USD85537S - Design fob a lamp - Google Patents
Design fob a lamp Download PDFInfo
- Publication number
- USD85537S USD85537S US D85537 S USD85537 S US D85537S
- Authority
- US
- United States
- Prior art keywords
- lamp
- design fob
- design
- moore
- fob
- Prior art date
Links
- 241001446467 Mama Species 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
Nov. 10, 1931. R. MooRE Des. 85,537 O LAMP Filed Sept. 10, 1931 mama Nov. 10, 1931 Des. 85,537
i UNITED STATES PATENT OFFICE BOSS KOORE, 01' OOLUIIBUS, OHIO DESIGN FOR. LAMP f Application led September 10, 1981. Serial Ho. 41,053. Term ot patent Si years.
. To all 'whom it 'may concern: Figure 1 is a side view in elevation of a, V d it known that I, Ross MooRE, a citizen lamp, showing my new design, and United States, residin at Columbus, Figure 2 is an end view.
in the county of Franklin an State of Ohio, I claim:
- have invented a new, original, and ornamen- The ornamental design for a lamp, as
tal Design for' a Lamp, of which the followshown. ing is' a specification, reference being had to ROSS MOORE.
i Vthe accompanying drawings, forming part
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD85537S (en) | Design fob a lamp | |
| USD75355S (en) | Design fob a floweb box | |
| USD76592S (en) | Design fob a bracket back for lighting fixtures | |
| USD77891S (en) | Design fob an ozonizeb | |
| USD82648S (en) | Design fob a lamp | |
| USD75349S (en) | Design fob a lamp | |
| USD74570S (en) | Design for a lamp bracket | |
| USD81871S (en) | Design for a hall rack | |
| USD90497S (en) | Design fob a shoe | |
| USD64527S (en) | Design fob a socket coveb | |
| USD87435S (en) | Design fob a clasp | |
| USD78505S (en) | Design fob a lamp | |
| USD78915S (en) | Design fob a stocking | |
| USD80606S (en) | Design fob a closet | |
| USD91589S (en) | Design fob a shoe | |
| USD82411S (en) | Design fob | |
| USD75347S (en) | Design fob a lamp | |
| USD87434S (en) | Design for a clasp | |
| USD86868S (en) | Design fob a badio sound box | |
| USD90726S (en) | Design fob a shoe | |
| USD73901S (en) | I-bank k | |
| USD86941S (en) | Design fob a badio sottnd box | |
| USD94190S (en) | Design fob an apron | |
| USD73204S (en) | Design for a lamp bracket | |
| USD77595S (en) | Design fob a badiocabinet |