USD82774S - Design fob a badiocabinet - Google Patents
Design fob a badiocabinet Download PDFInfo
- Publication number
- USD82774S USD82774S US D82774 S USD82774 S US D82774S
- Authority
- US
- United States
- Prior art keywords
- badiocabinet
- design fob
- design
- elmer
- radio
- Prior art date
Links
- 240000002840 Allium cepa Species 0.000 description 2
- 241001417524 Pomacanthidae Species 0.000 description 2
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
- 201000011510 cancer Diseases 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
Images
Description
Dec. 9, 1930 zw sE Des. 82,774
AAAAAAAAAA ET Patented Dec. 9, 1930 Des.
UNITED STATE'S PATENT OFFICE ELMER W. ZWIEBEL, OF LOS ANGELES, CALIFORNIA DESIGN FOR A BADIOCABINET Application filed October 8, 1930. Serial No. 37,181. Term of patent 3% years.
`To all whom it may cancer n: Fig. l is a front elevational view of a radio Be it known that I, ELMER NV. ZWIEBEL, a cabinet Showing my new design.
eitizen of the United States, residing at Los F g. 2 is a side elevational View of the cab- Angeles, in the County of Los Angeles and inet.
tate of California, have invented a new, I claim: original, and ornamental Design for Radio- The ornamental design for a radio cabinet cabinets, of Which the following is a specifias shown. cation, reference being had to the aceom- ELMER NV. ZWVIEBEL.
panying drawing, forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD82774S (en) | Design fob a badiocabinet | |
| USD82773S (en) | Design fob a badiocabinet | |
| USD82624S (en) | Design fob a radio and television cabinet | |
| USD99276S (en) | design for a vending cabinet | |
| USD105800S (en) | Design for a toy figure | |
| USD83020S (en) | John j | |
| USD76489S (en) | Design fob a kadiocabinet | |
| USD79801S (en) | Lionel l | |
| USD82738S (en) | Design fob a cabinet | |
| USD85553S (en) | Joseph smith | |
| USD80287S (en) | John e | |
| USD83382S (en) | Design eor a radiocabinet | |
| USD99874S (en) | Design for a cabinet for diathermy | |
| USD100835S (en) | Design for a radio cabinet | |
| USD104658S (en) | Design fob a pedestal clock | |
| USD84670S (en) | Stephen d | |
| USD77595S (en) | Design fob a badiocabinet | |
| USD104759S (en) | Design for a cabinet for a parking | |
| USD104144S (en) | Design for a handbag | |
| USD87160S (en) | Design for a kitchen cabinet | |
| USD78274S (en) | Design fob an advertising cabinet | |
| USD90447S (en) | Design for a shoe | |
| USD76488S (en) | Design foe a badiocabinet | |
| USD90535S (en) | Design for a shoe | |
| USD84505S (en) | Design for a radiocabinet |