USD55100S - Design fob - Google Patents
Design fob Download PDFInfo
- Publication number
- USD55100S USD55100S US D55100 S USD55100 S US D55100S
- Authority
- US
- United States
- Prior art keywords
- design fob
- design
- tire
- fob
- tenney
- Prior art date
Links
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
- QEVHRUUCFGRFIF-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C(C5=CC=C(OC)C=C5N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 QEVHRUUCFGRFIF-MDEJGZGSSA-N 0.000 description 2
Images
Description
UNITED STATES PATENT OFFICE.
DESIGN FOR A TIRE.
55,100. speeifieatien for Design-i Patented May 4, 1920.
Application filed June 28, 1919 Serial No. 307,488. Term of patent 3% years.
To all whom it may concern: 7 Figure 1 is a plan View of a portion of a Be it known that I, JOHN TENNEY, Jr., a tire of my new design, and citizen of the United States, residin at V Fig. 2 is a cross-section of the same. Plainfield, in the county of Union and tate I claim: of New J ersey,have invented anew, original," The ornamental design for a tire, as
and ornamental Design for Tires, of which shown. the following is a specification, reference bev a ing had tothe accompanying drawing, 'form- 1 V JOHN TENNEY, JR.
ing part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD55100S (en) | Design fob | |
| USD58610S (en) | Harry mccreary | |
| USD54647S (en) | Design for a tire | |
| USD60343S (en) | Design for a tire | |
| USD57125S (en) | Design fob a tike | |
| USD61221S (en) | William carnal | |
| USD61911S (en) | Design foe a head ornament | |
| USD59304S (en) | Design for a tire | |
| USD69986S (en) | cullen | |
| USD56934S (en) | Design for a tire-tread | |
| USD54347S (en) | Design for a tire-casing | |
| USD73254S (en) | William c | |
| USD62972S (en) | Design for a tike | |
| USD58419S (en) | Design fob | |
| USD61030S (en) | Design for an elastic vehicle tire | |
| USD54291S (en) | Design fob a tire | |
| USD58554S (en) | Design | |
| USD57124S (en) | Design fob a tike | |
| USD59379S (en) | Design fob a tbaction-tbead | |
| USD55332S (en) | George noah schell | |
| USD55216S (en) | Design for a tire | |
| USD61797S (en) | Design fob a tibe | |
| USD59815S (en) | Design for a tire | |
| USD93675S (en) | Design fob a nut cracker | |
| USD62659S (en) | Design for a rubber tire |