USD823139S1 - Watch - Google Patents
Watch Download PDFInfo
- Publication number
- USD823139S1 USD823139S1 US29/597,478 US201729597478F USD823139S US D823139 S1 USD823139 S1 US D823139S1 US 201729597478 F US201729597478 F US 201729597478F US D823139 S USD823139 S US D823139S
- Authority
- US
- United States
- Prior art keywords
- watch
- view
- elevational view
- citizen
- side elevational
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- GMVPRGQOIOIIMI-DODZYUBVSA-N 7-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(O)=O GMVPRGQOIOIIMI-DODZYUBVSA-N 0.000 description 1
Images
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JPD2017-1476F JP1584577S (enExample) | 2017-01-27 | 2017-01-27 | |
| JP2017-001476 | 2017-01-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD823139S1 true USD823139S1 (en) | 2018-07-17 |
Family
ID=59677903
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/597,478 Active USD823139S1 (en) | 2017-01-27 | 2017-03-17 | Watch |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD823139S1 (enExample) |
| JP (1) | JP1584577S (enExample) |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD857527S1 (en) * | 2018-02-28 | 2019-08-27 | Citizen Watch Co., Ltd. | Watchcase |
| USD857525S1 (en) * | 2018-02-28 | 2019-08-27 | Citizen Watch Co., Ltd. | Watchcase |
| USD858314S1 (en) * | 2018-02-28 | 2019-09-03 | Citizen Watch Co., Ltd. | Watchcase |
| USD867195S1 (en) * | 2017-08-30 | 2019-11-19 | Citizen Watch Co., Ltd. | Watchcase |
| USD902920S1 (en) * | 2018-06-22 | 2020-11-24 | Samsung Electronics Co., Ltd. | Portable electronic device |
| USD910616S1 (en) * | 2018-06-22 | 2021-02-16 | Samsung Electronics Co., Ltd. | Portable electronic device |
| USD912548S1 (en) * | 2019-03-20 | 2021-03-09 | Citizen Watch Co., Ltd. | Watch |
| USD912561S1 (en) * | 2020-01-31 | 2021-03-09 | Citizen Watch Co., Ltd. | Watch dial |
| USD913122S1 (en) * | 2019-02-05 | 2021-03-16 | Citizen Watch Co., Ltd. | Watchcase |
| USD917307S1 (en) | 2019-02-15 | 2021-04-27 | Citizen Watch Co., Ltd. | Watch |
| USD921513S1 (en) * | 2020-01-31 | 2021-06-08 | Citizen Watch Co., Ltd. | Watchcase |
| USD1054898S1 (en) | 2022-11-30 | 2024-12-24 | Citizen Watch Co., Ltd. | Watch dial |
Citations (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5077708A (en) * | 1989-07-13 | 1991-12-31 | Breitling Montres S.A. | Stop-watch wristwatch |
| USD381277S (en) * | 1995-04-07 | 1997-07-22 | Breitling, S.A. | Watch |
| USD506936S1 (en) * | 2004-12-16 | 2005-07-05 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD555515S1 (en) * | 2006-09-14 | 2007-11-20 | Krieger Ira S | Watch |
| USD580280S1 (en) * | 2008-04-02 | 2008-11-11 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD594351S1 (en) * | 2009-02-27 | 2009-06-16 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD640145S1 (en) * | 2011-02-16 | 2011-06-21 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD652328S1 (en) * | 2011-03-14 | 2012-01-17 | Montres Breguet S.A. | Watch |
| USD706144S1 (en) * | 2013-10-04 | 2014-06-03 | Omega Ltd. | Watch |
| USD715660S1 (en) * | 2013-02-27 | 2014-10-21 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD720240S1 (en) * | 2014-03-26 | 2014-12-30 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD723408S1 (en) * | 2014-01-20 | 2015-03-03 | Montblanc-Simplo Gmbh | Watch dial |
| USD730201S1 (en) * | 2013-01-22 | 2015-05-26 | Luxury Timepieces International Sa | Wristwatch |
| USD731327S1 (en) * | 2013-04-10 | 2015-06-09 | Breitling Sa | Watch |
| US9150978B2 (en) * | 2012-02-15 | 2015-10-06 | Omega S.A. | Device for fixedly securing a metallic inlay |
| USD741727S1 (en) * | 2014-04-28 | 2015-10-27 | Turlen Holding Sa | Watchcase |
| USD744865S1 (en) * | 2013-04-17 | 2015-12-08 | Lvmh Swiss Manufactures Sa | Watch case and dial |
| USD745834S1 (en) * | 2013-04-17 | 2015-12-22 | Lvmh Swiss Manufactures Sa | Watch dial |
| USD754549S1 (en) * | 2014-03-25 | 2016-04-26 | Citizen Holdings Co., Ltd. | Wrist watch case |
| USD762491S1 (en) * | 2015-03-17 | 2016-08-02 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD789808S1 (en) * | 2016-05-31 | 2017-06-20 | Citizen Watch Co., Ltd. | Wrist watch |
| USD793882S1 (en) * | 2016-05-31 | 2017-08-08 | Citizen Watch Co., Ltd. | Wrist watch |
-
2017
- 2017-01-27 JP JPD2017-1476F patent/JP1584577S/ja active Active
- 2017-03-17 US US29/597,478 patent/USD823139S1/en active Active
Patent Citations (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5077708A (en) * | 1989-07-13 | 1991-12-31 | Breitling Montres S.A. | Stop-watch wristwatch |
| USD381277S (en) * | 1995-04-07 | 1997-07-22 | Breitling, S.A. | Watch |
| USD506936S1 (en) * | 2004-12-16 | 2005-07-05 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD555515S1 (en) * | 2006-09-14 | 2007-11-20 | Krieger Ira S | Watch |
| USD580280S1 (en) * | 2008-04-02 | 2008-11-11 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD594351S1 (en) * | 2009-02-27 | 2009-06-16 | Citizen Tokei Kabushiki Kaisha | Wrist watch |
| USD640145S1 (en) * | 2011-02-16 | 2011-06-21 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD652328S1 (en) * | 2011-03-14 | 2012-01-17 | Montres Breguet S.A. | Watch |
| US9150978B2 (en) * | 2012-02-15 | 2015-10-06 | Omega S.A. | Device for fixedly securing a metallic inlay |
| USD730201S1 (en) * | 2013-01-22 | 2015-05-26 | Luxury Timepieces International Sa | Wristwatch |
| USD715660S1 (en) * | 2013-02-27 | 2014-10-21 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD731327S1 (en) * | 2013-04-10 | 2015-06-09 | Breitling Sa | Watch |
| USD745834S1 (en) * | 2013-04-17 | 2015-12-22 | Lvmh Swiss Manufactures Sa | Watch dial |
| USD744865S1 (en) * | 2013-04-17 | 2015-12-08 | Lvmh Swiss Manufactures Sa | Watch case and dial |
| USD706144S1 (en) * | 2013-10-04 | 2014-06-03 | Omega Ltd. | Watch |
| USD723408S1 (en) * | 2014-01-20 | 2015-03-03 | Montblanc-Simplo Gmbh | Watch dial |
| USD754549S1 (en) * | 2014-03-25 | 2016-04-26 | Citizen Holdings Co., Ltd. | Wrist watch case |
| USD720240S1 (en) * | 2014-03-26 | 2014-12-30 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD741727S1 (en) * | 2014-04-28 | 2015-10-27 | Turlen Holding Sa | Watchcase |
| USD762491S1 (en) * | 2015-03-17 | 2016-08-02 | Citizen Holdings Co., Ltd. | Wrist watch |
| USD789808S1 (en) * | 2016-05-31 | 2017-06-20 | Citizen Watch Co., Ltd. | Wrist watch |
| USD793882S1 (en) * | 2016-05-31 | 2017-08-08 | Citizen Watch Co., Ltd. | Wrist watch |
Cited By (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD867195S1 (en) * | 2017-08-30 | 2019-11-19 | Citizen Watch Co., Ltd. | Watchcase |
| USD857527S1 (en) * | 2018-02-28 | 2019-08-27 | Citizen Watch Co., Ltd. | Watchcase |
| USD857525S1 (en) * | 2018-02-28 | 2019-08-27 | Citizen Watch Co., Ltd. | Watchcase |
| USD858314S1 (en) * | 2018-02-28 | 2019-09-03 | Citizen Watch Co., Ltd. | Watchcase |
| USD902920S1 (en) * | 2018-06-22 | 2020-11-24 | Samsung Electronics Co., Ltd. | Portable electronic device |
| USD910616S1 (en) * | 2018-06-22 | 2021-02-16 | Samsung Electronics Co., Ltd. | Portable electronic device |
| USD913122S1 (en) * | 2019-02-05 | 2021-03-16 | Citizen Watch Co., Ltd. | Watchcase |
| USD917307S1 (en) | 2019-02-15 | 2021-04-27 | Citizen Watch Co., Ltd. | Watch |
| USD912548S1 (en) * | 2019-03-20 | 2021-03-09 | Citizen Watch Co., Ltd. | Watch |
| USD912561S1 (en) * | 2020-01-31 | 2021-03-09 | Citizen Watch Co., Ltd. | Watch dial |
| USD921513S1 (en) * | 2020-01-31 | 2021-06-08 | Citizen Watch Co., Ltd. | Watchcase |
| USD1054898S1 (en) | 2022-11-30 | 2024-12-24 | Citizen Watch Co., Ltd. | Watch dial |
Also Published As
| Publication number | Publication date |
|---|---|
| JP1584577S (enExample) | 2017-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD831509S1 (en) | Watch | |
| USD822510S1 (en) | Watch | |
| USD823139S1 (en) | Watch | |
| USD931146S1 (en) | Bicycle | |
| USD847002S1 (en) | Watchcase | |
| USD851503S1 (en) | Watchcase | |
| USD800580S1 (en) | Watchcase | |
| USD822509S1 (en) | Watchcase | |
| USD800581S1 (en) | Watchcase | |
| USD801195S1 (en) | Watchcase | |
| USD820693S1 (en) | Watch | |
| USD818376S1 (en) | Watchcase | |
| USD795118S1 (en) | Watch dial | |
| USD846896S1 (en) | Saddle | |
| USD831507S1 (en) | Watchcase | |
| USD789808S1 (en) | Wrist watch | |
| USD823141S1 (en) | Watch | |
| USD807200S1 (en) | Watchcase | |
| USD801196S1 (en) | Wrist watch | |
| USD823138S1 (en) | Wristwatch | |
| USD878235S1 (en) | Earring | |
| USD833302S1 (en) | Wristwatch | |
| USD907518S1 (en) | Corrector for timepieces | |
| USD793879S1 (en) | Wrist watch | |
| USD939987S1 (en) | Bicycle computer |