USD118169S - Design fob an inflatable water - Google Patents
Design fob an inflatable water Download PDFInfo
- Publication number
- USD118169S USD118169S US D118169 S USD118169 S US D118169S
- Authority
- US
- United States
- Prior art keywords
- inflatable water
- design fob
- inflatable
- design
- swing
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title description 10
- 229940096118 Ella Drugs 0.000 description 2
- 229940019452 Loris Drugs 0.000 description 2
- 241000288982 Loris Species 0.000 description 2
- 229960000200 ulipristal Drugs 0.000 description 2
- OOLLAFOLCSJHRE-ZHAKMVSLSA-N ulipristal acetate Chemical compound C1=CC(N(C)C)=CC=C1[C@@H]1C2=C3CCC(=O)C=C3CC[C@H]2[C@H](CC[C@]2(OC(C)=O)C(C)=O)[C@]2(C)C1 OOLLAFOLCSJHRE-ZHAKMVSLSA-N 0.000 description 2
Images
Description
' Dec. 19, 1939. B. E: PRINCE Des. 118,169
INFLATABLE WATER SWING Filed July 25, 1939 Invenior Z02 1}; Z710 v.firzhde Attorneys Patented'De c.19,1939 w Des. 118,169
UNITED STATES PATENT OFFICE DESIGN FOR AN INFLATABLE WATER SWING BettyElla Prince, Loris, S. C. Application July 25, 1939, Serial No. 86,237 Terniof patent 14 years To all whom it may concern: I Figure 1 is a top plan View of'an inflatable I Be it known that I, Betty'Ella Prince, a citiwater swing showing my new design.
zen of the United States, residing at Loris, in the Figure 2 is a side elevation thereof.
county of Horry and State of South Carolina, a I claim:
have invented a new, original, and ornamental The ornamental design-for an inflatable water Design for an Inflatable Water Swing, of which swing, as shown.
the following is aspecification, reference 'being BETTY ELLA PRINCE had to the accompanying drawing, "forming part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD118169S (en) | Design fob an inflatable water | |
| USD102188S (en) | Design for a shoe | |
| USD109318S (en) | Design fob a shoe | |
| USD100879S (en) | Design for a candy or liquor box | |
| USD108656S (en) | Design foe | |
| USD76500S (en) | Design for embroidered lace edging | |
| USD116429S (en) | Design fob a shoe | |
| USD130437S (en) | Design fob an artificial denture cleaner | |
| USD133575S (en) | Design for a heat preserver | |
| USD95980S (en) | Design for a signal and code dial | |
| USD74991S (en) | Clarence h | |
| USD104775S (en) | Design for a game apparatus | |
| USD116724S (en) | Design fob a slipper | |
| USD115016S (en) | Design fob a construction tot | |
| USD106702S (en) | Design fob a lace | |
| USD109410S (en) | Design for a sandal | |
| USD116194S (en) | Design fob a basket | |
| USD106648S (en) | Design for a wicker basket | |
| USD112906S (en) | Design for lace | |
| USD106529S (en) | Design for a serving tray | |
| USD78617S (en) | Design fob a nursery chest | |
| USD104919S (en) | Design for a shoe | |
| USD100174S (en) | Design fob a shoe | |
| USD112165S (en) | Design for a tire | |
| USD110214S (en) | Design for a drawer pull |