USD82446S - Design fob a child s costumier - Google Patents
Design fob a child s costumier Download PDFInfo
- Publication number
- USD82446S USD82446S US D82446 S USD82446 S US D82446S
- Authority
- US
- United States
- Prior art keywords
- costumier
- child
- design fob
- childs
- design
- Prior art date
Links
- 241000381875 Argiolestes muller Species 0.000 description 6
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
Des. 82,446
Nov. 4, 1930. s. A. MULLER CHILDS COSTUMER Filed Aug. 19. 1929 I INVENTOR.
A TTORNE Y.
Patented Nov. 4, 1930 Des. 82,446
UNITED STATES PATENT OFFICE GERTRUDE A. MULLER, 015 FORT WAYNE, INDIANA DESIGN FOR A CHILDS COSTUMER 7 Application filed August 19, 1929. Serial No. 32,445. Term of patent 8} years.
To all whom it my concern: The illustration is a perspective View of a 'Be it known that I, GERTRUDE A. MULLER, childs costumer showing my new design. ajcitizen of the United States, residin at I claim: Fort Wayne, in the county of Allen and tate The ornamental design for a childs cosof Indiana, have invented a new, original, turner as shown. and ornamental Design for a Childs Costumer, of which the followin is a specifica- GERTRUDE A. MULLER. tion, reference being had to t e accompanying drawing, forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD82446S (en) | Design fob a child s costumier | |
| USD73039S (en) | Design fob | |
| USD70902S (en) | Design for a combination desk set | |
| USD73471S (en) | Oscak b | |
| USD72341S (en) | Oscab b | |
| USD79743S (en) | Design fob | |
| USD65042S (en) | Design fob a stove | |
| USD71411S (en) | Design for a candlestick | |
| USD70310S (en) | Louis becker | |
| USD72135S (en) | Oscab b | |
| USD72346S (en) | Oscar b | |
| USD68093S (en) | Design eob a badiatob cap | |
| USD73746S (en) | Design fob | |
| USD75151S (en) | Christopher m | |
| USD70901S (en) | Design for a combination desk set | |
| USD80516S (en) | Isack goldberg | |
| USD71125S (en) | Design for a bottle | |
| USD72661S (en) | Design for a table | |
| USD72662S (en) | Design for a table | |
| USD70846S (en) | Jack katz | |
| USD68927S (en) | Design for a fireplace | |
| USD73172S (en) | Design fob a lamp shade | |
| USD70093S (en) | Design for a mattress ticking | |
| USD79746S (en) | Design fob a clock case | |
| USD77592S (en) | Design fob a chair or similar article |