USD93911S - Design for a burial vault - Google Patents
Design for a burial vault Download PDFInfo
- Publication number
- USD93911S USD93911S US D93911 S USD93911 S US D93911S
- Authority
- US
- United States
- Prior art keywords
- design
- burial vault
- burial
- vault
- ohio
- Prior art date
Links
- 238000009933 burial Methods 0.000 title description 12
- 229910000831 Steel Inorganic materials 0.000 description 2
- IBBLRJGOOANPTQ-JKVLGAQCSA-N quinapril hydrochloride Chemical compound Cl.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CC2=CC=CC=C2C1)C(O)=O)CC1=CC=CC=C1 IBBLRJGOOANPTQ-JKVLGAQCSA-N 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
Images
Description
Nov. 27, 1934. H. COHEN Des. 93,911
BURIAL VAULT Filed Sept. 24, 1934 INVENTOR ATTORNEY-5 Patented Nov. 27, 1934 UNITED STATES Des. 93,911
PATENT OFFKIE DESIGN FOR A BURIAL VAULT Harry Cohen, Gallon, Ohio, assignor to The Perfection Steel Body Company, Galion, Ohio,
a corporation Application September 24, 1934, Serial No. 53,391
Term of patent 14 years To all whom it may concern:
Be it known that I, HARRY Conan, a citizen of the United States, residing at Galion, in the county of Crawford and State of Ohio, have invented a new, original, and ornamental Design for a. Burial Vault, of which the following is a specification, reference being had to the accompanying drawing, forming a part thereof, in which The figure is a perspective view of a burial vault showing my new design.
I claim:- The ornamental design for a burial vaidt, substantially as shown.
HARRY COHEN.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD93911S (en) | Design for a burial vault | |
| USD93349S (en) | Design for a burial vault | |
| USD93383S (en) | Design for a burial vault | |
| USD90398S (en) | Design fob a burial vault | |
| USD90397S (en) | Design fob a burial vault | |
| USD99778S (en) | Design fob a burial vault | |
| USD93381S (en) | Design foe a burial vault | |
| USD92881S (en) | Design fob a bubial vault | |
| USD89804S (en) | Egbert f | |
| USD92390S (en) | Design for a burial vault | |
| USD107324S (en) | Design for a grave vault | |
| USD87562S (en) | Design for a burial vault | |
| USD97998S (en) | Design fob a burial case | |
| USD90076S (en) | Design for a grave vault | |
| USD89739S (en) | of galion | |
| USD91550S (en) | Design for a burial vault | |
| USD92982S (en) | Design fok a bukial vault | |
| USD87588S (en) | Design for a burial vault | |
| USD101250S (en) | Design fob a burial vault | |
| USD100022S (en) | Design foe a burial vault handle | |
| USD87589S (en) | Design for a burial vatjlt | |
| USD104441S (en) | Design for a dump body | |
| USD88293S (en) | henbebson | |
| USD88891S (en) | Design for a burial casket | |
| USD100023S (en) | Design fob a grave vatjlt |