USD91210S - Design for a cabinet - Google Patents
Design for a cabinet Download PDFInfo
- Publication number
- USD91210S USD91210S US D91210 S USD91210 S US D91210S
- Authority
- US
- United States
- Prior art keywords
- cabinet
- design
- springvale
- morin
- maine
- Prior art date
Links
- YXOLAZRVSSWPPT-UHFFFAOYSA-N 3,5,7,2',4'-Pentahydroxyflavonol Chemical compound OC1=CC(O)=CC=C1C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 YXOLAZRVSSWPPT-UHFFFAOYSA-N 0.000 description 6
- 235000007708 morin Nutrition 0.000 description 3
- 239000002023 wood Substances 0.000 description 1
Images
Description
Des. 91,210
H. l. MORIN Dec. 19, 1933.
CABINET Filed Oct. 9, 1933 UNITED STATES PATENT OFFICE DESIGN FOR A CABINET Henry I. Morin, Springvale, Maine, assignor to Springvale Wood Working 00. Inc., Springvale, Maine, a corporation of Maine Application October 9, 1933. Serial No. 49,428
Term of patent 7 years To all whom it may concern: Figure 1 is a perspective view of a cabinet show- I Be it known that I, HENRY I. MORIN, a citizen ing my new design; and
of the United States of America, residing at Figure 2 is a top plan view of the same. Springvale, town of Sanford, county of York, I claim:-
and State of Maine, have invented a new, original, The ornamental design for a cabinet, as shown. and ornamental Design for a Cabinet, of which the following is a specification, reference being HENRY I. MORIN. had to the accompanying drawing, forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD91210S (en) | Design for a cabinet | |
| USD90498S (en) | Design for a shoe | |
| USD91590S (en) | Design for a shoe | |
| USD90503S (en) | Design for a shoe | |
| USD94451S (en) | Design for a shoe | |
| USD98923S (en) | Design for a serving tray | |
| USD102786S (en) | Design foe a radio cabinet | |
| USD94767S (en) | Design for a jumping horse | |
| USD101119S (en) | Design for a sponge basket | |
| USD91115S (en) | Design for a humidifier | |
| USD94452S (en) | Design for a shoe | |
| USD90628S (en) | Design fob a shoe | |
| USD90205S (en) | Charles miller | |
| USD100483S (en) | Design fob a shoe | |
| USD94030S (en) | Design for a nail file | |
| USD90690S (en) | Design for a cabinet | |
| USD102835S (en) | Design for a radio cabinet or | |
| USD94453S (en) | Design for a shoe | |
| USD94448S (en) | Design for a shoe | |
| USD94270S (en) | Design fob a shoe | |
| USD90629S (en) | Design for a shoe | |
| USD90708S (en) | Design for a table | |
| USD90447S (en) | Design for a shoe | |
| USD105062S (en) | Design for a shoe | |
| USD101545S (en) | Design for a shoe |