USD64643S - Design for a building block - Google Patents
Design for a building block Download PDFInfo
- Publication number
- USD64643S USD64643S US D64643 S USD64643 S US D64643S
- Authority
- US
- United States
- Prior art keywords
- design
- building block
- building
- des
- straight
- Prior art date
Links
- AGOYDEPGAOXOCK-KCBOHYOISA-N clarithromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@](C)([C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)OC)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 AGOYDEPGAOXOCK-KCBOHYOISA-N 0.000 description 2
Images
Description
May 13 1924. Des. 64,643
M. T. STRAIGHT BUILDING BDOCK Filed Nov. 4. 1922 Patented May 13, 1924. 4 j Des. 651,643
UNITED STATES PATENT OFFICE.
. DESIGN FOR A BUILDING BLOCK.
Application filed November 4, 1922. Serial No. 4,225. Term of patent 3! years.
To all whom it may concern: The figure shows a perspective view of 3.
Be it known that I, MEBTON T. STRAIGHT, building block.
a citizen of the United States, and a resi- I claim:
dent of Adel, in the county of Dallas and The ornamental design for a building State of Iowa, have invented a certain new, block, as shown.
original, and ornamental Design for Build- Des Mloines, Iowa, April 20, 1922.
ing Blocks, of which the following is a specification, reference being had to the ac- MERTON T. STRAIGHT.
coinpanying drawing, forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD64643S (en) | Design for a building block | |
| USD74118S (en) | Design for a stocking | |
| USD64484S (en) | Design fob a show case | |
| USD75212S (en) | Design fob a brick | |
| USD61176S (en) | Design for a doll or statuette | |
| USD79840S (en) | Design fob an afbon | |
| USD80351S (en) | Design fob a casing foe an agitator | |
| USD76024S (en) | Design for a store front or similar article | |
| USD73886S (en) | Design for a toy | |
| USD78482S (en) | Design for a lamp | |
| USD72206S (en) | Design foe | |
| USD65801S (en) | Design for a monumental vase | |
| USD74779S (en) | Design for an oil can | |
| USD57602S (en) | Design fob | |
| USD83566S (en) | Design fob a smokee s wall set | |
| USD64756S (en) | Design for a statue | |
| USD73381S (en) | Design for a candy box | |
| USD121923S (en) | Design fob a toy | |
| USD58442S (en) | Design fob- a nail | |
| USD59787S (en) | Design fob a doll | |
| USD66284S (en) | Design for a grave lining | |
| USD72394S (en) | Design fob a toy | |
| USD117686S (en) | Design fob a nosing strip ob similab | |
| USD74103S (en) | Design for a candlestick ob similab article of manufacture | |
| USD87589S (en) | Design for a burial vatjlt |