USD332829S - Pedestal sink - Google Patents
Pedestal sink Download PDFInfo
- Publication number
- USD332829S USD332829S US07/637,596 US63759691F USD332829S US D332829 S USD332829 S US D332829S US 63759691 F US63759691 F US 63759691F US D332829 S USD332829 S US D332829S
- Authority
- US
- United States
- Prior art keywords
- pedestal sink
- pedestal
- sink
- view
- ornamental design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 title claims description 3
Images
Description
FIG. 1 is a top front perspective view of a pedestal sink showing my new design;
FIG. 2 is a top plan view thereof;
FIG. 3 is a front elevational view thereof;
FIG. 4 is a rear elevational view thereof;
FIG. 5 is a left side elevational view thereof; the right side being a mirror image of the left side shown; and,
FIG. 6 is a bottom plan view thereof.
Claims (1)
- The ornamental design for a pedestal sink, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/637,596 USD332829S (en) | 1991-01-03 | 1991-01-03 | Pedestal sink |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/637,596 USD332829S (en) | 1991-01-03 | 1991-01-03 | Pedestal sink |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD332829S true USD332829S (en) | 1993-01-26 |
Family
ID=70772535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US07/637,596 Expired - Lifetime USD332829S (en) | 1991-01-03 | 1991-01-03 | Pedestal sink |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD332829S (en) |
Cited By (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD344577S (en) | 1991-04-23 | 1994-02-22 | American Standard Inc. | Lavatory |
| USD354135S (en) | 1992-11-04 | 1995-01-03 | Siemens Aktiengesellschaft | Dental expectorant basin |
| USD370718S (en) | 1995-04-17 | 1996-06-11 | Eljer Industries | Pedestal for a drop-in sink |
| USD433743S (en) * | 2000-04-12 | 2000-11-14 | Acorn Engineering Co. | One-piece stainless steel pedestal wash basin |
| USD469170S1 (en) | 2002-07-19 | 2003-01-21 | Mansfield Plumbing Products, Llc | Pedestal for a lavatory |
| USD476067S1 (en) | 2001-08-01 | 2003-06-17 | Roca Sanitario, S.A. | Pedestal for lavatory |
| USD479586S1 (en) | 2001-10-26 | 2003-09-09 | Kohler Co. | Lavatory |
| USD482434S1 (en) | 2001-10-26 | 2003-11-18 | Kohler Co. | Plumbing fixture |
| USD504497S1 (en) | 2001-10-26 | 2005-04-26 | Kohler Co. | Lavatory |
| USD504499S1 (en) | 2001-10-26 | 2005-04-26 | Kohler Co. | Lavatory |
| USD504717S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504720S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504939S1 (en) | 2001-10-26 | 2005-05-10 | Kohler Co. | Lavatory |
| USD505191S1 (en) | 2001-10-26 | 2005-05-17 | Kohler, Co. | Lavatory |
| USD508983S1 (en) | 2001-10-26 | 2005-08-30 | Kohler Co. | Lavatory |
| USD510986S1 (en) | 2002-04-04 | 2005-10-25 | Kohler Co. | Lavatory |
| USD523181S1 (en) | 2005-01-21 | 2006-06-13 | Mayer Robert H | Pedestal sink |
| USD530803S1 (en) | 2001-10-26 | 2006-10-24 | Kohler Co. | Lavatory |
| US20100237756A1 (en) * | 2009-03-23 | 2010-09-23 | Hal Weinstein | Pedestal vanity |
| USD814614S1 (en) * | 2017-02-27 | 2018-04-03 | Kohler Co. | Sink |
| US20180206638A1 (en) * | 2017-03-09 | 2018-07-26 | Charles James SPOFFORD | Appliance with a base wall having a contact surface including at least three internal leveling extension platforms and method of use |
| US11454010B2 (en) | 2017-03-09 | 2022-09-27 | Charles James SPOFFORD | Appliance with shim compatible geometry |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US842527A (en) | 1906-03-10 | 1907-01-29 | Alexander Hamilton Cline Jr | Construction of lavatories and like fixtures for domestic use. |
| US1060106A (en) | 1912-07-03 | 1913-04-29 | Clarence T Maillette | Washstand. |
| US1490677A (en) | 1919-11-12 | 1924-04-15 | Adolph Mueller | Pedestal drinking fountain |
| US1891591A (en) | 1932-12-20 | Heater | ||
| USD273978S (en) | 1981-10-19 | 1984-05-22 | American Standard, Inc. | Lavatory |
| USD283155S (en) | 1983-12-02 | 1986-03-25 | Sears, Roebuck & Co. | Pedestal sink |
| USD289792S (en) | 1983-09-30 | 1987-05-12 | Produits Ceramiques De Touraine | Bathroom sink |
| USD292732S (en) | 1986-12-08 | 1987-11-10 | Kohler Co. | Pedestal lavatory |
-
1991
- 1991-01-03 US US07/637,596 patent/USD332829S/en not_active Expired - Lifetime
Patent Citations (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1891591A (en) | 1932-12-20 | Heater | ||
| US842527A (en) | 1906-03-10 | 1907-01-29 | Alexander Hamilton Cline Jr | Construction of lavatories and like fixtures for domestic use. |
| US1060106A (en) | 1912-07-03 | 1913-04-29 | Clarence T Maillette | Washstand. |
| US1490677A (en) | 1919-11-12 | 1924-04-15 | Adolph Mueller | Pedestal drinking fountain |
| USD273978S (en) | 1981-10-19 | 1984-05-22 | American Standard, Inc. | Lavatory |
| USD274164S (en) | 1981-10-19 | 1984-06-05 | American Standard, Inc. | Lavatory |
| USD289792S (en) | 1983-09-30 | 1987-05-12 | Produits Ceramiques De Touraine | Bathroom sink |
| USD283155S (en) | 1983-12-02 | 1986-03-25 | Sears, Roebuck & Co. | Pedestal sink |
| USD292732S (en) | 1986-12-08 | 1987-11-10 | Kohler Co. | Pedestal lavatory |
Cited By (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD344577S (en) | 1991-04-23 | 1994-02-22 | American Standard Inc. | Lavatory |
| USD354135S (en) | 1992-11-04 | 1995-01-03 | Siemens Aktiengesellschaft | Dental expectorant basin |
| USD370718S (en) | 1995-04-17 | 1996-06-11 | Eljer Industries | Pedestal for a drop-in sink |
| USD433743S (en) * | 2000-04-12 | 2000-11-14 | Acorn Engineering Co. | One-piece stainless steel pedestal wash basin |
| USD476067S1 (en) | 2001-08-01 | 2003-06-17 | Roca Sanitario, S.A. | Pedestal for lavatory |
| USD505191S1 (en) | 2001-10-26 | 2005-05-17 | Kohler, Co. | Lavatory |
| USD506246S1 (en) | 2001-10-26 | 2005-06-14 | Kohler Co. | Lavatory |
| USD482434S1 (en) | 2001-10-26 | 2003-11-18 | Kohler Co. | Plumbing fixture |
| USD495039S1 (en) | 2001-10-26 | 2004-08-24 | Kohler Co. | Lavatory |
| USD495405S1 (en) | 2001-10-26 | 2004-08-31 | Kohler Co. | Lavatory |
| USD497417S1 (en) | 2001-10-26 | 2004-10-19 | Kohler Co. | Plumbing fixture |
| USD497418S1 (en) | 2001-10-26 | 2004-10-19 | Kohler Co. | Plumbing fixture |
| USD497416S1 (en) | 2001-10-26 | 2004-10-19 | Kohler Co. | Plumbing fixture |
| USD497980S1 (en) | 2001-10-26 | 2004-11-02 | Kohler Co. | Lavatory |
| USD504497S1 (en) | 2001-10-26 | 2005-04-26 | Kohler Co. | Lavatory |
| USD504499S1 (en) | 2001-10-26 | 2005-04-26 | Kohler Co. | Lavatory |
| USD504717S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504720S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504719S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504718S1 (en) | 2001-10-26 | 2005-05-03 | Kohler Co. | Lavatory |
| USD504939S1 (en) | 2001-10-26 | 2005-05-10 | Kohler Co. | Lavatory |
| USD505189S1 (en) | 2001-10-26 | 2005-05-17 | Kohler Co. | Lavatory |
| USD530802S1 (en) | 2001-10-26 | 2006-10-24 | Kohler Co. | Lavatory |
| USD505717S1 (en) | 2001-10-26 | 2005-05-31 | Kohler Co. | Lavatory |
| USD479586S1 (en) | 2001-10-26 | 2003-09-09 | Kohler Co. | Lavatory |
| USD506535S1 (en) | 2001-10-26 | 2005-06-21 | Kohler Co. | Lavatory |
| USD506536S1 (en) | 2001-10-26 | 2005-06-21 | Kohler Co. | Lavatory |
| USD508114S1 (en) | 2001-10-26 | 2005-08-02 | Kohler Co. | Lavatory |
| USD508731S1 (en) | 2001-10-26 | 2005-08-23 | Kohler Co. | Lavatory |
| USD508983S1 (en) | 2001-10-26 | 2005-08-30 | Kohler Co. | Lavatory |
| USD510132S1 (en) | 2001-10-26 | 2005-09-27 | Kohler Co. | Lavatory |
| USD530803S1 (en) | 2001-10-26 | 2006-10-24 | Kohler Co. | Lavatory |
| USD510987S1 (en) | 2001-10-26 | 2005-10-25 | Kohler Co. | Lavatory |
| USD511373S1 (en) | 2001-10-26 | 2005-11-08 | Kohler Co. | Lavatory |
| USD511820S1 (en) | 2001-10-26 | 2005-11-22 | Kohler Co. | Lavatory |
| USD516190S1 (en) | 2001-10-26 | 2006-02-28 | Kohler, Co. | Lavatory |
| USD510986S1 (en) | 2002-04-04 | 2005-10-25 | Kohler Co. | Lavatory |
| USD469170S1 (en) | 2002-07-19 | 2003-01-21 | Mansfield Plumbing Products, Llc | Pedestal for a lavatory |
| USD523181S1 (en) | 2005-01-21 | 2006-06-13 | Mayer Robert H | Pedestal sink |
| US20100237756A1 (en) * | 2009-03-23 | 2010-09-23 | Hal Weinstein | Pedestal vanity |
| USD814614S1 (en) * | 2017-02-27 | 2018-04-03 | Kohler Co. | Sink |
| USD860411S1 (en) | 2017-02-27 | 2019-09-17 | Kohler Co. | Sink |
| US20180206638A1 (en) * | 2017-03-09 | 2018-07-26 | Charles James SPOFFORD | Appliance with a base wall having a contact surface including at least three internal leveling extension platforms and method of use |
| US10709242B2 (en) * | 2017-03-09 | 2020-07-14 | Charles James SPOFFORD | Appliance with a base wall having a contact surface including at least three internal leveling extension platforms and method of use |
| US11454010B2 (en) | 2017-03-09 | 2022-09-27 | Charles James SPOFFORD | Appliance with shim compatible geometry |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD347530S (en) | Chair | |
| USD357592S (en) | Stool | |
| USD349420S (en) | Set of cookware | |
| USD337444S (en) | Chair | |
| USD327181S (en) | Chair | |
| USD347342S (en) | Table | |
| USD332183S (en) | Wicker chair | |
| USD340589S (en) | Chair | |
| USD333044S (en) | Chair | |
| USD336165S (en) | Chair | |
| USD351052S (en) | Headband | |
| USD329566S (en) | Pillow | |
| USD308788S (en) | Pillow | |
| USD332829S (en) | Pedestal sink | |
| USD350653S (en) | Chair | |
| USD348788S (en) | Chair | |
| USD352840S (en) | Chair | |
| USD357344S (en) | Hat | |
| USD350242S (en) | Chair | |
| USD341953S (en) | Dining chair | |
| USD332648S (en) | Pool table | |
| USD325677S (en) | Chair | |
| USD354712S (en) | Combined standard and support | |
| USD338348S (en) | Chair | |
| USD343967S (en) | Settee |