USD95278S - Design for a teapot - Google Patents
Design for a teapot Download PDFInfo
- Publication number
- USD95278S USD95278S US D95278 S USD95278 S US D95278S
- Authority
- US
- United States
- Prior art keywords
- teapot
- design
- mills
- des
- edna
- Prior art date
Links
- QCOXCILKVHKOGO-UHFFFAOYSA-N N-(2-nitramidoethyl)nitramide Chemical compound [O-][N+](=O)NCCN[N+]([O-])=O QCOXCILKVHKOGO-UHFFFAOYSA-N 0.000 description 1
- 210000001138 Tears Anatomy 0.000 description 1
- 235000020639 clam Nutrition 0.000 description 1
- 230000003340 mental Effects 0.000 description 1
Images
Description
'April 16, 1935. E. c. MILLS f l y Des, 95-,278 CY TEAPoT Filed July 1934 Patented Apr. 16, 1935 i Des,
UNITED STATES PATENT GFFICE DESIGN FOR A TEAPGT Edna Clark Mills, Des Moines, Iowa Application July 27, 1934, Serial No. 52,713
Term of patent 3%. years To all whom it may concern: Figure 1 is a top plan view of the teapot, show- Be it known that I, Edna Clark Mills, a citizen ing my design.
of the United States, and a resident of Des Figure 2 iS a I'Ont elevational View.
Moines, in the county of Polk and State of Iowa, Figure 3 is a Side elevational view.
have invented a certain new, original, and orna- Figure 4 S a Tear elevational View.
mental Design for a Teapot, of which the fol- I Clam lowing is a specification, reference being had to The Ornamental design OI a teapot 21S ShOWllthe accompanying drawing, forming part hereof, DBS Moines, IOWS', NOVember 4, 1933.
in Which EDNA CLARK MILLS.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD95278S (en) | Design for a teapot | |
| USD104225S (en) | Design for a brush | |
| USD91958S (en) | Design fob a shoe | |
| USD92755S (en) | Design fob a shoe | |
| USD92862S (en) | Design fob a shoe | |
| USD92860S (en) | Design fob a shoe | |
| USD110140S (en) | Design fob a pitcher top ob similar | |
| USD92727S (en) | Design fob a shoe | |
| USD93061S (en) | Design for a shoe | |
| USD92754S (en) | Design for a shoe | |
| USD92861S (en) | Design for a shoe | |
| USD94248S (en) | Design for an aquarium | |
| USD92916S (en) | Design for a shoe | |
| USD92745S (en) | Design fob a shoe | |
| USD92856S (en) | Design fob a shoe | |
| USD114316S (en) | Design fob a shoe or the like | |
| USD92858S (en) | Design fob a shoe | |
| USD90258S (en) | Charles miller | |
| USD97524S (en) | Design fob a shoe top protector | |
| USD93635S (en) | Design for a shoe | |
| USD92741S (en) | Design fob a shoe | |
| USD90499S (en) | Design for a shoe | |
| USD101472S (en) | Design for a vanity case | |
| USD92972S (en) | Design for a shoe | |
| USD109394S (en) | Design for a ring |