USD89254S - Zachabiah b - Google Patents
Zachabiah b Download PDFInfo
- Publication number
- USD89254S USD89254S US D89254 S USD89254 S US D89254S
- Authority
- US
- United States
- Prior art keywords
- zachabiah
- gate
- fence
- combined
- roanoke
- Prior art date
Links
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
Feb. 14, 1933. Z 5 BURGE D'es. 89,254
COMBINED FENCE AND GATE Filed Nov. 15, 1932 Zacfiam'afi ,3. 3:17:92
Zhmentor Patented Feb. 14, 1933 D 89,254
UNITED STATES PATENT OFFICE ZACHABIAH B. BUB'GE, OF ROANOKE, VIRGINIA DESIGN FOR A COMBINED FENCE AND GATE Application filed November 15, 1932. Serial No. 45,994. Term of patent 7 years.
To all whom it may concern: The figure is a perspective view of a com- Be it known that I, ZACHARIAH B. Bonen, bined fence and gate, showing my new dea citizen of the United States, residin at si Roanoke, in the county of Roanoke and tate claim:
of Virginia, have invented, a new, original, The ornamental design for a combined and ornamental Design for a Combined Fence fence and gate, as shown.
and Gate, of which the following is a speci- ZACHARIAH B. BURGE.
fication, reference being had to the accompanying drawing, forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD89254S (en) | Zachabiah b | |
| USD87612S (en) | Design fob | |
| USD80479S (en) | Design eos a lighter | |
| USD77276S (en) | Design for a casing fob a vending machine | |
| USD92459S (en) | Design fob a game scoring device | |
| USD84467S (en) | Design fob | |
| USD81776S (en) | Chables w | |
| USD73693S (en) | friedman | |
| USD79840S (en) | Design fob an afbon | |
| USD76401S (en) | Design foe a smoking stand | |
| USD83234S (en) | Clintock co | |
| USD98016S (en) | Design for a comforter | |
| USD100414S (en) | Design for a burial base | |
| USD66208S (en) | poole | |
| USD126571S (en) | Design for a ceoqtjet mallet | |
| USD84090S (en) | Device | |
| USD84905S (en) | Design for a beacon tower | |
| USD72414S (en) | Julius dinhoper | |
| USD105105S (en) | Design for a bottle | |
| USD90887S (en) | Design fob a bed | |
| USD78581S (en) | Design for a casing head for a thermometer | |
| USD65590S (en) | Design fob a bottle | |
| USD100879S (en) | Design for a candy or liquor box | |
| USD103633S (en) | Design fob a scale | |
| USD111877S (en) | Design fob a piano |