USD144326S - Design for a soap dish - Google Patents
Design for a soap dish Download PDFInfo
- Publication number
- USD144326S USD144326S US D144326 S USD144326 S US D144326S
- Authority
- US
- United States
- Prior art keywords
- soap dish
- design
- soap
- dish
- doren
- Prior art date
Links
- 239000000344 soap Substances 0.000 title description 10
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
Images
Description
pril 2, 1946.
H. VA N DOREN' Des. 144,326
SOAP DISH Filed Nov. 9, 1944 r I Fig, I INVENTOR.
Harv/a l a/vflo/"en ATTORNEY Patented Apr. 2, 1946 Des. 144,326
UNITED STATES PATENT OFFICE DESIGN FOR A SOAP DISH Harold Van Doren, Philadelphia, Pa, assignor to Gerity-Adrian Manufacturing Corporation, a corporation of Michigan Application November 9, 1944, Serial No. 116,231
Term of patent 14 years (Cl. D4-3) Figure II is a front elevation, the fragmentary sectional portion being taken on lines 11-11 of Figure I; and
Figure III is a side elevational View of the soap dish.
I claim:
The ornamental design for a soap dish, substantially as shown.
HAROLD VAN DOREN.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD144326S (en) | Design for a soap dish | |
| USD144328S (en) | Design for a brush holder | |
| USD144327S (en) | Tumbler and brush holder | |
| USD138347S (en) | Design for a dkess | |
| USD145179S (en) | Spoon or other article op flatware | |
| USD134686S (en) | Design for a table | |
| USD134687S (en) | Design for a table | |
| USD145180S (en) | Spoon or other article of flatware | |
| USD140575S (en) | Design fob a combined sink and cabinet | |
| USD134688S (en) | Design for a table | |
| USD140574S (en) | Design for a combined sink and cabinet | |
| USD134978S (en) | Design for a table | |
| USD149908S (en) | Design for a soap dish | |
| USD138513S (en) | Design for a button | |
| USD141047S (en) | Design for a molding for store fronts | |
| USD144562S (en) | Design fob a bracelet ob similar abxicle | |
| USD109295S (en) | Design for a display rack or sibhlar | |
| USD119406S (en) | Dish or other article of hollow ware | |
| USD141985S (en) | Design for a sales meter | |
| USD135605S (en) | Design for a handbag | |
| USD133334S (en) | Design for a dress | |
| USD135615S (en) | Design for a pin or similar article | |
| USD133319S (en) | Design fob a dress | |
| USD115623S (en) | Design for a lavatory | |
| USD136552S (en) | Washing machine or similar article |