USD164808S - Bracelet ob the like - Google Patents
Bracelet ob the like Download PDFInfo
- Publication number
- USD164808S USD164808S US D164808 S USD164808 S US D164808S
- Authority
- US
- United States
- Prior art keywords
- bracelet
- des
- philippe
- united states
- oct
- Prior art date
Links
- BOSMZFBHAYFUBJ-UHFFFAOYSA-N tris(4-methylphenyl) phosphate Chemical compound C1=CC(C)=CC=C1OP(=O)(OC=1C=CC(C)=CC=1)OC1=CC=C(C)C=C1 BOSMZFBHAYFUBJ-UHFFFAOYSA-N 0.000 description 1
Images
Description
Oct. 9, 1951 p P Des. 164,808
BRACELET OR THE LIKE Filed June 15, 1951 Patented Oct. 9, 1951 Des. 164,808
UNITED STATES PATENT OFFICE BRACELET OR THE LIKE Alfred Philippe, Scarsdale, N. Y., assignor to Trifari, Krussman & Fishel, Inc., New York, N. Y.
Application June 15, 1951, Serial No. 15,557
Term of patent '7 years I claim: The ornamental design for a bracelet or the like, substantially as shown.
ALFRED PHILIPPE.
REFERENCES CITED The following references are of record in the file of this patent:
UNITED STATES PATENTS Number Name Date D. 17,070 Lindol Jan. 18, 1887 D. 155,230 Philippe Sept. 13, 1949
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD164808S (en) | Bracelet ob the like | |
| USD165544S (en) | Brooch or the like | |
| USD165546S (en) | Brooch oe the like | |
| USD166217S (en) | Brooch ob the like | |
| USD166708S (en) | Necklace ob the like | |
| USD169203S (en) | Necklace or the like | |
| USD169176S (en) | Necklace ob the like | |
| USD162577S (en) | Necklace or similar article | |
| USD167053S (en) | Brooch or the like | |
| USD166625S (en) | Brooch or the like | |
| USD167714S (en) | Brooch ob the like | |
| USD169096S (en) | Earring or the like | |
| USD166353S (en) | Necklace or the like | |
| USD167056S (en) | Bkooch or the like | |
| USD167713S (en) | Brooch or the like | |
| USD166216S (en) | Brooch or the like | |
| USD168636S (en) | Bracelet or the like | |
| USD166623S (en) | Brooch or the like | |
| USD166354S (en) | Necklace or the like | |
| USD164727S (en) | Earring or similar article | |
| USD167649S (en) | Necklace ob the like | |
| USD169192S (en) | Brooch ob the like | |
| USD166223S (en) | Eakring or the like | |
| USD166624S (en) | Brooch or the like | |
| USD160199S (en) | Earring or similar article |