USD94862S - Design fob a bottle - Google Patents
Design fob a bottle Download PDFInfo
- Publication number
- USD94862S USD94862S US D94862 S USD94862 S US D94862S
- Authority
- US
- United States
- Prior art keywords
- bottle
- design fob
- design
- wheeling
- fob
- Prior art date
Links
- CFCUWKMKBJTWLW-BKHRDMLASA-N Mithramycin Chemical compound O([C@@H]1C[C@@H](O[C@H](C)[C@H]1O)OC=1C=C2C=C3C[C@H]([C@@H](C(=O)C3=C(O)C2=C(O)C=1C)O[C@@H]1O[C@H](C)[C@@H](O)[C@H](O[C@@H]2O[C@H](C)[C@H](O)[C@H](O[C@@H]3O[C@H](C)[C@@H](O)[C@@](C)(O)C3)C2)C1)[C@H](OC)C(=O)[C@@H](O)[C@@H](C)O)[C@H]1C[C@@H](O)[C@H](O)[C@@H](C)O1 CFCUWKMKBJTWLW-BKHRDMLASA-N 0.000 description 1
Images
Description
March 12, 1935. F, MITH 7 Des. 94,862
BOTTLE Filed Jan. 18, 1935 Patented Mar. 12, 1935 D UNITED STATES PATENT OFFICE DESIGN FOR A BOTTLE Frasier Smith, Wheeling, W. Va., assignor to Hazel-Atlas Glass Company, Wheeling, W. Va., a corporation of West Virginia Application January 18, 1935, Serial No. 54,907
Term of patent 14 years To all whom it may concern: Figure 1 is a perspective view of a bottle show- Be it known that I, Frasier Smith, a citizen of ing my new design; and
the United States, residing at Wheeling, in the Figure 2 is an edge view thereof.
county of Ohio and State of West Virginia, have I claim:
invented a new, original, and ornamental De- The ornamental design for a bottle, as shown. sign for a Bottle, of which the following is a specification, reference being had to the accom- FRASIER SMITH.
panying drawing, forming part thereof,
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD94862S (en) | Design fob a bottle | |
| USD94864S (en) | Design fob a bottle | |
| USD93526S (en) | Design for a bottle | |
| USD97512S (en) | Design for a bottle | |
| USD95419S (en) | Design fob a jab | |
| USD101563S (en) | Design for a jar | |
| USD94861S (en) | Design fob a jab | |
| USD114370S (en) | Design fob a jab | |
| USD110882S (en) | Design fob a jab | |
| USD102456S (en) | Design for a jar | |
| USD112706S (en) | Design fob a jar | |
| USD93752S (en) | Design for a bottle | |
| USD93296S (en) | Design for a tumbler | |
| USD99374S (en) | Design for a bottle | |
| USD94863S (en) | Design for a bottle | |
| USD97102S (en) | Design fob a jar | |
| USD89976S (en) | Frasier smith | |
| USD122472S (en) | Design for a jar | |
| USD106872S (en) | Design for an ashtray | |
| USD120146S (en) | Design for a drinking glass | |
| USD118727S (en) | Design fob a pitcher | |
| USD98894S (en) | Design for an ashtray | |
| USD94246S (en) | Design fob a bottle | |
| USD130857S (en) | Design for a drinking glass | |
| USD87238S (en) | peregoy |