USD960563S1 - Handbag - Google Patents
Handbag Download PDFInfo
- Publication number
- USD960563S1 USD960563S1 US35/355,112 US35511233F USD960563S US D960563 S1 USD960563 S1 US D960563S1 US 35511233 F US35511233 F US 35511233F US D960563 S USD960563 S US D960563S
- Authority
- US
- United States
- Prior art keywords
- handbag
- color
- ornamental design
- design
- atelier
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PITMOJXAHYPVLG-UHFFFAOYSA-N 2-acetyloxybenzoic acid;n-(4-ethoxyphenyl)acetamide;1,3,7-trimethylpurine-2,6-dione Chemical compound CCOC1=CC=C(NC(C)=O)C=C1.CC(=O)OC1=CC=CC=C1C(O)=O.CN1C(=O)N(C)C(=O)C2=C1N=CN2C PITMOJXAHYPVLG-UHFFFAOYSA-N 0.000 description 1
Images
Classifications
-
- A—HUMAN NECESSITIES
- A45—HAND OR TRAVELLING ARTICLES
- A45C—PURSES; LUGGAGE; HAND CARRIED BAGS
- A45C3/00—Flexible luggage; Handbags
- A45C3/06—Ladies' handbags
Description
The patent or application file contains at least one drawing executed in color. Copies of this patent or patent application publication with color drawing(s) will be provided by the Office upon request and payment of the necessary fee.
1. Handbag
The text “A.P.C.” forming part of the claimed design is a registered trademark of Atelier de Production et de Creation.
Claims (1)
- The ornamental design for handbag, as shown and described.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US35/355,112 USD960563S1 (en) | 2020-10-16 | 2020-10-16 | Handbag |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US35/355,112 USD960563S1 (en) | 2020-10-16 | 2020-10-16 | Handbag |
Publications (1)
Publication Number | Publication Date |
---|---|
USD960563S1 true USD960563S1 (en) | 2022-08-16 |
Family
ID=82781524
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US35/355,112 Active USD960563S1 (en) | 2020-10-16 | 2020-10-16 | Handbag |
Country Status (1)
Country | Link |
---|---|
US (1) | USD960563S1 (en) |
Cited By (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD973353S1 (en) * | 2021-03-10 | 2022-12-27 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
USD975995S1 (en) * | 2021-03-22 | 2023-01-24 | Fendi S.R.L. | Bag |
USD984802S1 (en) * | 2023-02-14 | 2023-05-02 | Olivia Laws | Handbag |
USD986596S1 (en) * | 2023-02-14 | 2023-05-23 | Olivia Laws | Handle for handbag |
USD987992S1 (en) * | 2022-05-06 | 2023-06-06 | Furla S.P.A. | Bag |
USD1001490S1 (en) * | 2021-06-18 | 2023-10-17 | Cartier International Ag | Bag |
USD1007144S1 (en) * | 2022-02-21 | 2023-12-12 | Salvatore Ferragamo S.P.A. | Handbag |
USD1015736S1 (en) * | 2022-09-05 | 2024-02-27 | Valentino S.P.A. | Bag |
Citations (59)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD273833S (en) * | 1982-01-18 | 1984-05-15 | Taylor William A B | Insulated pouch for beer kegs |
USD421178S (en) * | 1998-09-14 | 2000-02-29 | Dandini Peter S | Carryall-beach blanket combination |
USD433803S (en) * | 1999-09-09 | 2000-11-21 | Louis Vuitton Malletier, S.A. | Handbag |
USD439041S1 (en) * | 2000-01-31 | 2001-03-20 | Philippe Cassegrain, S.A. | Handbag |
USD445567S1 (en) * | 1999-09-10 | 2001-07-31 | Cartier International B.V. | Handbag |
USD480621S1 (en) * | 2002-09-27 | 2003-10-14 | Renny Tse-Haw Ling | Zipper lock |
USD510661S1 (en) * | 2004-07-29 | 2005-10-18 | Valextra S.R.L. | Handbag |
USD537627S1 (en) * | 2003-04-22 | 2007-03-06 | Maximino Vazquez | Gathered bag |
USD570189S1 (en) * | 2007-04-23 | 2008-06-03 | Schlatter Pius H | Luggage lock |
USD570191S1 (en) * | 2007-04-23 | 2008-06-03 | Schlatter Pius H | Luggage lock |
USD580166S1 (en) * | 2007-07-11 | 2008-11-11 | J. Choo Limited | Handbag |
USD580165S1 (en) * | 2006-07-26 | 2008-11-11 | Celine | Handbag |
USD582157S1 (en) * | 2008-03-11 | 2008-12-09 | Design Sportswears | Handbag |
USD650988S1 (en) * | 2010-05-10 | 2011-12-27 | Lancel International S.A. | Handbag |
USD653031S1 (en) * | 2010-06-11 | 2012-01-31 | Peter Reisenthel | Handle bag with rivets |
USD653457S1 (en) * | 2010-04-22 | 2012-02-07 | Tod's S.P.A. | Textured material |
USD655583S1 (en) * | 2010-06-21 | 2012-03-13 | Mary Lou Palazzolo | Lunch purse |
USD655500S1 (en) * | 2010-06-22 | 2012-03-13 | Bottega Veneta International S.A.R.L. | Handbag |
USD655913S1 (en) * | 2011-05-10 | 2012-03-20 | Design Sportswears | Handbag |
USD663522S1 (en) * | 2011-02-10 | 2012-07-17 | Wendela Schiffman | Tote bag |
USD688450S1 (en) * | 2011-12-07 | 2013-08-27 | Celine | Handbag |
USD696860S1 (en) * | 2012-06-06 | 2014-01-07 | S.A.S. Jean Cassegrain | Handbag |
USD698146S1 (en) * | 2013-02-06 | 2014-01-28 | Yves Saint Laurent | Handbag |
USD712654S1 (en) * | 2013-01-28 | 2014-09-09 | Alexander Wang Incorporated | Bag with skeletal corners |
USD717043S1 (en) * | 2013-07-17 | 2014-11-11 | Thirty-One Gifts Llc | Backpack purse |
USD717540S1 (en) * | 2013-05-17 | 2014-11-18 | Fendi Adele S.R.L. | Handbag |
USD719349S1 (en) * | 2013-02-20 | 2014-12-16 | Furla S.P.A. | Handbag |
USD721889S1 (en) * | 2013-02-27 | 2015-02-03 | Christian Dior Couture, S.A. | Handbag |
USD728227S1 (en) * | 2014-01-15 | 2015-05-05 | Louis Vuitton Malletier | Handbag |
USD728225S1 (en) * | 2013-09-16 | 2015-05-05 | The Cambridge Satchel Company Limited | Handbag |
USD728925S1 (en) * | 2012-02-15 | 2015-05-12 | Diane Von Furstenberg Studio, L.P. | Bag with tablet holder |
USD730045S1 (en) * | 2013-08-19 | 2015-05-26 | Bentley Motors Limited | Bag |
USD730046S1 (en) * | 2013-09-24 | 2015-05-26 | Folli-Follie Commercial Manufacturing And Technical Societe Anonyme | Purse |
USD745270S1 (en) * | 2014-08-27 | 2015-12-15 | Yamashita Kogyosho Co., Ltd. | Carrying bag for a laptop or the like |
USD761015S1 (en) * | 2013-12-05 | 2016-07-12 | Moynat Paris Sas | Handbag |
USD761557S1 (en) * | 2014-07-17 | 2016-07-19 | Marni Group S.R.L. | Handbag |
USD764166S1 (en) * | 2014-09-08 | 2016-08-23 | Louis Vuitton Malletier | Handbag |
USD765969S1 (en) * | 2014-09-24 | 2016-09-13 | Christian Dior Couture | Handbag |
USD767270S1 (en) * | 2014-12-12 | 2016-09-27 | Bottega Veneta Sa | Handbag |
USD767886S1 (en) * | 2014-09-08 | 2016-10-04 | Louis Vuitton Malletier | Handbag |
USD768379S1 (en) * | 2014-06-19 | 2016-10-11 | Dongguan Shijin Industrial Co., Ltd. | Silicone handbag |
USD773809S1 (en) * | 2015-02-12 | 2016-12-13 | Chillinder Coolers, LLC | Bag |
USD775822S1 (en) * | 2014-08-06 | 2017-01-10 | Hermes Sellier (Societe Par Actions Simplifiee) | Bag |
USD775820S1 (en) * | 2015-09-04 | 2017-01-10 | Valentino S.P.A. | Bag |
USD785934S1 (en) * | 2015-09-02 | 2017-05-09 | Bottega Veneta Sa | Handbag |
USD789684S1 (en) * | 2015-08-25 | 2017-06-20 | Guccio Gucci S.P.A. | Handbag |
USD802298S1 (en) * | 2016-01-13 | 2017-11-14 | Valentino S.P.A. | Bag |
USD803554S1 (en) * | 2015-06-05 | 2017-11-28 | Bottega Veneta Sa | Handbag |
USD808647S1 (en) * | 2016-05-31 | 2018-01-30 | Celine | Handbag |
USD814789S1 (en) * | 2016-07-27 | 2018-04-10 | Hermes Sellier (Societe Par Actions Simplifiee) | Bag |
USD826555S1 (en) * | 2016-12-09 | 2018-08-28 | Valentino S.P.A. | Bag |
USD828022S1 (en) * | 2017-02-23 | 2018-09-11 | Bottega Veneta Sa | Handbag |
USD830058S1 (en) * | 2017-07-26 | 2018-10-09 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
USD830690S1 (en) * | 2016-09-07 | 2018-10-16 | Valentino S.P.A. | Bag |
USD834824S1 (en) * | 2016-09-22 | 2018-12-04 | Trussardi S.P.A. | Handbag with applied ornament |
USD871063S1 (en) * | 2017-10-03 | 2019-12-31 | Louis Vuitton Malletier | Handbag |
USD878745S1 (en) * | 2017-11-08 | 2020-03-24 | Salvatore Ferragamo S.P.A. | Handbag |
USD935174S1 (en) * | 2020-02-10 | 2021-11-09 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
USD935767S1 (en) * | 2019-06-05 | 2021-11-16 | Paloise Sas | Handbag |
-
2020
- 2020-10-16 US US35/355,112 patent/USD960563S1/en active Active
Patent Citations (64)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD273833S (en) * | 1982-01-18 | 1984-05-15 | Taylor William A B | Insulated pouch for beer kegs |
USD421178S (en) * | 1998-09-14 | 2000-02-29 | Dandini Peter S | Carryall-beach blanket combination |
USD433803S (en) * | 1999-09-09 | 2000-11-21 | Louis Vuitton Malletier, S.A. | Handbag |
USD445567S1 (en) * | 1999-09-10 | 2001-07-31 | Cartier International B.V. | Handbag |
USD439041S1 (en) * | 2000-01-31 | 2001-03-20 | Philippe Cassegrain, S.A. | Handbag |
USD480621S1 (en) * | 2002-09-27 | 2003-10-14 | Renny Tse-Haw Ling | Zipper lock |
USD537627S1 (en) * | 2003-04-22 | 2007-03-06 | Maximino Vazquez | Gathered bag |
USD510661S1 (en) * | 2004-07-29 | 2005-10-18 | Valextra S.R.L. | Handbag |
USD580165S1 (en) * | 2006-07-26 | 2008-11-11 | Celine | Handbag |
USD570189S1 (en) * | 2007-04-23 | 2008-06-03 | Schlatter Pius H | Luggage lock |
USD570191S1 (en) * | 2007-04-23 | 2008-06-03 | Schlatter Pius H | Luggage lock |
USD580166S1 (en) * | 2007-07-11 | 2008-11-11 | J. Choo Limited | Handbag |
USD582157S1 (en) * | 2008-03-11 | 2008-12-09 | Design Sportswears | Handbag |
USD653457S1 (en) * | 2010-04-22 | 2012-02-07 | Tod's S.P.A. | Textured material |
USD651402S1 (en) * | 2010-05-10 | 2012-01-03 | Lancel International S.A. | Handbag |
USD650988S1 (en) * | 2010-05-10 | 2011-12-27 | Lancel International S.A. | Handbag |
USD653031S1 (en) * | 2010-06-11 | 2012-01-31 | Peter Reisenthel | Handle bag with rivets |
USD655583S1 (en) * | 2010-06-21 | 2012-03-13 | Mary Lou Palazzolo | Lunch purse |
USD655500S1 (en) * | 2010-06-22 | 2012-03-13 | Bottega Veneta International S.A.R.L. | Handbag |
USD663522S1 (en) * | 2011-02-10 | 2012-07-17 | Wendela Schiffman | Tote bag |
USD655913S1 (en) * | 2011-05-10 | 2012-03-20 | Design Sportswears | Handbag |
USD688450S1 (en) * | 2011-12-07 | 2013-08-27 | Celine | Handbag |
USD728925S1 (en) * | 2012-02-15 | 2015-05-12 | Diane Von Furstenberg Studio, L.P. | Bag with tablet holder |
USD696860S1 (en) * | 2012-06-06 | 2014-01-07 | S.A.S. Jean Cassegrain | Handbag |
USD712654S1 (en) * | 2013-01-28 | 2014-09-09 | Alexander Wang Incorporated | Bag with skeletal corners |
USD698146S1 (en) * | 2013-02-06 | 2014-01-28 | Yves Saint Laurent | Handbag |
USD719349S1 (en) * | 2013-02-20 | 2014-12-16 | Furla S.P.A. | Handbag |
USD721889S1 (en) * | 2013-02-27 | 2015-02-03 | Christian Dior Couture, S.A. | Handbag |
USD717540S1 (en) * | 2013-05-17 | 2014-11-18 | Fendi Adele S.R.L. | Handbag |
USD717043S1 (en) * | 2013-07-17 | 2014-11-11 | Thirty-One Gifts Llc | Backpack purse |
USD730045S1 (en) * | 2013-08-19 | 2015-05-26 | Bentley Motors Limited | Bag |
USD728225S1 (en) * | 2013-09-16 | 2015-05-05 | The Cambridge Satchel Company Limited | Handbag |
USD730046S1 (en) * | 2013-09-24 | 2015-05-26 | Folli-Follie Commercial Manufacturing And Technical Societe Anonyme | Purse |
USD761015S1 (en) * | 2013-12-05 | 2016-07-12 | Moynat Paris Sas | Handbag |
USD728227S1 (en) * | 2014-01-15 | 2015-05-05 | Louis Vuitton Malletier | Handbag |
USD768379S1 (en) * | 2014-06-19 | 2016-10-11 | Dongguan Shijin Industrial Co., Ltd. | Silicone handbag |
USD761557S1 (en) * | 2014-07-17 | 2016-07-19 | Marni Group S.R.L. | Handbag |
USD775822S1 (en) * | 2014-08-06 | 2017-01-10 | Hermes Sellier (Societe Par Actions Simplifiee) | Bag |
USD745270S1 (en) * | 2014-08-27 | 2015-12-15 | Yamashita Kogyosho Co., Ltd. | Carrying bag for a laptop or the like |
USD767886S1 (en) * | 2014-09-08 | 2016-10-04 | Louis Vuitton Malletier | Handbag |
USD764166S1 (en) * | 2014-09-08 | 2016-08-23 | Louis Vuitton Malletier | Handbag |
USD765969S1 (en) * | 2014-09-24 | 2016-09-13 | Christian Dior Couture | Handbag |
USD767270S1 (en) * | 2014-12-12 | 2016-09-27 | Bottega Veneta Sa | Handbag |
USD773809S1 (en) * | 2015-02-12 | 2016-12-13 | Chillinder Coolers, LLC | Bag |
USD806385S1 (en) * | 2015-06-05 | 2018-01-02 | Bottega Veneta Sa | Handbag |
USD803554S1 (en) * | 2015-06-05 | 2017-11-28 | Bottega Veneta Sa | Handbag |
USD803555S1 (en) * | 2015-06-05 | 2017-11-28 | Bottega Veneta Sa | Handbag |
USD804170S1 (en) * | 2015-06-05 | 2017-12-05 | Bottega Veneta Sa | Handbag |
USD789684S1 (en) * | 2015-08-25 | 2017-06-20 | Guccio Gucci S.P.A. | Handbag |
USD785934S1 (en) * | 2015-09-02 | 2017-05-09 | Bottega Veneta Sa | Handbag |
USD775820S1 (en) * | 2015-09-04 | 2017-01-10 | Valentino S.P.A. | Bag |
USD802298S1 (en) * | 2016-01-13 | 2017-11-14 | Valentino S.P.A. | Bag |
USD808647S1 (en) * | 2016-05-31 | 2018-01-30 | Celine | Handbag |
USD814789S1 (en) * | 2016-07-27 | 2018-04-10 | Hermes Sellier (Societe Par Actions Simplifiee) | Bag |
USD830690S1 (en) * | 2016-09-07 | 2018-10-16 | Valentino S.P.A. | Bag |
USD834824S1 (en) * | 2016-09-22 | 2018-12-04 | Trussardi S.P.A. | Handbag with applied ornament |
USD835415S1 (en) * | 2016-09-22 | 2018-12-11 | Trussardi S.P.A. | Handbag with applied ornament |
USD826555S1 (en) * | 2016-12-09 | 2018-08-28 | Valentino S.P.A. | Bag |
USD828022S1 (en) * | 2017-02-23 | 2018-09-11 | Bottega Veneta Sa | Handbag |
USD830058S1 (en) * | 2017-07-26 | 2018-10-09 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
USD871063S1 (en) * | 2017-10-03 | 2019-12-31 | Louis Vuitton Malletier | Handbag |
USD878745S1 (en) * | 2017-11-08 | 2020-03-24 | Salvatore Ferragamo S.P.A. | Handbag |
USD935767S1 (en) * | 2019-06-05 | 2021-11-16 | Paloise Sas | Handbag |
USD935174S1 (en) * | 2020-02-10 | 2021-11-09 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
Cited By (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD973353S1 (en) * | 2021-03-10 | 2022-12-27 | Hermes Sellier (Société par Actions Simplifiée) | Bag |
USD975995S1 (en) * | 2021-03-22 | 2023-01-24 | Fendi S.R.L. | Bag |
USD1001490S1 (en) * | 2021-06-18 | 2023-10-17 | Cartier International Ag | Bag |
USD1001492S1 (en) * | 2021-06-18 | 2023-10-17 | Cartier International Ag | Bag |
USD1007144S1 (en) * | 2022-02-21 | 2023-12-12 | Salvatore Ferragamo S.P.A. | Handbag |
USD987992S1 (en) * | 2022-05-06 | 2023-06-06 | Furla S.P.A. | Bag |
USD1015736S1 (en) * | 2022-09-05 | 2024-02-27 | Valentino S.P.A. | Bag |
USD984802S1 (en) * | 2023-02-14 | 2023-05-02 | Olivia Laws | Handbag |
USD986596S1 (en) * | 2023-02-14 | 2023-05-23 | Olivia Laws | Handle for handbag |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
USD960563S1 (en) | Handbag | |
USD972010S1 (en) | Mountable chart | |
USD972011S1 (en) | Mountable chart | |
USD972021S1 (en) | Mountable chart | |
USD972016S1 (en) | Mountable chart | |
USD953916S1 (en) | Ring | |
USD947389S1 (en) | Belt | |
USD966139S1 (en) | Charm | |
USD972022S1 (en) | Mountable chart | |
USD972012S1 (en) | Mountable chart | |
USD972014S1 (en) | Mountable chart | |
USD972024S1 (en) | Mountable chart | |
USD972023S1 (en) | Mountable chart | |
USD972019S1 (en) | Mountable chart | |
USD972018S1 (en) | Mountable chart | |
USD972017S1 (en) | Mountable chart | |
USD969004S1 (en) | Ring | |
USD955478S1 (en) | Label | |
USD935529S1 (en) | Label | |
USD1004337S1 (en) | Doormat | |
USD961679S1 (en) | Label | |
USD1004461S1 (en) | Ring | |
USD971325S1 (en) | Label | |
USD945917S1 (en) | Pendant | |
USD1003351S1 (en) | Label |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FEPP | Fee payment procedure |
Free format text: ENTITY STATUS SET TO UNDISCOUNTED (ORIGINAL EVENT CODE: BIG.); ENTITY STATUS OF PATENT OWNER: LARGE ENTITY |