USD117856S - Design for a teapot - Google Patents
Design for a teapot Download PDFInfo
- Publication number
- USD117856S USD117856S US D117856 S USD117856 S US D117856S
- Authority
- US
- United States
- Prior art keywords
- teapot
- design
- thorley
- ohio
- palin
- Prior art date
Links
- JOHZPMXAZQZXHR-UHFFFAOYSA-N Pipemidic acid Chemical compound N1=C2N(CC)C=C(C(O)=O)C(=O)C2=CN=C1N1CCNCC1 JOHZPMXAZQZXHR-UHFFFAOYSA-N 0.000 description 6
Images
Description
Nov. 28, 1939. J p THORLEY Des. 117,856 i TEAPOT FiledMarGh 7, 1959 Patented Nov. 2s, 1939 Des, 117,85@
-UNITED STATES PATENT QFFICE DESIGN FOR A TEAPOT Joseph Palin Thorley, East LiverpooL Ohio, asy signor to The Hall China Company, East Liverpool, Ohio, a corporation of Ohio Application March 7, 1939, Serial No. 83,406
Term of patent 7 years To all whom it may concern: Figure 1 is a top plan View of the teapot show- Be it known that I, Joseph Palin Thorley, a ing my design. citizen of the United States of America, residing Figure 2 is a side elevational View thereof. at'East Liverpool, in the county of Columbiana I claim: and State of Ohio, have invented a new, original, The ornamental design for a teapot, as shown. and ornamental Design for a Teapot, of which the following is a speoication, reference being JOSEPH PALIN THORLEY.
had to the accompanying drawing, forming a part thereof.
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD117856S (en) | Design for a teapot | |
| USD117857S (en) | Design for a covered casserole | |
| USD117855S (en) | Design for a teapot | |
| USD117858S (en) | Design for a shirred egg dish | |
| USD107064S (en) | Design for a plate or similar article | |
| USD117859S (en) | Design for a teapot ob similar | |
| USD110170S (en) | Design for a teapot | |
| USD124881S (en) | Design for a covered bowl or the like | |
| USD115289S (en) | Design fob a king | |
| USD116373S (en) | Design for a cream pitcher | |
| USD112679S (en) | Design for a combined globe | |
| USD118553S (en) | Design for a lamp | |
| USD96445S (en) | Design fob a sugar bowl or similar | |
| USD115395S (en) | Design for a glass frying pan | |
| USD125469S (en) | Design for a bottle | |
| USD110140S (en) | Design fob a pitcher top ob similar | |
| USD110997S (en) | Design for a ring | |
| USD102109S (en) | Design for a plate or similar | |
| USD109394S (en) | Design for a ring | |
| USD93991S (en) | Design fob a floor plate | |
| USD134528S (en) | Design fob a display standard | |
| USD103495S (en) | Design for a bottle | |
| USD109924S (en) | Design for a handcar | |
| USD107552S (en) | Design | |
| USD92792S (en) | Design for a casing fob a tjnipowee |