USD220209S - Wrist compass - Google Patents
Wrist compass Download PDFInfo
- Publication number
- USD220209S USD220209S US D220209 S USD220209 S US D220209S
- Authority
- US
- United States
- Prior art keywords
- compass
- wrist
- wrist compass
- united states
- references
- Prior art date
Links
- 210000000707 Wrist Anatomy 0.000 title description 4
- VAYOSLLFUXYJDT-RDTXWAMCSA-N LSD Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 2
Images
Description
United States Patent Ofi WRIST COMPASS Owsley H. Brigham, 7510 Morningside Drive, Indianapolis, Ind. 46240 Filed Nov. 24, 1969, Ser. No. 20,231
Term of patent 14 years Int. Cl. D10-07 U.S. Cl. D526 second panel from top.
ice
Des. 220,209 Patented Mar. 16, 1971 References Cited UNITED STATES PATENTS Kahn D428X Mix 33222X Dinstman 33222 Weigenant 33222X OTHER REFERENCES National Jeweler, January 1968, p. 21, watch case in JOEL STEARMAN, Primary Examiner
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD220209S (en) | Wrist compass | |
| USD204894S (en) | Figure | |
| USD223623S (en) | Clock or similar article | |
| USD226322S (en) | Combined clock and perpetual calendar | |
| USD225427S (en) | Housing for a clock | |
| USD218187S (en) | Frame for a clock or the like | |
| USD219109S (en) | Clock housing | |
| USD231007S (en) | Finger ring | |
| USD230061S (en) | Time-estoicating face for a horologe | |
| USD221171S (en) | Clock or similar article | |
| USD217730S (en) | Clock | |
| USD218342S (en) | Combined watch face and compass face | |
| USD230059S (en) | Time-indicating face for a horologe | |
| USD199203S (en) | Edwin h | |
| USD212961S (en) | Combined clock and calendar | |
| USD226394S (en) | Clock casing | |
| USD217731S (en) | Clock | |
| USD199639S (en) | Radio | |
| USD222164S (en) | Clock radio | |
| USD220516S (en) | Drinking glass or the like | |
| USD211411S (en) | Combined portable radio and magazine tape recorder or similar article | |
| USD218188S (en) | Frame for a clock or the like | |
| USD216321S (en) | Combined wrist watch and radio | |
| USD212376S (en) | Beverage server | |
| USD226863S (en) | Zodiac clock face |