USD86454S - Design fob a candy chest - Google Patents
Design fob a candy chest Download PDFInfo
- Publication number
- USD86454S USD86454S US D86454 S USD86454 S US D86454S
- Authority
- US
- United States
- Prior art keywords
- candy
- chest
- design fob
- design
- hawkins
- Prior art date
Links
- 210000000038 chest Anatomy 0.000 title description 8
- 235000009508 confectionery Nutrition 0.000 title description 8
- FUHQFAMVYDIUKL-UHFFFAOYSA-N FOX-7 Chemical compound NC(N)=C([N+]([O-])=O)[N+]([O-])=O FUHQFAMVYDIUKL-UHFFFAOYSA-N 0.000 description 2
Images
Description
Des. 86,454
B. HAWKINS CANDY CHEST March 8, 1932.
Filed Dec. '7, 1931 Patented Mar. 8, 1932 Des,
UNITED STATES PATENT OFFICE BOY'D HAWKINS, OF MIAMI, FLORIDA DESIGN FOR A CANDY CHEST Application filed December 7, 1931. Serial No. 41,996. Term of patent 3) years.
To all whom it may concern: Figure 1 is a perspective View of a candy Be it known that I, BOYD HAWKINS, a chest embodying my design; and
citizen of the United States, residing at Figure 2 is an end View of the same.
Miami, in the county of Dade and State of I claim:
Florida, have invented a new, original, and The ornamental design for a candy chest ornamental Design for a Candy -Chest,,as as shown.
shown in the accompanying drawings and described in the following specification. BOYD HAWKINS.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD86454S (en) | Design fob a candy chest | |
| USD86402S (en) | Design for an electric cooker | |
| USD95101S (en) | Design for a kite plane glider or | |
| USD86400S (en) | Ebedebick j | |
| USD86401S (en) | Design for an electric cooker | |
| USD85469S (en) | Design i-ob a table lamp | |
| USD119606S (en) | Design for a building block | |
| USD96977S (en) | Design for a piano case | |
| USD81750S (en) | Design for a typewriter table | |
| USD82738S (en) | Design fob a cabinet | |
| USD94741S (en) | Design for a match box doll | |
| USD90498S (en) | Design for a shoe | |
| USD87839S (en) | Edward karfiol | |
| USD103569S (en) | Design for a combined bird figure | |
| USD93084S (en) | Design for an instrument case or | |
| USD81822S (en) | Design fob | |
| USD91437S (en) | Design for a can | |
| USD94478S (en) | Design fob a shoe | |
| USD101293S (en) | Design for a finger ring | |
| USD112272S (en) | Design fob a bottle | |
| USD117842S (en) | Design for a box | |
| USD92754S (en) | Design for a shoe | |
| USD96084S (en) | Design for a shoe ob similar article | |
| USD125415S (en) | Design fob a letter tray | |
| USD102639S (en) | Design for a confectionery product |