USD94087S - Design for a clasp loop fob garters - Google Patents
Design for a clasp loop fob garters Download PDFInfo
- Publication number
- USD94087S USD94087S US D94087 S USD94087 S US D94087S
- Authority
- US
- United States
- Prior art keywords
- garters
- design
- fob
- loop
- clasp loop
- Prior art date
Links
- 241001466538 Gymnogyps Species 0.000 description 2
- HSMVPDGQOIQYSR-KGENOOAVSA-N triflumizole Chemical compound C1=CN=CN1C(/COCCC)=N/C1=CC=C(Cl)C=C1C(F)(F)F HSMVPDGQOIQYSR-KGENOOAVSA-N 0.000 description 2
Images
Description
Dec. 18, 1934. frI A, KNOLL l Des. 94,087
CLASP LOOP FOR GARTERS OR THE: LIKE Filed Aug. 4, 1934 /4 TTU/@Aff Y6.
Patented Dec, 18, 1934 UNITED STATES Des. 94,087
PATENT OFFICE DESIGN FOR A CLASP LOOP FOR GARTERS OR THE LIKE Floyd A. Knoll, Bualo, N. Y., assignor to Condor Products, Inc., Buialo, N. Y.
Application August 4, 1934, Serial No. 52,816
Term of patent 14 years To all whom it may concern:
Be it known that I, Floyd A. Knoll, a citizen of the United States, residing at Buialo, Erie County, State of New York, have invented a new, orginal, and ornamental Design for a Clasp Loop for Garters or the like, of which the following is a specification, reference being had to the accompanying drawing, forming a part thereof.
In said drawing:
Fig. 1 is a front elevation of a clasp loop for garters or the like embodying my design.
Fig. 2 is a side elevation thereof,
Fig. 3 is a transverse section thereof, on line 3-3, Fig. 1.
In the drawing, the dominant feature of the design is found in the upper portion of the loop, such as above approximately the section line 3 3, including both the inner and outer contour and the aperture or loop at the top of the same.
I claim:
The ornamental design for a clasp loop for garters or the like, substantially as shown and described.
FLOYD A. KNOLL,
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD94087S (en) | Design for a clasp loop fob garters | |
| USD103159S (en) | Design for suspenders | |
| USD93170S (en) | Design for a garter | |
| USD103173S (en) | Design for suspenders | |
| USD94012S (en) | Design fob an ice bowl | |
| USD92300S (en) | Design fob a shoe | |
| USD92858S (en) | Design fob a shoe | |
| USD97807S (en) | Design fob a scale | |
| USD92730S (en) | Design for a shoe | |
| USD92741S (en) | Design fob a shoe | |
| USD92755S (en) | Design fob a shoe | |
| USD93001S (en) | Design for a cigarette holder or | |
| USD90497S (en) | Design fob a shoe | |
| USD92862S (en) | Design fob a shoe | |
| USD91958S (en) | Design fob a shoe | |
| USD94177S (en) | Design for a shoe | |
| USD93802S (en) | Design fob a shoe | |
| USD101280S (en) | Design fob a jug ob similab abticle | |
| USD94711S (en) | Design fob a leg fob a stove ob | |
| USD93165S (en) | Design for a buckle | |
| USD92016S (en) | Design for a shoe | |
| USD93061S (en) | Design for a shoe | |
| USD95649S (en) | Design for a plate ok similar | |
| USD95760S (en) | Design fob a plate or similar article | |
| USD92753S (en) | Design for a shoe |