F)C=C2Cl)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=NC3=C(C=C(S(C)(=O)=O)C=C3)S2)C=C1.O=S=O Chemical compound CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(=O)CC)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC(C)=C(N=NC2=CC(Cl)=C(F)C=C2Cl)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=NC3=C(C=C(S(C)(=O)=O)C=C3)S2)C=C1.O=S=O OMYZLMYILFOYNB-UHFFFAOYSA-N 0.000 description 4
- GGGBLZLICGWOBR-UHFFFAOYSA-N CCSC1=NN=C(C)S1 Chemical compound CCSC1=NN=C(C)S1 GGGBLZLICGWOBR-UHFFFAOYSA-N 0.000 description 4
- LIBQYHCHHAJWBA-UHFFFAOYSA-N [H]C(=O)C1=C(Cl)C(C#N)=C(C)S1 Chemical compound [H]C(=O)C1=C(Cl)C(C#N)=C(C)S1 LIBQYHCHHAJWBA-UHFFFAOYSA-N 0.000 description 4
- KHHPMIOQDUJRMB-HRNDJLQDSA-N C/N=N/C1=CC=CC=C1.CC Chemical compound C/N=N/C1=CC=CC=C1.CC KHHPMIOQDUJRMB-HRNDJLQDSA-N 0.000 description 3
- IYULAUPEFMQEKK-UHFFFAOYSA-N CC1=C(C)C(C)=C(C)S1 Chemical compound CC1=C(C)C(C)=C(C)S1 IYULAUPEFMQEKK-UHFFFAOYSA-N 0.000 description 3
- HHKDVGAWTPBACD-UHFFFAOYSA-N CC1=C([N+](=O)[O-])C=C([N+](=O)[O-])S1 Chemical compound CC1=C([N+](=O)[O-])C=C([N+](=O)[O-])S1 HHKDVGAWTPBACD-UHFFFAOYSA-N 0.000 description 3
- JOJQAEVKVSROEM-UHFFFAOYSA-N CC1=C2C=C([N+](=O)[O-])C=C(Br)C2=NS1 Chemical compound CC1=C2C=C([N+](=O)[O-])C=C(Br)C2=NS1 JOJQAEVKVSROEM-UHFFFAOYSA-N 0.000 description 3
- BEZDDPMMPIDMGJ-UHFFFAOYSA-N CC1=CC(C)=C(C)C(C)=C1C Chemical compound CC1=CC(C)=C(C)C(C)=C1C BEZDDPMMPIDMGJ-UHFFFAOYSA-N 0.000 description 3
- AYILKNSSTCEOKK-UHFFFAOYSA-N CC1=CC([N+](=O)[O-])=CC2=C(C)SN=C12 Chemical compound CC1=CC([N+](=O)[O-])=CC2=C(C)SN=C12 AYILKNSSTCEOKK-UHFFFAOYSA-N 0.000 description 3
- BAMPVSWRQZNDQC-UHFFFAOYSA-N CC1=NC(C)=C(C)S1 Chemical compound CC1=NC(C)=C(C)S1 BAMPVSWRQZNDQC-UHFFFAOYSA-N 0.000 description 3
- QCGWGZUXKJGPIS-UHFFFAOYSA-N CC1=NC2=C(C=C(Cl)C(Cl)=C2)S1 Chemical compound CC1=NC2=C(C=C(Cl)C(Cl)=C2)S1 QCGWGZUXKJGPIS-UHFFFAOYSA-N 0.000 description 3
- WSXLNBXUXXNHCV-UHFFFAOYSA-N CC1=NC2=CC(C)=C(C)C(C)=C2S1 Chemical compound CC1=NC2=CC(C)=C(C)C(C)=C2S1 WSXLNBXUXXNHCV-UHFFFAOYSA-N 0.000 description 3
- JXQGICFGPUAVLJ-UHFFFAOYSA-N CC1=NN=C(C)S1 Chemical compound CC1=NN=C(C)S1 JXQGICFGPUAVLJ-UHFFFAOYSA-N 0.000 description 3
- WXLGWMMWANWMNN-UHFFFAOYSA-N CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(=O)CC)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1 Chemical compound CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(=O)CC)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1 WXLGWMMWANWMNN-UHFFFAOYSA-N 0.000 description 3
- SHHIUWFOBYRJAM-CMDGGOBGSA-N C/N=N/c1ccccc1 Chemical compound C/N=N/c1ccccc1 SHHIUWFOBYRJAM-CMDGGOBGSA-N 0.000 description 2
- NFLMSYWHFBVICE-UHFFFAOYSA-N [H]C(=O)C1=C(Cl)N=C(C)S1 Chemical compound [H]C(=O)C1=C(Cl)N=C(C)S1 NFLMSYWHFBVICE-UHFFFAOYSA-N 0.000 description 2
- DDZKTYCOCWPZKW-UHFFFAOYSA-N CC1=C(C#N)C=C(N#NC2=CC=C([N+](=O)[O-])C=C2)S1 Chemical compound CC1=C(C#N)C=C(N#NC2=CC=C([N+](=O)[O-])C=C2)S1 DDZKTYCOCWPZKW-UHFFFAOYSA-N 0.000 description 1
- NVPPXCGGSXYVQQ-UHFFFAOYSA-N CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1 Chemical compound CCCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2)C=C1.CCN(CCC(=O)OCC(C)=O)C1=CC=C(N=NC2=CC=C([N+](=O)[O-])C=C2C#N)C=C1 NVPPXCGGSXYVQQ-UHFFFAOYSA-N 0.000 description 1
- NSWDTXHJALVRRR-UHFFFAOYSA-N CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1 Chemical compound CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2C#N)C=C1 NSWDTXHJALVRRR-UHFFFAOYSA-N 0.000 description 1
- XQDAMCYOIPNQEP-UHFFFAOYSA-N CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2[N+](=O)[O-])C=C1 Chemical compound CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(C#N)C=C([N+](=O)[O-])C=C2[N+](=O)[O-])C=C1 XQDAMCYOIPNQEP-UHFFFAOYSA-N 0.000 description 1
- OYYDVNSCCLYQCK-UHFFFAOYSA-N CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(Cl)C=C([N+](=O)[O-])C=C2C#N)C=C1OC Chemical compound CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C(Cl)C=C([N+](=O)[O-])C=C2C#N)C=C1OC OYYDVNSCCLYQCK-UHFFFAOYSA-N 0.000 description 1
- GFFIBZMHCAUWJH-UHFFFAOYSA-N CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C3C=C([N+](=O)[O-])C=CC3=NS2)C=C1 Chemical compound CCN(CCC(=O)OCC(C)=O)C1=CC(NC(C)=O)=C(N=NC2=C3C=C([N+](=O)[O-])C=CC3=NS2)C=C1 GFFIBZMHCAUWJH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0059—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing only sulfur as heteroatom
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0074—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing nitrogen and sulfur as heteroatoms
- C09B29/0077—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing nitrogen and sulfur as heteroatoms containing a five-membered heterocyclic ring with one nitrogen and one sulfur as heteroatoms
- C09B29/0081—Isothiazoles or condensed isothiazoles
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0074—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing nitrogen and sulfur as heteroatoms
- C09B29/0077—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing nitrogen and sulfur as heteroatoms containing a five-membered heterocyclic ring with one nitrogen and one sulfur as heteroatoms
- C09B29/0085—Thiazoles or condensed thiazoles
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
- C09B29/0805—Amino benzenes free of acid groups
- C09B29/0807—Amino benzenes free of acid groups characterised by the amino group
- C09B29/0809—Amino benzenes free of acid groups characterised by the amino group substituted amino group
- C09B29/0811—Amino benzenes free of acid groups characterised by the amino group substituted amino group further substituted alkylamino, alkenylamino, alkynylamino, cycloalkylamino aralkylamino or arylamino
- C09B29/0815—Amino benzenes free of acid groups characterised by the amino group substituted amino group further substituted alkylamino, alkenylamino, alkynylamino, cycloalkylamino aralkylamino or arylamino substituted by -C(=O)-
- C09B29/0816—Amino benzenes free of acid groups characterised by the amino group substituted amino group further substituted alkylamino, alkenylamino, alkynylamino, cycloalkylamino aralkylamino or arylamino substituted by -C(=O)- substituted by -COOR
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3643—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from quinolines or hydrogenated quinolines
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
- C09B31/043—Amino-benzenes
Definitions
- the present invention relates to disperse azo dyes in which a 2-oxoalkyl ester is linked to the chromophore.
- Dyes having this structural element are already known and described for example in GB 909843, WO95/20014 and WO05/056690. It has now been found that disperse azo dyes in which the structural element in question is linked to further selected structural elements in a certain manner have excellent properties and provide dyeings having excellent wash fastnesses and very good sublimation fastnesses.
- the invention relates to a dye of the formula (I)
- the invention also relates to the process to make the dye and the process of using the dye.
- D radicals of a diazo component are in particular those customary in the field of disperse dyes and known to one skilled in the art.
- D represents a group of the formula (IIa)
- (C 1 -C 6 )-Alkyl groups may be straight chain or branched and are, for example, methyl, ethyl, n-propyl, i-propyl, n-butyl, i-butyl, tert-butyl, n-pentyl or n-hexyl.
- alkoxy groups which are methoxy or ethoxy for example.
- C 3 -C 4 )-Alkenyl groups are in particular allyl.
- Substituted (C 1 -C 6 )-alkyl and (C 3 -C 4 )-alkenyl groups are in particular substituted by 1 to 3 substituents from the group consisting of halogen, cyano, hydroxyl, (C 1 -C 6 )-alkoxy, —COO(C 1 -C 6 )-alkyl, —COOaryl, —OCOO(C 1 -C 6 )-alkyl, —OCOOaryl, —OCO(C 1 -C 6 )-alkyl, phenyl, —OCOphenyl and phenoxy.
- Aryl is in particular phenyl or naphthyl, —NHSO 2 aryl is in particular phenylsulfonylamino.
- Halogen preferably represents chlorine or bromine.
- R 1 is preferably hydrogen, chlorine, methyl, ethyl, hydroxyl, methoxy, ethoxy, acetylamino, propionylamino, benzoylamino, methylsulfonylamino, ethylsulfonylamino or phenylsulfonylamino.
- R 2 is preferably hydrogen, chlorine, methyl, ethyl, methoxy, ethoxy or phenoxy.
- R 3 is preferably hydrogen, methyl, ethyl, propyl, butyl, benzyl, phenylethyl, phenoxyethyl, methoxyethyl, cyanoethyl, —C 2 H 4 OCOCH 3 , —C 2 H 4 OCOC 2 H 5 , —C 2 H 4 COOCH 3 , —C 2 H 4 COOC 2 H 5 or allyl.
- R 4 and R 7 are each preferably hydrogen, methyl or phenyl, more preferably hydrogen.
- R 6 is preferably hydrogen or methyl.
- R 5 is preferably methyl or ethyl.
- n is preferably 0 or 1, more preferably 0.
- T 1 to T 4 , R 1 to R 7 and n are each as defined above, but the compouds of the formula
- R 3 is not ethyl when R 1 is hydrogen. In further preferred dyes of the general formula (Ia), R 3 is not n-propyl or n-butyl when R 1 is —NHCOCH 3 .
- T 12 , R 1 to R 7 and n are each as defined above.
- T 5 , T 5′ , T 6 , R 1 to R 7 and n are each as defined above. 40
- T 7 to T 9 R 1 to R 7 and n are each as defined above.
- T 7 , T 8 , R 1 to R 7 and n are each as defined above and T 7 is in particular nitro, —CHO, COCH 3 or cyano.
- the dyes of the general formula (I) according to the present invention are obtainable using methods known to one skilled in the art.
- R 1 to R 7 and n are each as defined above.
- the diazotizing of the compounds of the general formula (III) is generally effected in a known manner, for example using sodium nitrite in an aqueous medium rendered acidic, for example with hydrochloric or sulfuric acid, or using nitrosylsulfuric acid in dilute sulfuric acid, phosphoric acid or in a mixture of acetic acid and propionic acid.
- the preferred temperature range is between 0° C. and 15° C.
- the coupling of the diazotized compounds onto the compounds of the general formula (IV) is generally likewise effected in a known manner, for example in an acidic, aqueous, aqueous-organic or organic medium, particularly advantageously at temperatures below 10° C.
- Acids used are in particular sulfuric acid, acetic acid or propionic acid.
- the present invention's dyes of the general formula (I) are very useful for dyeing and printing hydrophobic materials, the dyeings and prints obtained being notable for level hues and high service fastnesses. Deserving of particular mention are excellent wash fastnesses and very good sublimation fastnesses.
- the present invention thus also provides for the use of the dyes of the general formula I for dyeing and printing hydrophobic materials, i.e., processes for dyeing or printing such materials in a conventional manner wherein one or more dyes of the general formula (I) according to the present invention are used as a colorant.
- hydrophobic materials mentioned may be of synthetic or semisynthetic origin.
- Useful hydrophobic materials include for example secondary cellulose acetate, cellulose triacetate, polyamides and, in particular, high molecular weight polyesters.
- Materials of high molecular weight polyester are in particular those based on polyethylene glycol terephthalates.
- the hydrophobic synthetic materials can be present in the form of sheet- or threadlike constructions and can have been processed, for example, into yarns or into woven or knit textile materials. Preference is given to fibrous textile materials, which may also be present in the form of microfibers for example.
- the dyeing in accordance with the use provided by the present invention can be carried out in a conventional manner, preferably from an aqueous dispersion, if appropriate in the presence of carriers, at between 80 to about 110° C. by the exhaust process or by the HT process in a dyeing autoclave at 110 to 140° C., and also by the so-called thermofix process, in which the fabric is padded with the dyeing liquor and subsequently fixed/set at about 180 to 230° C.
- Printing of the materials mentioned can be carried out in a manner known per se by incorporating the dye of the general formula (I) of the present invention in a print paste and treating the fabric printed therewith at temperatures between 180 to 230° C. with HT steam, high-pressure steam or dry heat, if appropriate in the presence of a carrier, to fix the dye.
- the dyes of the general formula (I) of the present invention shall be in a very fine state of subdivision when they are used in dyeing liquors, padding liquors or print pastes.
- the dyes are converted into the fine state of subdivision in a conventional manner by slurrying the as-fabricated dye together with dispersants in a liquid medium, preferably in water, and subjecting the mixture to the action of shearing forces to mechanically communinute the original dye particles to such an extent that an optimal specific surface area is achieved and sedimentation of the dye is minimized. This is accomplished in suitable mills, such as ball or sand mills.
- the particle size of the dyes is generally between 0.5 and 5 ⁇ m and preferably equal to about 1 ⁇ m.
- the dispersants used in the milling operation can be nonionic or anionic.
- Nonionic dispersants include for example reaction products of alkylene oxides, for example ethylene oxide or propylene oxide, with alkylatable compounds, for example fatty alcohols, fatty amines, fatty acids, phenols, alkylphenols and carboxamides.
- Anionic dispersants are for example lignosulfonates, alkyl- or alkylarylsulfonates or alkylaryl polyglycol ether sulfates.
- the dye preparations thus obtained should be pourable for most applications. Accordingly, the dye and dispersant content is limited in these cases.
- the dispersions are adjusted to a dye content up to 50 percent by weight and a dispersant content up to about 25 percent by weight. For economic reasons, dye contents are in most cases not allowed to be below 15 percent by weight.
- the dispersions may also contain still further auxiliaries, for example those which act as an oxidizing agent, for example sodium m-nitrobenzenesulfonate, or fungicidal agents, for example sodium o-phenylphenoxide and sodium pentachlorophenoxide, and particularly so-called “acid donors”, examples being butyrolactone, monochloroacetamide, sodium chloroacetate, sodium dichloroacetate, the sodium salt of 3 -chloropropionic acid, monosulfate esters such as lauryl sulfate for example, and also sulfuric esters of ethoxylated and propoxylated alcohols, for example butylglycol sulfate.
- an oxidizing agent for example sodium m-nitrobenzenesulfonate
- fungicidal agents for example sodium o-phenylphenoxide and sodium pentachlorophenoxide
- acid donors examples being butyrolactone, monochloroacetamide, sodium
- the dye dispersions thus obtained are very advantageous for making up dyeing liquors and print pastes.
- powder formulations comprise the dye, dispersants and other auxiliaries, for example wetting, oxidizing, preserving and dustproofing agents and the abovementioned “acid donors”.
- a preferred method of making pulverulent preparations of dye consists in stripping the above-described liquid dye dispersions of their liquid, for example by vacuum drying, freeze drying, by drying on drum dryers, but preferably by spray drying.
- the dyeing liquors are made by diluting the requisite amounts of the above-described dye formulations with the dyeing medium, preferably water, such that a liquor ratio of 5:1 to 50:1 is obtained for dyeing.
- the dyeing medium preferably water
- further dyeing auxiliaries such as dispersing, wetting and fixing auxiliaries, in the liquors.
- Organic and inorganic acids such as acetic acid, succinic acid, boric acid or phosphoric acid are included to set a pH in the range from 4 to 5, preferably 4.5. It is advantageous to buffer the pH setting and to add a sufficient amount of a buffering system.
- the acetic acid/sodium acetate system is an example of an advantageous buffering system.
- the requisite amounts of the abovementioned dye formulations are kneaded in a conventional manner together with thickeners, for example alkali metal alginates or the like, and if appropriate further additives, for example fixation accelerants, wetting agents and oxidizing agents, to give print pastes.
- thickeners for example alkali metal alginates or the like
- further additives for example fixation accelerants, wetting agents and oxidizing agents
- the present invention also provides inks for digital textile printing by the ink jet process, comprising a present invention dye of the general formula (I).
- the inks of the present invention are preferably aqueous and comprise one or more of the present invention's dyes of the general formula (I), for example in amounts of 0.1% to 50% by weight, preferably in amounts of 1% to 30% by weight and more preferably in amounts of 1% to 15% by weight based on the total weight of the ink. They further comprise in particular from 0.1% to 20% by weight of a dispersant.
- Suitable dispersants are known to one skilled in the art, are commercially available and include for example sulfonated or sulfomethylated lignins, condensation products of aromatic sulfonic acids and formaldehyde, condensation products of substituted or unsubstituted phenol and formaldehyde, polyacrylates and corresponding copolymers, modified polyurethanes and reaction products of alkylene oxides with alkylatable compounds, for example fatty alcohols, fatty amines, fatty acids, carboxamides and substituted or unsubstituted phenols.
- the inks of the present invention may further comprise customary additives, for example viscosity moderators to set viscosities in the range from 1.5 to 40.0 mPas in the temperature range of 20 to 50° C.
- Preferred inks have a viscosity in the range from 1.5 to 20 mPas and particularly preferred inks have a viscosity in the range from 1.5 to 15 mPas.
- Useful viscosity moderators include rheological additives, for example polyvinyl-caprolactam, polyvinylpyrrolidone and also their copolymers, polyetherpolyol, associative thickeners, polyureas, sodium alginates, modified galactomannans, polyetherurea, polyurethane and nonionic cellulose ethers.
- rheological additives for example polyvinyl-caprolactam, polyvinylpyrrolidone and also their copolymers, polyetherpolyol, associative thickeners, polyureas, sodium alginates, modified galactomannans, polyetherurea, polyurethane and nonionic cellulose ethers.
- the inks of the present invention may include surface-active substances to set surface tensions in the range from 20 to 65 mN/m, which are if appropriate adapted depending on the process used (thermal or piezo technology).
- Useful surface-active substances include for example surfactants of any kind, preferably nonionic surfactants, butyldiglycol and 1,2 hexanediol.
- the inks may further include customary additives, for example chemical species to inhibit fungal and bacterial growth in amounts from 0.01% to 1% by weight based on the total weight of the ink.
- the inks of the present invention can be prepared in conventional manner by mixing the components in water.
- Example 2 is repeated except it proceeds from 2-oxopropyl 3- ⁇ [3-acetylamino-4-(6-bromo-2,4-dinitrophenylazo)phenyl]ethylamino ⁇ propionate and utilizes only one equivalent of copper(I) cyanide.
- the dye thus obtained has the formula (Iad)
- Examples 4 to 145 of Table 1 were prepared in a similar manner.
- Examples 147 to 173 of Table 2 were prepared in a similar manner.
- a textile fabric consisting of polyester is padded with a liquor consisting of 50 g/l of 8% sodium alginate solution, 100 g/l of 8-12% carob flour ether solution and 5 g/l of monosodium phosphate in water and then dried.
- the wet pickup is 70%.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Coloring (AREA)
- Ink Jet Recording Methods And Recording Media Thereof (AREA)
- Ink Jet (AREA)
Abstract
Description
This application is a national stage application (under 35 U.S.C. §371) of PCT/EP2007/061002, filed Oct. 16, 2007, which claims benefit of German application 10 2006 050642.1, filed Oct. 27, 2006.
The present invention relates to disperse azo dyes in which a 2-oxoalkyl ester is linked to the chromophore. Dyes having this structural element are already known and described for example in GB 909843, WO95/20014 and WO05/056690. It has now been found that disperse azo dyes in which the structural element in question is linked to further selected structural elements in a certain manner have excellent properties and provide dyeings having excellent wash fastnesses and very good sublimation fastnesses.
The invention relates to a dye of the formula (I)
- D is the radical of a diazo component;
- R1 is hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, hydroxyl, halogen, —NHCHO, —NHCO(C1-C6)-alkyl, —NHCOaryl, —NHSO2(C1-C6)-alkyl or —NHSO2aryl;
- R2 is hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, phenoxy or halogen;
- R3 is hydrogen, (C1-C6)-alkyl, substituted (C1-C6)-alkyl, (C3-C4)-alkenyl or substituted (C3-C4)-alkenyl;
or R2 and R3 combine to form the radical —C*H(CH3)CH2C(CH3)2—, where the carbon atom marked by * is attached to the phenyl nucleus; - R4 is hydrogen, (C1-C5)-alkyl or phenyl;
- R5 is (C1-C6)-alkyl or substituted (C1-C6)-alkyl;
- R6 is hydrogen or (C1-C6)-alkyl;
- R7 is hydrogen, (C1-C6)-alkyl or phenyl; and
- n 0, 1, 2 or 3;
although the compounds of the formulae
shall be excluded. The invention also relates to the process to make the dye and the process of using the dye.
D radicals of a diazo component are in particular those customary in the field of disperse dyes and known to one skilled in the art.
Preferably, D represents a group of the formula (IIa)
- T1 and T2 independently are hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, —SO2(C1-C6)-alkyl, —SO2aryl, cyano, halogen or nitro; and
- T4 and T3 independently are hydrogen, halogen, trifluoromethyl, cyano, —SCN, —SO2CH3 or nitro;
- although at least one of T1, T2, T3 and T4 is not hydrogen;
or represents a group of the formula (IIb)
- T5 and T5′ independently are hydrogen or halogen; and
- T6 is hydrogen, —SO2CH3, —SCN, (C1-C4)-alkoxy, halogen or nitro;
- although at least one of T5, T5′ and T6 is not hydrogen;
or represents a group of the formula (IIc)
- T12 is hydrogen or halogen;
or represents a group of the formula (IId)
- T7 is nitro, —CHO, cyano, —COCH3 or a group of the formula
-
- where T10 is hydrogen, halogen, nitro or cyano;
- T8 is hydrogen, (C1-C6)-alkyl or halogen; and
- T9 is nitro, cyano, —COCH3 or —COOT11; where T11 is (C1-C4)-alkyl;
or represents a group of the formula (IIe)
- where T7 and T8 are each as defined above;
or represents a group of the formula (IIf)
- where T13 is phenyl or S—(C1-C4)-alkyl.
(C1-C6)-Alkyl groups may be straight chain or branched and are, for example, methyl, ethyl, n-propyl, i-propyl, n-butyl, i-butyl, tert-butyl, n-pentyl or n-hexyl. A similar logic applies to alkoxy groups, which are methoxy or ethoxy for example. (C3-C4)-Alkenyl groups are in particular allyl.
Substituted (C1-C6)-alkyl and (C3-C4)-alkenyl groups are in particular substituted by 1 to 3 substituents from the group consisting of halogen, cyano, hydroxyl, (C1-C6)-alkoxy, —COO(C1-C6)-alkyl, —COOaryl, —OCOO(C1-C6)-alkyl, —OCOOaryl, —OCO(C1-C6)-alkyl, phenyl, —OCOphenyl and phenoxy.
Aryl is in particular phenyl or naphthyl, —NHSO2aryl is in particular phenylsulfonylamino. Halogen preferably represents chlorine or bromine.
R1 is preferably hydrogen, chlorine, methyl, ethyl, hydroxyl, methoxy, ethoxy, acetylamino, propionylamino, benzoylamino, methylsulfonylamino, ethylsulfonylamino or phenylsulfonylamino.
R2 is preferably hydrogen, chlorine, methyl, ethyl, methoxy, ethoxy or phenoxy.
R3 is preferably hydrogen, methyl, ethyl, propyl, butyl, benzyl, phenylethyl, phenoxyethyl, methoxyethyl, cyanoethyl, —C2H4OCOCH3, —C2H4OCOC2H5, —C2H4COOCH3, —C2H4COOC2H5 or allyl.
R4 and R7 are each preferably hydrogen, methyl or phenyl, more preferably hydrogen. R6 is preferably hydrogen or methyl.
R5 is preferably methyl or ethyl.
n is preferably 0 or 1, more preferably 0.
Preferred dyes according to the present invention conform to the general formula (Ia)
In preferred dyes of the general formula (Ia), R3 is not ethyl when R1 is hydrogen and n=0. In further preferred dyes of the general formula (Ia), R3 is not n-propyl or n-butyl when R1 is —NHCOCH3 and n=0.
In particularly preferred dyes of the general formula (Ia),
- R1 is acetylamino, propionylamino, benzoylamino or methylsulfonylamino;
- R2 is hydrogen, chlorine, methoxy or ethoxy;
- R3 is hydrogen, methyl, ethyl, allyl or benzyl;
- R4 is hydrogen or methyl;
- R5 methyl or ethyl;
- R6 is hydrogen or methyl and
- R7 is hydrogen, methyl or phenyl.
Particularly preferred dyes of the general formula (Ia) according to the present invention conform to the general formula (Iaa)
- T1 is hydrogen, nitro or methyl;
- T2 is hydrogen, nitro or chlorine;
- T3 is hydrogen, cyano, chlorine or bromine;
- T4 is hydrogen, cyano, nitro, chlorine, bromine or trifluoromethyl;
- R1 is hydrogen, hydroxyl, chlorine, methyl, acetylamino, propionylamino, benzoylamino or methylsulfonylamino;
- R2 is hydrogen, chlorine, methyl, phenoxy, methoxy or ethoxy;
- R3 is hydrogen, methyl, ethyl, butyl, benzyl, phenylethyl, phenoxyethyl or allyl;
- R5 is methyl or ethyl; and
- R4 and R7 are hydrogen, methyl or phenyl;
although the compounds of the formulae
In preferred dyes of the general formula (Iaa), R3 is not ethyl when R1 is hydrogen. In further preferred dyes of the general formula (Ia), R3 is not n-propyl or n-butyl when R1 is —NHCOCH3.
Further preferred dyes according to the present invention conform to the general formula (Ib)
Particularly preferred dyes of this type according to the present invention conform to the general formula (Iba)
- T12 is hydrogen, chlorine or bromine;
- R1 is hydrogen, hydroxyl, methyl, acetylamino or propionylamino;
- R2 is hydrogen, methyl, chlorine or methoxy;
- R3 is hydrogen, ethyl, butyl, benzyl or allyl; and
- R5 is methyl or ethyl.
Further preferred dyes according to the present invention conform to the general formula (Ic)
Particularly preferred dyes of this type according to the present invention conform to the general formula (Ica)
- T5 and T5′ independently are hydrogen or halogen;
- T6 is halogen or nitro;
- R1 is hydrogen, hydroxyl, methyl, acetylamino or propionylamino;
- R2 is hydrogen, methyl, chlorine or methoxy;
- R3 is hydrogen, ethyl, butyl, benzyl or allyl; and
- R5 is methyl or ethyl.
Further preferred dyes according to the present invention conform to the general formula (Id)
Particularly preferred dyes of this type according to the present invention conform to the general formula (Ida)
- T7 is nitro, —CHO or cyano;
- T8 is hydrogen, methyl or chlorine;
- T9 is nitro, cyano or —COCH3;
- R1 is hydrogen, hydroxyl, methyl, acetylamino or propionylamino;
- R2 is hydrogen, methyl, chlorine or methoxy;
- R3 is hydrogen, methyl, ethyl, butyl, benzyl, phenoxyethyl or allyl; and
- R5 is methyl or ethyl.
Further particularly preferred dyes of this type according to the present invention conform to the general formula (Idb)
- T10 is nitro;
- T9 is cyano or —COCH3;
- 1 is hydrogen, methyl or acetylamino;
- 3 is methyl, ethyl, butyl or allyl; and
- R5 methyl or ethyl.
Further preferred dyes according to the present invention conform to the general formula (Ie)
where T7, T8, R1 to R7 and n are each as defined above and T7 is in particular nitro, —CHO, COCH3 or cyano.
Particularly preferred dyes of this type according to the present invention conform to the general formula (Iea)
- T7 is nitro, —CHO or cyano;
- T8 is hydrogen or chlorine;
- R1 is hydrogen, hydroxyl, methyl, acetylamino or propionylamino;
- R2 is hydrogen, methyl, chlorine or methoxy;
- R3 is hydrogen, methyl, ethyl, butyl, benzyl, phenoxyethyl or allyl; and
- R5 is methyl or ethyl.
Further preferred dyes according to the present invention conform to the general formula (If)
- T13, R1 to R7 and n are each as defined above.
Particularly preferred dyes of this type according to the present invention conform to the general formula (Ifa)
- R1 is hydrogen, hydroxyl, methyl, acetylamino or propionylamino;
- R2 is hydrogen, methyl, chlorine or methoxy;
- R3 is hydrogen, methyl, ethyl, butyl, benzyl, phenoxyethyl or allyl; and
- R5 is methyl or ethyl.
The dyes of the general formula (I) according to the present invention are obtainable using methods known to one skilled in the art.
For instance, a compound of the general formula (III)
D-NH2 tm (III)
where D is as defined above, is diazotized and coupled onto a compound of the general formula (IV)
D-NH2 tm (III)
where D is as defined above, is diazotized and coupled onto a compound of the general formula (IV)
The diazotizing of the compounds of the general formula (III) is generally effected in a known manner, for example using sodium nitrite in an aqueous medium rendered acidic, for example with hydrochloric or sulfuric acid, or using nitrosylsulfuric acid in dilute sulfuric acid, phosphoric acid or in a mixture of acetic acid and propionic acid. The preferred temperature range is between 0° C. and 15° C.
The coupling of the diazotized compounds onto the compounds of the general formula (IV) is generally likewise effected in a known manner, for example in an acidic, aqueous, aqueous-organic or organic medium, particularly advantageously at temperatures below 10° C. Acids used are in particular sulfuric acid, acetic acid or propionic acid.
The compounds of the general formulae (III) and (IV) are known and can be prepared by known methods.
The present invention's dyes of the general formula (I) are very useful for dyeing and printing hydrophobic materials, the dyeings and prints obtained being notable for level hues and high service fastnesses. Deserving of particular mention are excellent wash fastnesses and very good sublimation fastnesses.
The present invention thus also provides for the use of the dyes of the general formula I for dyeing and printing hydrophobic materials, i.e., processes for dyeing or printing such materials in a conventional manner wherein one or more dyes of the general formula (I) according to the present invention are used as a colorant.
The hydrophobic materials mentioned may be of synthetic or semisynthetic origin. Useful hydrophobic materials include for example secondary cellulose acetate, cellulose triacetate, polyamides and, in particular, high molecular weight polyesters. Materials of high molecular weight polyester are in particular those based on polyethylene glycol terephthalates.
The hydrophobic synthetic materials can be present in the form of sheet- or threadlike constructions and can have been processed, for example, into yarns or into woven or knit textile materials. Preference is given to fibrous textile materials, which may also be present in the form of microfibers for example.
The dyeing in accordance with the use provided by the present invention can be carried out in a conventional manner, preferably from an aqueous dispersion, if appropriate in the presence of carriers, at between 80 to about 110° C. by the exhaust process or by the HT process in a dyeing autoclave at 110 to 140° C., and also by the so-called thermofix process, in which the fabric is padded with the dyeing liquor and subsequently fixed/set at about 180 to 230° C.
Printing of the materials mentioned can be carried out in a manner known per se by incorporating the dye of the general formula (I) of the present invention in a print paste and treating the fabric printed therewith at temperatures between 180 to 230° C. with HT steam, high-pressure steam or dry heat, if appropriate in the presence of a carrier, to fix the dye.
The dyes of the general formula (I) of the present invention shall be in a very fine state of subdivision when they are used in dyeing liquors, padding liquors or print pastes.
The dyes are converted into the fine state of subdivision in a conventional manner by slurrying the as-fabricated dye together with dispersants in a liquid medium, preferably in water, and subjecting the mixture to the action of shearing forces to mechanically communinute the original dye particles to such an extent that an optimal specific surface area is achieved and sedimentation of the dye is minimized. This is accomplished in suitable mills, such as ball or sand mills. The particle size of the dyes is generally between 0.5 and 5 μm and preferably equal to about 1 μm.
The dispersants used in the milling operation can be nonionic or anionic. Nonionic dispersants include for example reaction products of alkylene oxides, for example ethylene oxide or propylene oxide, with alkylatable compounds, for example fatty alcohols, fatty amines, fatty acids, phenols, alkylphenols and carboxamides. Anionic dispersants are for example lignosulfonates, alkyl- or alkylarylsulfonates or alkylaryl polyglycol ether sulfates.
The dye preparations thus obtained should be pourable for most applications. Accordingly, the dye and dispersant content is limited in these cases. In general, the dispersions are adjusted to a dye content up to 50 percent by weight and a dispersant content up to about 25 percent by weight. For economic reasons, dye contents are in most cases not allowed to be below 15 percent by weight. The dispersions may also contain still further auxiliaries, for example those which act as an oxidizing agent, for example sodium m-nitrobenzenesulfonate, or fungicidal agents, for example sodium o-phenylphenoxide and sodium pentachlorophenoxide, and particularly so-called “acid donors”, examples being butyrolactone, monochloroacetamide, sodium chloroacetate, sodium dichloroacetate, the sodium salt of 3 -chloropropionic acid, monosulfate esters such as lauryl sulfate for example, and also sulfuric esters of ethoxylated and propoxylated alcohols, for example butylglycol sulfate.
The dye dispersions thus obtained are very advantageous for making up dyeing liquors and print pastes.
There are certain fields of use where powder formulations are preferred. These powders comprise the dye, dispersants and other auxiliaries, for example wetting, oxidizing, preserving and dustproofing agents and the abovementioned “acid donors”.
A preferred method of making pulverulent preparations of dye consists in stripping the above-described liquid dye dispersions of their liquid, for example by vacuum drying, freeze drying, by drying on drum dryers, but preferably by spray drying.
The dyeing liquors are made by diluting the requisite amounts of the above-described dye formulations with the dyeing medium, preferably water, such that a liquor ratio of 5:1 to 50:1 is obtained for dyeing. In addition, it is generally customary to include further dyeing auxiliaries, such as dispersing, wetting and fixing auxiliaries, in the liquors. Organic and inorganic acids such as acetic acid, succinic acid, boric acid or phosphoric acid are included to set a pH in the range from 4 to 5, preferably 4.5. It is advantageous to buffer the pH setting and to add a sufficient amount of a buffering system. The acetic acid/sodium acetate system is an example of an advantageous buffering system.
To use the dye or dye mixture in textile printing, the requisite amounts of the abovementioned dye formulations are kneaded in a conventional manner together with thickeners, for example alkali metal alginates or the like, and if appropriate further additives, for example fixation accelerants, wetting agents and oxidizing agents, to give print pastes.
The present invention also provides inks for digital textile printing by the ink jet process, comprising a present invention dye of the general formula (I).
The inks of the present invention are preferably aqueous and comprise one or more of the present invention's dyes of the general formula (I), for example in amounts of 0.1% to 50% by weight, preferably in amounts of 1% to 30% by weight and more preferably in amounts of 1% to 15% by weight based on the total weight of the ink. They further comprise in particular from 0.1% to 20% by weight of a dispersant. Suitable dispersants are known to one skilled in the art, are commercially available and include for example sulfonated or sulfomethylated lignins, condensation products of aromatic sulfonic acids and formaldehyde, condensation products of substituted or unsubstituted phenol and formaldehyde, polyacrylates and corresponding copolymers, modified polyurethanes and reaction products of alkylene oxides with alkylatable compounds, for example fatty alcohols, fatty amines, fatty acids, carboxamides and substituted or unsubstituted phenols.
The inks of the present invention may further comprise customary additives, for example viscosity moderators to set viscosities in the range from 1.5 to 40.0 mPas in the temperature range of 20 to 50° C. Preferred inks have a viscosity in the range from 1.5 to 20 mPas and particularly preferred inks have a viscosity in the range from 1.5 to 15 mPas.
Useful viscosity moderators include rheological additives, for example polyvinyl-caprolactam, polyvinylpyrrolidone and also their copolymers, polyetherpolyol, associative thickeners, polyureas, sodium alginates, modified galactomannans, polyetherurea, polyurethane and nonionic cellulose ethers.
By way of further additives, the inks of the present invention may include surface-active substances to set surface tensions in the range from 20 to 65 mN/m, which are if appropriate adapted depending on the process used (thermal or piezo technology). Useful surface-active substances include for example surfactants of any kind, preferably nonionic surfactants, butyldiglycol and 1,2 hexanediol.
The inks may further include customary additives, for example chemical species to inhibit fungal and bacterial growth in amounts from 0.01% to 1% by weight based on the total weight of the ink.
The inks of the present invention can be prepared in conventional manner by mixing the components in water.
4.6 g of 6-chloro-2,4-dinitroaniline are introduced into a mixture of 9.8 ml of sulfuric acid (96%), 0.5 ml of water and 3.5 ml of nitrosylsulfuric acid (40%) at 30 to 35° C. After 3 hours of stirring at 30-35° C., excess nitrite is destroyed with amidosulfonic acid. The diazonium salt solution thus obtained is expediently added dropwise to a mixture of 7.0 g of 2-oxopropyl 3-[(5-acetylamino-2-methoxyphenyl)ethylamino]-propionate, 50 ml of methanol and 200 g of ice. After stirring for one hour the solids are filtered off with suction, washed with water and dried to leave 7.3 g of the dye of the formula (Iab)
7.5 g of 2-oxopropyl 3-{[3-acetylamino-4-(2,6-dibromo-4-nitrophenylazo)phenyl]-ethylamino}propionate and 2.15 g of copper(I) cyanide are stirred in 30 ml of N-methylpyrrolidone at 80° C. for 4 hours. After cooling, 200 ml of methanol and 30 ml of water are added dropwise. The precipitate is filtered off with suction, washed with 5% hydrochloric acid and water and dried under reduced pressure to leave 4.9 g of the dye of the formula (Iac)
(λmax [DMF]=612 nm), which dyes polyester in brilliant, blue shades and has excellent wash and sublimation fastnesses.
Example 2 is repeated except it proceeds from 2-oxopropyl 3-{[3-acetylamino-4-(6-bromo-2,4-dinitrophenylazo)phenyl]ethylamino}propionate and utilizes only one equivalent of copper(I) cyanide. The dye thus obtained has the formula (Iad)
(λmax [DMF]=602 nm) and dyes polyester in brilliant, blue shades and gives excellent wash and sublimation fastnesses.
Examples 4 to 145 of Table 1 were prepared in a similar manner.
| TABLE 1 |
|
|
| λmax | |||||||||||||
| Exam- | (nm) | ||||||||||||
| ple | T1 | T2 | T3 | T4 | R1 | R2 | R3 | R5 | R4 | R6 | R7 | n | DMF |
| 4 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 604 |
| 5 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 582 |
| 6 | NO2 | H | Br | CN | NHCOCH3 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 632 |
| 7 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | CH2CH3 | C2H5 | H | H | H | 0 | 604 |
| 8 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | CH2CH3 | C2H5 | H | H | H | 0 | 604 |
| 9 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | CH2CH3 | C2H5 | H | H | H | 0 | 582 |
| 10 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | CH3 | CH3 | H | H | H | 0 | 600 |
| 11 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | CH3 | CH3 | H | H | H | 0 | 598 |
| 12 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | CH3 | CH3 | H | H | H | 0 | 572 |
| 13 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | CH2CH═CH2 | CH3 | H | H | H | 0 | 598 |
| 14 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | CH2CH═CH2 | CH3 | H | H | H | 0 | 598 |
| 15 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | CH2CH═CH2 | CH3 | H | H | H | 0 | 574 |
| 16 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | CH2C6H5 | CH3 | H | H | H | 0 | 590 |
| 17 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | CH2C6H5 | CH3 | H | H | H | 0 | 590 |
| 18 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | CH2C6H5 | CH3 | H | H | H | 0 | 570 |
| 19 | NO2 | H | CN | NO2 | NHCOCH3 | OCH3 | CH2C6H5 | CH3 | H | H | H | 0 | 634 |
| 20 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 592 |
| 21 | NO2 | H | Cl | NO2 | NHCOCH3 | OC2H5 | H | CH3 | H | H | H | 0 | 594 |
| 22 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 594 |
| 23 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | C2H5 | H | H | H | 0 | 594 |
| 24 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | C2H5 | H | H | H | 0 | 600 |
| 25 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | H | C2H5 | H | H | H | 0 | 574 |
| 26 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 574 |
| 27 | NO2 | H | H | CF3 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 542 |
| 28 | NO2 | H | Br | CN | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 624 |
| 29 | NO2 | H | Br | CF3 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 562 |
| 30 | NO2 | H | Br | NO2 | NHCOC2H5 | OCH3 | H | CH3 | H | H | H | 0 | 596 |
| 31 | NO2 | H | Cl | NO2 | NHCOC2H5 | OCH3 | H | CH3 | H | H | H | 0 | 596 |
| 32 | NO2 | H | H | NO2 | NHCOC2H5 | OCH3 | H | CH3 | H | H | H | 0 | 576 |
| 33 | NO2 | H | Br | NO2 | NHCOC6H5 | OCH3 | H | CH3 | H | H | H | 0 | 586 |
| 34 | NO2 | H | Cl | NO2 | NHCOC6H5 | OCH3 | H | CH3 | H | H | H | 0 | 586 |
| 35 | NO2 | H | H | NO2 | NHCOC6H5 | OCH3 | H | CH3 | H | H | H | 0 | 572 |
| 36 | NO2 | Cl | H | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 0 | 576 |
| 37 | NO2 | H | Br | NO2 | NHCOC6H5 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 596 |
| 38 | NO2 | H | Br | NO2 | NHCOC2H5 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 606 |
| 39 | NO2 | H | Cl | NO2 | NNCOC2H5 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 608 |
| 40 | NO2 | H | CN | NO2 | NHCOCH3 | OCH3 | CH2CH3 | CH3 | H | H | H | 0 | 648 |
| 41 | NO2 | H | Br | NO2 | NHCOC6H5 | H | CH2CH3 | CH3 | H | H | H | 0 | 560 |
| 42 | NO2 | H | Br | NO2 | NHCOC2H5 | H | CH2CH3 | CH3 | H | H | H | 0 | 558 |
| 43 | NO2 | Cl | H | NO2 | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 548 |
| 44 | NO2 | H | Cl | NO2 | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 560 |
| 45 | NO2 | H | Cl | NO2 | NHCOCH3 | H | CH2CH3 | C2H5 | H | H | H | 0 | 560 |
| 46 | NO2 | H | Br | NO2 | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 558 |
| 47 | NO2 | H | Cl | NO2 | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 562 |
| 48 | NO2 | H | Cl | H | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 534 |
| 49 | NO2 | H | H | H | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 516 |
| 50 | NO2 | H | Br | CN | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 584 |
| 51 | NO2 | H | CN | NO2 | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 604 |
| 52 | NO2 | H | H | NO2 | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 548 |
| 53 | NO2 | H | H | CN | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 552 |
| 54 | NO2 | H | Br | CN | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 582 |
| 55 | NO2 | H | Cl | CN | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 582 |
| 56 | NO2 | H | Cl | H | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 534 |
| 57 | NO2 | H | Br | H | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 530 |
| 58 | NO2 | H | H | H | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 514 |
| 59 | NO2 | H | Cl | NO2 | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 554 |
| 60 | NO2 | H | H | CN | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 546 |
| 61 | NO2 | H | Br | NO2 | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 552 |
| 62 | NO2 | H | Cl | H | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 524 |
| 63 | NO2 | H | H | NO2 | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 540 |
| 64 | NO2 | H | H | H | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 506 |
| 65 | H | Cl | H | Cl | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 476 |
| 66 | NO2 | H | Br | CN | NHCOCH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 574 |
| 67 | NO2 | H | H | CN | NHCOCH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 554 |
| 68 | NO2 | H | Cl | NO2 | NHCOCH3 | H | CH2CH═CH2 | CH3 | H | H | H | 0 | 556 |
| 69 | NO2 | H | H | CN | NHCOCH3 | H | CH2CH═CH2 | CH3 | H | H | H | 0 | 548 |
| 70 | NO2 | H | H | Cl | NHSO2CH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 534 |
| 71 | NO2 | H | H | H | NHSO2CH3 | H | CH2C6H5 | CH3 | H | H | H | 0 | 494 |
| 72 | NO2 | H | H | CN | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 548 |
| 73 | NO2 | H | H | CN | CH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 550 |
| 74 | NO2 | H | H | Cl | CH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 526 |
| 75 | NO2 | H | CN | CN | CH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 600 |
| 76 | NO2 | H | CN | NO2 | CH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 590 |
| 77 | NO2 | H | Br | CN | CH3 | H | n-C4H9 | CH3 | H | H | H | 0 | 562 |
| 78 | NO2 | H | Cl | H | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 524 |
| 79 | NO2 | H | Cl | H | H | H | CH2CH3 | CH3 | H | H | H | 0 | 512 |
| 80 | NO2 | H | Cl | Cl | H | H | CH2CH3 | CH3 | H | H | H | 0 | 440 |
| 81 | NO2 | H | Br | Cl | H | H | CH2CH3 | CH3 | H | H | H | 0 | 442 |
| 82 | NO2 | H | Br | Br | H | H | CH2CH3 | CH3 | H | H | H | 0 | 440 |
| 83 | NO2 | H | H | Br | H | H | CH2CH3 | CH3 | H | H | H | 0 | 508 |
| 84 | NO2 | Cl | H | Cl | H | H | CH2CH3 | CH3 | H | H | H | 0 | 512 |
| 85 | NO2 | H | Br | Cl | H | H | n-C4H9 | CH3 | H | H | H | 0 | 444 |
| 86 | NO2 | H | Cl | Cl | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 432 |
| 87 | NO2 | H | Br | Cl | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 434 |
| 88 | NO2 | H | Cl | H | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 500 |
| 89 | NO2 | H | H | CN | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 526 |
| 90 | NO2 | H | H | CF3 | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 506 |
| 91 | NO2 | H | Br | Br | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 432 |
| 92 | NO2 | H | H | Br | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 498 |
| 93 | NO2 | H | Cl | Cl | H | H | CH2CH2C6H5 | CH3 | H | H | H | 0 | 440 |
| 94 | NO2 | H | Br | Cl | H | H | CH2CH2C6H5 | CH3 | H | H | H | 0 | 442 |
| 95 | NO2 | H | Cl | Cl | H | H | CH2CH2OC6H5 | CH3 | H | H | H | 0 | 436 |
| 96 | NO2 | H | Br | Cl | H | H | CH2CH2OC6H5 | CH3 | H | H | H | 0 | 432 |
| 97 | NO2 | H | H | Cl | H | H | CH2CH2OC6H5 | CH3 | H | H | H | 0 | 502 |
| 98 | NO2 | H | H | CN | H | H | CH2CH2OC6H5 | CH3 | H | H | H | 0 | 526 |
| 99 | NO2 | H | Cl | Cl | H | H | CH2CH2CN | CH3 | H | H | H | 0 | 424 |
| 100 | NO2 | H | Br | Br | H | H | CH2CH2CN | CH3 | H | H | H | 0 | 422 |
| 101 | NO2 | H | Cl | Cl | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 462 |
| 102 | NO2 | H | Br | Cl | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 460 |
| 103 | NO2 | H | Cl | CN | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 562 |
| 104 | NO2 | H | Br | CN | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 560 |
| 105 | NO2 | H | CN | CN | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 596 |
| 106 | NO2 | H | H | H | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 500 |
| 107 | NO2 | H | H | Br | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 522 |
| 108 | NO2 | Cl | H | Cl | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 524 |
| 109 | H | NO2 | H | H | CH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 452 |
| 110 | NO2 | Cl | Cl | H | H | H | CH2C6H5 | CH3 | H | H | H | 0 | 500 |
| 111 | NO2 | H | H | H | OH | H | CH2CH3 | CH3 | H | H | H | 0 | 494 |
| 112 | NO2 | H | H | Cl | OH | H | CH2CH3 | CH3 | H | H | H | 0 | 530 |
| 113 | NO2 | H | H | CN | OH | H | CH2CH3 | CH3 | H | H | H | 0 | 544 |
| 114 | NO2 | H | Cl | Cl | OH | H | CH2CH3 | CH3 | H | H | H | 0 | 486 |
| 115 | NO2 | H | H | H | Cl | OC6H3 | H | CH3 | H | H | H | 0 | 478 |
| 116 | NO2 | H | H | CN | Cl | OC6H3 | H | CH3 | H | H | H | 0 | 524 |
| 117 | NO2 | H | H | Cl | Cl | OC6H5 | H | CH3 | H | H | H | 0 | 498 |
| 118 | NO2 | H | Cl | Cl | Cl | OC6H5 | H | CH3 | H | H | H | 0 | 444 |
| 119 | NO2 | H | H | H | H | Cl | H | CH3 | H | H | H | 0 | 450 |
| 120 | NO2 | H | H | Cl | H | Cl | H | CH3 | H | H | H | 0 | 472 |
| 121 | NO2 | H | H | H | H | Cl | H | C2H5 | H | H | H | 0 | 450 |
| 122 | NO2 | H | H | NO2 | NHCOCH3 | Cl | H | CH3 | H | H | H | 0 | 520 |
| 123 | NO2 | H | H | H | NHCOCH3 | Cl | H | CH3 | H | H | H | 0 | 486 |
| 124 | NO2 | H | Cl | NO2 | NHCOCH3 | Cl | H | CH3 | H | H | H | 0 | 536 |
| 125 | NO2 | 11 | Cl | H | NHCOCH3 | Cl | H | CH3 | H | H | H | 0 | 508 |
| 126 | NO2 | H | H | CN | NHCOCH3 | Cl | H | CH3 | H | H | H | 0 | 530 |
| 127 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | CH3 | CH3 | H | H | 0 | 596 |
| 128 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | CH3 | H | H | 0 | 596 |
| 129 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | CH3 | H | 0 | 592 |
| 130 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 1 | 601 |
| 131 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 1 | 600 |
| 132 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 1 | 582 |
| 133 | NO2 | H | Br | CN | NHCOCH3 | OCH3 | H | CH3 | H | H | H | 1 | 630 |
| 134 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | CH3 | 0 | 594 |
| 135 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | CH3 | 0 | 594 |
| 136 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | CH3 | 0 | 576 |
| 137 | NO2 | H | Cl | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | C6H5 | 0 | 594 |
| 138 | NO2 | H | Br | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | C6H5 | 0 | 594 |
| 139 | NO2 | H | H | NO2 | NHCOCH3 | OCH3 | H | CH3 | H | H | C6H5 | 0 | 576 |
| 140 | NO2 | H | Br | NO2 | NHCOCH3 | CH3 | H | CH3 | H | H | H | 0 | 558 |
| 141 | NO2 | H | Cl | NO2 | NHCOCH3 | CH3 | H | CH3 | H | H | H | 0 | 558 |
| 142 | NO2 | H | Cl | H | NHCOCH3 | CH3 | H | CH3 | H | H | H | 0 | 532 |
| 143 | NO2 | H | Br | CN | NHCOCH3 | CH3 | H | CH3 | H | H | H | 0 | 584 |
| 144 | NO2 | H | H | NO2 | NHCOCH3 | CH3 | H | CH3 | H | H | H | 0 | 538 |
| 145 | CH3 | H | CN | CN | NHCOCH3 | H | CH2CH3 | CH3 | H | H | H | 0 | 532 |
4.3 g of 3-amino-5-nitrobenzisothiazole are introduced into a mixture of 11 ml of sulfuric acid (96%) and 4 ml of phosphoric acid (85%). Then, 4.6 ml of nitrosylsulfuric acid (40%) are added dropwise at 10 to 15° C. The mixture is subsequently stirred at 10 to 15° C. for 4 hours. The diazonium salt solution thus obtained is speedily added dropwise to a mixture of 6.6 g of 2-oxopropyl 3-[(5-acetylaminophenyl)ethylamino]-propionate, 100 ml of methanol, 1.1 g of urea and 100 g of ice. The mixture is stirred at room temperature overnight and the precipitate is filtered off with suction, washed with 1:1 methanol/water and dried to leave 7.9 g of the dye of the formula (Ibb)
(λmax [DMF]=622 nm), which dyes polyester in greenish blue shades and has very good wash and sublimation fastnesses.
Examples 147 to 173 of Table 2 were prepared in a similar manner.
| TABLE 2 |
|
|
| Exam- | λMAX | |||||
| ple | D | R1 | R2 | R3 | R5 | [DMF] |
| 147 |
|
NHCOCH3 | OCH3 | H | CH3 | 648 |
| 148 |
|
H | H | CH2CH3 | CH3 | 606 |
| 149 |
|
H | H | CH2C6H5 | CH3 | 594 |
| 150 |
|
CH3 | H | CH2CH3 | CH3 | 618 |
| 151 |
|
H | H | CH2CH3 | CH3 | 622 |
| 152 |
|
CH3 | H | CH2CH3 | CH3 | 636 |
| 153 |
|
CH3 | H | CH2CH3 | CH3 | 562 |
| 154 |
|
H | H | CH2CH3 | CH3 | 550 |
| 155 |
|
H | H | CH2C6H5 | CH3 | 540 |
| 156 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 564 |
| 157 |
|
CH3 | H | CH2CH3 | CH3 | 540 |
| 158 |
|
H | H | CH2CH3 | CH3 | 530 |
| 159 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 542 |
| 160 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 596 |
| 161 |
|
NHCOCH3 | OCH3 | H | CH3 | 608 |
| 162 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 556 |
| 163 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 526 |
| 164 |
|
NHCOCH3 | H | CH2C6H5 | CH3 | 520 |
| 165 |
|
CH3 | H | CH2CH3 | CH3 | 520 |
| 166 |
|
NHCOCH3 | H | CH2CH3 | CH3 | 644 |
| 167 |
|
CH3 | H | CH2CH3 | CH3 | 668 |
| 168 |
|
H | H | CH2CH3 | CH3 | 650 |
| 169 |
|
NHCOCH3 | H | CH2CH3 | CO3 | 604 |
| 170 |
|
CH3 | H | CH2CH3 | CH3 | 607 |
| 171 |
|
H | H | CH2CH3 | CH3 | 592 |
| 172 |
|
NHCOCH3 | OCH3 | CH2CH3 | CH3 | 650 |
| 173 |
|
H | H | CH2CH3 | CH3 | 664 |
A textile fabric consisting of polyester is padded with a liquor consisting of 50 g/l of 8% sodium alginate solution, 100 g/l of 8-12% carob flour ether solution and 5 g/l of monosodium phosphate in water and then dried. The wet pickup is 70%.
The textile thus pretreated is then printed with an aqueous ink prepared in accordance with the procedure described above and containing
- 3.5% of the dye of Example 1,
- 2.5% of Disperbyk 190 dispersant,
- 30% of 1,5-pentanediol,
- 5% of diethylene glycol monomethyl ether,
- 0.01% of Mergal K9N biocide, and
- 58.99% of water
using a drop-on-demand (piezo) ink jet print head. The print is fully dried. Fixing is effected by means of superheated steam at 175° C. for 7 minutes. The print is subsequently subjected to an alkaline reduction clear, rinsed warm and then dried.
Claims (12)
1. A dye of the formula (I)
where
T1 and T2 independently are hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, —SO2(C1-C6)-alkyl, —SO2aryl, cyano, halogen or nitro; and
T4 and T3 independently are hydrogen, halogen, trifluoromethyl, cyano, —SCN, —SO2CH3 or nitro;
although at least one of T1, T2, T3 and T4 is not hydrogen;
or represents a group of the formula (IIb)
where
T5 and T5′ independently are hydrogen or halogen; and
T6 is hydrogen, —SO2CH3, —SCN, (C1-C4)-alkoxy, halogen or nitro;
although at least one of T5, T5′ and T6 is not hydrogen;
or represents a group of the formula (IIc)
where T10 is hydrogen, halogen, nitro or cyano;
T8 is hydrogen, (C1-C6)-alkyl or halogen; and
T9 is nitro, cyano, —COCH3 or —COOT11; where T11 is (C1-C4)-alkyl;
or represents a group of the formula (IIe)
where T13 is phenyl or S-(C1-C4)-alkyl;
R1 is hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, hydroxyl, halogen, —NHCHO, —NHCO(C1-C6)-alkyl, —NHCOaryl, —NHSO2(C1-C6)-alkyl or —NHSO2aryl;
R2 is hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, phenoxy or halogen;
R3 is hydrogen, (C1-C6)-alkyl, substituted (C1-C6)-alkyl, (C3-C4)-alkenyl or substituted (C3-C4)-alkenyl;
or R2 and R3 combine to form the radical —C*H(CH3)CH2C(CH3)2—, where the carbon atom marked by * is attached to the phenyl nucleus;
R4 is hydrogen, (C1-C6)-alkyl or phenyl;
R5 is (C1-C6)-alkyl or substituted (C1-C6)-alkyl;
R6 is hydrogen or (C1-C6)-alkyl;
R7 is hydrogen, (C1-C6)-alkyl or phenyl; and
n 0, 1, 2 or 3;
although the compounds of the formulae
2. The dye as claimed in claim 1 , wherein D represents a group of the formula (IIa)
where
T1 and T2 independently are hydrogen, (C1-C6)-alkyl, (C1-C4)-alkoxy, —SO2(C1-C6)-alkyl, —SO2aryl, cyano, halogen or nitro; and
T4 and T3 independently are hydrogen, halogen, trifluoromethyl, cyano, —SCN, —SO2CH3 or nitro;
although at least one of T1, T2, T3 and T4 is not hydrogen;
or represents a group of the formula (IIb)
where
T5 and T5′ independently are hydrogen or halogen; and
T6 is hydrogen, —SO2CH3, —SCN, (C1-C4)-alkoxy, halogen or nitro;
although at least one of T5, T5′ and T6 is not hydrogen;
or represents a group of the formula (IIc)
where T10 is hydrogen, halogen, nitro or cyano;
T8 is hydrogen, (C1-C6)-alkyl or halogen; and
T9 is nitro, cyano, —COCH3 or —COOT11; where T11 is (C1-C4)-alkyl;
or represents a group of the formula (IIe)
3. The dye as claimed in claim 1 , wherein
R1 is hydrogen, chlorine, methyl, ethyl, methoxy, hydroxyl, ethoxy, acetylamino, propionylamino, benzoylamino, methylsulfonylamino, ethylsulfonylamino or phenylsulfonylamino;
R2 is hydrogen, chlorine, methyl, ethyl, methoxy, ethoxy or phenoxy;
R3 is hydrogen, methyl, ethyl, propyl, butyl, benzyl, phenylethyl, phenoxyethyl, methoxyethyl, cyanoethyl, —C2H4OCOCH3, —C2H4OCOC2H5, —C2H4COOCH3, —C2H4COOC2H5 or allyl;
R4 and R7 are hydrogen, methyl or phenyl;
R5 is methyl or ethyl;
R6 is hydrogen or methyl; and
n is 0 or 1;
although the compounds of the formulae
4. The dye as claimed in claim 2 , wherein
R1 is hydrogen, chlorine, methyl, ethyl, methoxy, hydroxyl, ethoxy, acetylamino, propionylamino, benzoylamino, methylsulfonylamino, ethylsulfonylamino or phenylsulfonylamino;
R2 is hydrogen, chlorine, methyl, ethyl, methoxy, ethoxy or phenoxy;
R3 is hydrogen, methyl, ethyl, propyl, butyl, benzyl, phenylethyl, phenoxyethyl, methoxyethyl, cyanoethyl, —C2H4OCOCH3, —C2H4OCOC2H5, —C2H4COOCH3, —C2H4COOC2H5 or allyl;
R4 and R7 are hydrogen, methyl or phenyl;
R5 is methyl or ethyl;
R6 is hydrogen or methyl; and
n is 0 or 1;
although the compounds of the formulae
6. The dye as claimed in claim 5 , wherein
R1 is acetylamino, propionylamino, benzoylamino or methylsulfonylamino;
R2 is hydrogen, chlorine, methoxy or ethoxy;
R3 is hydrogen, methyl, ethyl, allyl or benzyl;
R4 is hydrogen or methyl;
R5 methyl or ethyl;
R6 is hydrogen or methyl and
R7 is hydrogen, methyl or phenyl.
7. The dye as claimed in claim 5 , conforming to the formula (Iaa)
where
T1 is hydrogen, nitro or methyl;
T2 is hydrogen, nitro or chlorine;
T3 is hydrogen, cyano, chlorine or bromine;
T4 is hydrogen, cyano, nitro, chlorine, bromine or trifluoromethyl;
R1 is hydrogen, hydroxyl, chlorine, methyl, acetylamino, propionylamino, benzoylamino or methylsulfonylamino;
R2 is hydrogen, chlorine, methyl, phenoxy, methoxy or ethoxy;
R3 is hydrogen, methyl, ethyl, butyl, benzyl, phenylethyl, phenoxyethyl or allyl;
R5 is methyl or ethyl; and
R4 and R7 are hydrogen, methyl or phenyl;
although the compounds of the formulae
8. The dye as claimed in claim 7 , wherein T3 is chlorine or bromine and R1 is hydrogen or methyl.
10. A process for dyeing and printing a hydrophobic material which comprises contacting the material with the dye as claimed in claim 1 .
11. An ink for digital textile printing by the ink jet process, comprising the dye of the formula (I) as claimed in claim 1 .
12. An ink for digital textile printing by the ink jet process, comprising the dye of the formula (I) as claimed in claim 8 .
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13/667,106 USRE45686E1 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE102006050642 | 2006-10-27 | ||
| DE102006050642A DE102006050642A1 (en) | 2006-10-27 | 2006-10-27 | New azo dyes with a 2-oxoalkyl ester unit attached to the chromophore, used for dyeing and printing hydrophobic materials, e.g. for digital textile printing by the ink-jet process |
| US13/667,106 USRE45686E1 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
| US12/447,033 US7824450B2 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
| PCT/EP2007/061002 WO2008049758A2 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USRE45686E1 true USRE45686E1 (en) | 2015-09-29 |
Family
ID=39047868
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US13/667,106 Active 2027-10-31 USRE45686E1 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
| US12/447,033 Ceased US7824450B2 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US12/447,033 Ceased US7824450B2 (en) | 2006-10-27 | 2007-10-16 | Disperse dyes, their preparation and their use |
Country Status (13)
| Country | Link |
|---|---|
| US (2) | USRE45686E1 (en) |
| EP (1) | EP2113011B1 (en) |
| JP (1) | JP5635774B2 (en) |
| KR (1) | KR101431853B1 (en) |
| CN (1) | CN101522816B (en) |
| BR (1) | BRPI0718192A2 (en) |
| CA (1) | CA2667542C (en) |
| DE (1) | DE102006050642A1 (en) |
| ES (1) | ES2670396T3 (en) |
| MX (1) | MX2009004435A (en) |
| PT (1) | PT2113011T (en) |
| TW (1) | TWI510558B (en) |
| WO (1) | WO2008049758A2 (en) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TWI352103B (en) * | 2003-12-10 | 2011-11-11 | Clariant Finance Bvi Ltd | Disperse dyes |
| US8105694B2 (en) * | 2005-03-10 | 2012-01-31 | Daikin Industries, Ltd. | Polytetrafluoroethylene aqueous dispersion composition, polytetrafluoroethylene resin film and polytetrafluoroethylene resin impregnated article |
| GB0625624D0 (en) * | 2006-12-21 | 2007-01-31 | Dystar Textilfarben Gmbh & Co | Disperse dye mixtures |
| US9023117B2 (en) | 2009-08-21 | 2015-05-05 | Dystar Colours Deutschland Gmbh | Disperse dye mixtures, their preparation and use |
| DE102009028780A1 (en) | 2009-08-21 | 2011-02-24 | Dystar Colours Deutschland Gmbh | Disperse dye mixtures, their preparation and use |
| DE102011008683A1 (en) | 2011-01-15 | 2012-07-19 | Dystar Colours Distribution Gmbh | Disperse dye mixtures, their preparation and use |
| EP2754698A1 (en) | 2013-01-14 | 2014-07-16 | DyStar Colours Distribution GmbH | High wet-fast disperse dye mixtures |
| EP2754697A1 (en) | 2013-01-14 | 2014-07-16 | DyStar Colours Distribution GmbH | High wet-fast disperse dye mixtures |
| EP4700174A3 (en) * | 2013-01-14 | 2026-03-18 | DyStar Colours Distribution GmbH | High wet fast disperse dye mixtures |
| EP2995653A1 (en) * | 2014-09-15 | 2016-03-16 | DyStar Colours Distribution GmbH | High wet-fast disperse dyes and mixtures thereof |
| CN104479393A (en) * | 2014-11-18 | 2015-04-01 | 昌邑福莱蒽特精细化工有限公司 | Bright red disperse dye with high washing fastness and sublimation fastness and preparation method of bright red disperse dye |
| CN105111104B (en) * | 2015-06-29 | 2017-05-17 | 浙江龙盛集团股份有限公司 | Disperse dye monomer compound, disperse dye preparation and applications of disperse dye preparation |
| CN105001663A (en) * | 2015-07-10 | 2015-10-28 | 俞杏英 | Beta-ketonic ester and benzyl contained high-sublimation-fastness disperse dye compound, and preparation and application thereof |
| EP3178886A1 (en) * | 2015-12-10 | 2017-06-14 | DyStar Colours Distribution GmbH | High wet fast brilliant blue disperse dye mixtures |
| CN105462292A (en) * | 2015-12-24 | 2016-04-06 | 俞杏英 | Disperse dye composition and preparation method and application thereof |
| CN105623309A (en) * | 2016-01-20 | 2016-06-01 | 俞杏英 | High-dye-uptake disperse dye composition as well as preparation method and application thereof |
| CN105542508B (en) * | 2016-01-20 | 2018-02-16 | 俞杏英 | A kind of dispersion dyes monomer compound and its preparation method and application |
| CN105647235A (en) * | 2016-01-20 | 2016-06-08 | 俞杏英 | High dye uptake disperse dye composition and preparation method and application thereof |
| CN105733290A (en) * | 2016-01-28 | 2016-07-06 | 俞杏英 | Monomeric compound of orange disperse dye with high perspiration fastness as well as preparation method and application thereof |
| ES2814375T3 (en) | 2017-10-02 | 2021-03-26 | Dystar Colours Distrib Gmbh | High moisture fast dispersing dye mixtures |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB909843A (en) | 1959-02-10 | 1962-11-07 | Ici Ltd | New monoazo dyestuffs containing ester groups |
| DE2612742A1 (en) | 1975-03-25 | 1976-10-07 | Ici Ltd | DISPERSE MONOAZO DYES |
| WO1995020014A1 (en) | 1994-01-19 | 1995-07-27 | Zeneca Limited | Monoazo dyes containing a fluorosulphonyl group and use thereof |
| EP1411089A1 (en) | 2002-10-18 | 2004-04-21 | Clariant International Ltd. | Azo compounds |
| WO2005056690A1 (en) | 2003-12-10 | 2005-06-23 | Clariant International Ltd | Disperse dyes |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP4579689B2 (en) * | 2002-10-18 | 2010-11-10 | クラリアント ファイナンス (ビーブイアイ) リミティド | Azo compounds |
-
2006
- 2006-10-27 DE DE102006050642A patent/DE102006050642A1/en not_active Withdrawn
-
2007
- 2007-10-16 EP EP07821369.1A patent/EP2113011B1/en active Active
- 2007-10-16 CN CN2007800376130A patent/CN101522816B/en active Active
- 2007-10-16 MX MX2009004435A patent/MX2009004435A/en active IP Right Grant
- 2007-10-16 BR BRPI0718192-2A2A patent/BRPI0718192A2/en not_active IP Right Cessation
- 2007-10-16 US US13/667,106 patent/USRE45686E1/en active Active
- 2007-10-16 KR KR1020097007117A patent/KR101431853B1/en active Active
- 2007-10-16 CA CA2667542A patent/CA2667542C/en not_active Expired - Fee Related
- 2007-10-16 JP JP2009533791A patent/JP5635774B2/en active Active
- 2007-10-16 US US12/447,033 patent/US7824450B2/en not_active Ceased
- 2007-10-16 WO PCT/EP2007/061002 patent/WO2008049758A2/en not_active Ceased
- 2007-10-16 ES ES07821369.1T patent/ES2670396T3/en active Active
- 2007-10-16 PT PT78213691T patent/PT2113011T/en unknown
- 2007-10-25 TW TW096140076A patent/TWI510558B/en active
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB909843A (en) | 1959-02-10 | 1962-11-07 | Ici Ltd | New monoazo dyestuffs containing ester groups |
| DE2612742A1 (en) | 1975-03-25 | 1976-10-07 | Ici Ltd | DISPERSE MONOAZO DYES |
| GB1536429A (en) | 1975-03-25 | 1978-12-20 | Ici Ltd | Disperse monoazo dyestuffs |
| WO1995020014A1 (en) | 1994-01-19 | 1995-07-27 | Zeneca Limited | Monoazo dyes containing a fluorosulphonyl group and use thereof |
| EP1411089A1 (en) | 2002-10-18 | 2004-04-21 | Clariant International Ltd. | Azo compounds |
| WO2005056690A1 (en) | 2003-12-10 | 2005-06-23 | Clariant International Ltd | Disperse dyes |
Non-Patent Citations (1)
| Title |
|---|
| STIC Search Report dated Jun. 29, 2010. * |
Also Published As
| Publication number | Publication date |
|---|---|
| EP2113011A2 (en) | 2009-11-04 |
| US7824450B2 (en) | 2010-11-02 |
| ES2670396T3 (en) | 2018-05-30 |
| KR20090069284A (en) | 2009-06-30 |
| CN101522816B (en) | 2013-02-13 |
| BRPI0718192A2 (en) | 2014-03-25 |
| TWI510558B (en) | 2015-12-01 |
| JP2010507700A (en) | 2010-03-11 |
| CN101522816A (en) | 2009-09-02 |
| PT2113011T (en) | 2018-05-24 |
| MX2009004435A (en) | 2009-05-08 |
| US20100092670A1 (en) | 2010-04-15 |
| JP5635774B2 (en) | 2014-12-03 |
| TW200844183A (en) | 2008-11-16 |
| EP2113011B1 (en) | 2018-02-21 |
| CA2667542A1 (en) | 2008-05-02 |
| WO2008049758A3 (en) | 2009-03-26 |
| CA2667542C (en) | 2014-08-12 |
| DE102006050642A1 (en) | 2008-04-30 |
| KR101431853B1 (en) | 2014-08-25 |
| WO2008049758A2 (en) | 2008-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USRE45686E1 (en) | Disperse dyes, their preparation and their use | |
| US7909891B2 (en) | Azo dyes for dyeing and printing hydrophobic materials | |
| US7871446B2 (en) | Disperse azo dyestuffs | |
| US8696766B2 (en) | Azopyridone disperse dyes, their preparation and use | |
| US7833291B2 (en) | Dispersion dye, the production and use thereof | |
| US8070832B2 (en) | Disperse dyes, their preparation and use | |
| US20090209742A1 (en) | Disperse dyes, production and use | |
| HK1133027A (en) | Disperse dyes, their preparation and their use | |
| HK1146077A (en) | Azo dyes for dyeing and printing hydrophobic materials | |
| HK1142620A (en) | Disperse dyes, their preparation and use | |
| HK1132756A (en) | Disperse azo dyestuffs |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FEPP | Fee payment procedure |
Free format text: 7.5 YR SURCHARGE - LATE PMT W/IN 6 MO, LARGE ENTITY (ORIGINAL EVENT CODE: M1555) |
|
| MAFP | Maintenance fee payment |
Free format text: PAYMENT OF MAINTENANCE FEE, 8TH YEAR, LARGE ENTITY (ORIGINAL EVENT CODE: M1552) Year of fee payment: 8 |
|
| MAFP | Maintenance fee payment |
Free format text: PAYMENT OF MAINTENANCE FEE, 12TH YEAR, LARGE ENTITY (ORIGINAL EVENT CODE: M1553); ENTITY STATUS OF PATENT OWNER: LARGE ENTITY Year of fee payment: 12 |











































































