USD88494S - Design fob - Google Patents
Design fob Download PDFInfo
- Publication number
- USD88494S USD88494S US D88494 S USD88494 S US D88494S
- Authority
- US
- United States
- Prior art keywords
- design fob
- design
- anderson
- magazine rack
- michigan
- Prior art date
Links
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
Des. 88,494
G. ANDERSON MAGAZINE RACK Dec. 1932.
Filed Aug. 29, 1952 Patented Dec. 6, 1932 Des.
UNITED STATES PATENT OFFICE GEORGE ANDERSON, 0F BATTLE CREEK, MICHIGAN DESIGN FOR A MAGAZINE RACK Application filed August 29, 1932. Serial No. 44,716. Term of patent 7 years.
To all whom it may concern: The figure is a perspective View of a mag- Be it known that I, GEORGE ANDERSON, a azine rack showing my new design.
citizen of the United States, residin at 169 The sides not shown are like the opposite West Michigan Avenue, Battle Cree in the sides shown.
county of Calhoun and State of Michigan, I claim:
have invented a. new, original, and ornamen- The ornamental design for a magazine rack tal Design for a- Magazine Rack, of which the as shown and described.
following is a specification, reference being had to the accompanying drawing, forming GEORGE ANDERSON.
part of this specification.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD88494S (en) | Design fob | |
| USD90474S (en) | Design fob a furnace jacket | |
| USD96084S (en) | Design for a shoe ob similar article | |
| USD98408S (en) | Design fob a radiator or similar | |
| USD99394S (en) | H jewett | |
| USD87830S (en) | Design fob a combined valve contkol handle and indexing dial | |
| USD86978S (en) | Design fob a stove | |
| USD87456S (en) | Design fob a cooking stove ob similab abticle | |
| USD91032S (en) | Design for a serving tray or | |
| USD99381S (en) | Design for a refrigerator | |
| USD125415S (en) | Design fob a letter tray | |
| USD91911S (en) | Design fob a radiator or the like | |
| USD87759S (en) | Design fob | |
| USD95096S (en) | Design fob a shoe | |
| USD98410S (en) | Design for a radiator or similar | |
| USD96009S (en) | Design for a cooking stove or | |
| USD96978S (en) | Design fob a piano case | |
| USD79917S (en) | Otto bebgneb | |
| USD98819S (en) | Design fob a shoe ob similar abxicle | |
| USD90657S (en) | Design for a radiocabinet | |
| USD93702S (en) | Design fob a spectacle bow | |
| USD122403S (en) | Design fob a toy or similar article | |
| USD110868S (en) | Design fob a can ob sevm | |
| USD88686S (en) | Design fob a scale | |
| USD122401S (en) | Design for a toy or similar article |