USD423693S - Melon candle jar - Google Patents
Melon candle jar Download PDFInfo
- Publication number
- USD423693S USD423693S US29/105,439 US10543999F USD423693S US D423693 S USD423693 S US D423693S US 10543999 F US10543999 F US 10543999F US D423693 S USD423693 S US D423693S
- Authority
- US
- United States
- Prior art keywords
- melon
- candle jar
- candle
- jar
- view
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 241000219112 Cucumis Species 0.000 title claims description 3
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 title claims description 3
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
FIG. 1 is a perspective view of the design for a melon candle jar;
FIG. 2 is a front plan view thereof;
FIG. 3 is a left side view thereof;
FIG. 4 is a right side view thereof;
FIG. 5 is a top plan view thereof; and,
FIG. 6 is a bottom plan view of the above-identified design.
Claims (1)
- The ornamental design for a melon candle jar, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/105,439 USD423693S (en) | 1999-05-25 | 1999-05-25 | Melon candle jar |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US29/105,439 USD423693S (en) | 1999-05-25 | 1999-05-25 | Melon candle jar |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD423693S true USD423693S (en) | 2000-04-25 |
Family
ID=71780667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US29/105,439 Expired - Lifetime USD423693S (en) | 1999-05-25 | 1999-05-25 | Melon candle jar |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD423693S (en) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD750814S1 (en) * | 2013-07-11 | 2016-03-01 | Kimberly L. Moyal | Gel candle |
| USD767800S1 (en) * | 2013-07-11 | 2016-09-27 | Kimberly L. Moyal | Gel candle |
| USD859701S1 (en) * | 2017-10-18 | 2019-09-10 | Xing Zuo | Musical candle |
| USD862748S1 (en) * | 2018-09-06 | 2019-10-08 | Xing Zuo | Music candle lamp |
| USD878707S1 (en) * | 2016-03-23 | 2020-03-24 | Kukki Gmbh | Partially frozen drink |
| USD991496S1 (en) | 2022-05-20 | 2023-07-04 | Healing Light Soy Candles, LLC | Candle with accoutrements |
Citations (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US218687A (en) * | 1879-08-19 | Improvement in fruit-jar fasteners | ||
| US248098A (en) * | 1881-10-11 | Ohaelbs house | ||
| US792841A (en) * | 1904-01-05 | 1905-06-20 | Edward Nolte | Fruit-jar fastener. |
| US1602346A (en) * | 1924-11-17 | 1926-10-05 | Lynchburg Glass Corp | Glass jar |
| US1628330A (en) * | 1923-12-03 | 1927-05-10 | Aridor Company | Display receptacle |
| USRE18623E (en) * | 1932-10-18 | op medina | ||
| US2636370A (en) * | 1948-12-11 | 1953-04-28 | Gideon A Kramer | Method of decorating candles and the product thereof |
| US3039283A (en) * | 1960-11-08 | 1962-06-19 | Vincent J Buscemi | Method of ornamenting glass |
| US3254512A (en) * | 1960-06-17 | 1966-06-07 | Dacom Inc | Candles and method of making same |
| US3327108A (en) * | 1965-10-23 | 1967-06-20 | Rubel & Co Decorator Accessori | Hurricane lantern |
| US3741711A (en) * | 1972-03-27 | 1973-06-26 | G Bryant | Composite indefinitely reusable decorative candle |
| US3744956A (en) * | 1970-11-04 | 1973-07-10 | Vollmar W Bonner Wachsbleiche | Wax candle manufacture |
| US3947232A (en) * | 1974-07-18 | 1976-03-30 | Donald Foster | Decorative candle and method of manufacture therefor |
| US3998922A (en) * | 1976-01-28 | 1976-12-21 | Weiss Theodore H | Method of making a candle in a container |
| US4017729A (en) * | 1973-01-26 | 1977-04-12 | Faroy, Inc. | Decorative lamp |
| US4224017A (en) * | 1977-07-13 | 1980-09-23 | Valley Candle Mfg. Co., Inc. | Locking arrangement for a candle |
| US4225552A (en) * | 1978-01-23 | 1980-09-30 | Se Won Chang | Decorative candle |
| USD260381S (en) * | 1979-06-15 | 1981-08-25 | Adkins M Wayne | Thermoscope |
| US4304547A (en) * | 1978-06-23 | 1981-12-08 | Buzil Corporation | Candle having removable tabs for revealing messages |
| USD266594S (en) * | 1979-05-18 | 1982-10-19 | A.Ahlstrom Osakeyhtio | Candlestick |
| US4427366A (en) * | 1982-02-19 | 1984-01-24 | Moore Kenneth L | Scented candle |
| US4826428A (en) * | 1987-12-07 | 1989-05-02 | Ki Yip Chemical Works Limited | Decorative candle |
| US4931014A (en) * | 1988-12-27 | 1990-06-05 | Scott Edward J | Beveled glass candle holder |
| US5395233A (en) * | 1994-01-18 | 1995-03-07 | Scentex, Inc. | Potpourri decorative candle and method of making same |
| US5605765A (en) * | 1994-12-06 | 1997-02-25 | Magma Industries (Ilum) Ltd. | Decorative composite article and method of making a decorative pattern |
| US5632615A (en) * | 1995-12-11 | 1997-05-27 | Degarmo; Billy B. | Cookie cutter candle |
| USD380057S (en) * | 1995-08-29 | 1997-06-17 | Lukasik Susan L | Candle |
| USD380417S (en) * | 1997-05-02 | 1997-07-01 | Christopher Hardy | Candle holder |
| USD387446S (en) * | 1996-11-04 | 1997-12-09 | Aroma Tech, Inc. | Candle with bubbles |
| USD388892S (en) * | 1996-01-11 | 1998-01-06 | Design Ideas Ltd. | Candle holder |
| US5762487A (en) * | 1996-09-27 | 1998-06-09 | Coventry Creations, Inc. | Decorative candles |
| US5879694A (en) * | 1995-08-29 | 1999-03-09 | Pennzoil Products Company | Transparent gel candles |
| US5879151A (en) * | 1997-12-19 | 1999-03-09 | S. C. Johnson & Son, Inc. | Votive candle holder lid, candle package and related method |
| USD407164S (en) * | 1996-12-20 | 1999-03-23 | Aroma Tech | Candle with a pearl-like appearance |
| US5910005A (en) * | 1996-04-04 | 1999-06-08 | Scherr; Mark J. | Candleforming method |
| USD411891S (en) * | 1997-02-07 | 1999-07-06 | Aromatic Technologies, Inc. | Gel-like candle |
| US5927964A (en) * | 1997-08-05 | 1999-07-27 | Transmet Corporation | Candle with embedded metal particulates |
| US5927965A (en) * | 1998-06-18 | 1999-07-27 | Lumi-Lite Candle Company, Inc. | Candle with surrounding decorative combustible material |
| US5951278A (en) * | 1997-10-01 | 1999-09-14 | Young; April Diane | Candle holder apparatus |
-
1999
- 1999-05-25 US US29/105,439 patent/USD423693S/en not_active Expired - Lifetime
Patent Citations (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US218687A (en) * | 1879-08-19 | Improvement in fruit-jar fasteners | ||
| US248098A (en) * | 1881-10-11 | Ohaelbs house | ||
| USRE18623E (en) * | 1932-10-18 | op medina | ||
| US792841A (en) * | 1904-01-05 | 1905-06-20 | Edward Nolte | Fruit-jar fastener. |
| US1628330A (en) * | 1923-12-03 | 1927-05-10 | Aridor Company | Display receptacle |
| US1602346A (en) * | 1924-11-17 | 1926-10-05 | Lynchburg Glass Corp | Glass jar |
| US2636370A (en) * | 1948-12-11 | 1953-04-28 | Gideon A Kramer | Method of decorating candles and the product thereof |
| US3254512A (en) * | 1960-06-17 | 1966-06-07 | Dacom Inc | Candles and method of making same |
| US3039283A (en) * | 1960-11-08 | 1962-06-19 | Vincent J Buscemi | Method of ornamenting glass |
| US3327108A (en) * | 1965-10-23 | 1967-06-20 | Rubel & Co Decorator Accessori | Hurricane lantern |
| US3744956A (en) * | 1970-11-04 | 1973-07-10 | Vollmar W Bonner Wachsbleiche | Wax candle manufacture |
| US3741711A (en) * | 1972-03-27 | 1973-06-26 | G Bryant | Composite indefinitely reusable decorative candle |
| US4017729A (en) * | 1973-01-26 | 1977-04-12 | Faroy, Inc. | Decorative lamp |
| US3947232A (en) * | 1974-07-18 | 1976-03-30 | Donald Foster | Decorative candle and method of manufacture therefor |
| US3998922A (en) * | 1976-01-28 | 1976-12-21 | Weiss Theodore H | Method of making a candle in a container |
| US4224017A (en) * | 1977-07-13 | 1980-09-23 | Valley Candle Mfg. Co., Inc. | Locking arrangement for a candle |
| US4225552A (en) * | 1978-01-23 | 1980-09-30 | Se Won Chang | Decorative candle |
| US4304547A (en) * | 1978-06-23 | 1981-12-08 | Buzil Corporation | Candle having removable tabs for revealing messages |
| USD266594S (en) * | 1979-05-18 | 1982-10-19 | A.Ahlstrom Osakeyhtio | Candlestick |
| USD260381S (en) * | 1979-06-15 | 1981-08-25 | Adkins M Wayne | Thermoscope |
| US4427366A (en) * | 1982-02-19 | 1984-01-24 | Moore Kenneth L | Scented candle |
| US4826428A (en) * | 1987-12-07 | 1989-05-02 | Ki Yip Chemical Works Limited | Decorative candle |
| US4931014A (en) * | 1988-12-27 | 1990-06-05 | Scott Edward J | Beveled glass candle holder |
| US5395233A (en) * | 1994-01-18 | 1995-03-07 | Scentex, Inc. | Potpourri decorative candle and method of making same |
| US5605765A (en) * | 1994-12-06 | 1997-02-25 | Magma Industries (Ilum) Ltd. | Decorative composite article and method of making a decorative pattern |
| USD380057S (en) * | 1995-08-29 | 1997-06-17 | Lukasik Susan L | Candle |
| US5879694A (en) * | 1995-08-29 | 1999-03-09 | Pennzoil Products Company | Transparent gel candles |
| US5632615A (en) * | 1995-12-11 | 1997-05-27 | Degarmo; Billy B. | Cookie cutter candle |
| USD388892S (en) * | 1996-01-11 | 1998-01-06 | Design Ideas Ltd. | Candle holder |
| US5910005A (en) * | 1996-04-04 | 1999-06-08 | Scherr; Mark J. | Candleforming method |
| US5762487A (en) * | 1996-09-27 | 1998-06-09 | Coventry Creations, Inc. | Decorative candles |
| USD387446S (en) * | 1996-11-04 | 1997-12-09 | Aroma Tech, Inc. | Candle with bubbles |
| USD407164S (en) * | 1996-12-20 | 1999-03-23 | Aroma Tech | Candle with a pearl-like appearance |
| USD411891S (en) * | 1997-02-07 | 1999-07-06 | Aromatic Technologies, Inc. | Gel-like candle |
| USD380417S (en) * | 1997-05-02 | 1997-07-01 | Christopher Hardy | Candle holder |
| US5927964A (en) * | 1997-08-05 | 1999-07-27 | Transmet Corporation | Candle with embedded metal particulates |
| US5951278A (en) * | 1997-10-01 | 1999-09-14 | Young; April Diane | Candle holder apparatus |
| US5879151A (en) * | 1997-12-19 | 1999-03-09 | S. C. Johnson & Son, Inc. | Votive candle holder lid, candle package and related method |
| US5927965A (en) * | 1998-06-18 | 1999-07-27 | Lumi-Lite Candle Company, Inc. | Candle with surrounding decorative combustible material |
Non-Patent Citations (2)
| Title |
|---|
| Harry and David Christmas catalog; The Sunshine Assortment; p. 38; design digest, 1993. |
| Photograph of Candle Products. |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD750814S1 (en) * | 2013-07-11 | 2016-03-01 | Kimberly L. Moyal | Gel candle |
| USD767800S1 (en) * | 2013-07-11 | 2016-09-27 | Kimberly L. Moyal | Gel candle |
| USD878707S1 (en) * | 2016-03-23 | 2020-03-24 | Kukki Gmbh | Partially frozen drink |
| USD859701S1 (en) * | 2017-10-18 | 2019-09-10 | Xing Zuo | Musical candle |
| USD862748S1 (en) * | 2018-09-06 | 2019-10-08 | Xing Zuo | Music candle lamp |
| USD991496S1 (en) | 2022-05-20 | 2023-07-04 | Healing Light Soy Candles, LLC | Candle with accoutrements |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD427227S (en) | Eyewear | |
| USD437034S1 (en) | Gasket | |
| USD446728S1 (en) | Jar | |
| USD452159S1 (en) | Bottle | |
| USD434985S (en) | Bottle | |
| USD410022S (en) | Eyewear | |
| USD427622S (en) | Eyewear | |
| USD408841S (en) | Eyewear | |
| USD446729S1 (en) | Octagonal-sided jar | |
| USD434662S (en) | Bottle | |
| USD426568S (en) | Eyewear | |
| USD424597S (en) | Eyewear | |
| USD423694S (en) | Jelly bean candle jar | |
| USD424232S (en) | Wall sconce | |
| USD419176S (en) | Eyewear | |
| USD419827S (en) | Drinking glass | |
| USD437439S1 (en) | Floodlight | |
| USD417687S (en) | Eyewear front | |
| USD450374S1 (en) | Sink | |
| USD429361S (en) | Wall sconce | |
| USD438327S1 (en) | Light fixture | |
| USD431884S (en) | Mobile dog house | |
| USD445883S1 (en) | Sink | |
| USD439541S1 (en) | Gem design | |
| USD420379S (en) | Eyewear front |