USD776496S1 - Melon slicer with base cover - Google Patents
Melon slicer with base cover Download PDFInfo
- Publication number
- USD776496S1 USD776496S1 US29/509,654 US201429509654F USD776496S US D776496 S1 USD776496 S1 US D776496S1 US 201429509654 F US201429509654 F US 201429509654F US D776496 S USD776496 S US D776496S
- Authority
- US
- United States
- Prior art keywords
- base cover
- slicer
- melon
- melon slicer
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 241000219112 Cucumis Species 0.000 title claims description 3
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 title claims description 3
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
The broken lines in the drawings are for the purpose of illustrating unclaimed portions and form no part of the claimed design.
Claims (1)
- The ornamental design for a melon slicer with base cover, as shown and described.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US29/509,654 USD776496S1 (en) | 2014-11-19 | 2014-11-19 | Melon slicer with base cover |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US29/509,654 USD776496S1 (en) | 2014-11-19 | 2014-11-19 | Melon slicer with base cover |
Publications (1)
Publication Number | Publication Date |
---|---|
USD776496S1 true USD776496S1 (en) | 2017-01-17 |
Family
ID=57749500
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
US29/509,654 Active USD776496S1 (en) | 2014-11-19 | 2014-11-19 | Melon slicer with base cover |
Country Status (1)
Country | Link |
---|---|
US (1) | USD776496S1 (en) |
Cited By (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
USD814887S1 (en) * | 2017-01-13 | 2018-04-10 | Brian Schultz | Waffle cutter |
USD847863S1 (en) * | 2017-12-20 | 2019-05-07 | Crane Pumps & Systems, Inc. | Slicer blade and striker plate assembly for a centrifugal pump |
USD858222S1 (en) * | 2017-03-17 | 2019-09-03 | Fusionbrands Llc | Berry slicer and corer |
US20190270579A1 (en) * | 2013-11-19 | 2019-09-05 | Edible Ip, Llc | Fruit arrangement |
USD863872S1 (en) * | 2018-10-25 | 2019-10-22 | Pian Chen | Melon cutter |
USD896592S1 (en) * | 2019-06-28 | 2020-09-22 | Tonya Starkey | Cake wedge |
USD911775S1 (en) * | 2019-04-25 | 2021-03-02 | Lifetime Brands, Inc. | Bakeware sling |
USD915142S1 (en) * | 2019-06-06 | 2021-04-06 | Sharkninja Operating Llc | Food support for cooking device |
USD973453S1 (en) * | 2021-11-30 | 2022-12-27 | Shenzhen Niunisi Technology Co., Ltd. | Apple cutter base |
USD976660S1 (en) * | 2021-04-06 | 2023-01-31 | Savera Yadav | Jigsaw fruit slicer |
Citations (31)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US1466114A (en) * | 1923-04-07 | 1923-08-28 | Buchi Robert | Apple slicer |
USD432874S (en) * | 1998-08-28 | 2000-10-31 | The Pampered Chef, Ltd. | Apple wedger |
US6502490B1 (en) * | 2001-01-26 | 2003-01-07 | Steven M. Krawick | Melon slicer |
USD473109S1 (en) * | 2001-10-30 | 2003-04-15 | Natalee Elyse Birchansky | Fruit/vegetable cutter |
USD501371S1 (en) * | 2003-11-13 | 2005-02-01 | Good Time Industries Co., Ltd. | Fruit slicer |
US20050150117A1 (en) * | 2004-01-12 | 2005-07-14 | Helen Of Troy Limited | Mango Slicer |
USD521819S1 (en) * | 2005-02-02 | 2006-05-30 | Progressive International Corporation | Food cutter |
USD547620S1 (en) * | 2005-07-29 | 2007-07-31 | Helen Of Troy Limited | Mango slicer |
US7266894B1 (en) * | 2006-05-16 | 2007-09-11 | John Robert Hinckley | Apparatus for slicing fruit and other items |
USD550521S1 (en) * | 2006-03-29 | 2007-09-11 | Le-Trinh Mai Roberson | Apple slicer |
US20080168660A1 (en) * | 2007-01-12 | 2008-07-17 | Te-Sheng Chiu | Fruit Cutter that Cuts Fruit Exactly and Smoothly |
US20080216628A1 (en) * | 2007-03-06 | 2008-09-11 | John Michael Hamilton | Sectioning device with adjustable cutting filament |
USD582220S1 (en) * | 2008-05-19 | 2008-12-09 | Amco Houseworks, Llc | Food slicer |
US20090241344A1 (en) * | 2008-03-28 | 2009-10-01 | Mastroianni Michael R | Apparatus for coring and wedging food items |
US20090249965A1 (en) * | 2008-04-02 | 2009-10-08 | Progressive International Corporation | Pit remover |
US7610850B2 (en) * | 2005-06-21 | 2009-11-03 | Atlas Pacific Engineering Company | Apparatus for slicing apples |
US20090282990A1 (en) * | 2008-05-19 | 2009-11-19 | Farnum Ronald C | Apparatus for cutting food items |
USD648989S1 (en) * | 2011-02-01 | 2011-11-22 | Columbia Insurance Company | Food wedger |
USD649413S1 (en) * | 2011-01-20 | 2011-11-29 | Columbia Insurance Company | Food wedger |
USD650247S1 (en) * | 2011-02-08 | 2011-12-13 | Columbia Insurance Company | Food slicer |
USD650246S1 (en) * | 2011-01-26 | 2011-12-13 | Columbia Insurance Company | Food slicer |
US20120131800A1 (en) * | 2010-10-28 | 2012-05-31 | Progressive International Corporation | Slicing Device |
USD662790S1 (en) * | 2011-01-20 | 2012-07-03 | Christina Rugprayoon | Jellied cranberry slicer |
USD675889S1 (en) * | 2012-06-27 | 2013-02-12 | Carrie Cline | Fruit cutter |
USD676290S1 (en) * | 2012-06-27 | 2013-02-19 | Carrie Cline | Fruit cutter |
USD687267S1 (en) * | 2011-08-03 | 2013-08-06 | Columbia Insurance Company | Food cutter |
USD690170S1 (en) * | 2011-08-03 | 2013-09-24 | Columbia Insurance Company | Food cutter |
US20140109738A1 (en) * | 2012-10-24 | 2014-04-24 | Daniel G. Schwartz | Watermelon Slicer |
US8726521B2 (en) * | 2010-10-28 | 2014-05-20 | Progressive International Corporation | Apple wedger |
US8863391B2 (en) * | 2011-07-27 | 2014-10-21 | Progressive International Corporation | Egg slicer |
USD716109S1 (en) * | 2013-08-06 | 2014-10-28 | Axis Sourcing Group, Inc. | Melon slicer |
-
2014
- 2014-11-19 US US29/509,654 patent/USD776496S1/en active Active
Patent Citations (32)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US1466114A (en) * | 1923-04-07 | 1923-08-28 | Buchi Robert | Apple slicer |
USD432874S (en) * | 1998-08-28 | 2000-10-31 | The Pampered Chef, Ltd. | Apple wedger |
US6502490B1 (en) * | 2001-01-26 | 2003-01-07 | Steven M. Krawick | Melon slicer |
USD473109S1 (en) * | 2001-10-30 | 2003-04-15 | Natalee Elyse Birchansky | Fruit/vegetable cutter |
USD501371S1 (en) * | 2003-11-13 | 2005-02-01 | Good Time Industries Co., Ltd. | Fruit slicer |
US20050150117A1 (en) * | 2004-01-12 | 2005-07-14 | Helen Of Troy Limited | Mango Slicer |
USD521819S1 (en) * | 2005-02-02 | 2006-05-30 | Progressive International Corporation | Food cutter |
US7610850B2 (en) * | 2005-06-21 | 2009-11-03 | Atlas Pacific Engineering Company | Apparatus for slicing apples |
USD547620S1 (en) * | 2005-07-29 | 2007-07-31 | Helen Of Troy Limited | Mango slicer |
USD550521S1 (en) * | 2006-03-29 | 2007-09-11 | Le-Trinh Mai Roberson | Apple slicer |
US7266894B1 (en) * | 2006-05-16 | 2007-09-11 | John Robert Hinckley | Apparatus for slicing fruit and other items |
US20080168660A1 (en) * | 2007-01-12 | 2008-07-17 | Te-Sheng Chiu | Fruit Cutter that Cuts Fruit Exactly and Smoothly |
US20080216628A1 (en) * | 2007-03-06 | 2008-09-11 | John Michael Hamilton | Sectioning device with adjustable cutting filament |
US20090241344A1 (en) * | 2008-03-28 | 2009-10-01 | Mastroianni Michael R | Apparatus for coring and wedging food items |
US20090249965A1 (en) * | 2008-04-02 | 2009-10-08 | Progressive International Corporation | Pit remover |
US20090282990A1 (en) * | 2008-05-19 | 2009-11-19 | Farnum Ronald C | Apparatus for cutting food items |
USD582220S1 (en) * | 2008-05-19 | 2008-12-09 | Amco Houseworks, Llc | Food slicer |
US8726521B2 (en) * | 2010-10-28 | 2014-05-20 | Progressive International Corporation | Apple wedger |
US20120131800A1 (en) * | 2010-10-28 | 2012-05-31 | Progressive International Corporation | Slicing Device |
USD649413S1 (en) * | 2011-01-20 | 2011-11-29 | Columbia Insurance Company | Food wedger |
USD662790S1 (en) * | 2011-01-20 | 2012-07-03 | Christina Rugprayoon | Jellied cranberry slicer |
USD650246S1 (en) * | 2011-01-26 | 2011-12-13 | Columbia Insurance Company | Food slicer |
USD648989S1 (en) * | 2011-02-01 | 2011-11-22 | Columbia Insurance Company | Food wedger |
USD650247S1 (en) * | 2011-02-08 | 2011-12-13 | Columbia Insurance Company | Food slicer |
US8863391B2 (en) * | 2011-07-27 | 2014-10-21 | Progressive International Corporation | Egg slicer |
USD687267S1 (en) * | 2011-08-03 | 2013-08-06 | Columbia Insurance Company | Food cutter |
USD690170S1 (en) * | 2011-08-03 | 2013-09-24 | Columbia Insurance Company | Food cutter |
USD702512S1 (en) * | 2011-08-03 | 2014-04-15 | Columbia Insurance Company | Food cutter |
USD676290S1 (en) * | 2012-06-27 | 2013-02-19 | Carrie Cline | Fruit cutter |
USD675889S1 (en) * | 2012-06-27 | 2013-02-12 | Carrie Cline | Fruit cutter |
US20140109738A1 (en) * | 2012-10-24 | 2014-04-24 | Daniel G. Schwartz | Watermelon Slicer |
USD716109S1 (en) * | 2013-08-06 | 2014-10-28 | Axis Sourcing Group, Inc. | Melon slicer |
Cited By (11)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US20190270579A1 (en) * | 2013-11-19 | 2019-09-05 | Edible Ip, Llc | Fruit arrangement |
USD814887S1 (en) * | 2017-01-13 | 2018-04-10 | Brian Schultz | Waffle cutter |
USD858222S1 (en) * | 2017-03-17 | 2019-09-03 | Fusionbrands Llc | Berry slicer and corer |
USD847863S1 (en) * | 2017-12-20 | 2019-05-07 | Crane Pumps & Systems, Inc. | Slicer blade and striker plate assembly for a centrifugal pump |
USD863872S1 (en) * | 2018-10-25 | 2019-10-22 | Pian Chen | Melon cutter |
USD911775S1 (en) * | 2019-04-25 | 2021-03-02 | Lifetime Brands, Inc. | Bakeware sling |
USD915142S1 (en) * | 2019-06-06 | 2021-04-06 | Sharkninja Operating Llc | Food support for cooking device |
USD937627S1 (en) | 2019-06-06 | 2021-12-07 | Sharkninja Operating Llc | Food support for cooking device |
USD896592S1 (en) * | 2019-06-28 | 2020-09-22 | Tonya Starkey | Cake wedge |
USD976660S1 (en) * | 2021-04-06 | 2023-01-31 | Savera Yadav | Jigsaw fruit slicer |
USD973453S1 (en) * | 2021-11-30 | 2022-12-27 | Shenzhen Niunisi Technology Co., Ltd. | Apple cutter base |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
USD802116S1 (en) | Mouthpiece cover | |
USD747136S1 (en) | Lid | |
USD757703S1 (en) | Smartphone case | |
USD807737S1 (en) | Tray | |
USD780738S1 (en) | Phone case | |
USD783348S1 (en) | Brew basket | |
USD769231S1 (en) | Wireless access point | |
USD776496S1 (en) | Melon slicer with base cover | |
USD761884S1 (en) | Tray | |
USD763640S1 (en) | Head trimmer | |
USD785395S1 (en) | Drink machine | |
USD726886S1 (en) | Drain cover | |
USD803480S1 (en) | Self-hair clipper | |
USD750888S1 (en) | Wallet | |
USD733491S1 (en) | Mug cover | |
USD784955S1 (en) | Loudspeaker | |
USD757470S1 (en) | Table | |
USD732949S1 (en) | Cup | |
USD719674S1 (en) | Portable sanitizing machine | |
USD778727S1 (en) | Container | |
USD737686S1 (en) | Container | |
USD753296S1 (en) | Endoscope | |
USD727409S1 (en) | Copier | |
USD744487S1 (en) | Base plate | |
USD737685S1 (en) | Container |