USD99212S - Design for a mechanical pencil - Google Patents
Design for a mechanical pencil Download PDFInfo
- Publication number
- USD99212S USD99212S US D99212 S USD99212 S US D99212S
- Authority
- US
- United States
- Prior art keywords
- design
- mechanical pencil
- pencil
- peters
- mechanical
- Prior art date
Links
- UXZAXFPFSQRZOZ-UHFFFAOYSA-N Nopalinic acid Chemical compound NCCCC(C(O)=O)NC(C(O)=O)CCC(O)=O UXZAXFPFSQRZOZ-UHFFFAOYSA-N 0.000 description 2
- 230000003340 mental Effects 0.000 description 2
Images
Description
April 7, 1936. w PETERS Des/99,212
MECHANICAL PENCIL Filed June 26, 1955 Eli 3.
- r waiits Patented Apr. 7, 1936 Des,
UNITED STATES PATENT OFFICE DESIGN FOR, A MECHANICAL PENCIL Mark W. Peters, Glen Ridge, N. J., assignor to Eagle Pencil Company, New York, N. Y., a corporation of Delaware Application June 26, 1985, Serial No. 57,411
Term of patent 14 years To all whom it may concern: Figure 1 is a side elevation of a mechanical Be it known that I, Mark W. Peters, a citizen pencil showing my new design; and
of the United States of America, residing at Glen Fig. 2 is a plan view thereof.
Ridge, State of New Jersey, United States of Fig. 3 is an enlarged partial section on the America, have invented a new, original, and ornaline 3-3 of Figure 1.
mental Design for a Mechanical Pencil, of which I claim:
the following is a specification, reference being The ornamental design for a mechanical pencil had to the accompanying drawing, forming part as shown. thereof, in which MARK W. PETERS.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD99212S (en) | Design for a mechanical pencil | |
| USD99213S (en) | Design for a fountain pen | |
| USD119006S (en) | Design for a mechanical pencil | |
| USD107499S (en) | Design fob a pencil tip | |
| USD108548S (en) | Design for a pencil tip | |
| USD95769S (en) | Design for an eraser | |
| USD107745S (en) | Design for a pencil tip | |
| USD113977S (en) | Pencil tip | |
| USD111137S (en) | Design for a tray | |
| USD95915S (en) | Design for a hand telephone | |
| USD103386S (en) | Design for a lead pencil | |
| USD102912S (en) | Design fok a box | |
| USD86740S (en) | Design por a pencil | |
| USD96044S (en) | Design fob a platter | |
| USD88958S (en) | Design for an apron | |
| USD98923S (en) | Design for a serving tray | |
| USD104145S (en) | Design for a straw handbag | |
| USD87385S (en) | Design for a mechanical pencil | |
| USD102863S (en) | Design fob a powder can | |
| USD107500S (en) | Design fob a pencil tip | |
| USD124390S (en) | Design for a pin | |
| USD98610S (en) | Design for a lamp base | |
| USD107498S (en) | Design for a pencil tip | |
| USD119263S (en) | Design fob a lead propelling penctt | |
| USD109737S (en) | Design for a ring mounting |