USD173493S - Necklace or the like - Google Patents
Necklace or the like Download PDFInfo
- Publication number
- USD173493S USD173493S US D173493 S USD173493 S US D173493S
- Authority
- US
- United States
- Prior art keywords
- necklace
- katz
- providence
- united states
- new
- Prior art date
Links
- BGMZUEKZENQUJY-UHFFFAOYSA-N 2,5-Dimethoxy-4-iodoamphetamine Chemical compound COC1=CC(CC(C)N)=C(OC)C=C1I BGMZUEKZENQUJY-UHFFFAOYSA-N 0.000 description 1
- 241000220010 Rhode Species 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Images
Description
Nov. 16, 1954 A. KATZ Des. 173,493
NECKLACE OR THE LIKE Filed June 24, 1954 9 DOI-P H KATZ INVENTOR.
,477 R E, Y
United States Patent 0 Des. 173,493 Patented Nov. 16, 1954 NECKLACE OR THE LIKE Adolph Katz, Providence, R. L, assignor to Coro, Inc., New York, N. Y., a corporation of New York To all whom it may concern:
Be it known that I, Adolph Katz, a citizen of the United States of America, residing in Providence, county of Providence, and State of Rhode Island, have invented a new, original, and ornamental Design for a Necklace or the like, of which the following is a specification, reference being had to the accompanying drawing, forming part thereof.
Fig. 1 is a plan view of a necklace or the like showing my new design;
Fig. 2 is an edge view of the pendant portion.
The dominant feature of my design resides in the portions shown in solid lines.
I claim: The ornamental design for a necklace or the like, substantially as shown and described.
References Cited in the file of this patent UNITED STATES PATENTS Number Name Date D. 161,461 Katz Jan. 2, 1951 D. 167,651 Philippe Sept. 2, 1952 D. 168,457 Katz Dec. 23, 1952 D. 170,582 Katz Oct. 13, 1953
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD173493S (en) | Necklace or the like | |
| USD173990S (en) | Necklace or the like | |
| USD174573S (en) | Necklace or the like | |
| USD173989S (en) | Necklace or the like | |
| USD173498S (en) | Necklace or the like | |
| USD173992S (en) | Necklace or the like | |
| USD171651S (en) | Necklace or the like | |
| USD173353S (en) | Necklace or the like | |
| USD169850S (en) | Necklace or the like | |
| USD174632S (en) | Necklace or the like | |
| USD174265S (en) | Necklace or the like | |
| USD173950S (en) | Necklace or the like | |
| USD174267S (en) | Necklace or the like | |
| USD173578S (en) | Necklace or the like | |
| USD173497S (en) | Necklace or the like | |
| USD173948S (en) | Necklace or the like | |
| USD174280S (en) | Charm bracelet or the like | |
| USD168457S (en) | Necklace or the like | |
| USD173576S (en) | Necklace or the like | |
| USD166677S (en) | Necklace or the like | |
| USD164999S (en) | Necklace ob the like | |
| USD174579S (en) | Link chain for a necklace or the like | |
| USD173499S (en) | Necklace or the like | |
| USD174453S (en) | Link chain for a necklace or the like | |
| USD165003S (en) | Necklace ob the like |