USD112611S - Design fob a clock - Google Patents
Design fob a clock Download PDFInfo
- Publication number
- USD112611S USD112611S US D112611 S USD112611 S US D112611S
- Authority
- US
- United States
- Prior art keywords
- clock
- design fob
- marshall
- design
- doyle
- Prior art date
Links
- BHELIUBJHYAEDK-OAIUPTLZSA-N Aspoxicillin Chemical compound C1([C@H](C(=O)N[C@@H]2C(N3[C@H](C(C)(C)S[C@@H]32)C(O)=O)=O)NC(=O)[C@H](N)CC(=O)NC)=CC=C(O)C=C1 BHELIUBJHYAEDK-OAIUPTLZSA-N 0.000 description 2
Images
Description
D. B. MARSHALL Des. 112,611
CLOCK Filed Sept. 26, 1938 INVENTOR. fif Mara/7a]? Do/u/e BY 6 Patented Dec.20,1938 I y 1 D g, 112,611
UNITED STATES PATENT OFFICE Doyle B. Marshall,Marshall, Mich.
Application September 26, 1938, Serial No. 80,087
Term of patent 7 years To all whom it may concern: Fig. 1 is a front view,
Be it known that I, Doyle B. Marshall, a citizen Fig. 2 is a top plan view, and of the United States, residing at Marshall, in Fig. 3 is a side elevation of a clock, showing the county of Calhoun and State of Michigan, my new design. have invented a new, original, and ornamental I claim: I a Design for a Clock, of which therfollowing is The ornamental design for a clock, as shown. a specification, reference being had to the accompanying drawing, forming part thereof, in DOYLE B. MARSHALL.
which: I
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| USD112611S (en) | Design fob a clock | |
| USD112612S (en) | Design fob a clock | |
| USD112995S (en) | Design for an elevated tank | |
| USD124467S (en) | Design fob a dress | |
| USD118202S (en) | Design fob a dress | |
| USD122820S (en) | Design for a carpet or similar article | |
| USD116898S (en) | Design fob a dress | |
| USD117444S (en) | Design for a pipe coupling | |
| USD112368S (en) | Design fob a sock | |
| USD120575S (en) | Design fob a pin clip | |
| USD122821S (en) | Design for a carpet or similar article | |
| USD105765S (en) | Design for a mat | |
| USD125776S (en) | Design for a paint stikreh | |
| USD114794S (en) | Design fob a scarf or similar article | |
| USD97328S (en) | Design fob a price ticket | |
| USD130122S (en) | Design fob a latch | |
| USD104691S (en) | Design fob a top | |
| USD116938S (en) | Design fob a watch | |
| USD124892S (en) | Design fob a dress | |
| USD115252S (en) | Design for a badge or similar | |
| USD114956S (en) | Design for a badge | |
| USD90657S (en) | Design for a radiocabinet | |
| USD109699S (en) | Design for a face plate for oven | |
| USD116305S (en) | Design fob a dress | |
| USD103331S (en) | Design fob a shoe |