USD204742S - Knob or the like - Google Patents
Knob or the like Download PDFInfo
- Publication number
- USD204742S USD204742S US D204742 S USD204742 S US D204742S
- Authority
- US
- United States
- Prior art keywords
- knob
- examiner
- rockford
- ill
- elevational view
- Prior art date
Links
- 210000002370 ICC Anatomy 0.000 description 2
- ASCUXPQGEXGEMJ-GPLGTHOPSA-N [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-methylanilino)oxan-2-yl]methoxy]oxan-2-yl]methyl acetate Chemical compound CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@H]1OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](NC=2C=CC(C)=CC=2)O1 ASCUXPQGEXGEMJ-GPLGTHOPSA-N 0.000 description 2
Images
Description
United States Patent 0 ICC 2042142 Patented May 17, 1966 KNOB OR THE LIKE Vytant P. Aleks, Rockford, Ill., assignor to National Lock Co., Rockford, Ill., a corporation of Delaware Filed Sept. 10, 1965, Ser. No. 86,940
Term of patent 14 years (Cl. D10--8) FIGURE 1 is a front elevational view of a knob or References Cited by the Examiner the like embodying my new design; NITEDv TATE PATENT 'FIGURE 2 is a side elevational view thereof; 1 1 U 1' S S S 50-3 FIGURE 3 is a rear elevationalview thereof; and D 2 4/ 960 Heyer et Di FIGURE 4 is a cross-sectional view taken on the line i v of FIG. 1- WALLACE R. BURKE, Przmary Examiner.
I claim: WILLIAM N. WERTMAN, Assistant Examiner.
The ornamental design for a knob or the like, substantially as shown.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD204742S (en) | Knob or the like | |
| USD205243S (en) | Knob or the like | |
| USD208326S (en) | Escutcheon for door knobs or the like | |
| USD206056S (en) | Pull or the like | |
| USD208292S (en) | Pull or the like | |
| USD206058S (en) | Pull or the like | |
| USD203409S (en) | Combined knob and escutcheon for a combination lock | |
| USD236944S (en) | ||
| USD211938S (en) | Pull or the like | |
| USD211961S (en) | Backplate or the like | |
| USD236947S (en) | Escutcheon | |
| USD207667S (en) | Escutcheon or the like | |
| USD236942S (en) | ||
| USD204802S (en) | Backplate for a knob or the like | |
| USD240706S (en) | ||
| USD194661S (en) | Furniture pull or the like | |
| USD211936S (en) | Bail pull or the like | |
| USD236946S (en) | ||
| USD204801S (en) | Backplate for a knob or the like | |
| USD212079S (en) | Backplate or the like | |
| USD199051S (en) | Furniture pull or the like | |
| USD202099S (en) | Sash lock | |
| USD211937S (en) | Backplate or the like | |
| USD204977S (en) | Drawer knob | |
| USD212713S (en) | Connected key bows |