USD85562S - Design fob an amusement appahattts - Google Patents
Design fob an amusement appahattts Download PDFInfo
- Publication number
- USD85562S USD85562S US D85562 S USD85562 S US D85562S
- Authority
- US
- United States
- Prior art keywords
- amusement
- appahattts
- design fob
- design
- thomas
- Prior art date
Links
- 235000007575 Calluna vulgaris Nutrition 0.000 description 2
- 240000002804 Calluna vulgaris Species 0.000 description 2
- YFTGOBNOJKXZJC-UHFFFAOYSA-N DHICA Chemical compound OC1=C(O)C=C2NC(C(=O)O)=CC2=C1 YFTGOBNOJKXZJC-UHFFFAOYSA-N 0.000 description 2
Images
Description
Nov. 10, 1931. T. w. B. WATLlNG 7 1368- 35,552 0 AMUSEMENT APPARATUS Filed Sept. 2, 1930 I" 111. Ill!" Patented Nov. 10, 1931 Des, 85,562
UNITED STATES PATENT OFFICE THOMAS w. B. WATLING, OI CHICAGO, ILLINOIS DESIGN FOR AN AIUSEKENT APPARATUS Application filed September 2, 1980. Serial Io. 86,852. Term of patent 1i years.
Toallwhomz'tmay concern: The figure is a perspective of an amuse Be it known that I, THOMAS W. B. WAT- ment apparatus showing my new design. LING a citizen of the United States, residing I claim: in dhica 0, county of Cook, and State of The ornamental design for an amusement Illinois, ave invented a new, original, and apparatus substantially as shown. ornamental Desi for Amusement Apparatus, of which t e following is a specifica- THOMAS W. B. WATLING. 'tion, reference being had to the accompanying drawing, forming a part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD85562S (en) | Design fob an amusement appahattts | |
| USD75327S (en) | Design fob a lamp | |
| USD79976S (en) | Design fob a game board | |
| USD64452S (en) | Design for a combination lamp and phonograph stand | |
| USD88827S (en) | John barry ryan | |
| USD75332S (en) | Bobebt beabdsley | |
| USD64131S (en) | Design for an ash receiver | |
| USD117935S (en) | Design for a toy bank | |
| USD70806S (en) | Design fob a balloon toy | |
| USD80812S (en) | Design fob an exerciser casing | |
| USD83218S (en) | Design fob a toy animal | |
| USD67814S (en) | Design pob a doll | |
| USD75527S (en) | Design for a push toy | |
| USD83376S (en) | Ubasabttro tomita | |
| USD75340S (en) | Design for a lamp | |
| USD69795S (en) | cooley | |
| USD75764S (en) | Joseph b | |
| USD75331S (en) | Design fob | |
| USD80464S (en) | Xttyidhrrirci i | |
| USD90284S (en) | Design fob a combined coaster and ash tray | |
| USD86773S (en) | Design | |
| USD96907S (en) | Design fob a game apparatus | |
| USD65558S (en) | Design fob a top fob a pedestal ob similab abticle | |
| USD81343S (en) | Design fob a game board | |
| USD82460S (en) | Ubasabubo tomita |