USD716109S1 - Melon slicer - Google Patents
Melon slicer Download PDFInfo
- Publication number
- USD716109S1 USD716109S1 US29/462,651 US201329462651F USD716109S US D716109 S1 USD716109 S1 US D716109S1 US 201329462651 F US201329462651 F US 201329462651F US D716109 S USD716109 S US D716109S
- Authority
- US
- United States
- Prior art keywords
- melon
- slicer
- melon slicer
- orthogonal view
- ornamental design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 241000219112 Cucumis Species 0.000 title claims description 9
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 title claims description 9
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 title claims description 9
Images
Description
Claims (1)
- The ornamental design for a melon slicer, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/462,651 USD716109S1 (en) | 2013-08-06 | 2013-08-06 | Melon slicer |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/462,651 USD716109S1 (en) | 2013-08-06 | 2013-08-06 | Melon slicer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD716109S1 true USD716109S1 (en) | 2014-10-28 |
Family
ID=51753587
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/462,651 Active USD716109S1 (en) | 2013-08-06 | 2013-08-06 | Melon slicer |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD716109S1 (en) |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD758149S1 (en) * | 2014-02-24 | 2016-06-07 | Yan Kwong Wong | Food cutting device |
| USD776496S1 (en) * | 2014-11-19 | 2017-01-17 | Tristar Products, Inc. | Melon slicer with base cover |
| US9630334B2 (en) * | 2015-06-25 | 2017-04-25 | Lucio Garcia | Food cutting assembly |
| US20170189047A1 (en) * | 2016-01-06 | 2017-07-06 | Firas Eladoumikdachi | Lumpectomy Knife Set |
| USD795659S1 (en) * | 2016-01-11 | 2017-08-29 | Freshlink Product Development, Llc. | Apple slicer |
| USD858222S1 (en) * | 2017-03-17 | 2019-09-03 | Fusionbrands Llc | Berry slicer and corer |
| US20190270579A1 (en) * | 2013-11-19 | 2019-09-05 | Edible Ip, Llc | Fruit arrangement |
| USD911775S1 (en) * | 2019-04-25 | 2021-03-02 | Lifetime Brands, Inc. | Bakeware sling |
| USD915142S1 (en) * | 2019-06-06 | 2021-04-06 | Sharkninja Operating Llc | Food support for cooking device |
| USD1083529S1 (en) * | 2023-06-03 | 2025-07-15 | Deiss Limited | Fixing plate for apple cutters |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1466114A (en) * | 1923-04-07 | 1923-08-28 | Buchi Robert | Apple slicer |
| USD432874S (en) * | 1998-08-28 | 2000-10-31 | The Pampered Chef, Ltd. | Apple wedger |
| USD473109S1 (en) * | 2001-10-30 | 2003-04-15 | Natalee Elyse Birchansky | Fruit/vegetable cutter |
| US20050150117A1 (en) * | 2004-01-12 | 2005-07-14 | Helen Of Troy Limited | Mango Slicer |
| US7266894B1 (en) * | 2006-05-16 | 2007-09-11 | John Robert Hinckley | Apparatus for slicing fruit and other items |
| US20080168660A1 (en) * | 2007-01-12 | 2008-07-17 | Te-Sheng Chiu | Fruit Cutter that Cuts Fruit Exactly and Smoothly |
| US20090241344A1 (en) * | 2008-03-28 | 2009-10-01 | Mastroianni Michael R | Apparatus for coring and wedging food items |
| US20090249965A1 (en) * | 2008-04-02 | 2009-10-08 | Progressive International Corporation | Pit remover |
| US7610850B2 (en) * | 2005-06-21 | 2009-11-03 | Atlas Pacific Engineering Company | Apparatus for slicing apples |
| US20120131800A1 (en) * | 2010-10-28 | 2012-05-31 | Progressive International Corporation | Slicing Device |
-
2013
- 2013-08-06 US US29/462,651 patent/USD716109S1/en active Active
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1466114A (en) * | 1923-04-07 | 1923-08-28 | Buchi Robert | Apple slicer |
| USD432874S (en) * | 1998-08-28 | 2000-10-31 | The Pampered Chef, Ltd. | Apple wedger |
| USD473109S1 (en) * | 2001-10-30 | 2003-04-15 | Natalee Elyse Birchansky | Fruit/vegetable cutter |
| US20050150117A1 (en) * | 2004-01-12 | 2005-07-14 | Helen Of Troy Limited | Mango Slicer |
| US7610850B2 (en) * | 2005-06-21 | 2009-11-03 | Atlas Pacific Engineering Company | Apparatus for slicing apples |
| US7266894B1 (en) * | 2006-05-16 | 2007-09-11 | John Robert Hinckley | Apparatus for slicing fruit and other items |
| US20080168660A1 (en) * | 2007-01-12 | 2008-07-17 | Te-Sheng Chiu | Fruit Cutter that Cuts Fruit Exactly and Smoothly |
| US20090241344A1 (en) * | 2008-03-28 | 2009-10-01 | Mastroianni Michael R | Apparatus for coring and wedging food items |
| US8046921B2 (en) * | 2008-03-28 | 2011-11-01 | Focus Products Group, Llc | Apparatus for coring and wedging food items |
| US20090249965A1 (en) * | 2008-04-02 | 2009-10-08 | Progressive International Corporation | Pit remover |
| US20120131800A1 (en) * | 2010-10-28 | 2012-05-31 | Progressive International Corporation | Slicing Device |
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20190270579A1 (en) * | 2013-11-19 | 2019-09-05 | Edible Ip, Llc | Fruit arrangement |
| USD758149S1 (en) * | 2014-02-24 | 2016-06-07 | Yan Kwong Wong | Food cutting device |
| USD776496S1 (en) * | 2014-11-19 | 2017-01-17 | Tristar Products, Inc. | Melon slicer with base cover |
| US9630334B2 (en) * | 2015-06-25 | 2017-04-25 | Lucio Garcia | Food cutting assembly |
| US20170189047A1 (en) * | 2016-01-06 | 2017-07-06 | Firas Eladoumikdachi | Lumpectomy Knife Set |
| USD795659S1 (en) * | 2016-01-11 | 2017-08-29 | Freshlink Product Development, Llc. | Apple slicer |
| USD858222S1 (en) * | 2017-03-17 | 2019-09-03 | Fusionbrands Llc | Berry slicer and corer |
| USD911775S1 (en) * | 2019-04-25 | 2021-03-02 | Lifetime Brands, Inc. | Bakeware sling |
| USD915142S1 (en) * | 2019-06-06 | 2021-04-06 | Sharkninja Operating Llc | Food support for cooking device |
| USD937627S1 (en) | 2019-06-06 | 2021-12-07 | Sharkninja Operating Llc | Food support for cooking device |
| USD1083529S1 (en) * | 2023-06-03 | 2025-07-15 | Deiss Limited | Fixing plate for apple cutters |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD745328S1 (en) | Cup for finger-food | |
| USD682634S1 (en) | Recessed cutting board | |
| USD699473S1 (en) | Stand for a razor | |
| USD732520S1 (en) | Housing | |
| USD720752S1 (en) | Scanner | |
| USD713391S1 (en) | Microphone | |
| USD779904S1 (en) | Chisel | |
| USD708488S1 (en) | Knife | |
| USD736189S1 (en) | Mount | |
| USD701767S1 (en) | Pod | |
| USD713126S1 (en) | Hoodie-shaped towel | |
| USD696896S1 (en) | Ebelskiver | |
| USD705092S1 (en) | Thermostat | |
| USD716109S1 (en) | Melon slicer | |
| USD732901S1 (en) | Knife | |
| USD727570S1 (en) | Lipguard | |
| USD704010S1 (en) | Knife | |
| USD727628S1 (en) | Mirror | |
| USD744977S1 (en) | Loudspeaker | |
| USD739711S1 (en) | Holder | |
| USD745338S1 (en) | Knife | |
| USD731259S1 (en) | Knife holder | |
| USD731464S1 (en) | Loudspeaker | |
| USD713215S1 (en) | Knife | |
| USD742180S1 (en) | Knife |