USD315753S - Toy crocodile - Google Patents
Toy crocodile Download PDFInfo
- Publication number
- USD315753S USD315753S US07/443,230 US44323089F USD315753S US D315753 S USD315753 S US D315753S US 44323089 F US44323089 F US 44323089F US D315753 S USD315753 S US D315753S
- Authority
- US
- United States
- Prior art keywords
- crocodile
- toy
- toy crocodile
- view
- ornamental design
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 241000270722 Crocodylidae Species 0.000 title claims description 3
- LNNWVNGFPYWNQE-GMIGKAJZSA-N desomorphine Chemical compound C1C2=CC=C(O)C3=C2[C@]24CCN(C)[C@H]1[C@@H]2CCC[C@@H]4O3 LNNWVNGFPYWNQE-GMIGKAJZSA-N 0.000 title claims description 3
Images
Description
FIG. 1 is a top perspective view of the toy crocodile showing our new design;
FIG. 2 is a bottom perspective view;
FIG. 3 is a left side elevational view;
FIG. 4 is a front elevational view;
FIG. 5 is a right side elevational view;
FIG. 6 is a rear elevational view;
FIG. 7 is a top plan view;
FIG. 8 is a bottom plan view.
Claims (1)
- The ornamental design for a toy crocodile, as shown and described.
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/443,230 USD315753S (en) | 1989-11-29 | 1989-11-29 | Toy crocodile |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/443,230 USD315753S (en) | 1989-11-29 | 1989-11-29 | Toy crocodile |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| USD315753S true USD315753S (en) | 1991-03-26 |
Family
ID=70286434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US07/443,230 Expired - Lifetime USD315753S (en) | 1989-11-29 | 1989-11-29 | Toy crocodile |
Country Status (1)
| Country | Link |
|---|---|
| US (1) | USD315753S (en) |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD356836S (en) | 1993-09-22 | 1995-03-28 | Interlego Ag | Toy crocodile |
| USD416765S (en) * | 1999-02-22 | 1999-11-23 | Kevin P. Dankwardt | Holder for beverage container |
| USD431831S (en) * | 1998-09-23 | 2000-10-10 | Jose Felipe Gonzalez | Alligator glasses |
| USD469495S1 (en) | 2002-07-09 | 2003-01-28 | Shelcore, Inc. | Aquatic diving toy |
| USD545605S1 (en) * | 2005-06-24 | 2007-07-03 | Karen Sue Keller | Alligator-shaped pillow case |
| USD573293S1 (en) * | 2006-04-06 | 2008-07-15 | The L.D. Kichler Co. | Lighting fixture |
| USD621449S1 (en) * | 2009-08-31 | 2010-08-10 | Easeon Services, Ltd. | Squirting toy with animal head |
| USD704280S1 (en) * | 2012-11-20 | 2014-05-06 | Bandai Co., Ltd. | Monster-shaped toy |
| USD869572S1 (en) * | 2018-02-13 | 2019-12-10 | Tomy Company, Ltd. | Robot toy |
| USD980924S1 (en) * | 2022-04-01 | 2023-03-14 | Shantou Ourui Toys Industrial Co., Ltd. | Swimming toy for pool |
| USD986349S1 (en) * | 2021-06-08 | 2023-05-16 | Derong Wang | Lizard toy |
| USD989878S1 (en) | 2022-02-01 | 2023-06-20 | Sandstone Media, LLC | Game |
| USD1001209S1 (en) * | 2022-03-10 | 2023-10-10 | Weihong Wang | Remote-controlled crocodile |
| USD1053968S1 (en) * | 2024-05-06 | 2024-12-10 | Anhui Aipet Toys Company Limited | Rope crocodile toy |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US757834A (en) | 1903-08-12 | 1904-04-19 | George Morehouse | Mechanical toy. |
| USD248115S (en) | 1976-08-02 | 1978-06-06 | Interlego A.G. | Toy figure |
| USD251393S (en) | 1977-03-23 | 1979-03-20 | O'linger Gladys S | Stuffed animal |
| USD281519S (en) | 1982-12-10 | 1985-11-26 | Interlego A.G. | Toy horse figure |
-
1989
- 1989-11-29 US US07/443,230 patent/USD315753S/en not_active Expired - Lifetime
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US757834A (en) | 1903-08-12 | 1904-04-19 | George Morehouse | Mechanical toy. |
| USD248115S (en) | 1976-08-02 | 1978-06-06 | Interlego A.G. | Toy figure |
| USD251393S (en) | 1977-03-23 | 1979-03-20 | O'linger Gladys S | Stuffed animal |
| USD281519S (en) | 1982-12-10 | 1985-11-26 | Interlego A.G. | Toy horse figure |
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD356836S (en) | 1993-09-22 | 1995-03-28 | Interlego Ag | Toy crocodile |
| USD431831S (en) * | 1998-09-23 | 2000-10-10 | Jose Felipe Gonzalez | Alligator glasses |
| USD416765S (en) * | 1999-02-22 | 1999-11-23 | Kevin P. Dankwardt | Holder for beverage container |
| USD469495S1 (en) | 2002-07-09 | 2003-01-28 | Shelcore, Inc. | Aquatic diving toy |
| USD545605S1 (en) * | 2005-06-24 | 2007-07-03 | Karen Sue Keller | Alligator-shaped pillow case |
| USD573293S1 (en) * | 2006-04-06 | 2008-07-15 | The L.D. Kichler Co. | Lighting fixture |
| USD621449S1 (en) * | 2009-08-31 | 2010-08-10 | Easeon Services, Ltd. | Squirting toy with animal head |
| USD704280S1 (en) * | 2012-11-20 | 2014-05-06 | Bandai Co., Ltd. | Monster-shaped toy |
| USD869572S1 (en) * | 2018-02-13 | 2019-12-10 | Tomy Company, Ltd. | Robot toy |
| USD986349S1 (en) * | 2021-06-08 | 2023-05-16 | Derong Wang | Lizard toy |
| USD989878S1 (en) | 2022-02-01 | 2023-06-20 | Sandstone Media, LLC | Game |
| USD1001209S1 (en) * | 2022-03-10 | 2023-10-10 | Weihong Wang | Remote-controlled crocodile |
| USD980924S1 (en) * | 2022-04-01 | 2023-03-14 | Shantou Ourui Toys Industrial Co., Ltd. | Swimming toy for pool |
| USD1053968S1 (en) * | 2024-05-06 | 2024-12-10 | Anhui Aipet Toys Company Limited | Rope crocodile toy |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD309930S (en) | Toy car | |
| USD312845S (en) | Toy egg | |
| USD312488S (en) | Toy car | |
| USD317475S (en) | Toy construction element | |
| USD356836S (en) | Toy crocodile | |
| USD336943S (en) | Doll | |
| USD318924S (en) | Toy car | |
| USD318888S (en) | Toy car | |
| USD322295S (en) | Puzzle toy | |
| USD315753S (en) | Toy crocodile | |
| USD318081S (en) | Toy car | |
| USD317334S (en) | Toy vehicle | |
| USD310111S (en) | Toy automobile | |
| USD321728S (en) | Musical toy | |
| USD322102S (en) | Toy car | |
| USD317483S (en) | Toy telephone | |
| USD307591S (en) | Sprayer | |
| USD303273S (en) | Toy vehicle | |
| USD313255S (en) | Toy car | |
| USD328201S (en) | Toy box | |
| USD321021S (en) | Doll | |
| USD324085S (en) | Toy box | |
| USD311934S (en) | Toy vehicle | |
| USD314989S (en) | Toy tree element | |
| USD313256S (en) | Toy car |