USD764148S1 - Pocket - Google Patents
Pocket Download PDFInfo
- Publication number
- USD764148S1 USD764148S1 US29/496,262 US201429496262F USD764148S US D764148 S1 USD764148 S1 US D764148S1 US 201429496262 F US201429496262 F US 201429496262F US D764148 S USD764148 S US D764148S
- Authority
- US
- United States
- Prior art keywords
- bag
- pants
- article
- design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- PGOOBECODWQEAB-UHFFFAOYSA-N (E)-clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 description 1
- 210000003423 ankle Anatomy 0.000 description 1
- 238000003287 bathing Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Images
Description
The solid outlines in FIG. 1 and the thick dotted lines in FIG. 2 shown on the surface of the pocket represent stitching and are part of the claimed design. The broken lines shown in FIG. 1 and the thinner broken lines shown in FIG. 2 represent environmental structure only and form no part of the claimed design.
The claimed pocket is not limited to use with pants as is shown in FIG. 2 , but may be applied to any article of apparel, accessory, or other personal item, such as, for example and without limitation: pants; shorts; a skirt; a shirt; a blouse; a one-piece article of clothing such as a dress, pajamas, a robe, a sarong, or a romper; a belt; an armband; a wristband; a bracelet; an ankle band; a headband; a scarf; a money belt; a travel wallet; an undergarment; outerwear such as a sweater, a coat, a jacket, a vest, a sweatshirt, a fleece, or a poncho; a hat; a cap; a helmet; a handbag; a purse; an article of luggage such as a suitcase, a duffel, a grocery bag, a tote bag, a backpack, a messenger bag, a laptop bag, or a pannier bag such as for use on a bicycle or motorcycle; a wallet; a makeup bag; a toiletry case; footwear; a sock; a glove; or a bathing suit.
Further, the claimed pocket is not limited to use with wearable items.
Claims (1)
- The ornamental design for a pocket, as shown and described.
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/496,262 USD764148S1 (en) | 2014-07-10 | 2014-07-10 | |
| CA 157634 CA157634S (en) | 2014-07-10 | 2014-07-11 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/496,262 USD764148S1 (en) | 2014-07-10 | 2014-07-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD764148S1 true USD764148S1 (en) | 2016-08-23 |
Family
ID=53009083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/496,262 Active USD764148S1 (en) | 2014-07-10 | 2014-07-10 |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD764148S1 (en) |
| CA (1) | CA157634S (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD787159S1 (en) * | 2015-11-03 | 2017-05-23 | Diesel S.p.A. | Jeans |
| USD788407S1 (en) * | 2015-10-16 | 2017-06-06 | G-Star Raw C.V. | Pants |
| USD809248S1 (en) * | 2016-05-16 | 2018-02-06 | Catherine Hart | Jeans |
| USD811048S1 (en) * | 2016-06-02 | 2018-02-27 | Delicia Hestle | Backward jean |
| USD909715S1 (en) * | 2017-12-14 | 2021-02-09 | Buckle Brands, Inc. | Pocket for jeans and the like |
| USD985889S1 (en) * | 2021-10-13 | 2023-05-16 | Buckle Brands, Inc. | Pocket for jeans and the like |
Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD278377S (en) * | 1982-09-22 | 1985-04-16 | Englishtown Sportswear, Ltd. | Pocket for jeans or the like |
| USD278379S (en) * | 1982-09-22 | 1985-04-16 | Englishtown Sportswear, Ltd. | Pocket for jeans or the like |
| USD541507S1 (en) * | 2006-03-09 | 2007-05-01 | The Children's Place Services Company, Llc | Decorative stitching for a pocket |
| USD582633S1 (en) * | 2008-06-20 | 2008-12-16 | Bo Zhang | |
| USD593283S1 (en) * | 2007-09-13 | 2009-06-02 | Diesel S.p.A. | |
| USD608984S1 (en) * | 2009-06-18 | 2010-02-02 | A & H Sportswear Co., Inc. | Decorative pattern for a pocket |
| USD619334S1 (en) * | 2008-05-08 | 2010-07-13 | Black Studio S.R.L. | Pocket for clothing |
| USD625902S1 (en) * | 2009-05-08 | 2010-10-26 | All Saints Retail Limited | Stitch pattern |
| USD693993S1 (en) * | 2009-05-08 | 2013-11-26 | All Saints Retail Limited | |
| USD696000S1 (en) * | 2013-06-21 | 2013-12-24 | Cherokee Inc. | |
| USD710069S1 (en) * | 2012-01-25 | 2014-08-05 | Grotto S.P.A. | Trousers |
| USD731154S1 (en) * | 2012-12-10 | 2015-06-09 | Ariat International, Inc. | Apparel pocket |
-
2014
- 2014-07-10 US US29/496,262 patent/USD764148S1/en active Active
- 2014-07-11 CA CA 157634 patent/CA157634S/en not_active Expired - Lifetime
Patent Citations (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD278377S (en) * | 1982-09-22 | 1985-04-16 | Englishtown Sportswear, Ltd. | Pocket for jeans or the like |
| USD278379S (en) * | 1982-09-22 | 1985-04-16 | Englishtown Sportswear, Ltd. | Pocket for jeans or the like |
| USD541507S1 (en) * | 2006-03-09 | 2007-05-01 | The Children's Place Services Company, Llc | Decorative stitching for a pocket |
| USD593283S1 (en) * | 2007-09-13 | 2009-06-02 | Diesel S.p.A. | |
| USD619334S1 (en) * | 2008-05-08 | 2010-07-13 | Black Studio S.R.L. | Pocket for clothing |
| USD582633S1 (en) * | 2008-06-20 | 2008-12-16 | Bo Zhang | |
| USD625902S1 (en) * | 2009-05-08 | 2010-10-26 | All Saints Retail Limited | Stitch pattern |
| USD693993S1 (en) * | 2009-05-08 | 2013-11-26 | All Saints Retail Limited | |
| USD608984S1 (en) * | 2009-06-18 | 2010-02-02 | A & H Sportswear Co., Inc. | Decorative pattern for a pocket |
| USD710069S1 (en) * | 2012-01-25 | 2014-08-05 | Grotto S.P.A. | Trousers |
| USD731154S1 (en) * | 2012-12-10 | 2015-06-09 | Ariat International, Inc. | Apparel pocket |
| USD696000S1 (en) * | 2013-06-21 | 2013-12-24 | Cherokee Inc. |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD788407S1 (en) * | 2015-10-16 | 2017-06-06 | G-Star Raw C.V. | Pants |
| USD801001S1 (en) * | 2015-10-16 | 2017-10-31 | G-Star Raw C.V. | Pants |
| USD837485S1 (en) * | 2015-10-16 | 2019-01-08 | G-Star Raw C.V. | Pants |
| USD787159S1 (en) * | 2015-11-03 | 2017-05-23 | Diesel S.p.A. | Jeans |
| USD787158S1 (en) * | 2015-11-03 | 2017-05-23 | Diesel S.p.A. | Jeans |
| USD787784S1 (en) * | 2015-11-03 | 2017-05-30 | Diesel S.p.A. | Jeans |
| USD788408S1 (en) * | 2015-11-03 | 2017-06-06 | Diesel S.p.A. | Jeans |
| USD809248S1 (en) * | 2016-05-16 | 2018-02-06 | Catherine Hart | Jeans |
| USD811048S1 (en) * | 2016-06-02 | 2018-02-27 | Delicia Hestle | Backward jean |
| USD909715S1 (en) * | 2017-12-14 | 2021-02-09 | Buckle Brands, Inc. | Pocket for jeans and the like |
| USD985889S1 (en) * | 2021-10-13 | 2023-05-16 | Buckle Brands, Inc. | Pocket for jeans and the like |
Also Published As
| Publication number | Publication date |
|---|---|
| CA157634S (en) | 2015-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD764148S1 (en) | ||
| US20200093245A1 (en) | Articles incorporated into an attached pouch | |
| USD701021S1 (en) | ||
| US20150201686A1 (en) | Modifiable garment with adhesive seam | |
| US20160192720A1 (en) | Convertible Garment | |
| US20140115754A1 (en) | Add-On Fashion Arm Sleeves | |
| US20180338554A1 (en) | Garment with storage pocket | |
| US20140130312A1 (en) | Alteration Clips | |
| JP3219509U (en) | clothes | |
| CN208909165U (en) | A kind of foldable jacket for handbag shape | |
| CN207531915U (en) | A kind of hunting dress cotton work clothes | |
| US20120266360A1 (en) | Sleeved Wrist Pouch | |
| US20180116312A1 (en) | Interchangeable Pocket Panels | |
| CN112914170A (en) | Garment with side functional pockets | |
| JP3202411U (en) | Pocket vest | |
| TR201700934U (en) | PORTABLE PRACTICAL ABAYA | |
| CN105286112A (en) | Attractive and elegant woman's mood jacket capable of being positioned and with pocket | |
| CN105942619A (en) | A sleeve-detachable multifunctional overcoat | |
| CN205682492U (en) | A kind of convenient clothes that change the outfit | |
| JP2019217240A (en) | Pocketful waistcloth (t .831) | |
| KR101361909B1 (en) | A collar for clothes | |
| Bae et al. | Design Characteristics of New Senior Women's Coat | |
| GB2522279A (en) | Clever blazer bag | |
| HK40021274A (en) | Articles incorporated into an attached pouch | |
| CN105266221A (en) | Pocket-equipped woman sport cashmere sweater capable of positioning and realizing attractive appearance |