USD81636S - Design eor an electrolier - Google Patents
Design eor an electrolier Download PDFInfo
- Publication number
- USD81636S USD81636S US D81636 S USD81636 S US D81636S
- Authority
- US
- United States
- Prior art keywords
- electrolier
- design eor
- design
- eor
- frankel
- Prior art date
Links
- MXBCYQUALCBQIJ-RYVPXURESA-N (8S,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-11-methylidene-1,2,3,6,7,8,9,10,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol;(8R,9S,13S,14S,17R)-17-ethynyl-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1.C1CC[C@@H]2[C@H]3C(=C)C[C@](CC)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 MXBCYQUALCBQIJ-RYVPXURESA-N 0.000 description 2
Images
Description
July 22, 1930. l D, FRANKEL Des. 81,636
ELEGTROLIER Flef April 29, 1929 A TTORNE Y.
Patented `luly 22, 1930 y Des,
DAVID FBANKEL, OF CLEVELAND, OHIO DESIGN FOR AN ELECTROLIER Application filed Apri*L 29, 1929. Serial No. 31,039. Term of patent 3J; years.
To all w 710m t may 00am/am.' In the drawing the figure shows my new de- Be it known that I, DAVID FRANKEL, a citisign in perspective. zen of the United States, residing at Cleve- I claim:
land, county of Cuyahoga, State of Ohio, The ornamental design for an electroliei as have insf'entecl a new, original, and ornamentshown.
al Design for an Electrolier, of which the followingis a speciieation, reference being had DAVID FRANKEL. to the accompanying drawing, forming a part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD81636S (en) | Design eor an electrolier | |
| USD81637S (en) | Design for | |
| USD78508S (en) | Design fob a nursery bench chest | |
| USD108638S (en) | Design fob an ashtray | |
| USD77595S (en) | Design fob a badiocabinet | |
| USD79492S (en) | Design for a radiocabinet | |
| USD61168S (en) | Design fob a swivel confection rack | |
| USD77384S (en) | Design fob a ring | |
| USD128028S (en) | Design fob a heater cabinet | |
| USD68006S (en) | Design fob a candleholdeb | |
| USD76055S (en) | Design fob a king | |
| USD78484S (en) | Design fob | |
| USD78920S (en) | Design fob a game board | |
| USD82572S (en) | John k | |
| USD58908S (en) | Design for a radiator-cap | |
| USD64598S (en) | Design fob a column | |
| USD81685S (en) | Design fob a counter | |
| USD69927S (en) | Design fob a toy | |
| USD68623S (en) | oe dayton | |
| USD71924S (en) | Design fob a game board | |
| USD76753S (en) | Design for a purse | |
| USD69626S (en) | Design fob a eange | |
| USD85349S (en) | Design for a teailee cab | |
| USD148967S (en) | Design for a bobsled | |
| USD70916S (en) | Combination desk set |