USD82055S - Design fob a pocket lighter - Google Patents
Design fob a pocket lighter Download PDFInfo
- Publication number
- USD82055S USD82055S US D82055 S USD82055 S US D82055S
- Authority
- US
- United States
- Prior art keywords
- design fob
- pocket lighter
- lighter
- design
- Prior art date
Links
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
Patented Sept. 16, 1930 Des,
v UNITED STATES PATENT 0FFlE I ALFRED F. REILLY, OF ATTLEBORO, MASSACHUSETTS DESIGN FOR A POCKET LIGHTER Application filed June 13, 1929. Serial No. 31,671. Term of patent 14 years.
To all whom it may concern.- Figure 1 is it too plan View of a. lighter for Be it known that I, ALFRED F. REILLY, 21 e1; the like. citizen of the United States, residin at At- R ui'e 2 is a side eievetion of the lighter. tleboro, in the county of Bristol, tate of Figure 3 is a side elevation of the lighter Massachusetts, have invented a new, original, viewed from the right in Figure 2. and ornamental Design for Pocket Lighters, 1 claim:
of which the following is a specification, ref- The ornun'iental design for a pocket lighterence being had to the accompanying drawe1, as shown. ings, forming part thereof. ALFRED F. REILLY.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD82055S (en) | Design fob a pocket lighter | |
| USD74989S (en) | Design fob | |
| USD74479S (en) | Island | |
| USD78077S (en) | Design for a pocket igniter | |
| USD76362S (en) | Design for a cigar lighter | |
| USD69253S (en) | Design for a cigar lighter | |
| USD80325S (en) | Edwin l | |
| USD71309S (en) | Design fob | |
| USD128383S (en) | Design fob a cigarette lighter | |
| USD71446S (en) | Design for a belt buckle | |
| USD75134S (en) | Chusetts | |
| USD80326S (en) | Edwin l | |
| USD73575S (en) | Benjamin nathan | |
| USD72117S (en) | Design for a finger ring | |
| USD70892S (en) | Design fob a belt buckle | |
| USD70628S (en) | Design for a lady s belt | |
| USD78374S (en) | Design for a necktie holder | |
| USD83333S (en) | Design fob a combined cigarette holder and lighter | |
| USD84071S (en) | Design for a combined receptacle for smokers articles or similar devices | |
| USD121081S (en) | Design for a receptacle for cosmetics | |
| USD80214S (en) | Design for a lighter or similar article | |
| USD77275S (en) | Design for a lighter | |
| USD80137S (en) | Bernat mecklovits | |
| USD75930S (en) | Design for a box or similar article | |
| USD80621S (en) | Edward j |