USD690336S1 - Hydraulic turbocharger pedestal seal - Google Patents
Hydraulic turbocharger pedestal seal Download PDFInfo
- Publication number
- USD690336S1 USD690336S1 US29/396,516 US201129396516F USD690336S US D690336 S1 USD690336 S1 US D690336S1 US 201129396516 F US201129396516 F US 201129396516F US D690336 S USD690336 S US D690336S
- Authority
- US
- United States
- Prior art keywords
- hydraulic turbocharger
- pedestal seal
- turbocharger pedestal
- seal
- hydraulic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims 2
Images
Description
Claims (1)
- The ornamental design for a hydraulic turbocharger pedestal seal, as shown and described.
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/396,516 USD690336S1 (en) | 2011-06-30 | 2011-06-30 | Hydraulic turbocharger pedestal seal |
| CA 143425 CA143425S (en) | 2011-06-30 | 2011-12-07 | Hydraulic turbocharger pedestal seal |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/396,516 USD690336S1 (en) | 2011-06-30 | 2011-06-30 | Hydraulic turbocharger pedestal seal |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD690336S1 true USD690336S1 (en) | 2013-09-24 |
Family
ID=49081085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/396,516 Active USD690336S1 (en) | 2011-06-30 | 2011-06-30 | Hydraulic turbocharger pedestal seal |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | USD690336S1 (en) |
| CA (1) | CA143425S (en) |
Cited By (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD711445S1 (en) * | 2013-08-13 | 2014-08-19 | Eaton Corporation | Helical gear differential housing |
| USD720217S1 (en) * | 2012-10-30 | 2014-12-30 | Performance Packaging Of Nevada, Llc | Flexible oral dispensing apparatus |
| USD767658S1 (en) | 2013-08-13 | 2016-09-27 | Eaton Corporation | Helical gear differential housing |
| USD774630S1 (en) * | 2016-04-21 | 2016-12-20 | Hase Llc | Toilet seal |
| USD802531S1 (en) * | 2015-03-24 | 2017-11-14 | Ying-Chieh Liao | Turbocharger adapter |
| USD803908S1 (en) * | 2016-02-10 | 2017-11-28 | Hitachi Kokusai Electric Inc. | Rotary tool for boat of semiconductor manufacturing apparatus |
| USD806520S1 (en) * | 2015-02-27 | 2018-01-02 | Todd Krombein | Mounting flange |
| USD807727S1 (en) * | 2015-02-27 | 2018-01-16 | Todd Krombein | Mounting system components |
| USD808248S1 (en) * | 2015-02-27 | 2018-01-23 | Todd Krombein | Mounting system components |
| USD811558S1 (en) * | 2016-07-26 | 2018-02-27 | Elfblend Pty Ltd | Drainage outlet |
| USD822081S1 (en) * | 2016-02-10 | 2018-07-03 | Hitachi Kokusai Electric Inc. | Rotary tool for boat of semiconductor manufacturing apparatus |
| USD837685S1 (en) * | 2016-12-20 | 2019-01-08 | Morito Co., Ltd. | Eyelet |
| USD844526S1 (en) * | 2017-03-23 | 2019-04-02 | Diego Jaime Villamizar | Hub |
| USD844525S1 (en) * | 2017-03-23 | 2019-04-02 | Diego Jaime Villamizar | Hub |
| USD884746S1 (en) * | 2017-10-26 | 2020-05-19 | Valqua, Ltd. | Seal |
| USD885444S1 (en) * | 2017-12-19 | 2020-05-26 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD885443S1 (en) * | 2017-12-19 | 2020-05-26 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD891293S1 (en) * | 2018-11-16 | 2020-07-28 | Hyuck Sang Jo | Eyelet |
| USD897504S1 (en) * | 2017-11-17 | 2020-09-29 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD898171S1 (en) * | 2017-12-19 | 2020-10-06 | Valqua, Ltd. | Seal members for use in semiconductor production apparatuses |
| USD898170S1 (en) * | 2017-12-01 | 2020-10-06 | Valqua, Ltd. | Composite seal member for semiconductor production apparatus |
| USD905761S1 (en) * | 2018-07-24 | 2020-12-22 | Valqua, Ltd. | Seal member for semiconductor production apparatus |
| USD908150S1 (en) | 2020-05-08 | 2021-01-19 | Luvata Ohio, Inc. | Welding cap |
| USD922140S1 (en) | 2018-12-02 | 2021-06-15 | Helen Of Troy Limited | Bottle lid lug |
| USD925027S1 (en) * | 2018-06-20 | 2021-07-13 | GEA HOLDING S.p.A. | Closures for scent diffusers |
| USD941377S1 (en) * | 2020-04-22 | 2022-01-18 | William Avent | Female insulator cap for use with a welder terminal lead |
| USD1073554S1 (en) * | 2023-07-17 | 2025-05-06 | Scaled Buy Llc | Metallic automotive shifter linkage bushing |
| USD1073556S1 (en) * | 2023-07-19 | 2025-05-06 | Scaled Buy Llc | Plastic automotive shifter linkage bushing |
Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3557549A (en) | 1969-03-21 | 1971-01-26 | Caterpillar Tractor Co | Turbocharger system for internal combustion engine |
| US4893474A (en) | 1988-07-25 | 1990-01-16 | Allied-Signal Inc. | Turbocharger with dual function actuator |
| USD402354S (en) * | 1997-10-09 | 1998-12-08 | Delta Engineering Holdings Limited | Flange mask |
| US6109167A (en) | 1998-06-04 | 2000-08-29 | Gits Manufacturing Company | Actuator with axially movable O-rings between piston and housing |
| USD435090S (en) * | 1999-05-20 | 2000-12-12 | Eastern Sheet Metal, Inc. | Gasket |
| USD539117S1 (en) * | 2004-10-20 | 2007-03-27 | Freshfield Properites Pty, Ltd. | Seal insert |
| USD582437S1 (en) * | 2007-10-15 | 2008-12-09 | Eagle Industry Co., Ltd. | Seal for a rotary shaft |
| USD616966S1 (en) * | 2009-02-11 | 2010-06-01 | Kmt Waterjet Systems Inc. | Outer follower element for a high pressure seal |
| USD631066S1 (en) * | 2008-11-26 | 2011-01-18 | Eagle Industry Co., Ltd. | Seal for a rotary shaft |
| USD655796S1 (en) * | 2010-01-06 | 2012-03-13 | Fernco, Inc. | Urinal seal |
-
2011
- 2011-06-30 US US29/396,516 patent/USD690336S1/en active Active
- 2011-12-07 CA CA 143425 patent/CA143425S/en not_active Expired - Lifetime
Patent Citations (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3557549A (en) | 1969-03-21 | 1971-01-26 | Caterpillar Tractor Co | Turbocharger system for internal combustion engine |
| US4893474A (en) | 1988-07-25 | 1990-01-16 | Allied-Signal Inc. | Turbocharger with dual function actuator |
| USD402354S (en) * | 1997-10-09 | 1998-12-08 | Delta Engineering Holdings Limited | Flange mask |
| US6109167A (en) | 1998-06-04 | 2000-08-29 | Gits Manufacturing Company | Actuator with axially movable O-rings between piston and housing |
| USD435090S (en) * | 1999-05-20 | 2000-12-12 | Eastern Sheet Metal, Inc. | Gasket |
| USD539117S1 (en) * | 2004-10-20 | 2007-03-27 | Freshfield Properites Pty, Ltd. | Seal insert |
| USD582437S1 (en) * | 2007-10-15 | 2008-12-09 | Eagle Industry Co., Ltd. | Seal for a rotary shaft |
| USD631066S1 (en) * | 2008-11-26 | 2011-01-18 | Eagle Industry Co., Ltd. | Seal for a rotary shaft |
| USD616966S1 (en) * | 2009-02-11 | 2010-06-01 | Kmt Waterjet Systems Inc. | Outer follower element for a high pressure seal |
| USD655796S1 (en) * | 2010-01-06 | 2012-03-13 | Fernco, Inc. | Urinal seal |
Cited By (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD720217S1 (en) * | 2012-10-30 | 2014-12-30 | Performance Packaging Of Nevada, Llc | Flexible oral dispensing apparatus |
| USD818360S1 (en) | 2012-10-30 | 2018-05-22 | Performance Packaging Of Nevada, Llc | Flexible oral dispensing apparatus |
| USD767658S1 (en) | 2013-08-13 | 2016-09-27 | Eaton Corporation | Helical gear differential housing |
| USD770550S1 (en) | 2013-08-13 | 2016-11-01 | Eaton Corporation | Helical gear differential housing |
| USD711445S1 (en) * | 2013-08-13 | 2014-08-19 | Eaton Corporation | Helical gear differential housing |
| USD808248S1 (en) * | 2015-02-27 | 2018-01-23 | Todd Krombein | Mounting system components |
| USD806520S1 (en) * | 2015-02-27 | 2018-01-02 | Todd Krombein | Mounting flange |
| USD807727S1 (en) * | 2015-02-27 | 2018-01-16 | Todd Krombein | Mounting system components |
| USD802531S1 (en) * | 2015-03-24 | 2017-11-14 | Ying-Chieh Liao | Turbocharger adapter |
| USD822081S1 (en) * | 2016-02-10 | 2018-07-03 | Hitachi Kokusai Electric Inc. | Rotary tool for boat of semiconductor manufacturing apparatus |
| USD803908S1 (en) * | 2016-02-10 | 2017-11-28 | Hitachi Kokusai Electric Inc. | Rotary tool for boat of semiconductor manufacturing apparatus |
| USD774630S1 (en) * | 2016-04-21 | 2016-12-20 | Hase Llc | Toilet seal |
| USD811558S1 (en) * | 2016-07-26 | 2018-02-27 | Elfblend Pty Ltd | Drainage outlet |
| USD837685S1 (en) * | 2016-12-20 | 2019-01-08 | Morito Co., Ltd. | Eyelet |
| USD844526S1 (en) * | 2017-03-23 | 2019-04-02 | Diego Jaime Villamizar | Hub |
| USD844525S1 (en) * | 2017-03-23 | 2019-04-02 | Diego Jaime Villamizar | Hub |
| USD884746S1 (en) * | 2017-10-26 | 2020-05-19 | Valqua, Ltd. | Seal |
| USD897504S1 (en) * | 2017-11-17 | 2020-09-29 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD922545S1 (en) | 2017-11-17 | 2021-06-15 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD923158S1 (en) | 2017-11-17 | 2021-06-22 | Valqua, Ltd. | Seal members for use in semiconductor production apparatus |
| USD923159S1 (en) | 2017-11-17 | 2021-06-22 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD922027S1 (en) | 2017-12-01 | 2021-06-15 | Valqua, Ltd. | Composite seal member for semiconductor production apparatus |
| USD922546S1 (en) | 2017-12-01 | 2021-06-15 | Valqua, Ltd. | Composite seal member for semiconductor production apparatus |
| USD898170S1 (en) * | 2017-12-01 | 2020-10-06 | Valqua, Ltd. | Composite seal member for semiconductor production apparatus |
| USD898171S1 (en) * | 2017-12-19 | 2020-10-06 | Valqua, Ltd. | Seal members for use in semiconductor production apparatuses |
| USD885443S1 (en) * | 2017-12-19 | 2020-05-26 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD922547S1 (en) | 2017-12-19 | 2021-06-15 | Valqua, Ltd. | Seal members for use in semiconductor production apparatuses |
| USD885444S1 (en) * | 2017-12-19 | 2020-05-26 | Valqua, Ltd. | Seal member for use in semiconductor production apparatus |
| USD925027S1 (en) * | 2018-06-20 | 2021-07-13 | GEA HOLDING S.p.A. | Closures for scent diffusers |
| USD919670S1 (en) | 2018-07-24 | 2021-05-18 | Valqua, Ltd. | Seal member for semiconductor production apparatus |
| USD919669S1 (en) | 2018-07-24 | 2021-05-18 | Valqua, Ltd. | Seal member for semiconductor production apparatus |
| USD905761S1 (en) * | 2018-07-24 | 2020-12-22 | Valqua, Ltd. | Seal member for semiconductor production apparatus |
| USD891293S1 (en) * | 2018-11-16 | 2020-07-28 | Hyuck Sang Jo | Eyelet |
| USD922140S1 (en) | 2018-12-02 | 2021-06-15 | Helen Of Troy Limited | Bottle lid lug |
| USD934026S1 (en) | 2018-12-02 | 2021-10-26 | Helen Of Troy Limited | Bottle lid |
| USD941377S1 (en) * | 2020-04-22 | 2022-01-18 | William Avent | Female insulator cap for use with a welder terminal lead |
| USD941897S1 (en) * | 2020-04-22 | 2022-01-25 | William Avent | Female insulator cap for use with a welder terminal lead |
| USD963010S1 (en) * | 2020-04-22 | 2022-09-06 | William Avent | Male insulator cap for use with a welder terminal lead |
| USD966363S1 (en) * | 2020-04-22 | 2022-10-11 | William Avent | Male insulating cap |
| USD908150S1 (en) | 2020-05-08 | 2021-01-19 | Luvata Ohio, Inc. | Welding cap |
| USD1073554S1 (en) * | 2023-07-17 | 2025-05-06 | Scaled Buy Llc | Metallic automotive shifter linkage bushing |
| USD1073556S1 (en) * | 2023-07-19 | 2025-05-06 | Scaled Buy Llc | Plastic automotive shifter linkage bushing |
Also Published As
| Publication number | Publication date |
|---|---|
| CA143425S (en) | 2013-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD690336S1 (en) | Hydraulic turbocharger pedestal seal | |
| USD672435S1 (en) | Showerhead | |
| USD659175S1 (en) | Sealing ring | |
| USD680153S1 (en) | Spectacles | |
| USD696751S1 (en) | Slip-on gasket | |
| USD663714S1 (en) | Headsets for cellular phones | |
| USD701600S1 (en) | Ear swab | |
| USD672266S1 (en) | Ring | |
| USD710930S1 (en) | Goggles | |
| USD707572S1 (en) | Watch | |
| USD681176S1 (en) | Seal ring | |
| USD656164S1 (en) | Front loader assembly | |
| USD683063S1 (en) | Lighting fixture | |
| USD674377S1 (en) | Audio headset | |
| USD670407S1 (en) | Shingle | |
| USD650813S1 (en) | Pump | |
| USD666356S1 (en) | Hookah | |
| USD676428S1 (en) | Microphone | |
| USD667366S1 (en) | Tire | |
| USD665034S1 (en) | Scooter | |
| USD740436S1 (en) | Pipette barrel | |
| USD664262S1 (en) | Impeller arrangement for fermenter | |
| USD646353S1 (en) | Showerhead | |
| USD693091S1 (en) | Pants | |
| USD694145S1 (en) | Ring |