USD554201S1 - Handle - Google Patents
Handle Download PDFInfo
- Publication number
- USD554201S1 USD554201S1 US29/234,286 US23428605F USD554201S US D554201 S1 USD554201 S1 US D554201S1 US 23428605 F US23428605 F US 23428605F US D554201 S USD554201 S US D554201S
- Authority
- US
- United States
- Prior art keywords
- handle
- orthogonal view
- view
- new design
- showing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 3
- 230000007613 environmental effect Effects 0.000 description 1
Images
Description
The broken lines showing the rip cord and wheel are included for the purpose of illustrating environmental structures and form no part of the claimed design.
Claims (1)
- The ornamental design for a handle, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/234,286 USD554201S1 (en) | 2005-07-14 | 2005-07-14 | Handle |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/234,286 USD554201S1 (en) | 2005-07-14 | 2005-07-14 | Handle |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD554201S1 true USD554201S1 (en) | 2007-10-30 |
Family
ID=38623848
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/234,286 Expired - Lifetime USD554201S1 (en) | 2005-07-14 | 2005-07-14 | Handle |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD554201S1 (en) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20090253345A1 (en) * | 2008-04-04 | 2009-10-08 | Tomy Company, Ltd. | Spinner for toy top |
| USD616043S1 (en) * | 2008-06-09 | 2010-05-18 | Tomy Company, Ltd. | Toy hand grip for toy top spinner |
| USD637661S1 (en) | 2010-04-15 | 2011-05-10 | Tomy Company, Ltd. | Winder for toy top spinner |
| USD639349S1 (en) | 2010-04-05 | 2011-06-07 | Tomy Company, Ltd. | Toy top spinner |
| US20110177750A1 (en) * | 2010-01-15 | 2011-07-21 | Tomy Company, Ltd. | Spinner for toy top |
| US8715032B2 (en) | 2010-10-06 | 2014-05-06 | Tomy Company, Ltd. | Spinner for toy top |
| USD735815S1 (en) * | 2012-10-31 | 2015-08-04 | Vladislav Shyutten | Amusement projectile toy |
| USD759164S1 (en) * | 2015-04-24 | 2016-06-14 | SZ DJI Technology Co., Ltd. | Launcher for toy aerial projectiles |
| US9427671B2 (en) | 2014-05-30 | 2016-08-30 | Mattel, Inc. | Toy vehicle launcher and toy track for use therewith |
| US9707488B2 (en) | 2013-05-03 | 2017-07-18 | Mattel, Inc. | Toy vehicle, launching apparatus therefor and methods of using the same |
| USD825677S1 (en) * | 2017-02-28 | 2018-08-14 | Tomy Company, Ltd. | Launching apparatus for spinning top toy |
| USD908175S1 (en) * | 2018-12-12 | 2021-01-19 | MerchSource, LLC | Toy paper airplane launcher |
| USD921563S1 (en) * | 2019-11-14 | 2021-06-08 | Shenzhen Lefeet Innovation Technology Co., Ltd. | Single handle for single cylinder underwater propeller |
| USD1091719S1 (en) * | 2023-07-25 | 2025-09-02 | Tomy Company, Ltd. | Winder of launching apparatus for spinning top toy |
Citations (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US681499A (en) * | 1901-04-05 | 1901-08-27 | Matthew Duffner | Toy. |
| US922416A (en) * | 1908-08-03 | 1909-05-18 | Rudolph Glaser | Toy. |
| US2938300A (en) * | 1958-07-17 | 1960-05-31 | Alfred R Newbert | Rotor spinning device |
| US3246424A (en) * | 1963-04-11 | 1966-04-19 | Joseph E Gregory | Spinning toy launcher |
| US3570467A (en) * | 1967-06-16 | 1971-03-16 | Woodstream Corp | Bird launcher |
| US3701216A (en) * | 1971-12-22 | 1972-10-31 | California R & D Center | Wheel apparatus and rack and pinion launcher enabling repeated strokes and having automatic ejector |
| USD246758S (en) | 1976-04-12 | 1977-12-27 | Honda Giken Kogyo Kabushiki Kaisha | Handle grip for vehicle |
| US4165580A (en) * | 1976-11-05 | 1979-08-28 | Motoshi Miura | Flying toy |
| USD269850S (en) | 1981-07-22 | 1983-07-26 | Drag Specialties, Inc. | Handlebar grip |
| USD270345S (en) | 1982-08-02 | 1983-08-30 | Injoy-A-Stick | Video game control grip |
| USD274122S (en) | 1983-06-20 | 1984-06-05 | Drag Specialties, Inc. | Motorcycle handlebar grip |
| USD278879S (en) | 1983-10-14 | 1985-05-21 | Chun-Hsiung Hwung | Grip |
| USD284259S (en) | 1984-08-06 | 1986-06-17 | Oury Grip U.S.A., Inc. | Cycle hand grip |
| USD287568S (en) | 1983-05-11 | 1987-01-06 | Marie-Louise Hernqvist | Handlebar grip |
| USD298309S (en) | 1984-12-27 | 1988-11-01 | Huret Et Ses Fils | Brake and derailleur actuating unit |
| US4781642A (en) * | 1987-07-29 | 1988-11-01 | Victor Stanzel | Rotary flying toy |
| US4895044A (en) | 1989-02-22 | 1990-01-23 | Aero Toys, Incorporated | Hand grip for cycle handles |
| USD311676S (en) | 1988-06-17 | 1990-10-30 | Neal Kenneth L | Bicycle handlebar grip |
| USD320125S (en) | 1988-12-06 | 1991-09-24 | Newell Co. | Handle for cookware or the like |
| USD320922S (en) | 1990-02-26 | 1991-10-22 | Lurkis Jeffry L | Bicycle handle bar grip |
| USD324478S (en) | 1990-04-18 | 1992-03-10 | Baer Anna M | Bicycle or motorcycle handlebar grip |
| USD324634S (en) | 1990-07-20 | 1992-03-17 | Co-Union Industry Co., Ltd. | Handlebar grip |
| USD364898S (en) * | 1994-10-26 | 1995-12-05 | Davidson Frankie G | Toy |
| USD372656S (en) | 1994-09-06 | 1996-08-13 | Cateye Co., Ltd. | Handlebar grip for a bicycle |
| USD386220S (en) * | 1996-08-09 | 1997-11-11 | Schossow Charles C | Battery operated flying toy |
| USD404282S (en) | 1998-04-01 | 1999-01-19 | Yi-Hsung Hsu | Bicycle handle grip |
| USD405342S (en) | 1998-04-27 | 1999-02-09 | Thompson Spencer J | Handlebar grip |
| USD407048S (en) | 1997-05-13 | 1999-03-23 | Ahlberg Rehab Ab | Handle grip with brake lever mechanism |
| USD409182S (en) | 1998-02-02 | 1999-05-04 | Mad Catz, Inc. | Dual controller assembly for video games |
| USD411432S (en) | 1998-02-27 | 1999-06-22 | Kuryakyn Holdings, Inc. | Iso handlebar grip |
| USD413880S (en) | 1998-08-06 | 1999-09-14 | First Person Gaming, Inc. | Computer controller |
| USD422194S (en) | 1998-06-22 | 2000-04-04 | Speed Control, Inc. | Shift mechanism |
| USD428012S (en) | 1999-08-17 | 2000-07-11 | Acco Brands, Inc. | Game controller |
| USD429990S (en) | 1998-11-30 | 2000-08-29 | The Procter & Gamble Co. | Handle grip |
| US6221409B1 (en) * | 1998-08-28 | 2001-04-24 | Nestec S.A. | Rotatable frozen confectionary product |
| US20020098768A1 (en) * | 2001-01-19 | 2002-07-25 | Kuo Yin Jyh | Audio and video effect flight toy |
| USD461390S1 (en) | 2001-09-04 | 2002-08-13 | Paul M. Livingston | Grip for handle bar |
| USD463501S1 (en) | 2001-03-29 | 2002-09-24 | Konami Corporation | Operating apparatus for game machine |
| USD479239S1 (en) | 2002-05-21 | 2003-09-02 | Logitech Europe S.A. | Joystick |
| US6681653B2 (en) | 2002-03-06 | 2004-01-27 | Tsai-Yun Yu | Vehicle handlebar grip |
-
2005
- 2005-07-14 US US29/234,286 patent/USD554201S1/en not_active Expired - Lifetime
Patent Citations (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US681499A (en) * | 1901-04-05 | 1901-08-27 | Matthew Duffner | Toy. |
| US922416A (en) * | 1908-08-03 | 1909-05-18 | Rudolph Glaser | Toy. |
| US2938300A (en) * | 1958-07-17 | 1960-05-31 | Alfred R Newbert | Rotor spinning device |
| US3246424A (en) * | 1963-04-11 | 1966-04-19 | Joseph E Gregory | Spinning toy launcher |
| US3570467A (en) * | 1967-06-16 | 1971-03-16 | Woodstream Corp | Bird launcher |
| US3701216A (en) * | 1971-12-22 | 1972-10-31 | California R & D Center | Wheel apparatus and rack and pinion launcher enabling repeated strokes and having automatic ejector |
| USD246758S (en) | 1976-04-12 | 1977-12-27 | Honda Giken Kogyo Kabushiki Kaisha | Handle grip for vehicle |
| US4165580A (en) * | 1976-11-05 | 1979-08-28 | Motoshi Miura | Flying toy |
| USD269850S (en) | 1981-07-22 | 1983-07-26 | Drag Specialties, Inc. | Handlebar grip |
| USD270345S (en) | 1982-08-02 | 1983-08-30 | Injoy-A-Stick | Video game control grip |
| USD287568S (en) | 1983-05-11 | 1987-01-06 | Marie-Louise Hernqvist | Handlebar grip |
| USD274122S (en) | 1983-06-20 | 1984-06-05 | Drag Specialties, Inc. | Motorcycle handlebar grip |
| USD278879S (en) | 1983-10-14 | 1985-05-21 | Chun-Hsiung Hwung | Grip |
| USD284259S (en) | 1984-08-06 | 1986-06-17 | Oury Grip U.S.A., Inc. | Cycle hand grip |
| USD298309S (en) | 1984-12-27 | 1988-11-01 | Huret Et Ses Fils | Brake and derailleur actuating unit |
| US4781642A (en) * | 1987-07-29 | 1988-11-01 | Victor Stanzel | Rotary flying toy |
| USD311676S (en) | 1988-06-17 | 1990-10-30 | Neal Kenneth L | Bicycle handlebar grip |
| USD320125S (en) | 1988-12-06 | 1991-09-24 | Newell Co. | Handle for cookware or the like |
| US4895044A (en) | 1989-02-22 | 1990-01-23 | Aero Toys, Incorporated | Hand grip for cycle handles |
| USD320922S (en) | 1990-02-26 | 1991-10-22 | Lurkis Jeffry L | Bicycle handle bar grip |
| USD324478S (en) | 1990-04-18 | 1992-03-10 | Baer Anna M | Bicycle or motorcycle handlebar grip |
| USD324634S (en) | 1990-07-20 | 1992-03-17 | Co-Union Industry Co., Ltd. | Handlebar grip |
| USD372656S (en) | 1994-09-06 | 1996-08-13 | Cateye Co., Ltd. | Handlebar grip for a bicycle |
| USD364898S (en) * | 1994-10-26 | 1995-12-05 | Davidson Frankie G | Toy |
| USD386220S (en) * | 1996-08-09 | 1997-11-11 | Schossow Charles C | Battery operated flying toy |
| USD407048S (en) | 1997-05-13 | 1999-03-23 | Ahlberg Rehab Ab | Handle grip with brake lever mechanism |
| USD409182S (en) | 1998-02-02 | 1999-05-04 | Mad Catz, Inc. | Dual controller assembly for video games |
| USD411432S (en) | 1998-02-27 | 1999-06-22 | Kuryakyn Holdings, Inc. | Iso handlebar grip |
| USD404282S (en) | 1998-04-01 | 1999-01-19 | Yi-Hsung Hsu | Bicycle handle grip |
| USD405342S (en) | 1998-04-27 | 1999-02-09 | Thompson Spencer J | Handlebar grip |
| USD422194S (en) | 1998-06-22 | 2000-04-04 | Speed Control, Inc. | Shift mechanism |
| USD413880S (en) | 1998-08-06 | 1999-09-14 | First Person Gaming, Inc. | Computer controller |
| US6221409B1 (en) * | 1998-08-28 | 2001-04-24 | Nestec S.A. | Rotatable frozen confectionary product |
| USD429990S (en) | 1998-11-30 | 2000-08-29 | The Procter & Gamble Co. | Handle grip |
| USD428012S (en) | 1999-08-17 | 2000-07-11 | Acco Brands, Inc. | Game controller |
| US20020098768A1 (en) * | 2001-01-19 | 2002-07-25 | Kuo Yin Jyh | Audio and video effect flight toy |
| USD463501S1 (en) | 2001-03-29 | 2002-09-24 | Konami Corporation | Operating apparatus for game machine |
| USD461390S1 (en) | 2001-09-04 | 2002-08-13 | Paul M. Livingston | Grip for handle bar |
| US6681653B2 (en) | 2002-03-06 | 2004-01-27 | Tsai-Yun Yu | Vehicle handlebar grip |
| USD479239S1 (en) | 2002-05-21 | 2003-09-02 | Logitech Europe S.A. | Joystick |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20090253345A1 (en) * | 2008-04-04 | 2009-10-08 | Tomy Company, Ltd. | Spinner for toy top |
| USD616043S1 (en) * | 2008-06-09 | 2010-05-18 | Tomy Company, Ltd. | Toy hand grip for toy top spinner |
| US20110177750A1 (en) * | 2010-01-15 | 2011-07-21 | Tomy Company, Ltd. | Spinner for toy top |
| USD639349S1 (en) | 2010-04-05 | 2011-06-07 | Tomy Company, Ltd. | Toy top spinner |
| USD637661S1 (en) | 2010-04-15 | 2011-05-10 | Tomy Company, Ltd. | Winder for toy top spinner |
| US8715032B2 (en) | 2010-10-06 | 2014-05-06 | Tomy Company, Ltd. | Spinner for toy top |
| USD735815S1 (en) * | 2012-10-31 | 2015-08-04 | Vladislav Shyutten | Amusement projectile toy |
| US9707488B2 (en) | 2013-05-03 | 2017-07-18 | Mattel, Inc. | Toy vehicle, launching apparatus therefor and methods of using the same |
| US9427671B2 (en) | 2014-05-30 | 2016-08-30 | Mattel, Inc. | Toy vehicle launcher and toy track for use therewith |
| USD759164S1 (en) * | 2015-04-24 | 2016-06-14 | SZ DJI Technology Co., Ltd. | Launcher for toy aerial projectiles |
| USD825677S1 (en) * | 2017-02-28 | 2018-08-14 | Tomy Company, Ltd. | Launching apparatus for spinning top toy |
| USD908175S1 (en) * | 2018-12-12 | 2021-01-19 | MerchSource, LLC | Toy paper airplane launcher |
| USD921563S1 (en) * | 2019-11-14 | 2021-06-08 | Shenzhen Lefeet Innovation Technology Co., Ltd. | Single handle for single cylinder underwater propeller |
| USD1091719S1 (en) * | 2023-07-25 | 2025-09-02 | Tomy Company, Ltd. | Winder of launching apparatus for spinning top toy |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD519813S1 (en) | Hatchet | |
| USD618797S1 (en) | Handle assembly for surgical instrument | |
| USD548508S1 (en) | Carafe | |
| USD557684S1 (en) | Wireless headphone | |
| USD527971S1 (en) | Portable electric drill | |
| USD543081S1 (en) | Cordless drill | |
| USD528406S1 (en) | Oversize carabiner | |
| USD556256S1 (en) | Printer | |
| USD556257S1 (en) | Printer | |
| USD549740S1 (en) | Weight for a vehicle | |
| USD523635S1 (en) | Toolbox | |
| USD571448S1 (en) | Shroud floor fan | |
| USD554201S1 (en) | Handle | |
| USD520937S1 (en) | Golf cart top | |
| USD535451S1 (en) | Wheelbarrow | |
| USD567125S1 (en) | Stress meter | |
| USD565648S1 (en) | Printer | |
| USD515952S1 (en) | Multimeter | |
| USD544485S1 (en) | Handheld computer | |
| USD534209S1 (en) | Printer | |
| USD526886S1 (en) | Ribbon carabiner | |
| USD570664S1 (en) | Handle for a screwdriver | |
| USD575569S1 (en) | Interchangeable CD-page | |
| USD540643S1 (en) | Powered drill | |
| USD544532S1 (en) | Printer |