USD97296S - Design for a hand mirror or the like - Google Patents
Design for a hand mirror or the like Download PDFInfo
- Publication number
- USD97296S USD97296S US D97296 S USD97296 S US D97296S
- Authority
- US
- United States
- Prior art keywords
- design
- hand mirror
- hand
- mirror
- cecil
- Prior art date
Links
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 2
Images
Description
UNITED STATES PATENT OFFICE DESIGN FOR A HAND MIRROR OR THE LIKE Cecil H. Lawrence, Attleboro, Mass, assignor to Evans Case Company, a corporation of Massaehusetts Application September 12, 1935, Serial No. 58,538
Term of patent 3% years To all whom it may concern: Figure 1 is a front view of a hand mirror or the Be it known that I, Cecil H. Lawrence, a citilike showing my design.
zen of the United States, residing at Attleboro, Fig. 2 is a side view of the same.
county of Bristol, and State of Massachusetts, I claim:
have invented a new, original, and ornamental The ornamental design for a hand mirror or Design for Hand Mirrors or the like, of which the like as shown.
the following is a specification, reference being had to the accompanying drawing, forming a part CECIL LAWRENCE thereof.
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
USD97296S (en) | Design for a hand mirror or the like | |
USD91040S (en) | Design for a hand mirror or the | |
USD91039S (en) | Design for a hand mirror or the | |
USD98398S (en) | Design for a hand mirror | |
USD91668S (en) | Design for a hand mirror or the like | |
USD93278S (en) | Design fob a hand mirror ob the like | |
USD91035S (en) | Design for a hand mirror or the | |
USD91036S (en) | Design fob a hand mirror or the | |
USD91038S (en) | Design for a hand mirror or the | |
USD91669S (en) | Design for a hand mirror or the uke | |
USD91037S (en) | Design fob a hand mirror or the | |
USD98910S (en) | Design for a bracelet | |
USD122627S (en) | Design for a hand-mirror frame or the like | |
USD90645S (en) | Design for an ornamental cross | |
USD102507S (en) | Design fob jeweled metal trimming | |
USD84363S (en) | Design fob | |
USD102508S (en) | Design for jeweled metal trimming | |
USD120716S (en) | Design for a hand mirror frame or the like | |
USD116991S (en) | Design for a compact or the like | |
USD92927S (en) | Design for a brooch | |
USD113222S (en) | Design for a pendant or similar | |
USD101075S (en) | Design for a spoon or similar | |
USD100908S (en) | Design fob a lace | |
USD100888S (en) | Design for a spoon or other article | |
USD118782S (en) | Design fob an atomizer |